![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[SND]](/icons/sound2.gif) | { ANDREW LEE } WYATT FAMILY 2020.mp3 | 2022-07-02 10:37 | 5.7M | |
![[SND]](/icons/sound2.gif) | { ANDREW LEE } UNDERTAKER KANE.mp3 | 2022-07-05 02:50 | 5.7M | |
![[SND]](/icons/sound2.gif) | { ANDREW LEE } THE GAME by TRIPLE H 2020.mp3 | 2022-07-02 11:04 | 4.7M | |
![[SND]](/icons/sound2.gif) | { ANDREW LEE } SAIYAJIN WARRIOR.mp3 | 2022-07-09 04:09 | 7.8M | |
![[SND]](/icons/sound2.gif) | { ANDREW LEE } KUNGFU YOGA DB.mp3 | 2022-07-05 09:42 | 6.2M | |
![[SND]](/icons/sound2.gif) | { ANDREW LEE } DANCE MONKEY 2020.mp3 | 2022-07-05 11:24 | 5.3M | |
![[SND]](/icons/sound2.gif) | { ANDREW LEE } BROCK LESNAR 2020.mp3 | 2022-07-02 10:39 | 4.4M | |
![[SND]](/icons/sound2.gif) | { ANDREW LEE } AI NI YI WAN NIEN.mp3 | 2022-07-03 00:44 | 5.1M | |
![[SND]](/icons/sound2.gif) | zzzz.mp3 | 2022-07-20 15:07 | 1.5M | |
![[SND]](/icons/sound2.gif) | zzz1.mp3 | 2022-07-19 14:57 | 404K | |
![[SND]](/icons/sound2.gif) | zzz.mp3 | 2022-08-06 06:44 | 2.2M | |
![[SND]](/icons/sound2.gif) | zzxx.mp3 | 2022-07-02 07:34 | 2.3M | |
![[SND]](/icons/sound2.gif) | zzxcn.mp3 | 2022-07-16 10:16 | 0 | |
![[SND]](/icons/sound2.gif) | zzkzz12.mp3 | 2022-07-22 17:39 | 0 | |
![[SND]](/icons/sound2.gif) | zzen12.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen11.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen9.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen8.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen6.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen5.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen4.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen3.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen2.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen1.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zzen0.mp3 | 2022-07-30 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | zze.mp3 | 2022-08-06 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | zz6.mp3 | 2022-07-03 04:01 | 2.1M | |
![[SND]](/icons/sound2.gif) | zz5.mp3 | 2022-07-03 04:01 | 4.3M | |
![[SND]](/icons/sound2.gif) | zz4.mp3 | 2022-07-03 04:01 | 4.2M | |
![[SND]](/icons/sound2.gif) | zz3.mp3 | 2022-07-08 03:19 | 3.3M | |
![[SND]](/icons/sound2.gif) | zz2.mp3 | 2022-07-08 03:33 | 1.4M | |
![[SND]](/icons/sound2.gif) | zz1.mp3 | 2022-07-08 03:31 | 2.5M | |
![[SND]](/icons/sound2.gif) | zz.mp3 | 2022-08-11 05:02 | 2.4M | |
![[SND]](/icons/sound2.gif) | zyra5.mp3 | 2022-07-16 07:29 | 2.0M | |
![[SND]](/icons/sound2.gif) | zyra4.mp3 | 2022-07-16 07:19 | 2.8M | |
![[SND]](/icons/sound2.gif) | zyra3.mp3 | 2022-07-16 03:57 | 3.0M | |
![[SND]](/icons/sound2.gif) | zyc1.mp3 | 2022-07-29 11:31 | 0 | |
![[SND]](/icons/sound2.gif) | zxzeon15.mp3 | 2022-07-19 14:37 | 0 | |
![[SND]](/icons/sound2.gif) | zxzeon14.mp3 | 2022-07-20 13:52 | 0 | |
![[SND]](/icons/sound2.gif) | zxzeon13.mp3 | 2022-07-20 13:46 | 4.3M | |
![[SND]](/icons/sound2.gif) | zxzeon12.mp3 | 2022-07-13 04:23 | 2.9M | |
![[SND]](/icons/sound2.gif) | zxzeon11.mp3 | 2022-07-13 04:23 | 2.7M | |
![[SND]](/icons/sound2.gif) | zxzeon10.mp3 | 2022-06-30 09:40 | 4.1M | |
![[SND]](/icons/sound2.gif) | zxzeon9.mp3 | 2022-06-30 09:45 | 4.6M | |
![[SND]](/icons/sound2.gif) | zxzeon8.mp3 | 2022-06-30 09:39 | 4.1M | |
![[SND]](/icons/sound2.gif) | zxzeon7.mp3 | 2022-06-30 09:39 | 3.5M | |
![[SND]](/icons/sound2.gif) | zxzeon6.mp3 | 2022-06-30 09:38 | 3.9M | |
![[SND]](/icons/sound2.gif) | zxzeon5.mp3 | 2022-06-30 09:38 | 4.0M | |
![[SND]](/icons/sound2.gif) | zxzeon4.mp3 | 2022-06-30 09:37 | 4.0M | |
![[SND]](/icons/sound2.gif) | zxzeon3.mp3 | 2022-06-30 09:35 | 3.5M | |
![[SND]](/icons/sound2.gif) | zxzeon2.mp3 | 2022-06-30 09:34 | 4.2M | |
![[SND]](/icons/sound2.gif) | zxzeon1.mp3 | 2022-06-30 09:22 | 4.2M | |
![[SND]](/icons/sound2.gif) | zxzeon.mp3 | 2022-06-30 09:21 | 3.5M | |
![[SND]](/icons/sound2.gif) | zxz.mp3 | 2022-08-01 07:24 | 0 | |
![[SND]](/icons/sound2.gif) | zxxx.mp3 | 2022-07-26 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | zxxlk3.mp3 | 2022-07-01 23:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | zxxlk2.mp3 | 2022-07-01 23:06 | 432K | |
![[SND]](/icons/sound2.gif) | zxxlk1.mp3 | 2022-07-01 23:05 | 431K | |
![[SND]](/icons/sound2.gif) | zxo.mp3 | 2022-07-16 15:16 | 0 | |
![[SND]](/icons/sound2.gif) | zxensamp.mp3 | 2022-07-03 07:46 | 2.8M | |
![[SND]](/icons/sound2.gif) | zxensad.mp3 | 2022-07-02 11:28 | 2.7M | |
![[SND]](/icons/sound2.gif) | zxenlugowo.mp3 | 2022-07-08 12:53 | 3.3M | |
![[SND]](/icons/sound2.gif) | zxenkane.mp3 | 2022-07-03 03:59 | 601K | |
![[SND]](/icons/sound2.gif) | zxen4.mp3 | 2022-07-31 07:20 | 0 | |
![[SND]](/icons/sound2.gif) | zxen3.mp3 | 2022-08-11 08:50 | 0 | |
![[SND]](/icons/sound2.gif) | zxen2.mp3 | 2022-07-16 14:37 | 3.4M | |
![[SND]](/icons/sound2.gif) | zxen1.mp3 | 2022-07-15 10:52 | 3.4M | |
![[SND]](/icons/sound2.gif) | zxcw.mp3 | 2022-08-04 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | zxcvb9.mp3 | 2022-07-20 13:52 | 0 | |
![[SND]](/icons/sound2.gif) | zxcv.mp3 | 2022-07-25 19:01 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursedkillua.mp3.mp3 | 2022-08-12 10:10 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursedkillua.mp3 | 2022-08-12 10:05 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursedbankai.mp3 | 2022-07-07 13:16 | 4.5M | |
![[SND]](/icons/sound2.gif) | zxcursed_Killua.mp3 | 2022-08-12 09:51 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursed_-_never_enough_74046259.mp3 | 2022-08-12 09:24 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursed_-_killua_74293338.mp3 | 2022-08-12 09:45 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursed_-_Never_Enough_(musmore.com).mp3 | 2022-07-31 08:28 | 5.5M | |
![[SND]](/icons/sound2.gif) | zxcursedKillua (2).mp3 | 2022-08-12 10:06 | 0 | |
![[SND]](/icons/sound2.gif) | zxcursed-u-menya-est-demony-v-golove.mp3 | 2022-07-07 19:01 | 2.9M | |
![[SND]](/icons/sound2.gif) | zxcursed - quinque.mp3 | 2022-07-16 12:01 | 5.8M | |
![[SND]](/icons/sound2.gif) | zxca32.mp3 | 2022-07-26 17:45 | 0 | |
![[SND]](/icons/sound2.gif) | zxc.mp3 | 2022-08-12 12:17 | 728K | |
![[SND]](/icons/sound2.gif) | zx2.mp3 | 2022-08-03 12:10 | 0 | |
![[SND]](/icons/sound2.gif) | zx.mp3 | 2022-07-11 06:53 | 19M | |
![[SND]](/icons/sound2.gif) | zvuki-perezaryadki-tankovyx-orudii-iz-world-of-ta_9RmCO549.mp3 | 2022-07-30 07:26 | 0 | |
![[SND]](/icons/sound2.gif) | zvukbutton.mp3 | 2022-07-26 21:29 | 0 | |
![[SND]](/icons/sound2.gif) | zvuk_-_krik_devushki.mp3 | 2022-07-04 07:54 | 158K | |
![[SND]](/icons/sound2.gif) | zvuk-stona-devushki.mp3 | 2022-07-07 19:38 | 410K | |
![[SND]](/icons/sound2.gif) | zuya1.mp3 | 2022-07-12 05:52 | 3.1M | |
![[SND]](/icons/sound2.gif) | zurafelix1.mp3 | 2022-06-29 06:44 | 1.4M | |
![[SND]](/icons/sound2.gif) | zul.mp3 | 2022-07-15 12:25 | 365K | |
![[SND]](/icons/sound2.gif) | zubzz.mp3 | 2022-06-29 11:55 | 4.7M | |
![[SND]](/icons/sound2.gif) | zubken.mp3 | 2022-06-29 12:41 | 4.7M | |
![[SND]](/icons/sound2.gif) | ztg.mp3 | 2022-07-01 18:25 | 6.1M | |
![[SND]](/icons/sound2.gif) | ztee22.mp3 | 2022-07-26 01:40 | 3.1M | |
![[SND]](/icons/sound2.gif) | zrkzoom.mp3 | 2022-06-29 07:53 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrkyakuza.mp3 | 2022-06-29 07:38 | 2.2M | |
![[SND]](/icons/sound2.gif) | zrkxdadari.mp3 | 2022-06-29 07:44 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkwig.mp3 | 2022-06-29 07:48 | 4.2M | |
![[SND]](/icons/sound2.gif) | zrkwhoopty.mp3 | 2022-06-29 07:37 | 1.1M | |
![[SND]](/icons/sound2.gif) | zrkwhodat.mp3 | 2022-06-29 07:38 | 1.9M | |
![[SND]](/icons/sound2.gif) | zrkwhoa.mp3 | 2022-06-29 07:42 | 4.8M | |
![[SND]](/icons/sound2.gif) | zrkvinjay.mp3 | 2022-06-29 07:38 | 4.1M | |
![[SND]](/icons/sound2.gif) | zrkundertale.mp3 | 2022-06-29 07:40 | 55M | |
![[SND]](/icons/sound2.gif) | zrktwil.mp3 | 2022-06-29 07:38 | 1.8M | |
![[SND]](/icons/sound2.gif) | zrktrunk.mp3 | 2022-06-29 07:38 | 1.9M | |
![[SND]](/icons/sound2.gif) | zrktoxic.mp3 | 2022-06-29 07:53 | 6.5M | |
![[SND]](/icons/sound2.gif) | zrktouge.mp3 | 2022-06-29 07:50 | 6.3M | |
![[SND]](/icons/sound2.gif) | zrkthings.mp3 | 2022-06-29 07:37 | 3.3M | |
![[SND]](/icons/sound2.gif) | zrkthats.mp3 | 2022-06-29 07:55 | 2.2M | |
![[SND]](/icons/sound2.gif) | zrktakusai.mp3 | 2022-06-29 07:38 | 4.4M | |
![[SND]](/icons/sound2.gif) | zrktadakoe.mp3 | 2022-06-29 07:38 | 2.4M | |
![[SND]](/icons/sound2.gif) | zrksyndrome.mp3 | 2022-06-29 07:55 | 5.5M | |
![[SND]](/icons/sound2.gif) | zrkswords.mp3 | 2022-06-29 07:49 | 6.4M | |
![[SND]](/icons/sound2.gif) | zrksweetscar.mp3 | 2022-06-29 07:56 | 4.8M | |
![[SND]](/icons/sound2.gif) | zrkswag.mp3 | 2022-06-29 07:38 | 1.9M | |
![[SND]](/icons/sound2.gif) | zrksurname.mp3 | 2022-06-29 07:38 | 1.8M | |
![[SND]](/icons/sound2.gif) | zrksummerdays.mp3 | 2022-06-29 07:41 | 2.2M | |
![[SND]](/icons/sound2.gif) | zrksulingtulul.mp3 | 2022-07-14 09:24 | 1.5M | |
![[SND]](/icons/sound2.gif) | zrkstress.mp3 | 2022-06-29 07:38 | 1.9M | |
![[SND]](/icons/sound2.gif) | zrkst.mp3 | 2022-07-11 08:04 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrksmalltalk.mp3 | 2022-06-29 07:37 | 1.8M | |
![[SND]](/icons/sound2.gif) | zrksisarasa.mp3 | 2022-06-29 07:51 | 9.7M | |
![[SND]](/icons/sound2.gif) | zrkshawtybustit.mp3 | 2022-06-29 07:37 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrksenja.mp3 | 2022-06-29 07:51 | 5.5M | |
![[SND]](/icons/sound2.gif) | zrksenam.mp3 | 2022-06-29 07:45 | 2.4M | |
![[SND]](/icons/sound2.gif) | zrksearch.mp3 | 2022-06-29 07:55 | 7.6M | |
![[SND]](/icons/sound2.gif) | zrkscarry.mp3 | 2022-06-29 07:48 | 5.5M | |
![[SND]](/icons/sound2.gif) | zrksabilulungan.mp3 | 2022-06-29 07:50 | 4.3M | |
![[SND]](/icons/sound2.gif) | zrkrumahsinggah.mp3 | 2022-06-29 07:39 | 3.8M | |
![[SND]](/icons/sound2.gif) | zrkridinclean.mp3 | 2022-06-29 07:50 | 6.3M | |
![[SND]](/icons/sound2.gif) | zrkrick.mp3 | 2022-07-12 04:15 | 3.2M | |
![[SND]](/icons/sound2.gif) | zrkrenungan.mp3 | 2022-06-29 07:56 | 6.1M | |
![[SND]](/icons/sound2.gif) | zrkrenegade.mp3 | 2022-06-29 07:39 | 3.4M | |
![[SND]](/icons/sound2.gif) | zrkreggie.mp3 | 2022-06-29 07:37 | 2.2M | |
![[SND]](/icons/sound2.gif) | zrkreckless.mp3 | 2022-06-29 07:55 | 4.6M | |
![[SND]](/icons/sound2.gif) | zrkrave.mp3 | 2022-06-29 07:38 | 2.6M | |
![[SND]](/icons/sound2.gif) | zrkrain.mp3 | 2022-06-29 07:42 | 7.5M | |
![[SND]](/icons/sound2.gif) | zrkragu.mp3 | 2022-06-29 07:52 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkperlahan.mp3 | 2022-06-29 07:51 | 7.4M | |
![[SND]](/icons/sound2.gif) | zrkpericintaku.mp3 | 2022-06-29 07:41 | 4.0M | |
![[SND]](/icons/sound2.gif) | zrkpercayalah.mp3 | 2022-06-29 07:51 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkparjamban.mp3 | 2022-06-29 07:52 | 12M | |
![[SND]](/icons/sound2.gif) | zrkonlyme.mp3 | 2022-06-29 07:55 | 4.8M | |
![[SND]](/icons/sound2.gif) | zrkoldgenesis.mp3 | 2022-06-29 07:50 | 5.0M | |
![[SND]](/icons/sound2.gif) | zrkoffmyface.mp3 | 2022-06-29 07:54 | 6.2M | |
![[SND]](/icons/sound2.gif) | zrkoctane.mp3 | 2022-06-29 07:37 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrknyanyi.mp3 | 2022-07-16 09:01 | 372K | |
![[SND]](/icons/sound2.gif) | zrknumberone.mp3 | 2022-06-29 07:54 | 6.6M | |
![[SND]](/icons/sound2.gif) | zrknight.mp3 | 2022-06-29 07:47 | 9.9M | |
![[SND]](/icons/sound2.gif) | zrkngorok.mp3 | 2022-07-14 09:24 | 156K | |
![[SND]](/icons/sound2.gif) | zrknasipadangdrill.mp3 | 2022-06-29 07:39 | 2.7M | |
![[SND]](/icons/sound2.gif) | zrkmotley.mp3 | 2022-06-29 07:54 | 4.2M | |
![[SND]](/icons/sound2.gif) | zrkmoneyrain.mp3 | 2022-06-29 07:43 | 5.8M | |
![[SND]](/icons/sound2.gif) | zrkmiddle.mp3 | 2022-06-29 07:46 | 6.3M | |
![[SND]](/icons/sound2.gif) | zrkmerasaindah.mp3 | 2022-06-29 07:47 | 8.7M | |
![[SND]](/icons/sound2.gif) | zrkmenepi.mp3 | 2022-06-29 07:51 | 5.7M | |
![[SND]](/icons/sound2.gif) | zrkmendung.mp3 | 2022-06-29 07:55 | 4.7M | |
![[SND]](/icons/sound2.gif) | zrkmemphis.mp3 | 2022-06-29 07:42 | 5.2M | |
![[SND]](/icons/sound2.gif) | zrkmelepaslajang.mp3 | 2022-06-29 07:47 | 9.7M | |
![[SND]](/icons/sound2.gif) | zrkmedotjanji.mp3 | 2022-06-29 07:51 | 5.7M | |
![[SND]](/icons/sound2.gif) | zrkluloelektron.mp3 | 2022-07-14 17:30 | 27M | |
![[SND]](/icons/sound2.gif) | zrklowriding.mp3 | 2022-06-29 07:38 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrklongdrives.mp3 | 2022-06-29 07:48 | 7.0M | |
![[SND]](/icons/sound2.gif) | zrkliveanother.mp3 | 2022-06-29 07:48 | 5.1M | |
![[SND]](/icons/sound2.gif) | zrklilx.mp3 | 2022-06-29 07:53 | 3.9M | |
![[SND]](/icons/sound2.gif) | zrklegowo.mp3 | 2022-07-16 09:01 | 3.5M | |
![[SND]](/icons/sound2.gif) | zrklauv.mp3 | 2022-06-29 07:56 | 4.5M | |
![[SND]](/icons/sound2.gif) | zrklatinashawty.mp3 | 2022-06-29 07:41 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrklaespada.mp3 | 2022-06-29 07:44 | 6.8M | |
![[SND]](/icons/sound2.gif) | zrklaboratory.mp3 | 2022-07-12 04:14 | 2.1M | |
![[SND]](/icons/sound2.gif) | zrkkmtw.mp3 | 2022-06-29 07:56 | 4.6M | |
![[SND]](/icons/sound2.gif) | zrkkidstay.mp3 | 2022-06-29 07:56 | 3.2M | |
![[SND]](/icons/sound2.gif) | zrkkatakansaja.mp3 | 2022-06-29 07:47 | 9.8M | |
![[SND]](/icons/sound2.gif) | zrkjtown.mp3 | 2022-06-29 07:37 | 2.7M | |
![[SND]](/icons/sound2.gif) | zrkjosh.mp3 | 2022-06-29 07:38 | 1.8M | |
![[SND]](/icons/sound2.gif) | zrkjoji.mp3 | 2022-06-29 07:37 | 3.6M | |
![[SND]](/icons/sound2.gif) | zrkjmjh.mp3 | 2022-06-29 07:58 | 5.3M | |
![[SND]](/icons/sound2.gif) | zrkjanjiputih.mp3 | 2022-06-29 07:54 | 4.1M | |
![[SND]](/icons/sound2.gif) | zrkjangganggu.mp3 | 2022-06-29 07:58 | 5.5M | |
![[SND]](/icons/sound2.gif) | zrkitsyou.mp3 | 2022-06-29 07:48 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkissucks.mp3 | 2022-06-29 07:56 | 2.7M | |
![[SND]](/icons/sound2.gif) | zrkintentions.mp3 | 2022-06-29 07:41 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkinsomnia.mp3 | 2022-06-29 07:38 | 2.1M | |
![[SND]](/icons/sound2.gif) | zrkindustry.mp3 | 2022-06-29 07:55 | 4.9M | |
![[SND]](/icons/sound2.gif) | zrkidontlike.mp3 | 2022-06-29 07:49 | 11M | |
![[SND]](/icons/sound2.gif) | zrkicejj.mp3 | 2022-07-12 04:14 | 3.1M | |
![[SND]](/icons/sound2.gif) | zrkhotgirl.mp3 | 2022-06-29 07:54 | 7.1M | |
![[SND]](/icons/sound2.gif) | zrkhmmm.mp3 | 2022-06-29 07:49 | 6.6M | |
![[SND]](/icons/sound2.gif) | zrkhigh.mp3 | 2022-06-29 07:54 | 3.5M | |
![[SND]](/icons/sound2.gif) | zrkheresyouperfect.mp3 | 2022-06-29 07:56 | 3.7M | |
![[SND]](/icons/sound2.gif) | zrkhere.mp3 | 2022-06-29 07:49 | 7.9M | |
![[SND]](/icons/sound2.gif) | zrkheat.mp3 | 2022-06-29 07:49 | 7.9M | |
![[SND]](/icons/sound2.gif) | zrkhashiriya.mp3 | 2022-06-29 07:50 | 6.0M | |
![[SND]](/icons/sound2.gif) | zrkhappiers.mp3 | 2022-06-29 07:56 | 4.1M | |
![[SND]](/icons/sound2.gif) | zrkhalhebat.mp3 | 2022-06-29 07:48 | 13M | |
![[SND]](/icons/sound2.gif) | zrkhajatan.mp3 | 2022-06-29 07:45 | 11M | |
![[SND]](/icons/sound2.gif) | zrkghost.mp3 | 2022-06-29 07:50 | 5.9M | |
![[SND]](/icons/sound2.gif) | zrkgenjermix.mp3 | 2022-06-29 07:55 | 4.9M | |
![[SND]](/icons/sound2.gif) | zrkfoundyou.mp3 | 2022-06-29 07:38 | 2.7M | |
![[SND]](/icons/sound2.gif) | zrkformyteam.mp3 | 2022-06-29 07:41 | 1.7M | |
![[SND]](/icons/sound2.gif) | zrkforever.mp3 | 2022-07-04 02:34 | 4.5M | |
![[SND]](/icons/sound2.gif) | zrkfieldhouse.mp3 | 2022-06-29 07:37 | 3.0M | |
![[SND]](/icons/sound2.gif) | zrkfeisty.mp3 | 2022-06-29 07:42 | 5.5M | |
![[SND]](/icons/sound2.gif) | zrkfaceoff.mp3 | 2022-06-29 07:37 | 3.8M | |
![[SND]](/icons/sound2.gif) | zrkeshay.mp3 | 2022-06-29 07:54 | 7.3M | |
![[SND]](/icons/sound2.gif) | zrkemm.mp3 | 2022-06-29 07:37 | 2.7M | |
![[SND]](/icons/sound2.gif) | zrkedamame.mp3 | 2022-06-29 07:55 | 3.2M | |
![[SND]](/icons/sound2.gif) | zrkduka.mp3 | 2022-06-29 07:55 | 4.9M | |
![[SND]](/icons/sound2.gif) | zrkdudizoom.mp3 | 2022-06-29 07:38 | 1.9M | |
![[SND]](/icons/sound2.gif) | zrkdudidam.mp3 | 2022-06-29 07:49 | 1.8M | |
![[SND]](/icons/sound2.gif) | zrkdropit.mp3 | 2022-06-29 07:53 | 5.1M | |
![[SND]](/icons/sound2.gif) | zrkdripdown.mp3 | 2022-06-29 07:42 | 7.3M | |
![[SND]](/icons/sound2.gif) | zrkdrip.mp3 | 2022-06-29 07:44 | 6.5M | |
![[SND]](/icons/sound2.gif) | zrkdoubletap.mp3 | 2022-06-29 07:54 | 6.9M | |
![[SND]](/icons/sound2.gif) | zrkdoubletake.mp3 | 2022-06-29 07:56 | 4.0M | |
![[SND]](/icons/sound2.gif) | zrkdontgive.mp3 | 2022-06-29 07:38 | 1.8M | |
![[SND]](/icons/sound2.gif) | zrkdjwan.mp3 | 2022-06-29 07:43 | 7.5M | |
![[SND]](/icons/sound2.gif) | zrkdjthenight.mp3 | 2022-06-29 07:43 | 10M | |
![[SND]](/icons/sound2.gif) | zrkdjstereo.mp3 | 2022-06-29 07:39 | 5.6M | |
![[SND]](/icons/sound2.gif) | zrkdjsoibah.mp3 | 2022-06-29 07:43 | 7.6M | |
![[SND]](/icons/sound2.gif) | zrkdjslebew.mp3 | 2022-06-29 07:43 | 7.9M | |
![[SND]](/icons/sound2.gif) | zrkdjside.mp3 | 2022-06-29 07:46 | 18M | |
![[SND]](/icons/sound2.gif) | zrkdjsampebawah.mp3 | 2022-06-29 07:39 | 9.2M | |
![[SND]](/icons/sound2.gif) | zrkdjsalting.mp3 | 2022-06-29 07:51 | 6.2M | |
![[SND]](/icons/sound2.gif) | zrkdjpompom.mp3 | 2022-06-29 07:43 | 10M | |
![[SND]](/icons/sound2.gif) | zrkdjodarling.mp3 | 2022-06-29 07:39 | 6.2M | |
![[SND]](/icons/sound2.gif) | zrkdjocopakele.mp3 | 2022-06-29 07:43 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkdjnyaman.mp3 | 2022-06-29 07:50 | 3.7M | |
![[SND]](/icons/sound2.gif) | zrkdjmontage.mp3 | 2022-06-29 07:45 | 12M | |
![[SND]](/icons/sound2.gif) | zrkdjmbon.mp3 | 2022-06-29 07:50 | 11M | |
![[SND]](/icons/sound2.gif) | zrkdjmama.mp3 | 2022-06-29 07:43 | 9.5M | |
![[SND]](/icons/sound2.gif) | zrkdjmacarena.mp3 | 2022-06-29 07:55 | 4.1M | |
![[SND]](/icons/sound2.gif) | zrkdjliving.mp3 | 2022-06-29 07:41 | 3.8M | |
![[SND]](/icons/sound2.gif) | zrkdjkomangsekali.mp3 | 2022-06-29 07:49 | 12M | |
![[SND]](/icons/sound2.gif) | zrkdjkomangghost.mp3 | 2022-06-29 07:49 | 8.7M | |
![[SND]](/icons/sound2.gif) | zrkdjjangganggu.mp3 | 2022-06-29 07:59 | 7.3M | |
![[SND]](/icons/sound2.gif) | zrkdjinoma.mp3 | 2022-06-29 07:43 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkdjindia.mp3 | 2022-06-29 07:55 | 4.7M | |
![[SND]](/icons/sound2.gif) | zrkdjharga.mp3 | 2022-06-29 07:41 | 4.4M | |
![[SND]](/icons/sound2.gif) | zrkdjgueparty.mp3 | 2022-06-29 07:39 | 7.0M | |
![[SND]](/icons/sound2.gif) | zrkdjgoreng.mp3 | 2022-06-29 07:41 | 3.1M | |
![[SND]](/icons/sound2.gif) | zrkdjfullbass.mp3 | 2022-06-29 07:44 | 7.1M | |
![[SND]](/icons/sound2.gif) | zrkdjdota.mp3 | 2022-06-29 07:41 | 4.4M | |
![[SND]](/icons/sound2.gif) | zrkdjdontgo.mp3 | 2022-06-29 07:51 | 7.2M | |
![[SND]](/icons/sound2.gif) | zrkdjdinda.mp3 | 2022-06-29 07:39 | 5.4M | |
![[SND]](/icons/sound2.gif) | zrkdjdevil.mp3 | 2022-06-29 07:43 | 14M | |
![[SND]](/icons/sound2.gif) | zrkdjdapatkah.mp3 | 2022-06-29 07:54 | 12M | |
![[SND]](/icons/sound2.gif) | zrkdjchicaloca.mp3 | 2022-06-29 07:55 | 5.5M | |
![[SND]](/icons/sound2.gif) | zrkdjcalma.mp3 | 2022-06-29 07:46 | 20M | |
![[SND]](/icons/sound2.gif) | zrkdjcallme.mp3 | 2022-06-29 07:44 | 8.1M | |
![[SND]](/icons/sound2.gif) | zrkdjbumbum.mp3 | 2022-06-29 07:59 | 7.1M | |
![[SND]](/icons/sound2.gif) | zrkdjbreak.mp3 | 2022-06-29 07:46 | 11M | |
![[SND]](/icons/sound2.gif) | zrkdjbody.mp3 | 2022-06-29 07:54 | 9.3M | |
![[SND]](/icons/sound2.gif) | zrkdjbilangmantu.mp3 | 2022-06-29 07:54 | 8.6M | |
![[SND]](/icons/sound2.gif) | zrkdjbaby.mp3 | 2022-06-29 07:59 | 7.2M | |
![[SND]](/icons/sound2.gif) | zrkdjanggap.mp3 | 2022-06-29 07:59 | 7.7M | |
![[SND]](/icons/sound2.gif) | zrkdjangelbaby.mp3 | 2022-06-29 07:41 | 9.8M | |
![[SND]](/icons/sound2.gif) | zrkdjalone.mp3 | 2022-06-29 07:58 | 5.7M | |
![[SND]](/icons/sound2.gif) | zrkdjaduh.mp3 | 2022-06-29 07:41 | 4.4M | |
![[SND]](/icons/sound2.gif) | zrkdevillady.mp3 | 2022-06-29 07:44 | 7.0M | |
![[SND]](/icons/sound2.gif) | zrkdeadtome.mp3 | 2022-06-29 07:49 | 8.8M | |
![[SND]](/icons/sound2.gif) | zrkdbz.mp3 | 2022-06-29 07:41 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrkdawinsubs.mp3 | 2022-06-29 07:48 | 7.2M | |
![[SND]](/icons/sound2.gif) | zrkdawinslow.mp3 | 2022-06-29 07:48 | 9.0M | |
![[SND]](/icons/sound2.gif) | zrkdawininstru.mp3 | 2022-06-29 07:48 | 7.3M | |
![[SND]](/icons/sound2.gif) | zrkdatstick.mp3 | 2022-06-29 07:56 | 2.9M | |
![[SND]](/icons/sound2.gif) | zrkdandelions.mp3 | 2022-06-29 07:56 | 5.4M | |
![[SND]](/icons/sound2.gif) | zrkdadari.mp3 | 2022-06-29 07:44 | 7.3M | |
![[SND]](/icons/sound2.gif) | zrkcowbell.mp3 | 2022-06-29 07:37 | 2.3M | |
![[SND]](/icons/sound2.gif) | zrkcomet.mp3 | 2022-06-29 07:45 | 8.2M | |
![[SND]](/icons/sound2.gif) | zrkclown.mp3 | 2022-06-29 07:59 | 4.3M | |
![[SND]](/icons/sound2.gif) | zrkcloudbread.mp3 | 2022-06-29 07:52 | 8.6M | |
![[SND]](/icons/sound2.gif) | zrkcintasederhana.mp3 | 2022-06-29 07:56 | 5.5M | |
![[SND]](/icons/sound2.gif) | zrkchillbill.mp3 | 2022-06-29 07:38 | 2.1M | |
![[SND]](/icons/sound2.gif) | zrkcheck.mp3 | 2022-06-29 07:38 | 1.7M | |
![[SND]](/icons/sound2.gif) | zrkcheating.mp3 | 2022-06-29 07:56 | 4.7M | |
![[SND]](/icons/sound2.gif) | zrkchacaron.mp3 | 2022-07-12 04:14 | 2.5M | |
![[SND]](/icons/sound2.gif) | zrkcell.mp3 | 2022-06-29 07:38 | 1.1M | |
![[SND]](/icons/sound2.gif) | zrkcatatankecil.mp3 | 2022-06-29 07:38 | 3.4M | |
![[SND]](/icons/sound2.gif) | zrkcarefree.mp3 | 2022-07-14 09:24 | 3.1M | |
![[SND]](/icons/sound2.gif) | zrkcalling.mp3 | 2022-06-29 07:56 | 4.7M | |
![[SND]](/icons/sound2.gif) | zrkbuster.mp3 | 2022-06-29 07:37 | 2.2M | |
![[SND]](/icons/sound2.gif) | zrkbukanjodohnya.mp3 | 2022-06-29 07:45 | 12M | |
![[SND]](/icons/sound2.gif) | zrkbread.mp3 | 2022-06-29 07:51 | 11M | |
![[SND]](/icons/sound2.gif) | zrkbones.mp3 | 2022-06-29 07:37 | 1.5M | |
![[SND]](/icons/sound2.gif) | zrkblood.mp3 | 2022-06-29 07:38 | 1.8M | |
![[SND]](/icons/sound2.gif) | zrkbertahanterluka.mp3 | 2022-06-29 07:45 | 9.2M | |
![[SND]](/icons/sound2.gif) | zrkbernafas.mp3 | 2022-06-29 07:51 | 9.0M | |
![[SND]](/icons/sound2.gif) | zrkberhentikasihan.mp3 | 2022-06-29 07:56 | 5.7M | |
![[SND]](/icons/sound2.gif) | zrkbegadangdrill.mp3 | 2022-06-29 07:39 | 2.2M | |
![[SND]](/icons/sound2.gif) | zrkbealright.mp3 | 2022-06-29 07:56 | 4.5M | |
![[SND]](/icons/sound2.gif) | zrkbassthoven.mp3 | 2022-06-29 07:55 | 2.9M | |
![[SND]](/icons/sound2.gif) | zrkbadhabits.mp3 | 2022-06-29 07:38 | 2.5M | |
![[SND]](/icons/sound2.gif) | zrkbackintown.mp3 | 2022-06-29 07:41 | 2.2M | |
![[SND]](/icons/sound2.gif) | zrkarcade.mp3 | 2022-06-29 07:47 | 7.6M | |
![[SND]](/icons/sound2.gif) | zrkapakabar.mp3 | 2022-06-29 07:52 | 9.4M | |
![[SND]](/icons/sound2.gif) | zrkanimephonk.mp3 | 2022-06-29 07:37 | 2.0M | |
![[SND]](/icons/sound2.gif) | zrkanggap.mp3 | 2022-06-29 07:59 | 6.7M | |
![[SND]](/icons/sound2.gif) | zrkangelbabyx.mp3 | 2022-06-29 07:39 | 4.3M | |
![[SND]](/icons/sound2.gif) | zrkangelbaby.mp3 | 2022-06-29 07:42 | 8.5M | |
![[SND]](/icons/sound2.gif) | zrkakusayangaku.mp3 | 2022-06-29 07:55 | 6.3M | |
![[SND]](/icons/sound2.gif) | zrkakuma.mp3 | 2022-06-29 07:50 | 6.8M | |
![[SND]](/icons/sound2.gif) | zrkajarkan.mp3 | 2022-06-29 07:51 | 8.6M | |
![[SND]](/icons/sound2.gif) | zrkaim.mp3 | 2022-06-29 07:44 | 4.8M | |
![[SND]](/icons/sound2.gif) | zrkadauntukmu.mp3 | 2022-06-29 07:42 | 10M | |
![[SND]](/icons/sound2.gif) | zrkacaaca.mp3 | 2022-06-29 07:44 | 10M | |
![[SND]](/icons/sound2.gif) | zrk303.mp3 | 2022-06-29 07:38 | 2.1M | |
![[SND]](/icons/sound2.gif) | zrk20min.mp3 | 2022-06-29 07:50 | 3.4M | |
![[SND]](/icons/sound2.gif) | zrk8letter.mp3 | 2022-07-04 02:34 | 2.9M | |
![[SND]](/icons/sound2.gif) | zrk1nonlyzoom.mp3 | 2022-06-29 07:52 | 4.9M | |
![[SND]](/icons/sound2.gif) | zrk1nonlystay.mp3 | 2022-06-29 07:55 | 5.4M | |
![[SND]](/icons/sound2.gif) | zrk1nonlyliu.mp3 | 2022-06-29 07:41 | 3.2M | |
![[SND]](/icons/sound2.gif) | zrk1nonlykiss.mp3 | 2022-06-29 07:49 | 5.3M | |
![[SND]](/icons/sound2.gif) | zrk1nonlydance.mp3 | 2022-06-29 07:53 | 6.1M | |
![[SND]](/icons/sound2.gif) | zrk1nonlybunny.mp3 | 2022-06-29 07:54 | 3.8M | |
![[SND]](/icons/sound2.gif) | zrk1nonly.mp3 | 2022-06-29 07:55 | 3.4M | |
![[SND]](/icons/sound2.gif) | zpl.mp3 | 2022-07-25 10:56 | 0 | |
![[SND]](/icons/sound2.gif) | zp.mp3 | 2022-07-25 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | zouhire.mp3 | 2022-07-21 19:54 | 0 | |
![[SND]](/icons/sound2.gif) | zopa.mp3 | 2022-07-18 14:37 | 68K | |
![[SND]](/icons/sound2.gif) | zoopark.mp3 | 2022-06-28 09:56 | 4.4M | |
![[SND]](/icons/sound2.gif) | zoomin.mp3 | 2022-07-02 15:14 | 2.7M | |
![[SND]](/icons/sound2.gif) | zone.mp3 | 2022-08-11 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | zonayaman.mp3 | 2022-07-05 22:54 | 4.0M | |
![[SND]](/icons/sound2.gif) | zona yaman.mp3 | 2022-07-05 22:01 | 4.0M | |
![[SND]](/icons/sound2.gif) | zombiegtaae.mp3 | 2022-07-02 13:02 | 556K | |
![[SND]](/icons/sound2.gif) | zombie_music_lastdayz_life.mp3 | 2022-07-30 18:13 | 2.3M | |
![[SND]](/icons/sound2.gif) | zombie.mp3 | 2022-07-18 15:05 | 0 | |
![[SND]](/icons/sound2.gif) | zomb-dj-tarantino-devockaxocetdviza-2018.mp3 | 2022-07-23 07:15 | 0 | |
![[SND]](/icons/sound2.gif) | zom.mp3 | 2022-07-17 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | zodivk_-_devil_eyes_muzati.net.mp3 | 2022-07-22 13:39 | 0 | |
![[SND]](/icons/sound2.gif) | zodivk-devil-eyes.mp3 | 2022-06-29 11:41 | 5.2M | |
![[SND]](/icons/sound2.gif) | zodivk-devil-eyes-mp3.mp3 | 2022-06-27 20:38 | 5.2M | |
![[SND]](/icons/sound2.gif) | zna.mp3 | 2022-07-22 17:51 | 4.0M | |
![[SND]](/icons/sound2.gif) | zn.mp3 | 2022-07-25 11:50 | 0 | |
![[SND]](/icons/sound2.gif) | zm1.mp3 | 2022-08-10 09:12 | 44K | |
![[SND]](/icons/sound2.gif) | zlye-treki-31hz-young-dolph-feat.-snoop-dogg-i-think-i-can-fly-screwed-by-danka_(mp3IQ.net).mp3 | 2022-07-30 12:14 | 2.2M | |
![[SND]](/icons/sound2.gif) | zlij_reper_zenik_-_gmo_(z2.fm).mp3 | 2022-08-09 15:58 | 0 | |
![[SND]](/icons/sound2.gif) | ziya20.mp3 | 2022-07-07 11:21 | 4.4M | |
![[SND]](/icons/sound2.gif) | ziya19.mp3 | 2022-07-07 11:21 | 4.7M | |
![[SND]](/icons/sound2.gif) | ziya18.mp3 | 2022-07-07 11:20 | 3.9M | |
![[SND]](/icons/sound2.gif) | ziya17.mp3 | 2022-07-07 11:20 | 4.0M | |
![[SND]](/icons/sound2.gif) | ziya16.mp3 | 2022-07-07 11:16 | 3.8M | |
![[SND]](/icons/sound2.gif) | ziya15.mp3 | 2022-07-07 11:16 | 5.7M | |
![[SND]](/icons/sound2.gif) | ziya14.mp3 | 2022-07-07 11:15 | 5.2M | |
![[SND]](/icons/sound2.gif) | ziya13.mp3 | 2022-07-07 11:15 | 3.8M | |
![[SND]](/icons/sound2.gif) | ziya12.mp3 | 2022-07-07 11:05 | 4.2M | |
![[SND]](/icons/sound2.gif) | ziya11.mp3 | 2022-07-07 11:02 | 3.7M | |
![[SND]](/icons/sound2.gif) | ziya10.mp3 | 2022-07-05 18:09 | 4.7M | |
![[SND]](/icons/sound2.gif) | ziya9.mp3 | 2022-07-05 18:08 | 4.6M | |
![[SND]](/icons/sound2.gif) | ziya8.mp3 | 2022-07-05 18:08 | 3.4M | |
![[SND]](/icons/sound2.gif) | ziya7.mp3 | 2022-07-05 18:07 | 4.7M | |
![[SND]](/icons/sound2.gif) | ziya6.mp3 | 2022-07-05 18:07 | 5.4M | |
![[SND]](/icons/sound2.gif) | ziya5.mp3 | 2022-07-05 18:07 | 4.7M | |
![[SND]](/icons/sound2.gif) | ziya4.mp3 | 2022-07-05 18:06 | 5.9M | |
![[SND]](/icons/sound2.gif) | ziya3.mp3 | 2022-07-05 18:06 | 4.6M | |
![[SND]](/icons/sound2.gif) | ziya2.mp3 | 2022-07-05 18:06 | 4.2M | |
![[SND]](/icons/sound2.gif) | ziya1.mp3 | 2022-07-05 18:05 | 4.2M | |
![[SND]](/icons/sound2.gif) | ziya.mp3 | 2022-07-05 18:05 | 3.7M | |
![[SND]](/icons/sound2.gif) | zitzen2.mp3 | 2022-08-06 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | zitzen1.mp3 | 2022-08-06 10:59 | 0 | |
![[SND]](/icons/sound2.gif) | zio.mp3 | 2022-07-19 13:08 | 0 | |
![[SND]](/icons/sound2.gif) | zindagi.mp3 | 2022-07-04 16:10 | 941K | |
![[SND]](/icons/sound2.gif) | zilly.mp3 | 2022-07-26 16:40 | 0 | |
![[SND]](/icons/sound2.gif) | zill101.mp3 | 2022-08-03 10:09 | 3.8M | |
![[SND]](/icons/sound2.gif) | zill100.mp3 | 2022-08-10 16:42 | 0 | |
![[SND]](/icons/sound2.gif) | zill21.mp3 | 2022-08-04 14:29 | 0 | |
![[SND]](/icons/sound2.gif) | zill14.mp3 | 2022-07-08 06:20 | 4.5M | |
![[SND]](/icons/sound2.gif) | zill13.mp3 | 2022-07-08 05:59 | 2.7M | |
![[SND]](/icons/sound2.gif) | zill12.mp3 | 2022-07-03 18:38 | 2.6M | |
![[SND]](/icons/sound2.gif) | zill11.mp3 | 2022-07-03 18:06 | 3.3M | |
![[SND]](/icons/sound2.gif) | zill10.mp3 | 2022-06-30 10:02 | 1.5M | |
![[SND]](/icons/sound2.gif) | zill9.mp3 | 2022-06-30 09:59 | 3.6M | |
![[SND]](/icons/sound2.gif) | zill8.mp3 | 2022-06-30 09:54 | 3.1M | |
![[SND]](/icons/sound2.gif) | zill7.mp3 | 2022-06-30 09:47 | 3.1M | |
![[SND]](/icons/sound2.gif) | zill6.mp3 | 2022-06-30 09:46 | 3.5M | |
![[SND]](/icons/sound2.gif) | zill5.mp3 | 2022-06-30 09:42 | 2.9M | |
![[SND]](/icons/sound2.gif) | zill4.mp3 | 2022-06-29 14:26 | 1.2M | |
![[SND]](/icons/sound2.gif) | zill3.mp3 | 2022-06-29 14:25 | 4.2M | |
![[SND]](/icons/sound2.gif) | zill2.mp3 | 2022-06-29 14:24 | 4.3M | |
![[SND]](/icons/sound2.gif) | zill1.mp3 | 2022-06-29 14:22 | 3.6M | |
![[SND]](/icons/sound2.gif) | zill.mp3 | 2022-08-01 16:52 | 0 | |
![[SND]](/icons/sound2.gif) | zildjian-ligawtingin.mp3 | 2022-07-05 01:29 | 3.5M | |
![[SND]](/icons/sound2.gif) | zild.mp3 | 2022-07-12 05:45 | 5.8M | |
![[SND]](/icons/sound2.gif) | zilan.mp3 | 2022-08-07 00:05 | 0 | |
![[SND]](/icons/sound2.gif) | zila.mp3 | 2022-06-29 07:27 | 3.1M | |
![[SND]](/icons/sound2.gif) | zikri4.mp3 | 2022-06-28 11:48 | 5.0M | |
![[SND]](/icons/sound2.gif) | ziko2.mp3 | 2022-06-29 23:52 | 1.8M | |
![[SND]](/icons/sound2.gif) | ziko1.mp3 | 2022-06-29 23:55 | 3.0M | |
![[SND]](/icons/sound2.gif) | zigzag1.mp3 | 2022-06-29 03:27 | 2.4M | |
![[SND]](/icons/sound2.gif) | zidoulmasih.m4a | 2022-07-03 21:53 | 3.8M | |
![[SND]](/icons/sound2.gif) | zidan.mp3 | 2022-07-12 14:06 | 6.2M | |
![[SND]](/icons/sound2.gif) | zicoco.mp3 | 2022-07-29 08:48 | 0 | |
![[SND]](/icons/sound2.gif) | zico2.mp3 | 2022-07-12 11:16 | 4.6M | |
![[SND]](/icons/sound2.gif) | zico1.mp3 | 2022-07-12 11:16 | 5.6M | |
![[SND]](/icons/sound2.gif) | zhuusoft.mp3 | 2022-06-29 10:21 | 4.8M | |
![[SND]](/icons/sound2.gif) | zhuusad2.mp3 | 2022-06-30 23:40 | 3.1M | |
![[SND]](/icons/sound2.gif) | zhuusad.mp3 | 2022-06-28 10:29 | 3.1M | |
![[SND]](/icons/sound2.gif) | zhuudespa.mp3 | 2022-06-28 10:54 | 4.1M | |
![[SND]](/icons/sound2.gif) | zhuki-batarejjka.mp3 | 2022-07-05 06:48 | 5.2M | |
![[SND]](/icons/sound2.gif) | zhestkyi fit s donaldom.mp3 | 2022-07-13 09:35 | 2.0M | |
![[SND]](/icons/sound2.gif) | zhenskie-stony.mp3 | 2022-07-13 17:49 | 1.2M | |
![[SND]](/icons/sound2.gif) | zhanulka_-_ty_pokhozh_na_kota_73373031.mp3 | 2022-07-26 14:31 | 0 | |
![[SND]](/icons/sound2.gif) | zhanulka_-_Ty_pokhozh_na_kota_(musmore.com).mp3 | 2022-07-01 02:03 | 7.3M | |
![[SND]](/icons/sound2.gif) | zhanulka - ты похож на кота (yottvmottv remix).mp3 | 2022-07-08 19:02 | 8.0M | |
![[SND]](/icons/sound2.gif) | zhanul_ka_-_kis-kis_ya_kotik_ty_kotik_muzati.net.mp3 | 2022-07-01 18:25 | 6.5M | |
![[SND]](/icons/sound2.gif) | zhalan-dunie-zhalan-eken_(muzzona.kz).mp3 | 2022-08-09 18:11 | 0 | |
![[SND]](/icons/sound2.gif) | zhalan-dunie-zhalan-eken.mp3 | 2022-08-09 18:15 | 0 | |
![[SND]](/icons/sound2.gif) | zgzgxvfx.mp3 | 2022-07-03 12:39 | 1.0M | |
![[SND]](/icons/sound2.gif) | zg3.mp3 | 2022-07-16 20:10 | 0 | |
![[SND]](/icons/sound2.gif) | zexy3.mp3 | 2022-07-11 07:39 | 32M | |
![[SND]](/icons/sound2.gif) | zexy2.mp3 | 2022-07-07 10:33 | 55M | |
![[SND]](/icons/sound2.gif) | zexy1.mp3 | 2022-07-07 06:15 | 2.8M | |
![[SND]](/icons/sound2.gif) | zexy.mp3 | 2022-07-07 05:50 | 3.1M | |
![[SND]](/icons/sound2.gif) | zerpbills3.mp3 | 2022-07-25 01:20 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills21.mp3 | 2022-07-25 01:13 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills19.mp3 | 2022-07-25 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills18.mp3 | 2022-07-25 01:10 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills17.mp3 | 2022-07-25 01:08 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills16.mp3 | 2022-07-25 01:12 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills15.mp3 | 2022-07-25 01:12 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills14.mp3 | 2022-07-25 01:08 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills13.mp3 | 2022-07-25 01:09 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills12.mp3 | 2022-07-25 01:06 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills11.mp3 | 2022-07-25 01:06 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills10.mp3 | 2022-07-25 01:06 | 632K | |
![[SND]](/icons/sound2.gif) | zerobills9.mp3 | 2022-07-25 01:18 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills8.mp3 | 2022-07-25 01:19 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills7.mp3 | 2022-07-25 01:17 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills5.mp3 | 2022-07-25 01:17 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills4.mp3 | 2022-07-25 01:15 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills2.mp3 | 2022-07-25 01:10 | 0 | |
![[SND]](/icons/sound2.gif) | zerobills1.mp3 | 2022-07-25 01:07 | 0 | |
![[SND]](/icons/sound2.gif) | zero2.mp3 | 2022-06-30 18:16 | 4.2M | |
![[SND]](/icons/sound2.gif) | zero.mp3 | 2022-07-16 21:23 | 3.6M | |
![[SND]](/icons/sound2.gif) | zerelli4.mp3 | 2022-07-16 01:31 | 13M | |
![[SND]](/icons/sound2.gif) | zerelli3.mp3 | 2022-07-16 01:23 | 12M | |
![[SND]](/icons/sound2.gif) | zerelli2.mp3 | 2022-07-10 10:16 | 8.9M | |
![[SND]](/icons/sound2.gif) | zerelli1.mp3 | 2022-07-07 07:35 | 38M | |
![[SND]](/icons/sound2.gif) | zerelli.mp3 | 2022-07-15 23:08 | 6.9M | |
![[SND]](/icons/sound2.gif) | zer.mp3 | 2022-08-03 12:32 | 7.2M | |
![[SND]](/icons/sound2.gif) | zep8.mp3 | 2022-07-22 07:10 | 0 | |
![[SND]](/icons/sound2.gif) | zep7.mp3 | 2022-07-22 07:10 | 0 | |
![[SND]](/icons/sound2.gif) | zep4.mp3 | 2022-07-22 07:10 | 0 | |
![[SND]](/icons/sound2.gif) | zep3.mp3 | 2022-07-22 07:10 | 0 | |
![[SND]](/icons/sound2.gif) | zep2.mp3 | 2022-07-22 07:09 | 8.0K | |
![[SND]](/icons/sound2.gif) | zep1.mp3 | 2022-07-22 07:09 | 3.8M | |
![[SND]](/icons/sound2.gif) | zeondjj11.mp3 | 2022-07-08 17:18 | 4.4M | |
![[SND]](/icons/sound2.gif) | zeondjj10.mp3 | 2022-07-08 17:18 | 4.5M | |
![[SND]](/icons/sound2.gif) | zeondjj9.mp3 | 2022-07-08 17:18 | 5.0M | |
![[SND]](/icons/sound2.gif) | zeondjj8.mp3 | 2022-07-08 17:18 | 4.7M | |
![[SND]](/icons/sound2.gif) | zeondjj7.mp3 | 2022-07-08 17:18 | 4.9M | |
![[SND]](/icons/sound2.gif) | zeondjj6.mp3 | 2022-07-08 17:18 | 4.7M | |
![[SND]](/icons/sound2.gif) | zeondjj5.mp3 | 2022-07-08 17:18 | 5.2M | |
![[SND]](/icons/sound2.gif) | zeondjj4.mp3 | 2022-07-08 17:18 | 7.8M | |
![[SND]](/icons/sound2.gif) | zeondjj3.mp3 | 2022-07-08 17:17 | 6.3M | |
![[SND]](/icons/sound2.gif) | zeondjj2.mp3 | 2022-07-08 17:18 | 6.6M | |
![[SND]](/icons/sound2.gif) | zeondjj1.mp3 | 2022-07-08 17:17 | 5.6M | |
![[SND]](/icons/sound2.gif) | zeondjj.mp3 | 2022-07-08 08:48 | 4.8M | |
![[SND]](/icons/sound2.gif) | zeon11.mp3 | 2022-07-09 16:09 | 21M | |
![[SND]](/icons/sound2.gif) | zeon10.mp3 | 2022-06-30 07:00 | 30M | |
![[SND]](/icons/sound2.gif) | zeon8.mp3 | 2022-06-30 07:00 | 13M | |
![[SND]](/icons/sound2.gif) | zeon6.mp3 | 2022-07-09 15:46 | 41M | |
![[SND]](/icons/sound2.gif) | zeon4.mp3 | 2022-07-09 15:45 | 2.8M | |
![[SND]](/icons/sound2.gif) | zenzen.mp3 | 2022-08-05 11:22 | 4.5M | |
![[SND]](/icons/sound2.gif) | zenygkuinginkan.mp3 | 2022-07-30 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | zentakternilai.mp3 | 2022-07-30 05:40 | 0 | |
![[SND]](/icons/sound2.gif) | zenseluruhnafas.mp3 | 2022-07-30 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | zenseandainya.mp3 | 2022-07-30 05:33 | 3.9M | |
![[SND]](/icons/sound2.gif) | zensad1.mp3 | 2022-07-23 03:11 | 0 | |
![[SND]](/icons/sound2.gif) | zensad.mp3 | 2022-06-30 13:57 | 45M | |
![[SND]](/icons/sound2.gif) | zenrindumu.mp3 | 2022-07-30 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | zenperih.mp3 | 2022-07-30 05:33 | 868K | |
![[SND]](/icons/sound2.gif) | zenpedih.mp3 | 2022-07-30 05:33 | 3.9M | |
![[SND]](/icons/sound2.gif) | zenn12.mp3 | 2022-07-30 03:41 | 0 | |
![[SND]](/icons/sound2.gif) | zenn11.mp3 | 2022-07-30 03:40 | 0 | |
![[SND]](/icons/sound2.gif) | zenn10.mp3 | 2022-07-30 03:42 | 0 | |
![[SND]](/icons/sound2.gif) | zenn9.mp3 | 2022-07-30 03:39 | 0 | |
![[SND]](/icons/sound2.gif) | zenn8.mp3 | 2022-07-30 03:40 | 0 | |
![[SND]](/icons/sound2.gif) | zenn6.mp3 | 2022-07-30 03:42 | 0 | |
![[SND]](/icons/sound2.gif) | zenn4.mp3 | 2022-07-30 03:37 | 0 | |
![[SND]](/icons/sound2.gif) | zenn3.mp3 | 2022-07-30 03:37 | 0 | |
![[SND]](/icons/sound2.gif) | zenn2.mp3 | 2022-07-30 03:39 | 0 | |
![[SND]](/icons/sound2.gif) | zenn1.mp3 | 2022-07-30 03:40 | 0 | |
![[SND]](/icons/sound2.gif) | zenmenyerah.mp3 | 2022-07-30 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | zenlwish.mp3 | 2022-07-13 10:52 | 3.8M | |
![[SND]](/icons/sound2.gif) | zenbernafas.mp3 | 2022-07-30 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | zen49.mp3 | 2022-07-23 03:43 | 0 | |
![[SND]](/icons/sound2.gif) | zen19.mp3 | 2022-07-27 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | zen12.mp3 | 2022-07-30 06:33 | 0 | |
![[SND]](/icons/sound2.gif) | zen11.mp3 | 2022-07-30 06:15 | 0 | |
![[SND]](/icons/sound2.gif) | zen10.mp3 | 2022-07-30 06:12 | 0 | |
![[SND]](/icons/sound2.gif) | zen8.mp3 | 2022-07-30 06:12 | 0 | |
![[SND]](/icons/sound2.gif) | zen7.mp3 | 2022-07-30 06:12 | 0 | |
![[SND]](/icons/sound2.gif) | zen6.mp3 | 2022-07-30 06:11 | 0 | |
![[SND]](/icons/sound2.gif) | zen5.mp3 | 2022-07-30 06:11 | 0 | |
![[SND]](/icons/sound2.gif) | zen4.mp3 | 2022-07-30 06:33 | 0 | |
![[SND]](/icons/sound2.gif) | zen3.mp3 | 2022-07-30 06:11 | 3.3M | |
![[SND]](/icons/sound2.gif) | zen2.mp3 | 2022-07-30 06:10 | 3.6M | |
![[SND]](/icons/sound2.gif) | zen1.mp3 | 2022-07-30 06:10 | 2.6M | |
![[SND]](/icons/sound2.gif) | zen.mp3 | 2022-07-25 10:35 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas94.mp3 | 2022-07-18 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas80.mp3 | 2022-07-18 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas71.mp3 | 2022-07-18 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas54.mp3 | 2022-07-18 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas43.mp3 | 2022-07-18 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas30.mp3 | 2022-07-18 14:02 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas19.mp3 | 2022-07-18 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | zemzilasdebesublodas14.mp3 | 2022-07-18 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | zeldalab.mp3 | 2022-07-20 07:16 | 0 | |
![[SND]](/icons/sound2.gif) | zedash1.mp3 | 2022-07-05 02:14 | 3.8M | |
![[SND]](/icons/sound2.gif) | zecki - chichen itza.mp3 | 2022-07-23 06:42 | 0 | |
![[SND]](/icons/sound2.gif) | zebra.mp3 | 2022-07-23 21:13 | 0 | |
![[SND]](/icons/sound2.gif) | zeb.mp3 | 2022-07-20 06:16 | 1.8M | |
![[SND]](/icons/sound2.gif) | ze.mp3 | 2022-08-03 10:23 | 0 | |
![[SND]](/icons/sound2.gif) | zcz.mp3 | 2022-08-02 16:09 | 0 | |
![[SND]](/icons/sound2.gif) | zcx.mp3 | 2022-06-28 13:35 | 60M | |
![[SND]](/icons/sound2.gif) | zbzbzbzb.mp3 | 2022-07-22 19:22 | 0 | |
![[SND]](/icons/sound2.gif) | zbida9.mp3 | 2022-07-08 11:29 | 6.7M | |
![[SND]](/icons/sound2.gif) | zbida8.mp3 | 2022-07-08 11:25 | 8.0M | |
![[SND]](/icons/sound2.gif) | zbida7.mp3 | 2022-07-08 11:25 | 10M | |
![[SND]](/icons/sound2.gif) | zbida6.mp3 | 2022-07-08 11:25 | 8.0M | |
![[SND]](/icons/sound2.gif) | zbida5.mp3 | 2022-07-08 02:21 | 11M | |
![[SND]](/icons/sound2.gif) | zbida4.mp3 | 2022-07-08 01:28 | 7.9M | |
![[SND]](/icons/sound2.gif) | zbida3.mp3 | 2022-07-08 01:33 | 3.8M | |
![[SND]](/icons/sound2.gif) | zbida2.mp3 | 2022-07-08 01:30 | 6.5M | |
![[SND]](/icons/sound2.gif) | zbida1.mp3 | 2022-07-08 01:32 | 12M | |
![[SND]](/icons/sound2.gif) | zayn.mp3 | 2022-07-25 16:16 | 0 | |
![[SND]](/icons/sound2.gif) | zayah.mp3 | 2022-07-27 16:07 | 8.8M | |
![[SND]](/icons/sound2.gif) | zay.mp3 | 2022-08-06 13:10 | 0 | |
![[SND]](/icons/sound2.gif) | zaxn1.mp3 | 2022-08-09 15:10 | 0 | |
![[SND]](/icons/sound2.gif) | zawsze.mp3 | 2022-08-09 17:43 | 0 | |
![[SND]](/icons/sound2.gif) | zawanbeats-low.mp3 | 2022-08-11 23:12 | 0 | |
![[SND]](/icons/sound2.gif) | zawali.mp3 | 2022-07-21 18:11 | 0 | |
![[SND]](/icons/sound2.gif) | zavod_fon.mp3 | 2022-07-17 12:39 | 0 | |
![[SND]](/icons/sound2.gif) | zavet_-_96-slez.mp3 | 2022-07-15 22:15 | 4.7M | |
![[SND]](/icons/sound2.gif) | zaur-magomadov-idet-karavan-iz-irana.mp3 | 2022-08-11 11:16 | 0 | |
![[SND]](/icons/sound2.gif) | zatyanu.mp3 | 2022-08-10 18:09 | 0 | |
![[SND]](/icons/sound2.gif) | zastavka-k-serialu-narko-meksika-narcos-mexico-opening-credits.mp3 | 2022-07-03 23:08 | 4.0M | |
![[SND]](/icons/sound2.gif) | zara-sa.mp3 | 2022-08-10 08:40 | 0 | |
![[SND]](/icons/sound2.gif) | zapsplat_multimedia_cell_phone_smart_screen_button_press_click_feedback_003_60932.mp3 | 2022-07-05 02:52 | 1.1K | |
![[SND]](/icons/sound2.gif) | zapsplat_foley_bag_backpack_zipper_001_42460.mp3 | 2022-07-17 23:08 | 0 | |
![[SND]](/icons/sound2.gif) | zapsplat_emergency_alarm_siren_high_pitched_beeps_danger_68955-[AudioTrimmer.com].mp3 | 2022-07-26 08:50 | 0 | |
![[SND]](/icons/sound2.gif) | zapsplat_aminal_wild_could_be_bear_growl_snarl_001_60537.mp3 | 2022-08-05 13:10 | 28K | |
![[SND]](/icons/sound2.gif) | zapomni-kozhura.mp3 | 2022-07-08 12:28 | 5.6M | |
![[SND]](/icons/sound2.gif) | zapali-grad-official-video.mp3 | 2022-07-11 20:25 | 3.6M | |
![[SND]](/icons/sound2.gif) | zans.mp3 | 2022-07-16 19:32 | 2.9M | |
![[SND]](/icons/sound2.gif) | zannn.mp3 | 2022-07-02 03:44 | 18M | |
![[SND]](/icons/sound2.gif) | zan1.mp3 | 2022-07-04 06:44 | 2.2M | |
![[SND]](/icons/sound2.gif) | zan.mp3 | 2022-07-02 03:27 | 3.8M | |
![[SND]](/icons/sound2.gif) | zamo12.mp3 | 2022-07-21 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | zamo11.mp3 | 2022-07-21 16:52 | 0 | |
![[SND]](/icons/sound2.gif) | zamo10.mp3 | 2022-07-21 16:38 | 0 | |
![[SND]](/icons/sound2.gif) | zamo9.mp3 | 2022-07-21 16:42 | 2.9M | |
![[SND]](/icons/sound2.gif) | zamo8.mp3 | 2022-07-21 16:43 | 0 | |
![[SND]](/icons/sound2.gif) | zamo7.mp3 | 2022-07-21 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | zamo6.mp3 | 2022-07-21 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | zamo5.mp3 | 2022-07-21 16:46 | 3.7M | |
![[SND]](/icons/sound2.gif) | zamo4.mp3 | 2022-07-21 16:44 | 0 | |
![[SND]](/icons/sound2.gif) | zamo3.mp3 | 2022-07-21 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | zamo2.mp3 | 2022-07-21 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | zamo1.mp3 | 2022-07-21 16:48 | 0 | |
![[SND]](/icons/sound2.gif) | zaluipkingk.mp3 | 2022-07-23 23:10 | 0 | |
![[SND]](/icons/sound2.gif) | zalil4.mp3 | 2022-07-06 14:11 | 2.3M | |
![[SND]](/icons/sound2.gif) | zalil3.mp3 | 2022-07-06 14:11 | 2.1M | |
![[SND]](/icons/sound2.gif) | zalil2.mp3 | 2022-07-06 14:11 | 1.9M | |
![[SND]](/icons/sound2.gif) | zalil1.mp3 | 2022-07-06 14:11 | 1.8M | |
![[SND]](/icons/sound2.gif) | zalil0.mp3 | 2022-07-06 14:11 | 1.5M | |
![[SND]](/icons/sound2.gif) | zalil.mp3 | 2022-07-06 14:11 | 2.3M | |
![[SND]](/icons/sound2.gif) | zali13.mp3 | 2022-07-17 18:48 | 0 | |
![[SND]](/icons/sound2.gif) | zali12.mp3 | 2022-07-17 18:54 | 0 | |
![[SND]](/icons/sound2.gif) | zali11.mp3 | 2022-07-17 18:43 | 6.2M | |
![[SND]](/icons/sound2.gif) | zali10.mp3 | 2022-07-16 04:15 | 9.4M | |
![[SND]](/icons/sound2.gif) | zali9.mp3 | 2022-07-16 04:15 | 9.5M | |
![[SND]](/icons/sound2.gif) | zali8.mp3 | 2022-07-16 08:09 | 9.3M | |
![[SND]](/icons/sound2.gif) | zali7.mp3 | 2022-07-16 04:15 | 10M | |
![[SND]](/icons/sound2.gif) | zali6.mp3 | 2022-07-16 04:14 | 3.9M | |
![[SND]](/icons/sound2.gif) | zali5.mp3 | 2022-07-15 17:14 | 5.5M | |
![[SND]](/icons/sound2.gif) | zali4.mp3 | 2022-07-15 17:13 | 4.6M | |
![[SND]](/icons/sound2.gif) | zali3.mp3 | 2022-07-15 17:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | zali2.mp3 | 2022-07-15 16:21 | 3.7M | |
![[SND]](/icons/sound2.gif) | zali1.mp3 | 2022-07-15 16:12 | 7.3M | |
![[SND]](/icons/sound2.gif) | zaldj1.mp3 | 2022-07-30 08:52 | 0 | |
![[SND]](/icons/sound2.gif) | zaldj.mp3 | 2022-07-30 09:02 | 0 | |
![[SND]](/icons/sound2.gif) | zaky1.mp3 | 2022-07-17 18:19 | 0 | |
![[SND]](/icons/sound2.gif) | zakinylnas.mp3 | 2022-07-25 07:07 | 0 | |
![[SND]](/icons/sound2.gif) | zaki.mp3 | 2022-07-15 16:28 | 1.7M | |
![[SND]](/icons/sound2.gif) | zakaganteng6.mp3 | 2022-07-05 16:34 | 3.5M | |
![[SND]](/icons/sound2.gif) | zakaganteng5.mp3 | 2022-07-05 16:30 | 3.7M | |
![[SND]](/icons/sound2.gif) | zakaganteng4.mp3 | 2022-07-04 19:09 | 9.0M | |
![[SND]](/icons/sound2.gif) | zakaganteng3.mp3 | 2022-07-04 19:08 | 6.4M | |
![[SND]](/icons/sound2.gif) | zakaganteng2.mp3 | 2022-07-04 18:45 | 2.5M | |
![[SND]](/icons/sound2.gif) | zakaganteng1.mp3 | 2022-07-04 17:58 | 2.5M | |
![[SND]](/icons/sound2.gif) | zaip1.mp3 | 2022-08-02 07:51 | 0 | |
![[SND]](/icons/sound2.gif) | zaebispizdato.mp3 | 2022-08-12 15:02 | 0 | |
![[SND]](/icons/sound2.gif) | zacky4.mp3 | 2022-08-10 16:08 | 0 | |
![[SND]](/icons/sound2.gif) | zacky3.mp3 | 2022-07-06 10:26 | 2.0M | |
![[SND]](/icons/sound2.gif) | zacky2.mp3 | 2022-06-28 20:30 | 2.4M | |
![[SND]](/icons/sound2.gif) | zacky1.mp3 | 2022-06-28 20:25 | 20M | |
![[SND]](/icons/sound2.gif) | zacky.mp3 | 2022-06-28 20:13 | 4.7M | |
![[SND]](/icons/sound2.gif) | zackin.mp3 | 2022-06-27 15:32 | 8.4M | |
![[SND]](/icons/sound2.gif) | zacki.mp3 | 2022-06-27 16:18 | 7.8M | |
![[SND]](/icons/sound2.gif) | zack10.mp3 | 2022-06-28 06:39 | 7.8M | |
![[SND]](/icons/sound2.gif) | zack9.mp3 | 2022-06-28 06:40 | 8.8M | |
![[SND]](/icons/sound2.gif) | zack8.mp3 | 2022-06-28 06:40 | 11M | |
![[SND]](/icons/sound2.gif) | zack7.mp3 | 2022-06-28 06:40 | 9.8M | |
![[SND]](/icons/sound2.gif) | zack6.mp3 | 2022-06-28 06:40 | 9.5M | |
![[SND]](/icons/sound2.gif) | zack5.mp3 | 2022-06-28 06:39 | 8.6M | |
![[SND]](/icons/sound2.gif) | zack4.mp3 | 2022-06-28 06:39 | 7.7M | |
![[SND]](/icons/sound2.gif) | zack3.mp3 | 2022-07-02 08:17 | 3.6M | |
![[SND]](/icons/sound2.gif) | zack2.mp3 | 2022-07-02 08:13 | 4.1M | |
![[SND]](/icons/sound2.gif) | zack1.mp3 | 2022-07-02 08:01 | 3.4M | |
![[SND]](/icons/sound2.gif) | zack0.mp3 | 2022-07-02 07:58 | 3.7M | |
![[SND]](/icons/sound2.gif) | zack.mp3 | 2022-07-02 07:54 | 4.2M | |
![[SND]](/icons/sound2.gif) | za_vse-zaplacheno.mp3 | 2022-07-31 01:07 | 0 | |
![[SND]](/icons/sound2.gif) | za3im.mp3 | 2022-08-12 13:25 | 2.9M | |
![[SND]](/icons/sound2.gif) | za.mp3 | 2022-08-10 05:19 | 0 | |
![[SND]](/icons/sound2.gif) | z_uki-vystrel-iz-pistoleta(1).mp3 | 2022-06-28 07:03 | 220K | |
![[SND]](/icons/sound2.gif) | zXcVb2.mp3 | 2022-07-24 13:13 | 0 | |
![[SND]](/icons/sound2.gif) | zXcVb1.mp3 | 2022-07-23 09:09 | 3.6M | |
![[SND]](/icons/sound2.gif) | zXcVDJ1.mp3 | 2022-07-24 13:15 | 0 | |
![[SND]](/icons/sound2.gif) | zTest.mp3 | 2022-07-15 06:53 | 3.1M | |
![[SND]](/icons/sound2.gif) | zE.mp3 | 2022-06-28 08:34 | 3.3M | |
![[SND]](/icons/sound2.gif) | z12.mp3 | 2022-06-30 10:54 | 3.7M | |
![[SND]](/icons/sound2.gif) | z11.mp3 | 2022-06-30 10:54 | 7.7M | |
![[SND]](/icons/sound2.gif) | z10.mp3 | 2022-06-30 10:51 | 5.4M | |
![[SND]](/icons/sound2.gif) | z9.mp3 | 2022-06-30 10:50 | 2.4M | |
![[SND]](/icons/sound2.gif) | z8.mp3 | 2022-06-30 10:49 | 3.3M | |
![[SND]](/icons/sound2.gif) | z7u9qs8o8eaxyc62cx (1).m4a | 2022-07-28 12:29 | 0 | |
![[SND]](/icons/sound2.gif) | z7.mp3 | 2022-06-30 10:47 | 3.4M | |
![[SND]](/icons/sound2.gif) | z6.mp3 | 2022-06-30 10:48 | 5.0M | |
![[SND]](/icons/sound2.gif) | z5.mp3 | 2022-08-07 04:06 | 7.2M | |
![[SND]](/icons/sound2.gif) | z4.mp3 | 2022-06-30 10:40 | 5.5M | |
![[SND]](/icons/sound2.gif) | z3.mp3 | 2022-06-30 10:34 | 5.7M | |
![[SND]](/icons/sound2.gif) | z2 (1).mp3 | 2022-07-01 16:19 | 2.6M | |
![[SND]](/icons/sound2.gif) | z1.mp3 | 2022-07-18 14:41 | 3.2M | |
![[SND]](/icons/sound2.gif) | z1 (1).mp3 | 2022-07-01 16:16 | 4.8M | |
![[SND]](/icons/sound2.gif) | z.mp3 | 2022-07-24 00:04 | 4.5M | |
![[SND]](/icons/sound2.gif) | yzxyzz.mp3 | 2022-08-01 00:27 | 0 | |
![[SND]](/icons/sound2.gif) | yyyggt.mp3 | 2022-07-07 05:24 | 4.4M | |
![[SND]](/icons/sound2.gif) | yyy.mp3 | 2022-07-27 18:39 | 0 | |
![[SND]](/icons/sound2.gif) | yynv.mp3 | 2022-07-21 12:28 | 0 | |
![[SND]](/icons/sound2.gif) | yyhksh.mp3 | 2022-08-06 06:15 | 0 | |
![[SND]](/icons/sound2.gif) | yy.mp3 | 2022-08-11 04:39 | 3.4M | |
![[SND]](/icons/sound2.gif) | yxz4.mp3 | 2022-07-02 10:24 | 2.9M | |
![[SND]](/icons/sound2.gif) | yxz3.mp3 | 2022-06-29 09:12 | 2.4M | |
![[SND]](/icons/sound2.gif) | yxz2.mp3 | 2022-06-29 09:12 | 3.6M | |
![[SND]](/icons/sound2.gif) | yxz1.mp3 | 2022-06-29 09:12 | 3.0M | |
![[SND]](/icons/sound2.gif) | ywm.mp3 | 2022-07-25 13:01 | 14M | |
![[SND]](/icons/sound2.gif) | ywe.mp3 | 2022-06-30 07:44 | 3.6M | |
![[SND]](/icons/sound2.gif) | yuyu.mp3 | 2022-08-05 11:13 | 0 | |
![[SND]](/icons/sound2.gif) | yus.mp3 | 2022-08-01 23:41 | 0 | |
![[SND]](/icons/sound2.gif) | yus❤️_29-07-22_12-30-07-469.mp3 | 2022-07-29 05:39 | 0 | |
![[SND]](/icons/sound2.gif) | yus❤️.mp3 | 2022-07-29 05:44 | 0 | |
![[SND]](/icons/sound2.gif) | yuriy_shatunov_-_sedaya_noch__(ivan_art_remix)_muzati.net.mp3 | 2022-07-03 17:08 | 8.6M | |
![[SND]](/icons/sound2.gif) | yurij-shatunov-kazhdomu-svoyo.mp3 | 2022-06-29 20:44 | 9.8M | |
![[SND]](/icons/sound2.gif) | yurij-shatunov-kazhdomu-svoyo (2).mp3 | 2022-06-29 20:39 | 9.8M | |
![[SND]](/icons/sound2.gif) | yurij-shatunov-kazhdomu-svoyo (1).mp3 | 2022-06-29 20:44 | 9.8M | |
![[SND]](/icons/sound2.gif) | yurii_shatunov_-_pro_belye_rozy_muzati.net.mp3 | 2022-07-27 04:43 | 0 | |
![[SND]](/icons/sound2.gif) | yurielibog.mp3 | 2022-08-07 02:06 | 0 | |
![[SND]](/icons/sound2.gif) | yummy.mp3 | 2022-07-13 10:08 | 7.0M | |
![[SND]](/icons/sound2.gif) | yummy - ayesha erotica (lyrics).mp3 | 2022-07-17 01:22 | 0 | |
![[SND]](/icons/sound2.gif) | yume 🎟.mp3 | 2022-08-03 09:37 | 0 | |
![[SND]](/icons/sound2.gif) | yuk_bersholawat_bop.mp3 | 2022-07-08 22:25 | 59M | |
![[SND]](/icons/sound2.gif) | yuiz.mp3 | 2022-08-04 15:11 | 1.8M | |
![[SND]](/icons/sound2.gif) | yuhuuu.mp3 | 2022-07-23 14:59 | 0 | |
![[SND]](/icons/sound2.gif) | yuh.mp3 | 2022-07-29 04:10 | 0 | |
![[SND]](/icons/sound2.gif) | ytyt.mp3 | 2022-07-06 07:42 | 368K | |
![[SND]](/icons/sound2.gif) | yttaasik.mp3 | 2022-07-06 15:18 | 5.3M | |
![[VID]](/icons/movie.gif) | ytmp3id.net - Kobo Kanaeru - Mantra Hujan (Lyrics_Lirik).mp4 | 2022-08-05 00:46 | 0 | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_uvi-pozdrav-brate-youtubemp3free.org.mp3 | 2022-08-12 16:26 | 0 | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_tate-mcrae-shes-all-i-wanna-be-official-video-youtubemp3free.org.mp3 | 2022-07-29 22:46 | 0 | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_otherworld-youtubemp3free.org.mp3 | 2022-07-02 10:32 | 3.0M | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_ochi-alvira-ft-maulana-ardiansyah-full-senyum-sayang-official-music-video-youtubemp3free.org.mp3 | 2022-08-03 15:49 | 0 | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_nino-donesi-divlje-mirise-audio-2011-youtubemp3free.org.mp3 | 2022-07-29 22:21 | 0 | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_laskar-pelangi-nidji-ft-indomusikteam-petik-youtubemp3free.org.mp3 | 2022-07-13 06:35 | 3.9M | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_illslick-the-illest-one-ft-dm-explicit-youtubemp3free.org.mp3 | 2022-06-30 16:33 | 2.8M | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_hollow-knight-sealed-vessel-theme-extended-youtubemp3free.org.mp3 | 2022-07-16 20:45 | 7.1M | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_elden-ring-ost-mohg-lord-of-blood-w-nihil-screams-youtubemp3free.org.mp3 | 2022-07-10 07:06 | 4.1M | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_born-a-stranger-youtubemp3free.org.mp3 | 2022-07-23 03:41 | 0 | |
![[SND]](/icons/sound2.gif) | ytmp3free.cc_ace-banzuelo-muli-official-lyric-video-youtubemp3free.org.mp3 | 2022-07-16 05:38 | 4.4M | |
![[SND]](/icons/sound2.gif) | ytm.mp3 | 2022-07-24 12:23 | 0 | |
![[SND]](/icons/sound2.gif) | ytest1.mp3 | 2022-06-28 14:29 | 3.4M | |
![[SND]](/icons/sound2.gif) | ytb.mp3 | 2022-07-07 00:54 | 3.5M | |
![[SND]](/icons/sound2.gif) | yt5s33fasa4r233ras13.mp3 | 2022-07-18 04:01 | 1.2M | |
![[SND]](/icons/sound2.gif) | yt5s33fasa4r233ras1.mp3 | 2022-07-18 01:50 | 0 | |
![[SND]](/icons/sound2.gif) | yt5s33fasa4r233ras.mp3 | 2022-07-18 01:49 | 0 | |
![[SND]](/icons/sound2.gif) | yt5s.mp3 | 2022-07-10 13:12 | 14M | |
![[SND]](/icons/sound2.gif) | yt5s.io - The Supremes_ Love Is Like an Itching in My Heart (Holland _ Dozier, 1966) - Lyrics (128 kbps).mp3 | 2022-08-08 10:34 | 0 | |
![[VID]](/icons/movie.gif) | yt5s.io-DJ COCO SONG X I LIKE TO MOVE IT SOUND DANZZ_, DDZX REMIX BY DJ TOGOK MENGKANE-(480p).mp4 | 2022-06-29 12:21 | 80M | |
![[SND]](/icons/sound2.gif) | yt5s.io - Bee Gees - Spirits (Having Flown) (128 kbps).mp3 | 2022-08-08 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | yt5s.io - ASMR besando tus Orejitas_ Mouth sounds-ASMR EAR EATING con 3dio (128 kbps).mp3 | 2022-07-05 19:17 | 12M | |
![[SND]](/icons/sound2.gif) | yt5s.com - it will rain - bruno mars %2F%2Flyrics (terjemahan) slowed ver (128 kbps).mp3 | 2022-07-05 10:04 | 4.3M | |
![[SND]](/icons/sound2.gif) | yt5s.com-QUEVEDO __ BZRP Music Sessions .mp3 | 2022-07-12 18:29 | 5.6M | |
![[SND]](/icons/sound2.gif) | yt5s.com - Papii Kocha - salima (official audio) (128 kbps).mp3 | 2022-07-07 17:11 | 6.2M | |
![[SND]](/icons/sound2.gif) | yt5s.com - In Too Deep (128 kbps).mp3 | 2022-06-30 00:20 | 1.9M | |
![[SND]](/icons/sound2.gif) | yt5s.com - Glassjaw - Ape Dos Mil (Video Version) (128 kbps).mp3 | 2022-07-30 17:24 | 0 | |
![[SND]](/icons/sound2.gif) | yt5s.com - Gellen Martadinata Selamat Ulang Tahun (cover by Moyy) (128 kbps).mp3 | 2022-07-25 11:47 | 1.0M | |
![[SND]](/icons/sound2.gif) | yt5s.com - DJ ANGEL BABY JEDAG JEDUG FULL BEAT VIRAL TIKTOK TERBARU 2022 DJ KOMANG RIMEX _ DJ ANGEL BABY REMIX (128 kbps).mp3 | 2022-08-02 15:15 | 0 | |
![[SND]](/icons/sound2.gif) | yt5s.com - Ace Attorney Spirit Of Justice Sound Effect - Judge’s Gavel (128 kbps).mp3 | 2022-07-02 22:05 | 27K | |
![[SND]](/icons/sound2.gif) | yt5s.com - A$AP Mob - Yamborghini High (Official Video - Explicit) ft. Juicy J (320 kbps).mp3 | 2022-07-09 06:41 | 12M | |
![[SND]](/icons/sound2.gif) | yt5s.com+-+Gellen+Martadinata+Selamat+Ulang+Tahun+(cover+by+Moyy)+(128+kbps)_out.mp3 | 2022-07-25 16:33 | 907K | |
![[SND]](/icons/sound2.gif) | yt2mate13.mp3 | 2022-08-04 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate11.mp3 | 2022-08-04 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate10.mp3 | 2022-08-04 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate9.mp3 | 2022-08-04 21:22 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate8.mp3 | 2022-08-04 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate7.mp3 | 2022-08-04 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate6.mp3 | 2022-08-04 21:22 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate5.mp3 | 2022-08-04 21:22 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate4.mp3 | 2022-08-04 21:22 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate3.mp3 | 2022-08-04 21:22 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate2.mp3 | 2022-08-04 21:22 | 0 | |
![[SND]](/icons/sound2.gif) | yt2mate.mp3 | 2022-08-04 21:22 | 0 | |
![[SND]](/icons/sound2.gif) | yt1scom-underwear-i-swear-by-minions-ost-from-despicable-me-02-hd-with-lyrics_MFLTM7Kk.mp3 | 2022-07-12 04:12 | 2.6M | |
![[SND]](/icons/sound2.gif) | yt1scom-ALBUM-LFERDA-Cagoul-Offi (1).mp3 | 2022-07-24 07:37 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - Tshego Morore - Project Geese (2024) (128 kbps)(1).mp3 | 2022-08-11 22:54 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.io - (Drunk in a shaappu) മലയാളം song remix (DJ MALAYALAM) drank song BOOSTED BASS By SKULL FORCE (128 kbps).mp3 | 2022-08-07 16:30 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - living life in the night ringtonewhatsapp status PABLO BEATS.mp3 | 2022-08-10 12:28 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - justin bieber favorite girl slowed reverb.mp3 | 2022-07-08 09:12 | 4.1M | |
![[SND]](/icons/sound2.gif) | yt1s.com - boboiboy movie 2 hello tada tahmu hali ini ulang tahun than ccelamat ulang tahun yaa babay emoji.mp3 | 2022-08-01 04:34 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - anya waku waku song .mp3 | 2022-07-01 13:34 | 1.1M | |
![[SND]](/icons/sound2.gif) | yt1s.com - akon lonely slowed reverb.mp3 | 2022-07-08 09:47 | 4.1M | |
![[SND]](/icons/sound2.gif) | yt1s.com - VIKRAM Title Track Lyric Kamal Haasan Vijay Sethupathi Lokesh Kanagaraj Anirudh.mp3 | 2022-07-10 13:54 | 3.3M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Underwear I swear by Minions OST from Despicable me 02 HD with lyrics.mp3 | 2022-07-12 04:05 | 1.5M | |
![[SND]](/icons/sound2.gif) | yt1s.com - System Of A Down BYOB Official HD Video.mp3 | 2022-07-10 10:34 | 4.0M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Snatcher Rap Lyrics by Cookie.mp3 | 2022-07-06 08:10 | 2.6M | |
![[SND]](/icons/sound2.gif) | yt1s.com - SOUND JJ ZERSOFBOY.mp3 | 2022-08-05 16:21 | 168K | |
![[SND]](/icons/sound2.gif) | yt1s.com - Rollinin In The Rearview Headbone ft Jabu Cars Delinquent Road Hazards Song HD 2 1 Audio.mp3 | 2022-08-07 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Rick Astley Never Gonna Give You Up Official Music Video.mp3 | 2022-07-28 06:45 | 3.2M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Play Dat tick Melanie Martinez Play Date TikTok Slow Version X Rich Brian Dat tick MASHUP.mp3 | 2022-07-05 08:48 | 3.0M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Petre Stefan NANE Darbuka Official Video.mp3 | 2022-07-01 13:47 | 2.2M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Persona 5 Among Us Remix FULL VERSION.mp3 | 2022-07-15 19:43 | 2.9M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Patricio en su caballito de mar con Fly me to The moon pero la canta ozuna.mp3 | 2022-07-17 13:55 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Pala Peler.mp3 | 2022-07-16 05:14 | 3.4M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Nightcore Materyal.mp3 | 2022-07-27 03:34 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Ngaca dulu Woy ANJAR OXS FEAT RYAN RAP.mp3 | 2022-08-09 00:14 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Monte Carlo Boyz.mp3 | 2022-08-05 22:21 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Me corro aaaaaaaaaahg.mp3 | 2022-07-15 19:36 | 32K | |
![[SND]](/icons/sound2.gif) | yt1s.com - Lagu Jorok agus Baon Cikadap3gp.mp3 | 2022-07-30 18:59 | 3.4M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Keane Somewhere Only We Know Lyrics.mp3 | 2022-07-01 14:12 | 3.5M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Kanlungan Panapanahon Ang Pagkakataon Lyrics Noel Cabangon.mp3 | 2022-07-14 17:53 | 4.2M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Jugando Free Fire.mp3 | 2022-07-20 18:29 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Hari ini hari ulang tahunmu Mentahan LirikAesthetic .mp3 | 2022-08-11 00:55 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Glass Animals Heat Waves Lyrics.mp3 | 2022-07-01 13:48 | 3.6M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Free Fire La Ñapa Kevin Vin MC MRK Video Oficial.mp3 | 2022-07-20 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Fly Me To The Moon pero lo canta Ozuna.mp3 | 2022-07-17 14:02 | 6.8M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Egzod Maestro Chives Royalty Lyrics ft Neoni.mp3 | 2022-07-07 07:08 | 3.4M | |
![[SND]](/icons/sound2.gif) | yt1s.com - DJ FULL OLD PAIMUNA X AKU JATUH CINTA DJ SOPAN .mp3 | 2022-07-08 08:33 | 2.9M | |
![[SND]](/icons/sound2.gif) | yt1s.com - DJ BENTO REMIX 2022 VIRAL TERBARU FULL BASS.mp3 | 2022-07-20 13:44 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Chikh Mourad Alik Hna Ki Dayrin Remix.mp3 | 2022-08-08 21:39 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Catching Flies Diamonds Official Music Video.mp3 | 2022-07-25 00:42 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Breaking Bad Main Title Theme Extended.mp3 | 2022-08-09 08:03 | 0 | |
![[VID]](/icons/movie.gif) | yt1s.com - Bankrol Hayden Cabo Official Music Video.mp4 | 2022-07-02 11:06 | 60M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Assobio do whatsapp zap zap toque whatsapp whistle donwload .mp3 | 2022-07-07 04:17 | 104K | |
![[SND]](/icons/sound2.gif) | yt1s.com - Anirudh Ravichander Anthony Daasan Dippam Dappam From Kaathuvaakula Rendu Kaadhal.mp3 | 2022-07-22 15:50 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - Animal Crossing Relaxing Music with Soft Rain .mp3 | 2022-06-27 16:16 | 56M | |
![[SND]](/icons/sound2.gif) | yt1s.com - Andrew Pinching I See The Future.mp3 | 2022-07-05 20:39 | 1.8M | |
![[VID]](/icons/movie.gif) | yt1s.com - Alan Walker Faded Lyrics_v240P.mp4 | 2022-07-30 15:35 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - ATACAD que SOIS ESPAÑOLES.mp3 | 2022-07-15 19:41 | 257K | |
![[SND]](/icons/sound2.gif) | yt1s.com - ALBUM LFERDA Cagoulé Official Audio.mp3 | 2022-07-24 07:21 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - 10 MINUTINHOS DE BEAT BOLHA AFOGANDO TUDO DJ JUNINHO SJM 2020.mp3 | 2022-08-05 01:32 | 0 | |
![[VID]](/icons/movie.gif) | yt1s.com - غير وحدي مدمر نبغي نسكر عليها نهدر.mp4 | 2022-08-12 17:28 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s.com - حلمي تحطم واختفى اغنية مؤثرة وجميلة AMV Ahlam song IZZ ft Emy Hetari لا تفوتك.mp3 | 2022-08-10 23:13 | 0 | |
![[SND]](/icons/sound2.gif) | yt1s (mp3cut.net).mp3 | 2022-07-14 13:16 | 232K | |
![[SND]](/icons/sound2.gif) | yt.mp3 | 2022-08-12 18:35 | 0 | |
![[SND]](/icons/sound2.gif) | yss.mp3 | 2022-08-09 06:51 | 0 | |
![[SND]](/icons/sound2.gif) | ysp1.mp3 | 2022-07-22 12:51 | 0 | |
![[SND]](/icons/sound2.gif) | ysp.mp3 | 2022-07-22 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | yrnm.mp3 | 2022-08-06 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | yp.mp3 | 2022-07-23 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | yoyo.mp3 | 2022-08-06 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | yovoy.mp3 | 2022-07-29 14:21 | 520K | |
![[SND]](/icons/sound2.gif) | youu.mp3 | 2022-08-09 16:25 | 0 | |
![[SND]](/icons/sound2.gif) | youtubeGcopytight.mp3 | 2022-07-10 14:47 | 8.4M | |
![[SND]](/icons/sound2.gif) | yourtears.mp3 | 2022-06-28 07:00 | 3.5M | |
![[SND]](/icons/sound2.gif) | yourslang.mp3 | 2022-07-26 04:08 | 0 | |
![[SND]](/icons/sound2.gif) | yourperfect.mp3 | 2022-07-25 16:11 | 0 | |
![[SND]](/icons/sound2.gif) | yourmanz.mp3 | 2022-07-31 11:01 | 528K | |
![[SND]](/icons/sound2.gif) | yourman.mp3 | 2022-07-13 10:07 | 6.5M | |
![[SND]](/icons/sound2.gif) | youreyes.mp3 | 2022-07-27 14:49 | 0 | |
![[SND]](/icons/sound2.gif) | yourdog.mp3 | 2022-07-18 06:42 | 0 | |
![[SND]](/icons/sound2.gif) | your.mp3 | 2022-06-27 17:14 | 11M | |
![[SND]](/icons/sound2.gif) | young loov-Itachi Versace -kissvk.com.mp3 | 2022-07-01 12:40 | 3.7M | |
![[SND]](/icons/sound2.gif) | younglex2.mp3 | 2022-07-10 11:06 | 4.5M | |
![[SND]](/icons/sound2.gif) | young lex2.mp3 | 2022-07-10 10:42 | 4.5M | |
![[SND]](/icons/sound2.gif) | younglex1.mp3 | 2022-07-10 11:06 | 4.5M | |
![[SND]](/icons/sound2.gif) | young Lex1.mp3 | 2022-07-10 10:42 | 4.5M | |
![[SND]](/icons/sound2.gif) | young.mp3 | 2022-07-28 05:40 | 1.9M | |
![[SND]](/icons/sound2.gif) | young-sheldon-family-intro.mp3 | 2022-07-06 01:54 | 294K | |
![[SND]](/icons/sound2.gif) | you have slain the enemy.mp3 | 2022-07-24 07:10 | 0 | |
![[SND]](/icons/sound2.gif) | youfeelpowerful.mp3 | 2022-08-05 10:43 | 0 | |
![[SND]](/icons/sound2.gif) | youexist.mp3 | 2022-07-19 01:05 | 77K | |
![[SND]](/icons/sound2.gif) | youbrokemefirst.mp3 | 2022-08-06 07:48 | 0 | |
![[SND]](/icons/sound2.gif) | youbrokeme.mp3 | 2022-08-06 07:44 | 0 | |
![[SND]](/icons/sound2.gif) | youandme.mp3 | 2022-07-22 12:01 | 0 | |
![[SND]](/icons/sound2.gif) | youandi.mp3 | 2022-08-07 14:56 | 0 | |
![[SND]](/icons/sound2.gif) | you_win_1.mp3 | 2022-08-11 05:52 | 0 | |
![[SND]](/icons/sound2.gif) | you_were_poked.mp3 | 2022-07-22 07:11 | 0 | |
![[SND]](/icons/sound2.gif) | you.mp3 | 2022-07-10 10:37 | 2.2M | |
![[SND]](/icons/sound2.gif) | you-are-an-idiot.mp3 | 2022-06-28 02:16 | 80K | |
![[SND]](/icons/sound2.gif) | you-are-always-with-me-piano-version-15841.mp3 | 2022-07-26 17:02 | 7.4M | |
![[SND]](/icons/sound2.gif) | yo soy caro.mp3 | 2022-07-18 13:15 | 0 | |
![[SND]](/icons/sound2.gif) | yorushika - bakudanma.mp3 | 2022-07-13 17:58 | 6.0M | |
![[SND]](/icons/sound2.gif) | yorushika - bakudanma.m4a | 2022-07-13 17:44 | 5.1M | |
![[SND]](/icons/sound2.gif) | yoreyes1.mp3 | 2022-08-12 19:54 | 0 | |
![[SND]](/icons/sound2.gif) | yooman.mp3 | 2022-07-12 16:53 | 2.5M | |
![[SND]](/icons/sound2.gif) | yoo.mp3 | 2022-07-29 16:45 | 0 | |
![[SND]](/icons/sound2.gif) | yon1.mp3 | 2022-07-09 06:22 | 15M | |
![[SND]](/icons/sound2.gif) | yon.mp3 | 2022-08-12 14:57 | 0 | |
![[SND]](/icons/sound2.gif) | yoluma.mp3 | 2022-07-16 12:04 | 0 | |
![[SND]](/icons/sound2.gif) | yoksun.mp3 | 2022-08-07 22:58 | 0 | |
![[SND]](/icons/sound2.gif) | yoi.mp3 | 2022-07-16 12:20 | 2.5M | |
![[SND]](/icons/sound2.gif) | yohoho1.mp3 | 2022-07-18 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | yogya.mp3 | 2022-07-29 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | yogi1.mp3 | 2022-08-02 08:39 | 0 | |
![[SND]](/icons/sound2.gif) | yogaxerik23.mp3 | 2022-07-01 02:51 | 2.9M | |
![[SND]](/icons/sound2.gif) | yoga.mp3 | 2022-07-01 02:32 | 2.9M | |
![[SND]](/icons/sound2.gif) | yoasobi.mp3 | 2022-08-05 11:47 | 0 | |
![[SND]](/icons/sound2.gif) | yoasobi-tabun-shorts-128-ytshorts.savetube.me.mp3 | 2022-07-26 13:26 | 371K | |
![[SND]](/icons/sound2.gif) | yo_maps_location_official_audio_mp3_62395.mp3 | 2022-08-02 21:20 | 0 | |
![[SND]](/icons/sound2.gif) | yo.mp3 | 2022-07-31 01:02 | 0 | |
![[SND]](/icons/sound2.gif) | yo-voy_(mp3IQ.net)(mailbox).mp3 | 2022-08-07 17:36 | 0 | |
![[SND]](/icons/sound2.gif) | yo-voy.mp3 | 2022-08-07 17:35 | 0 | |
![[SND]](/icons/sound2.gif) | yo-voy-feat-daddy-yankee.mp3 | 2022-06-30 09:20 | 8.5M | |
![[SND]](/icons/sound2.gif) | ynt.mp3 | 2022-07-29 14:20 | 0 | |
![[SND]](/icons/sound2.gif) | yname.mp3 | 2022-07-16 07:40 | 2.7M | |
![[SND]](/icons/sound2.gif) | yn3.mp3 | 2022-07-11 23:33 | 4.0M | |
![[SND]](/icons/sound2.gif) | yn2.mp3 | 2022-07-11 11:04 | 3.5M | |
![[SND]](/icons/sound2.gif) | yn1.mp3 | 2022-07-11 10:46 | 5.3M | |
![[SND]](/icons/sound2.gif) | ylia.mp3 | 2022-08-05 14:16 | 3.9M | |
![[SND]](/icons/sound2.gif) | ylang.mp3 | 2022-08-03 15:46 | 0 | |
![[SND]](/icons/sound2.gif) | yl21.mp3 | 2022-07-30 04:00 | 0 | |
![[SND]](/icons/sound2.gif) | yl17.mp3 | 2022-07-30 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | yl16.mp3 | 2022-08-06 07:42 | 0 | |
![[SND]](/icons/sound2.gif) | yl15.mp3 | 2022-07-30 11:50 | 0 | |
![[SND]](/icons/sound2.gif) | yl14.mp3 | 2022-07-30 04:08 | 4.3M | |
![[SND]](/icons/sound2.gif) | yl13.mp3 | 2022-07-02 03:09 | 4.6M | |
![[SND]](/icons/sound2.gif) | yl12.mp3 | 2022-06-30 06:18 | 2.0M | |
![[SND]](/icons/sound2.gif) | yl12 .mp3 | 2022-06-28 14:47 | 2.0M | |
![[SND]](/icons/sound2.gif) | yl11.mp3 | 2022-06-28 14:48 | 3.6M | |
![[SND]](/icons/sound2.gif) | yl10.mp3 | 2022-06-28 14:48 | 2.4M | |
![[SND]](/icons/sound2.gif) | yl9.mp3 | 2022-06-28 14:47 | 2.3M | |
![[SND]](/icons/sound2.gif) | yl8.mp3 | 2022-06-28 14:47 | 2.0M | |
![[SND]](/icons/sound2.gif) | yl7.mp3 | 2022-06-28 14:47 | 1.9M | |
![[SND]](/icons/sound2.gif) | yl6.mp3 | 2022-06-28 14:47 | 1.8M | |
![[SND]](/icons/sound2.gif) | yl5.mp3 | 2022-06-28 14:48 | 3.1M | |
![[SND]](/icons/sound2.gif) | yl4.mp3 | 2022-06-28 14:48 | 2.7M | |
![[SND]](/icons/sound2.gif) | yl3.mp3 | 2022-06-28 14:48 | 1.4M | |
![[SND]](/icons/sound2.gif) | yl2.mp3 | 2022-06-28 14:48 | 3.7M | |
![[SND]](/icons/sound2.gif) | yl1.mp3 | 2022-06-28 14:47 | 3.0M | |
![[SND]](/icons/sound2.gif) | yl.mp3 | 2022-07-30 11:53 | 0 | |
![[SND]](/icons/sound2.gif) | ykyk.mp3 | 2022-06-30 07:15 | 3.5M | |
![[SND]](/icons/sound2.gif) | ykulbaintro.mp3 | 2022-08-02 01:25 | 0 | |
![[SND]](/icons/sound2.gif) | ykulba.mp3 | 2022-08-02 01:16 | 0 | |
![[SND]](/icons/sound2.gif) | yjfhf.mp3 | 2022-07-25 16:19 | 0 | |
![[SND]](/icons/sound2.gif) | yiw.mp3 | 2022-07-30 05:16 | 4.1M | |
![[SND]](/icons/sound2.gif) | yigidimaslanim.mp3 | 2022-07-30 14:55 | 0 | |
![[SND]](/icons/sound2.gif) | yhoi.mp3 | 2022-07-02 03:40 | 5.2M | |
![[SND]](/icons/sound2.gif) | ygy10.mp3 | 2022-06-28 05:19 | 3.6M | |
![[VID]](/icons/movie.gif) | ygy.mp4 | 2022-06-30 14:24 | 53M | |
![[SND]](/icons/sound2.gif) | yguhvi.mp3 | 2022-07-24 16:23 | 1.9M | |
![[SND]](/icons/sound2.gif) | ygkedua.mp3 | 2022-08-11 03:05 | 0 | |
![[SND]](/icons/sound2.gif) | yg-go-loko-ft-tyga-jon-z.mp3 | 2022-07-01 13:08 | 9.2M | |
![[SND]](/icons/sound2.gif) | yeyo.mp3 | 2022-08-06 20:47 | 0 | |
![[SND]](/icons/sound2.gif) | yey.mp3 | 2022-08-02 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | yeusacyeu.mp3 | 2022-07-30 14:37 | 0 | |
![[SND]](/icons/sound2.gif) | yeu:(.mp3 | 2022-07-18 11:38 | 1.9M | |
![[SND]](/icons/sound2.gif) | yeu.mp3 | 2022-08-09 17:14 | 0 | |
![[SND]](/icons/sound2.gif) | yesxd.mp3 | 2022-07-04 10:25 | 5.9M | |
![[SND]](/icons/sound2.gif) | yesus.mp3 | 2022-07-16 21:21 | 4.6M | |
![[SND]](/icons/sound2.gif) | yesus.m4a | 2022-07-04 03:56 | 4.7M | |
![[SND]](/icons/sound2.gif) | yes.mp3 | 2022-07-06 01:35 | 507K | |
![[SND]](/icons/sound2.gif) | yerle-yeksan-drill-remix.mp3 | 2022-08-10 20:01 | 0 | |
![[SND]](/icons/sound2.gif) | yeniden-offical-video.mp3 | 2022-06-28 18:32 | 3.3M | |
![[SND]](/icons/sound2.gif) | yeni_akubukanjodohnya_bop.mp3 | 2022-07-05 19:12 | 6.1M | |
![[SND]](/icons/sound2.gif) | yeni.mp3 | 2022-07-24 07:22 | 0 | |
![[SND]](/icons/sound2.gif) | yelow.mp3 | 2022-08-01 09:24 | 2.4M | |
![[SND]](/icons/sound2.gif) | yellowen.mp3 | 2022-06-30 13:49 | 3.2M | |
![[SND]](/icons/sound2.gif) | yelloweenn.mp3 | 2022-07-20 12:13 | 0 | |
![[SND]](/icons/sound2.gif) | yelloween.mp3 | 2022-07-27 09:18 | 0 | |
![[SND]](/icons/sound2.gif) | yellow_pixie_-_Red_Dawn_73379160.mp3 | 2022-07-17 11:55 | 0 | |
![[SND]](/icons/sound2.gif) | yellow.mp3 | 2022-08-10 04:52 | 3.2M | |
![[SND]](/icons/sound2.gif) | yedek.mp3 | 2022-08-02 05:19 | 0 | |
![[SND]](/icons/sound2.gif) | yed.mp3 | 2022-07-19 02:10 | 23M | |
![[SND]](/icons/sound2.gif) | yebimenya.mp3 | 2022-07-11 12:09 | 5.9M | |
![[SND]](/icons/sound2.gif) | yeatmoney.mp3 | 2022-06-29 05:34 | 2.5M | |
![[SND]](/icons/sound2.gif) | yeatfz7.mp3 | 2022-07-07 02:05 | 2.5M | |
![[SND]](/icons/sound2.gif) | yeatfz6.mp3 | 2022-07-07 02:05 | 1.9M | |
![[SND]](/icons/sound2.gif) | yeatfz5.mp3 | 2022-07-07 02:05 | 2.4M | |
![[SND]](/icons/sound2.gif) | yeatfz4.mp3 | 2022-07-07 02:04 | 2.6M | |
![[SND]](/icons/sound2.gif) | yeatfz3.mp3 | 2022-07-07 02:04 | 2.1M | |
![[SND]](/icons/sound2.gif) | yeatfz2.mp3 | 2022-07-07 02:04 | 2.4M | |
![[SND]](/icons/sound2.gif) | yeatfz1.mp3 | 2022-07-07 02:03 | 2.5M | |
![[SND]](/icons/sound2.gif) | yeatfz.mp3 | 2022-07-07 02:03 | 1.6M | |
![[SND]](/icons/sound2.gif) | yeat.mp3 | 2022-06-28 12:39 | 2.4M | |
![[SND]](/icons/sound2.gif) | yeat - double (based1 2000s rnb).mp3 | 2022-06-29 17:37 | 2.4M | |
![[SND]](/icons/sound2.gif) | yeat - 1st hunnid.mp3 | 2022-06-28 20:07 | 2.8M | |
![[SND]](/icons/sound2.gif) | yearly.mp3 | 2022-07-08 04:07 | 19M | |
![[SND]](/icons/sound2.gif) | yeahhhhhhh.mp3 | 2022-06-28 10:36 | 2.6M | |
![[SND]](/icons/sound2.gif) | yeah.mp3 | 2022-07-19 07:45 | 5.4M | |
![[SND]](/icons/sound2.gif) | yazin.mp3 | 2022-07-25 17:11 | 18M | |
![[SND]](/icons/sound2.gif) | yaya.mp3 | 2022-07-28 08:48 | 0 | |
![[SND]](/icons/sound2.gif) | yaukoshi-lxst-cxntury-coj-ya-vyklyuchayu-televizor-remiks.mp3 | 2022-07-30 10:02 | 2.6M | |
![[SND]](/icons/sound2.gif) | yatz33.mp3 | 2022-06-28 01:24 | 5.2M | |
![[SND]](/icons/sound2.gif) | yatz32.mp3 | 2022-06-28 01:41 | 3.6M | |
![[SND]](/icons/sound2.gif) | yatz31.mp3 | 2022-06-28 01:40 | 4.4M | |
![[SND]](/icons/sound2.gif) | yatz30.mp3 | 2022-07-20 12:22 | 4.5M | |
![[SND]](/icons/sound2.gif) | yatz29.mp3 | 2022-06-28 01:40 | 5.4M | |
![[SND]](/icons/sound2.gif) | yatz28.mp3 | 2022-06-28 01:40 | 5.1M | |
![[SND]](/icons/sound2.gif) | yatz27.mp3 | 2022-06-28 01:39 | 3.3M | |
![[SND]](/icons/sound2.gif) | yatz26.mp3 | 2022-06-28 01:39 | 2.9M | |
![[SND]](/icons/sound2.gif) | yatz25.mp3 | 2022-07-14 08:54 | 2.5M | |
![[SND]](/icons/sound2.gif) | yatz24.mp3 | 2022-07-15 06:38 | 3.3M | |
![[SND]](/icons/sound2.gif) | yatz23.mp3 | 2022-06-28 01:39 | 2.3M | |
![[SND]](/icons/sound2.gif) | yatz22.mp3 | 2022-06-28 01:39 | 2.6M | |
![[SND]](/icons/sound2.gif) | yatz21.mp3 | 2022-06-28 01:39 | 6.0M | |
![[SND]](/icons/sound2.gif) | yatz20.mp3 | 2022-06-28 01:38 | 4.2M | |
![[SND]](/icons/sound2.gif) | yatz19.mp3 | 2022-06-28 01:38 | 3.2M | |
![[SND]](/icons/sound2.gif) | yatz18.mp3 | 2022-06-28 01:38 | 3.4M | |
![[SND]](/icons/sound2.gif) | yatz17.mp3 | 2022-06-28 01:38 | 4.5M | |
![[SND]](/icons/sound2.gif) | yatz16.mp3 | 2022-06-28 01:38 | 3.8M | |
![[SND]](/icons/sound2.gif) | yatz15.mp3 | 2022-06-28 01:38 | 3.5M | |
![[SND]](/icons/sound2.gif) | yatz14.mp3 | 2022-06-28 01:38 | 3.8M | |
![[SND]](/icons/sound2.gif) | yatz13.mp3 | 2022-06-28 01:38 | 3.5M | |
![[SND]](/icons/sound2.gif) | yatz12.mp3 | 2022-06-28 01:37 | 3.7M | |
![[SND]](/icons/sound2.gif) | yatz11.mp3 | 2022-06-28 01:37 | 5.3M | |
![[SND]](/icons/sound2.gif) | yatz10.mp3 | 2022-06-28 01:37 | 2.8M | |
![[SND]](/icons/sound2.gif) | yatz9.mp3 | 2022-06-28 01:37 | 2.7M | |
![[SND]](/icons/sound2.gif) | yatz8.mp3 | 2022-06-28 01:37 | 1.6M | |
![[SND]](/icons/sound2.gif) | yatz7.mp3 | 2022-06-28 01:37 | 2.4M | |
![[SND]](/icons/sound2.gif) | yatz6.mp3 | 2022-06-28 01:36 | 2.4M | |
![[SND]](/icons/sound2.gif) | yatz5.mp3 | 2022-06-28 01:36 | 2.4M | |
![[SND]](/icons/sound2.gif) | yatz4.mp3 | 2022-06-28 01:36 | 2.8M | |
![[SND]](/icons/sound2.gif) | yatz3.mp3 | 2022-08-11 18:39 | 3.2M | |
![[SND]](/icons/sound2.gif) | yatz2.mp3 | 2022-08-11 19:03 | 3.6M | |
![[SND]](/icons/sound2.gif) | yatz1.mp3 | 2022-06-28 01:35 | 3.6M | |
![[SND]](/icons/sound2.gif) | yatz.mp3 | 2022-06-28 01:35 | 6.2M | |
![[SND]](/icons/sound2.gif) | yatta.mp3 | 2022-07-28 03:44 | 0 | |
![[SND]](/icons/sound2.gif) | yatr1.mp3 | 2022-07-12 16:45 | 3.2M | |
![[SND]](/icons/sound2.gif) | yarichin.mp3 | 2022-07-09 05:22 | 3.1M | |
![[SND]](/icons/sound2.gif) | yapma nolursun.m4a | 2022-06-30 18:47 | 652K | |
![[SND]](/icons/sound2.gif) | yapehal.mp3 | 2022-06-29 04:43 | 5.1M | |
![[SND]](/icons/sound2.gif) | yanzganteng.mp3 | 2022-08-07 06:25 | 0 | |
![[SND]](/icons/sound2.gif) | yanto02.mp3 | 2022-08-10 18:40 | 0 | |
![[SND]](/icons/sound2.gif) | yanto01.mp3 | 2022-08-10 18:39 | 0 | |
![[SND]](/icons/sound2.gif) | yanto.mp3 | 2022-08-08 16:41 | 3.0M | |
![[SND]](/icons/sound2.gif) | yano.mp3 | 2022-07-12 14:32 | 4.0M | |
![[SND]](/icons/sound2.gif) | yannn.mp3 | 2022-07-21 08:46 | 5.3M | |
![[SND]](/icons/sound2.gif) | yann5.mp3 | 2022-06-29 19:01 | 6.1M | |
![[SND]](/icons/sound2.gif) | yann4.mp3 | 2022-06-29 19:01 | 5.1M | |
![[SND]](/icons/sound2.gif) | yann3.mp3 | 2022-06-28 05:11 | 6.6M | |
![[SND]](/icons/sound2.gif) | yann2.mp3 | 2022-06-28 05:12 | 4.1M | |
![[SND]](/icons/sound2.gif) | yann.mp3 | 2022-07-15 13:49 | 2.1M | |
![[SND]](/icons/sound2.gif) | yann-tiersen-j-y-suis-jamais-alle-zvbxr-remix.mp3 | 2022-07-06 18:06 | 6.9M | |
![[SND]](/icons/sound2.gif) | yankee_beats_-_MNOGOZNAAL_-_Kolkhoznik_Slow_version_70918642.mp3 | 2022-06-27 21:18 | 7.6M | |
![[SND]](/icons/sound2.gif) | yank.mp3 | 2022-06-27 12:39 | 7.3M | |
![[SND]](/icons/sound2.gif) | yangpentinghappy .mp3 | 2022-07-08 19:20 | 4.0M | |
![[SND]](/icons/sound2.gif) | yang.mp3 | 2022-07-19 03:54 | 0 | |
![[SND]](/icons/sound2.gif) | yan29.mp3 | 2022-08-10 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | yan28.mp3 | 2022-08-10 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | yan27.mp3 | 2022-08-10 12:52 | 0 | |
![[SND]](/icons/sound2.gif) | yan26.mp3 | 2022-08-10 12:52 | 0 | |
![[SND]](/icons/sound2.gif) | yan25.mp3 | 2022-08-10 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | yan24.mp3 | 2022-08-10 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | yan23.mp3 | 2022-08-10 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | yan22.mp3 | 2022-08-10 11:56 | 7.9M | |
![[SND]](/icons/sound2.gif) | yan21.mp3 | 2022-08-10 11:56 | 5.5M | |
![[SND]](/icons/sound2.gif) | yan20.mp3 | 2022-08-10 11:56 | 5.4M | |
![[SND]](/icons/sound2.gif) | yan19.mp3 | 2022-08-10 11:55 | 4.8M | |
![[SND]](/icons/sound2.gif) | yan18.mp3 | 2022-08-10 11:55 | 2.2M | |
![[SND]](/icons/sound2.gif) | yan17.mp3 | 2022-08-10 11:55 | 2.4M | |
![[SND]](/icons/sound2.gif) | yan16.mp3 | 2022-08-10 11:55 | 3.6M | |
![[SND]](/icons/sound2.gif) | yan15.mp3 | 2022-08-10 11:55 | 5.3M | |
![[SND]](/icons/sound2.gif) | yan14.mp3 | 2022-08-10 11:55 | 3.4M | |
![[SND]](/icons/sound2.gif) | yan13.mp3 | 2022-08-10 11:56 | 7.1M | |
![[SND]](/icons/sound2.gif) | yan12.mp3 | 2022-08-10 11:55 | 5.8M | |
![[SND]](/icons/sound2.gif) | yan11.mp3 | 2022-08-10 11:55 | 2.8M | |
![[SND]](/icons/sound2.gif) | yan10.mp3 | 2022-08-10 11:55 | 3.8M | |
![[SND]](/icons/sound2.gif) | yan9.mp3 | 2022-08-10 11:58 | 5.4M | |
![[SND]](/icons/sound2.gif) | yan8.mp3 | 2022-08-10 11:57 | 3.7M | |
![[SND]](/icons/sound2.gif) | yan7.mp3 | 2022-08-10 11:57 | 4.2M | |
![[SND]](/icons/sound2.gif) | yan6.mp3 | 2022-08-10 11:58 | 8.0M | |
![[SND]](/icons/sound2.gif) | yan5.mp3 | 2022-08-10 11:57 | 1.9M | |
![[SND]](/icons/sound2.gif) | yan4.mp3 | 2022-08-10 11:57 | 4.8M | |
![[SND]](/icons/sound2.gif) | yan3.mp3 | 2022-08-10 11:57 | 5.3M | |
![[SND]](/icons/sound2.gif) | yan2.mp3 | 2022-08-10 11:56 | 4.9M | |
![[SND]](/icons/sound2.gif) | yan1.mp3 | 2022-08-10 11:54 | 3.6M | |
![[SND]](/icons/sound2.gif) | yan01.mp3 | 2022-08-10 11:55 | 6.0M | |
![[SND]](/icons/sound2.gif) | yan000.mp3 | 2022-08-10 11:54 | 3.2M | |
![[SND]](/icons/sound2.gif) | yan00.mp3 | 2022-08-10 11:54 | 3.2M | |
![[SND]](/icons/sound2.gif) | yan0.mp3 | 2022-08-10 11:54 | 4.6M | |
![[SND]](/icons/sound2.gif) | yan.mp3 | 2022-07-26 18:48 | 0 | |
![[SND]](/icons/sound2.gif) | yametekudasaicat.mp3 | 2022-07-06 22:02 | 32K | |
![[SND]](/icons/sound2.gif) | yameteh2.mp3 | 2022-07-01 16:34 | 189K | |
![[SND]](/icons/sound2.gif) | yameteh.mp3 | 2022-07-13 06:28 | 232K | |
![[SND]](/icons/sound2.gif) | yamete.mp3 | 2022-07-25 23:38 | 0 | |
![[SND]](/icons/sound2.gif) | yamet.mp3 | 2022-07-24 10:45 | 0 | |
![[SND]](/icons/sound2.gif) | yamate.mp3 | 2022-07-08 21:46 | 70M | |
![[SND]](/icons/sound2.gif) | yaman.mp3 | 2022-07-17 09:54 | 0 | |
![[SND]](/icons/sound2.gif) | yama.mp3 | 2022-07-03 23:51 | 4.8M | |
![[SND]](/icons/sound2.gif) | yam2.mp3 | 2022-08-08 09:38 | 0 | |
![[SND]](/icons/sound2.gif) | yam1.mp3 | 2022-06-29 11:22 | 2.9M | |
![[SND]](/icons/sound2.gif) | yakuza.mp3 | 2022-06-28 14:26 | 2.5M | |
![[SND]](/icons/sound2.gif) | yakapsadilim.mp3 | 2022-08-03 00:03 | 3.1M | |
![[SND]](/icons/sound2.gif) | yakap.mp3 | 2022-08-07 07:27 | 3.1M | |
![[SND]](/icons/sound2.gif) | yahanana.mp3 | 2022-06-29 05:02 | 11M | |
![[SND]](/icons/sound2.gif) | yahah.mp3 | 2022-08-12 09:55 | 0 | |
![[SND]](/icons/sound2.gif) | yah.mp3 | 2022-07-06 15:24 | 4.8M | |
![[SND]](/icons/sound2.gif) | yagitu.mp3 | 2022-08-04 03:14 | 0 | |
![[SND]](/icons/sound2.gif) | yadgarxalidia2.mp3 | 2022-08-03 00:15 | 0 | |
![[SND]](/icons/sound2.gif) | yad_dobra_-_dzhaman_(feat._marcus_tenshi)_muzati.net.mp3 | 2022-08-08 18:43 | 0 | |
![[SND]](/icons/sound2.gif) | yacumakamu.mp3 | 2022-07-03 16:41 | 6.3M | |
![[SND]](/icons/sound2.gif) | yaao.mp3 | 2022-07-09 13:03 | 5.4M | |
![[SND]](/icons/sound2.gif) | yaadmin.mp3 | 2022-08-04 11:05 | 0 | |
![[SND]](/icons/sound2.gif) | yaa.mp3 | 2022-07-02 04:07 | 4.2M | |
![[SND]](/icons/sound2.gif) | ya_ronyayu_zapad_-_Fejs_(iPleer.com).mp3 | 2022-07-18 15:39 | 0 | |
![[SND]](/icons/sound2.gif) | ya_-_YA_Aim_VKH_i_jetomu_ya_rad_63254429.mp3 | 2022-08-04 10:53 | 0 | |
![[SND]](/icons/sound2.gif) | ya69.mp3 | 2022-08-07 15:36 | 0 | |
![[SND]](/icons/sound2.gif) | ya1.mp3 | 2022-06-30 06:48 | 2.3M | |
![[SND]](/icons/sound2.gif) | ya.mp3 | 2022-08-12 22:20 | 3.0M | |
![[SND]](/icons/sound2.gif) | y682 (online-audio-converter.com).mp3 | 2022-06-28 03:38 | 26K | |
![[SND]](/icons/sound2.gif) | y5.mp3 | 2022-08-09 12:50 | 0 | |
![[SND]](/icons/sound2.gif) | y4nn.mp3 | 2022-06-28 12:10 | 3.6M | |
![[SND]](/icons/sound2.gif) | y4.mp3 | 2022-08-09 12:50 | 0 | |
![[SND]](/icons/sound2.gif) | y3.mp3 | 2022-08-09 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - prank suara desah (128 kbps).mp3 | 2022-07-08 19:28 | 172K | |
![[SND]](/icons/sound2.gif) | y2meta.com - [ZAIAE] Kamen Rider 555 OST - ISSA - JustiFaiz (RUS_ENG Lyrics) (320 kbps).mp3 | 2022-07-19 08:48 | 276K | |
![[SND]](/icons/sound2.gif) | y2meta.com - Wish You Were Here - Neck Deep (Lirik Lagu Terjemahan) (128 kbps).mp3 | 2022-07-08 04:04 | 2.9M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Wasted - J emm Dahon, KL, Kushin, Ft. Aeron J, Guthrie Nikolao (Lyrics) (320 kbps).mp3 | 2022-07-23 19:32 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - VIET DEEP 2022 - HOUSE LAK CHILL ĐI BẠN ƠI, VIỆT MIX 2022 - SET NHẠC CHILL (128 kbps).mp3 | 2022-08-10 08:02 | 44K | |
![[SND]](/icons/sound2.gif) | y2meta.com - Ta Say - APJ x Helia x Masew (128 kbps).mp3 | 2022-08-08 02:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - THE NIGHT REMIX - TVT Remix _ Nhạc Tik Tok Gây Nghiện Hay Nhất 2022 × JR Remix (128 kbps).mp3 | 2022-06-29 13:27 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Stephen Sanchez - Until I Found You (Lyrics) (320 kbps).mp3 | 2022-07-30 08:30 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Rifalietsky - Im not the clown (Official audio) (320 kbps).mp3 | 2022-08-05 08:10 | 0 | |
![[VID]](/icons/movie.gif) | y2meta.com-QuestionMark - คนนี้ครับ Ft. Z9 , 1K , T.THRILLER , PLATHONG , ATLAS-(480p).mp4 | 2022-07-21 14:22 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Parookaville - Timmy Trumpet Layla Remix Version [BEST AUDIO] - Highlights (64 kbps).mp3 | 2022-08-03 04:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - O O Jaane Jaana Full Song with Lyrics _ Pyar Kiya Toh Darna Kya _ Salman Khan, Kajol (128 kbps).mp3 | 2022-08-02 08:22 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Nonstop 2022 - I Don't Know Her Name Remix - Nhạc Hot Trend Xu Hướng Tik Tok 2022 (320 kbps).mp3 | 2022-08-11 08:14 | 1.1M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Last Child - DUKA (Official Lyric Video) (128 kbps).mp3 | 2022-08-09 13:05 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Lagu Barat Terbaru__Ghost-Justin Bieber {Lirik Lagu} (320 kbps).mp3 | 2022-07-27 08:43 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Kate Bush - Running Up That Hill (Stranger Things Version) (320 kbps).mp3 | 2022-07-10 18:18 | 12M | |
![[SND]](/icons/sound2.gif) | y2meta.com - KXNVRA - BLOWIN' (128 kbps).mp3 | 2022-08-07 22:04 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - JUL - MON BIJOU __ CLIP OFFICIEL __ 2016 (128 kbps).mp3 | 2022-07-03 03:16 | 3.0M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Happy Birthday to You - piano instrumental with lyrics (320 kbps).mp3 | 2022-07-31 05:55 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Friday Night Funkin_ Neo [Bopeebo] (128 kbps).mp3 | 2022-07-24 16:28 | 1.5M | |
![[SND]](/icons/sound2.gif) | y2meta.com - FULL ALBUM ADE ASTRID TERBARU 2022 -- GALA GALA -- PECAH SERIBU -- VERSI KUDA RENGGONG (320 kbps).mp3 | 2022-07-05 08:50 | 33M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Emre Orak Ağır Roman Gül Ali Pa4x Kronos2 Uygar Orak (128 kbps).mp3 | 2022-07-12 19:35 | 878K | |
![[SND]](/icons/sound2.gif) | y2meta.com - Duka - Last Child (Lirik) (128 kbps).mp3 | 2022-07-20 23:25 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - DKN - SCARFACE (320 kbps).mp3 | 2022-08-04 19:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - DJ TIKTOK TERBARU 2022 - DJ SIKOK BAGI DUO PALEMBANG REMIX X BAJU HITAM X BENTO _ VIRAL FULL BASS (320 kbps).mp3 | 2022-07-11 22:27 | 120M | |
![[SND]](/icons/sound2.gif) | y2meta.com - DJ Dash Uciha Plis Ku Tak Suka Preman Slow Tik Tok Remix Terbaru 2021 (DJ Cantik Remix) (320 kbps).mp3 | 2022-08-10 11:37 | 0 | |
![[VID]](/icons/movie.gif) | y2meta.com-DJ BETA JANJI BETA JAGA X CEPAK CEPAK JEDER 30 DETIK����-(480p).mp4 | 2022-07-08 11:45 | 2.9M | |
![[VID]](/icons/movie.gif) | y2meta.com - DJ 40 DETIK FULLBASS!! - Zahran Fvnky(360p).mp4 | 2022-07-07 19:56 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2meta.com - Dây Tơ Kết Đôi Remix - (NANA LIU x Đại Mèo Remix) _ Định ước trăm năm duyên thành đôi hot tiktok (128 kbps).mp3 | 2022-07-19 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Coven _ Official Skins Theme 2021 - League of Legends (128 kbps).mp3 | 2022-07-19 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | y2meta.com - Bruno Mars - It Will Rain (Official Music Video) (320 kbps).mp3 | 2022-07-05 10:04 | 10M | |
![[SND]](/icons/sound2.gif) | y2meta.com - BALANÇANDO AS UMBRELLA - MC Nem JM e MC Madruguinha (DJ Teixeira e DJ K) (320 kbps).mp3 | 2022-06-29 21:18 | 6.0M | |
![[SND]](/icons/sound2.gif) | y2meta (mp3cut.net).mp3 | 2022-08-08 00:02 | 0 | |
![[SND]](/icons/sound2.gif) | y2matemp3.online-128kbps-aCFRna5G-try.mp3 | 2022-08-04 09:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate2022.mp3 | 2022-07-31 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.m4a | 2022-08-09 06:21 | 958K | |
![[SND]](/icons/sound2.gif) | y2mate.com_-_bo_en_my_time (1).mp3 | 2022-07-19 19:02 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com_-_We_do_not_care_meme_v144P.mp4 | 2022-07-19 19:32 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com_-_TPL_BM_OTP_London_View_Remix_ft_Mini_x_Sava_x_Marin_x_Rambizz_Music_Video_Pressplay.mp3 | 2022-07-23 14:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com_-_GTARPNETWORK_Heading.mp3 | 2022-08-09 16:52 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - you make me strongOne direction Speed upaudio edit Viral Tiktok.mp3 | 2022-08-08 17:00 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - viral ringtone 2022 new trending ringtone girl ringtone girl attitude ringtone chemistry tone.mp3 | 2022-07-06 23:31 | 627K | |
![[SND]](/icons/sound2.gif) | y2mate.com - twbl.mp3 | 2022-07-12 00:56 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - tobat masiat meme DJ remix.mp3 | 2022-07-12 06:48 | 2.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - timmies tell me why im waiting ft shiloh 1 hour loop.mp3 | 2022-07-18 21:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - terimakasih Viral TIKTOK.mp3 | 2022-07-19 07:57 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - tak ingin usai keisya levronka tiktok version.mp3 | 2022-07-30 01:22 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - story wa kekinian healing kita healing.mp3 | 2022-07-25 12:29 | 470K | |
![[SND]](/icons/sound2.gif) | y2mate.com - story WAIG lagu if a picture is all that i have Wish You Were Here.mp3 | 2022-08-05 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - story WAIG lagu if a picture is all that i have Wish You Were Here (1).mp3 | 2022-08-05 01:32 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - spice_and_wolf_op_1_full_with_lyrics_W6q1AWnjNiU_320kbps.mp3 | 2022-07-09 11:23 | 11M | |
![[SND]](/icons/sound2.gif) | y2mate.com - skinnyfabs happy audio.mp3 | 2022-08-05 16:21 | 3.1M | |
![[VID]](/icons/movie.gif) | y2mate.com - sempurna andra and the backbone slowed tiktok version _v720P.mp4 | 2022-08-07 10:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - seafret atlantis speed up.mp3 | 2022-08-06 07:33 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ruth b dandelions tiktok version Im in a field of dandelions lyrics in the description.mp3 | 2022-08-01 18:11 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ruth b dandelions lyrics.mp3 | 2022-08-04 16:08 | 1.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - radio bleep sound effect.mp3 | 2022-06-30 09:48 | 10K | |
![[SND]](/icons/sound2.gif) | y2mate.com - one kiss is all it takes liverpool Calvin Harris Dua Lipa One Kiss sub español.mp3 | 2022-06-30 01:32 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - no copyright music Purple lofi background music_256kbps.mp3 | 2022-08-10 14:05 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - near karna su sayang ft Dian Sorowea official lyric video .mp3 | 2022-07-22 22:33 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - monokrom tulus 1hour.mp3 | 2022-07-15 01:45 | 58M | |
![[SND]](/icons/sound2.gif) | y2mate.com - mentahan happy birthday to you lucu ngakak viral tiktok.mp3 | 2022-07-29 18:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - love story taylors version taylor swift audio edit.mp3 | 2022-07-07 05:37 | 818K | |
![[SND]](/icons/sound2.gif) | y2mate.com - last friday night TikTok Version speed up lyrics.mp3 | 2022-07-08 01:38 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - kyouran hey kids Noragami Aragoto but is it okay if its lofi hiphop.mp3 | 2022-08-04 13:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - i like sx i like drugs i like money.mp3 | 2022-07-24 08:36 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - iPhone New phone ringtone 2020 Best iPhone ringtone 2020 Apple ringtone 2020 download.mp3 | 2022-08-09 15:27 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - hivi remaja sped up.mp3 | 2022-07-19 10:45 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - hildanlogic berjuang official music video.mp3 | 2022-07-15 17:47 | 2.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - happy birthday too you versi india.mp3 | 2022-08-04 06:40 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - gua tandain lu sound pubg tik tok viral kata kata kasar.mp3 | 2022-07-10 17:47 | 139K | |
![[SND]](/icons/sound2.gif) | y2mate.com - gtaonlinergame visaoem phai kh0k (1).mp3 | 2022-08-02 09:37 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - grentperez Only About Love Official Lyric Video.mp3 | 2022-08-02 09:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - giờ này anh biết phải làm gì .mp3 | 2022-07-31 11:19 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - frad first date.mp3 | 2022-07-25 11:32 | 2.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - favorite girl justin bieber edit audio.mp3 | 2022-08-02 11:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - dj fyp cheap thrills x sampe bawah noizxmix_320kbps.mp3 | 2022-07-24 11:36 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - diaz.mp3 | 2022-07-09 05:39 | 5.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com-desah.mp3 | 2022-07-18 21:12 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - desah.mp3 | 2022-07-18 21:16 | 51K | |
![[SND]](/icons/sound2.gif) | y2mate.com - cover viral Last Child Duka cover bashri.mp3 | 2022-08-08 11:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - cinematic video 30 detik lagu play date.mp3 | 2022-07-10 21:30 | 495K | |
![[SND]](/icons/sound2.gif) | y2mate.com - cactuskk Shaiqa Official Audio.mp3 | 2022-07-22 15:25 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - beach bunny prom queen LYRICS.mp3 | 2022-07-05 08:44 | 2.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - azer bülbül Kursun yedim.mp3 | 2022-07-09 23:45 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - akon lonely slowed reverb.mp3 | 2022-07-09 05:42 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - ZEDD x VALORANT Music Theme.mp3 | 2022-07-23 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Zülfü Livaneli Yiğidim Aslanım Atatürk 10 Kasım.mp3 | 2022-07-30 14:51 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Yuri feat Bmo Jak Terk Dong Cap Ketum (1).mp3 | 2022-07-24 08:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Yowis Ben Dulur Saklawase Official Music Video.mp3 | 2022-06-29 09:23 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Your Time Is Over Muzzy Remix.mp3 | 2022-07-12 06:33 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Your Text Sundial Lirik Terjemahan Indonesia Lyrics Video.mp3 | 2022-07-07 16:34 | 3.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Yiruma 이루마 River Flows in You.mp3 | 2022-07-23 16:11 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Yeryuzunde Bir Akşam.mp3 | 2022-07-21 14:20 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Yellow Claw Shotgun ft Rochelle Official Music Video.mp3 | 2022-06-27 20:48 | 2.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Yaa Rasulallah Guru Udin Bersama Gambus Balasyik Jember.mp3 | 2022-07-30 20:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - YOUNG LEX GGS FtSkinny Indonesian 24 Reza Oktovian Kemal Palevi Dycal Official MV.mp3 | 2022-07-08 14:03 | 4.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - YOASOBI大正浪漫Official Music Video.mp3 | 2022-07-17 00:23 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - YNW MELLY I GOT BURGERS ON MY MIND PARODY (2).mp3 | 2022-07-19 19:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - YNTKTS Sound Effect.mp3 | 2022-07-18 21:17 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - YG Toxic_320kbps.mp3 | 2022-08-12 19:42 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - XMAN NDUGAL We Dont Care.mp3 | 2022-07-04 14:13 | 2.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Woro Widowati Kebacut Nyaman Official Music Live Wes tak cubo kanggo nglalekno.mp3 | 2022-07-08 19:37 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Wika Wika Remix - Copy.mp3 | 2022-07-28 13:56 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com-When-are-you-ready-by-Ps-May-Shah-June-05-2022.mp3 | 2022-07-19 08:04 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - We Are Familia.mp3 | 2022-07-29 18:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - WKCR Hijacking.mp3 | 2022-07-13 05:42 | 5.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - WHUT Wanna Hold U Tight Aisha Retno Lirik Lagu Terjemahan.mp3 | 2022-07-16 06:33 | 2.8M | |
![[VID]](/icons/movie.gif) | y2mate.com - WHITE SCREEN 1 second_v144P 2.mp4 | 2022-07-21 16:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Virgoun Surat Cinta Untuk Starla Original Key Karaoke Version.mp3 | 2022-07-14 16:09 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Vierra Seandainya Lirik Lagu Nostalgia.mp3 | 2022-07-19 07:01 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Video Cinematic Ucapan Ulang Tahun.mp3 | 2022-07-03 15:39 | 882K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Vibras Pablo ChillE.mp3 | 2022-07-08 06:14 | 2.4M | |
![[VID]](/icons/movie.gif) | y2mate.com - VegetozKEHADIRANMU COVER CHIKA LUTFI Story wa keren LYRIC_360p.mp4 | 2022-07-03 16:43 | 1.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Vampire Party 1 Hour Dark Clubbing Bass House Dark Techno Mix.mp3 | 2022-07-23 14:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - VIRAL DJ KNOW ME TOO WELL SOUND SIRKUIT MANDALIKA TIKTOK FULL.mp3 | 2022-07-03 20:07 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - VARDAN URUMYAN GEGHAM MELQONYAN Sirun Akhchik.mp3 | 2022-07-02 04:02 | 4.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Untuk Perempuan Yang Sedang Dalam Pelukan Payung Teduh cover by Albayments Aku Jeje.mp3 | 2022-08-04 15:40 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Unstoppable Lyric Mix Sia Jaymes Young Shawn Mendes Ruth B.mp3 | 2022-07-04 06:20 | 14M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Ungu Feat Andien Saat Bahagia slowed reverb.mp3 | 2022-07-26 22:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Undertale Soundtrack lagu turu.mp3 | 2022-07-04 19:28 | 724K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Undertale Soundtrack lagu turu (1).mp3 | 2022-07-12 15:26 | 724K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Undangan Digital versi jawa Kosong template.mp3 | 2022-07-11 07:31 | 947K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Unconditionally X Dandelions Lyrics Slowed Version.mp3 | 2022-07-18 12:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ULTRA HEISEI Opening Mashup Lyrics.mp3 | 2022-06-30 10:07 | 13M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Twitch Türkiye Dancin edit.mp3 | 2022-07-12 14:04 | 510K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Tulus Perahu Kertas Konser Salute Erwin Gutawa to 3 Female Songwriters.mp3 | 2022-08-04 04:52 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Try this Hacker Voice to Prank your friends.mp3 | 2022-07-25 19:22 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Troye Sivan Angel Baby Visualiser.mp3 | 2022-07-18 12:00 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Troye Sivan Angel Baby.mp3 | 2022-07-31 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Tropes what if youre right and theyre wrong w mental 3d kurai sped up.mp3 | 2022-07-21 04:57 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Tropes what if youre right and theyre wrong w mental 3d kurai lyrics.mp3 | 2022-07-22 03:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Tidurlah selamat malam lupakan sajalah akubersama bintanglirik.mp3 | 2022-07-05 00:20 | 4.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Walters I Love You So_320kbps.mp3 | 2022-08-10 04:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Walters I Love You So.mp3 | 2022-07-05 01:01 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Remedy For a Broken Heart why am i so in love Lyrics Terjemahan.mp3 | 2022-07-13 09:09 | 2.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Rare Occasions Notion Lyrics_320kbps.mp3 | 2022-07-22 11:22 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Qemists Jungle feat Hacktivist.mp3 | 2022-07-01 16:08 | 3.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - TheOvertunes Sayap Pelindungmu Lirik_320kbps.mp3 | 2022-07-24 04:59 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - TheOvertunes Sayap Pelindungmu Lirik_64kbps.mp3 | 2022-07-24 05:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Neighbourhood Sweater Weather slowed reverb.mp3 | 2022-08-06 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Last Gunfighter Ballad.mp3 | 2022-08-04 20:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - The Beatles Guns N Roses Greatest Hits Full Album Update 2018 Best Classic Rock Songs Collection.mp3 | 2022-07-16 13:23 | 82M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Thailand Style x Slow Bass Joko Tingkir Ngombe Dawet DJ Topeng Remix .mp3 | 2022-08-05 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - TemperatureSean Paul.mp3 | 2022-08-02 18:16 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Tek It Cafuné Guitar Cover With Tabs and Chords.mp3 | 2022-06-27 13:28 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Tante Tante anaknya nonton boke tante.mp3 | 2022-07-21 00:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - TXT 투모로우바이투게더 Good Boy Gone Bad Easy Lyrics.mp3 | 2022-07-01 18:13 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - TULUS HatiHati di Jalan Official Music Video.mp3 | 2022-07-27 15:28 | 4.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - TULUS HatiHati di Jalan Lyrics Video Ku Kira Kita Asam dan Garam tulus manusia (1).mp3 | 2022-07-05 00:13 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - TRICKSTER ANTHEM ProdBy MANGBORIS Official Audio.mp3 | 2022-07-04 16:14 | 2.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - TRICKSTER ANTHEM Official Music Video.mp3 | 2022-08-08 03:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - TRANG TRẠI CẦN X TOMMY TÈO CÔNG THÀNH REMIX.mp3 | 2022-07-13 11:30 | 6.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - TIARA KRIS LIVE COVER INDAH YASTAMI.mp3 | 2022-07-17 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - TIARA KRIS Cover INDAH YASTAMI Full Album Terpopuler 2022 Lagu Galau Terpopuler.mp3 | 2022-08-05 09:54 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - TIẾN QUÂN CA Quốc Ca nước Cộng hòa xã hội chủ nghĩa Việt Nam OFFICIAL MV _1080p.mp4 | 2022-08-03 14:27 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - THE NIGHT TVT FT NEVERNHẠC TIKTOK 2022.mp3 | 2022-07-22 14:16 | 348K | |
![[SND]](/icons/sound2.gif) | y2mate.com - TE VOY A CULEAR ABUELOPASION SHITMUSIC.mp3 | 2022-07-22 15:26 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - TE VOY A CULEAR ABUELOPASION SHITMUSIC (1).mp3 | 2022-07-22 15:23 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com-TAGAL.mp3 | 2022-07-13 22:56 | 4.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Tương Tư Nan Tuyệt Remix Đại Thần Tuệ Top 10 Bài hát TikTok MỚI NHẤT tuần vừa qua AML MUSIC.mp3 | 2022-08-11 03:33 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sweet Cigarettes After Sex.mp3 | 2022-07-31 17:42 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Suzume no Tojimari.mp3 | 2022-08-10 09:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Superstitious Foundation SCP original song Instrumental.mp3 | 2022-07-26 08:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Superman Is Dead Bulan dan Ksatria (1).mp3 | 2022-07-08 22:08 | 3.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Suni Clay In a Hood Near You Need for Speed Most Wanted Soundtrack 1080p.mp3 | 2022-07-13 19:37 | 5.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Stratus You must follow Need for Speed Most Wanted Soundtrack 1080p.mp3 | 2022-07-14 00:34 | 3.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Story wa janji suci.mp3 | 2022-07-16 02:55 | 925K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Story wa 30 detik Selamat Ulang Tahun Gellen Martadinata.mp3 | 2022-07-23 00:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Story Wa Sebenarnya Aku Ultramen.mp3 | 2022-07-13 02:31 | 239K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Story Wa Anime AOT Lagu Sasageyo.mp3 | 2022-08-10 00:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Story WA Ucapan Selamat Ulang Tahun.mp3 | 2022-07-31 07:45 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Story WA Lagu Barat Terjemahan 30 Detik Lagu Barat Bucin Romantis Dusk Till DawnZAYN ftSia.mp3 | 2022-07-08 03:47 | 469K | |
![[SND]](/icons/sound2.gif) | y2mate.com - StoryStatus WA Nufi wardhana KANGEN Semua kata rindumu semakin membuatku tak berdaya.mp3 | 2022-07-22 13:03 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Standly PEGATE.mp3 | 2022-07-16 08:37 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sound Yang Lagi Viral Di TikTok RizkiSz Dj Midua Cinta Mengkane Bootleg Raka Remixer.mp3 | 2022-08-11 09:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sound Viral Di Tiktok BEKEN Dj Ular X Malam Ini Tangkis Dang X Bernyanyi Sound Tiktok Mengkane.mp3 | 2022-07-18 21:20 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sound Effect Bakso Kontol Slow Reverb.mp3 | 2022-07-29 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Song of The French Resistance Le Chant Des Partisans.mp3 | 2022-08-03 11:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - SongHari Raya Remix2022.mp3 | 2022-07-15 15:10 | 2.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sofia Reyes 1 2 3 slowed reverb.mp3 | 2022-07-01 02:36 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Silent Poets Asylum For The Feeling.mp3 | 2022-07-16 23:38 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Siantar Rap Foundation Tinggalkan Ayah Tinggalkan Ibu Lirik Lagu.mp3 | 2022-07-09 04:17 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Shortparis Хор ветеранов им Ф М Козлова Яблонный Сад.mp3 | 2022-07-09 00:44 | 5.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Shop Pet Society OST HQ Extended Loop.mp3 | 2022-07-30 05:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sholawat Saadah Memberi Kebahagiaan Dunia Akhirat.mp3 | 2022-07-02 03:56 | 530K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sholawat Assaadah allahuma shali wa salim ala x Tombo Ati cover versi full.mp3 | 2022-07-02 03:55 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Shawn Mendes Imagination Audio.mp3 | 2022-07-06 16:43 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Shania Twain From This Moment On Official Music Video.mp3 | 2022-07-25 14:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Shane Filan Beautiful In White Official Video.mp3 | 2022-07-08 07:50 | 3.6M | |
![[VID]](/icons/movie.gif) | y2mate.com - Sexual Mix 𝘴𝘭𝘰𝘸𝘦𝘥 𝘵𝘰 𝘱𝘦𝘳𝘧𝘦𝘤𝘵𝘪𝘰𝘯 _360p.mp4 | 2022-07-15 20:19 | 26M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Seperti Kisah Rizky Febian KARAOKE PIANO FEMALE KEY.mp3 | 2022-07-10 02:28 | 4.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Send This to your bestfriend In all of my Lonely Nights Henry Moodie.mp3 | 2022-06-27 15:59 | 2.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Selamat Ulang Tahun lagi.mp3 | 2022-07-07 10:40 | 917K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Selamat Ulang Tahun Jamrud.mp3 | 2022-07-11 02:56 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Search Isabella.mp3 | 2022-07-09 09:52 | 4.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Sean Paul Temperature Lyrics well woman the way the time cold i wanna be keepin you warm_320kbps.mp3 | 2022-08-02 18:17 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Seafret Atlantis Audio.mp3 | 2022-07-31 17:25 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Script HTML っ ngucapin selamat ulangtahun soo sweet banget.mp3 | 2022-07-08 16:47 | 480K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Say Goodbye.mp3 | 2022-07-16 08:11 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - San Oscuro.mp3 | 2022-07-12 06:57 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Saat bahagia sped up reverb (1).mp3 | 2022-07-30 06:59 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - SURAT CINTA UNTUK STARLA Virgoun Kalimba Cover with Tabs.mp3 | 2022-07-02 04:38 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - SUÝT NỮA THÌ OFFICIAL OST CHUYẾN ĐI CỦA THANH XUÂN ANDIEZ x BITIS HUNTER LYRIC VIDEO.mp3 | 2022-07-10 01:14 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - SOUND YANG LAGI VIRALL TIKTOK DJ ULAR V9 X PYRAMID SOUND JJ RAKA REMIXER FIRAL YANG KALIAN CARI.mp3 | 2022-07-18 21:19 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - SOUND MAMANG GAROX ZERZSOFTBOY KANE IJUL RMX.mp3 | 2022-07-31 16:01 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - SELAMAT ULANGTAHUN Gellenmartadinata ACOUSTIC COVER BY DEA DEVINA .mp3 | 2022-08-05 11:27 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - SELAMAT ULANG TAHUN Gellen Martadinata Kalimba Cover with Tabs.mp3 | 2022-07-18 16:07 | 2.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - SCRIPT HTML BUCIN TERBARU NGUNGKAPIN PERASAAN KE CEWEK YANG KITA SUKA CODING 2022.mp3 | 2022-07-19 13:28 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - SAYKOJI JALAN PANJANG ft GUNTUR SIMBOLON.mp3 | 2022-07-05 04:19 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - SATU ROOM PASTI MELAYANG TINGGI DJ CINTA TEGARKAN HATIKU X NEW JUNGLE DUTCH 2021 FULL BASS.mp3 | 2022-07-02 17:34 | 25M | |
![[SND]](/icons/sound2.gif) | y2mate.com - SABILULUNGAN Ft 6IX9INE NLE CHOPPA LIL PUMP XXXTENTACION BLUEFACE DRAKE AND LIL BABY.mp3 | 2022-08-06 19:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Ruang Rindu Letto Video Lirik Adlani Rambe Live Cover.mp3 | 2022-07-13 18:14 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rosenfeld like u Official Audio.mp3 | 2022-07-09 07:40 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Romeo Santos Propuesta Indecente LetraLyrics.mp3 | 2022-07-31 15:12 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Romantic Happy Birthday Arranged by Miranda Wong Piano Cover.mp3 | 2022-08-12 12:30 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rock I am Rock Need for Speed Most Wanted Soundtrack 1080p.mp3 | 2022-07-13 19:35 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rizkyfebian Selamat Ulang tahun Lyrics.mp3 | 2022-08-12 11:36 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rizky Febian Seperti Kisah Official Lyric Video.mp3 | 2022-08-09 15:37 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rifalietsky Im not the clown Official audio.mp3 | 2022-07-01 17:04 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Riders On The Storm Snoop Dogg ft The Doors.mp3 | 2022-07-25 00:19 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Ricky Montgomery Line Without a Hook Official Lyric Video.mp3 | 2022-07-30 13:54 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Rick Astley Never Gonna Give You Up Official Music Video_720p.mp4 | 2022-07-02 09:55 | 57M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rick Astley Never Gonna Give You Up Official Music Video.mp3 | 2022-07-02 10:03 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rich Brian Yellow ft Bekon Official Video.mp3 | 2022-08-09 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rich Brian Drive Safe Lyric Video.mp3 | 2022-08-09 10:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rex Orange County Television So Far So Good Official Audio.mp3 | 2022-07-26 22:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Red Velvet 레드벨벳 Feel My Rhythm Performance Video.mp3 | 2022-07-28 02:57 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rawhide_320kbps.mp3 | 2022-07-06 22:31 | 4.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Raizer Speed Official Lyric Video.mp3 | 2022-07-12 06:36 | 3.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Raissa Anggiani Kau Rumahku Official Audio.mp3 | 2022-07-13 05:24 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Rain Noise Rain Sound Effect No Copyright Nature Sounds720P HD.mp3 | 2022-08-13 01:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - RRAFIZZZ Makna Puasa ft Dava Stay Halal Brother.mp3 | 2022-07-31 08:37 | 2.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - RESIDENT EVIL DARKSCARYAMBIENCE MUSIC COMPILATION.mp3.mp3 | 2022-07-22 11:01 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - RECO ALO BABY BIGSHARK OFFICIAL MUSIC VIDEO.mp3 | 2022-07-28 18:25 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - RAP MONSTER RHOSY SNAP Official Music Video .mp3 | 2022-08-01 10:35 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Quando Quando Quando with Nelly Furtado_256kbps.mp3 | 2022-07-03 11:14 | 8.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - QUEVEDO BZRP Music Sessions 52.mp3 | 2022-07-13 22:24 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - PsoGnar Sabotage.mp3 | 2022-08-04 13:18 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - ProleteR April Showers_480p.mp4 | 2022-07-11 16:45 | 5.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Pluto Projector.mp3 | 2022-07-04 04:17 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Playlist 1 Hour MASHUP hơn 10 bài HOT trên Tik Tok P1 P2 P3 P4 Changmie x Tiến Tới x Ca Ca.mp3 | 2022-07-31 10:29 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Playboi Carti Sky Official Audio.mp3 | 2022-08-12 20:22 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Playboi Carti ILoveUIHateU Official Audio.mp3 | 2022-07-09 07:32 | 2.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Pháo Hồng H2O Remix Đạt Long Vinh Nụ Cười Ai Nát Lòng Ngày Mai Em Lấy Chồng Hot TikTok.mp3 | 2022-07-26 02:43 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Peterpan Mungkin Nanti Official Music Video.mp3 | 2022-06-28 19:09 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Perfect Ed Sheeran Lyrics.mp3 | 2022-08-11 03:21 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Perfect Ed Sheeran Lirik video dan terjemahan Leroy Sanchez Cover.mp3 | 2022-07-17 03:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Payung Teduh Di Atas Meja Official Lyric Video.mp3 | 2022-07-13 11:10 | 5.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Passenger Let Her Go Lyrics.mp3 | 2022-07-17 03:53 | 4.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Party LagiiiDJ SCOBYDOO PAPA x SIKOK BAGI DUO Pargoy Junggle Dutch Ricko Pillow Remix.mp3 | 2022-07-29 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Pak Pong Vong x Bambimbum x Pong Pong DJ Topeng Remix .mp3 | 2022-07-04 18:45 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - PXNDX Disculpa los Malos Pensamientos.mp3 | 2022-07-16 08:06 | 3.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - PRESET AM JEDAG JEDUG VIRAL TIKTOK LAGU BY DIRLYWELL.mp3 | 2022-08-04 08:33 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - PARTYNEXTDOOR Break from Toronto audio edit TikTok.mp3 | 2022-07-03 11:05 | 957K | |
![[SND]](/icons/sound2.gif) | y2mate.com - PAMUNGKAS FULL ALBUM_320kbps.mp3 | 2022-07-25 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Opick Ramadhan Tiba Official Video.mp3 | 2022-07-29 15:08 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - One Direction Strong lirik Terjemahan.mp3 | 2022-07-28 09:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - One Direction Night Changes Lyrics.mp3 | 2022-08-07 15:04 | 2.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Official OST After Met You Video Lyric.mp3 | 2022-07-10 08:46 | 2.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - OTrack LSV LOS VAGOS SOI Stateofindonesia GTAVRP FiveM VAGOS.mp3 | 2022-07-23 04:52 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ORANGE 7 VERSI KOPLO VIRAL TIKTOK TERBARU.mp3 | 2022-08-05 06:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - OMORI Battle Among Friends remix console.mp3 | 2022-07-19 19:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - OJO DIBANDINGKE Farel Prayoga ft Filla Talia OFFICIAL ONE NADA.mp3 | 2022-08-01 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nothings Gonna Change My Love For You Westlife Lyrics video dan terjemahan.mp3 | 2022-07-30 08:11 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nothings Gonna Change My Love For You Shania Yan Cover.mp3 | 2022-08-05 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - NonStop Malayalam Melody Songs To Sleep Vol2 TopNotch Playlist_v240P-mc.m4a | 2022-06-28 12:11 | 29M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Noisecream Legion.mp3 | 2022-07-29 18:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - No Surprises.mp3 | 2022-08-06 02:05 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nightcore Kawaii TATARKA.mp3 | 2022-07-24 14:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nfx Warzone Official Clip 2016Beat x LeftField .mp3 | 2022-07-15 05:07 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - New Syila Musik Pet Polypet Pipet Angka 7 Tujuh Vs Garam Cina By Wendol.mp3 | 2022-07-21 07:31 | 2.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - New GM ChevyGMCCadillac Door Chime Sound Effect HQ.mp3 | 2022-08-09 12:20 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Neto Peña Cholo En Un Low Video Oficial_320kbps.mp3 | 2022-06-30 08:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Neck Deep December.mp3 | 2022-07-28 12:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Naruto Shippuden OST Saika Colourful Mist Extended (1).mp3 | 2022-07-16 08:15 | 6.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Nano Separuhku Official Lyric Video.mp3 | 2022-07-11 03:24 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - NLE Choppa Shotta Flow Remix ft Blueface Directed by Cole Bennett.mp3 | 2022-07-10 03:38 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - NATIIVE Memories Lyrics ft FINLAY.mp3 | 2022-07-13 18:21 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - My Love.mp3 | 2022-07-28 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Muzammil Hasballah AlHujurat 10 13 Terjemah Indonesia.mp3 | 2022-08-05 01:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Monolink Return To Oz ARTBAT Remix Edit.mp3 | 2022-07-13 18:58 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Monday Mood Morning Chill Mix English songs chill music mix.mp3 | 2022-06-28 08:43 | 62M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mix spongebob bikin kuping sakit.mp3 | 2022-07-18 21:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Migos Open It Up Audio.mp3 | 2022-08-03 12:16 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Midas The Jagaban Party With A Jagaban Lyrics.mp3 | 2022-06-29 16:21 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Metallica Enter Sandman Official Music Video.mp3 | 2022-07-15 16:18 | 5.1M | |
![[VID]](/icons/movie.gif) | y2mate.com - Mentahan lyrics lagu Angel baby Trend TikTok 40 detik_480p.mp4 | 2022-07-11 04:06 | 748K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mentahan lirik lagu the shaderex orange countyi would love just the be stuck to your side.mp3 | 2022-07-31 01:29 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Mentahan lirik lagu Heat Waves Overlay Lyrics_480p(1).mp4 | 2022-07-22 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mentahan ccp lirik lagu 30 detik Dj Kaulah Yang Terakhir Bagiku Link media fire.mp3 | 2022-07-19 05:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mentahan Favorite Girl Justin Bieber Slowed Version Lyrics Overlay TikTok_320kbps.mp3 | 2022-08-02 07:51 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mentahan Favorite Girl Justin Bieber Slowed Version Lyrics Overlay TikTok.mp3 | 2022-08-02 05:03 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mentahan Ccp lirik lagu Heat Waves You look so broken when you cry _320kbps.mp3 | 2022-07-22 11:32 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Mentahan CCP lirik lagu Dj Move On Dj Tebang Mentahan Lirik Lagu DJ Hidup cuma sekali Move On_480p.mp4 | 2022-07-30 10:20 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Melanie Martinez Play Date Official Audio.mp3 | 2022-07-23 01:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Maroon 5 Wont Go Home Without You Lyrics .mp3 | 2022-07-13 01:05 | 3.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Marcell Takkan Terganti Official Music Video musikindonesia takkanterganti laguhits.mp3 | 2022-06-28 04:35 | 680K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mamma Mia Slipping Through My Fingers Lyrics Tiktok slipping through my fingers all the time.mp3 | 2022-07-08 10:00 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Maliq DEssentials Himalaya Lyric Video.mp3 | 2022-08-07 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Make You Mine Public cover by Ghea Indrawari.mp3 | 2022-08-04 05:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mahmut Orhan Ft Sena Sener Feel Extended Drop.mp3 | 2022-08-11 11:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Ma gaming rap phiên bản lofi cực chill .mp3 | 2022-07-23 01:51 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Maduk Poison ft Gid Sedgwick.mp3 | 2022-07-17 09:30 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Maduk Got Me Thinking ft Veela.mp3 | 2022-07-17 08:25 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - MV Paul Kim폴킴 Me After You너를 만나.mp3 | 2022-07-14 18:14 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - MV Flying High JKT48.mp3 | 2022-06-30 05:47 | 4.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - MV Colde 콜드 묘 Cat.mp3 | 2022-08-05 14:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - MONSTER MASH.mp3 | 2022-08-10 19:41 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - MODERN RP Prod By MANGBORIS Official Audio.mp3 | 2022-07-28 07:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - MENTAHAN OVERLAY LIRIK LAGU SELAMAT ULANG TAHUN JAMRUD.mp3 | 2022-07-11 14:24 | 583K | |
![[SND]](/icons/sound2.gif) | y2mate.com - MENTAHAN LIRIK LAGU 30 DETIK TERBARU LAGU NIGHT CHANGES FREE DOWNLOAD .mp3 | 2022-07-22 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Mười Năm Nhân Gian Việt Mino Remix Tiktok 十年人间 越南鼓 Hot Trend Tiktok 2022.mp3 | 2022-07-24 07:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Música De Fondo Inspiradora y Dramática Para Videos.mp3 | 2022-07-31 01:34 | 1.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Más de una Vez Pailita Video Oficial ProdLewisSomes.mp3 | 2022-07-09 08:53 | 3.0M | |
![[VID]](/icons/movie.gif) | y2mate.com - Lugowo lagu China versi Dangdut Sibay Classic_720pFHR.mp4 | 2022-07-08 10:56 | 28M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lugowo lagu China versi Dangdut Sibay Classic.mp3 | 2022-07-07 17:15 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Love The Way You Lie Part III Original Demo.mp3 | 2022-07-06 08:40 | 3.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Love Story.mp3 | 2022-07-30 05:09 | 4.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Love Maybe Secret Number OST Business Proposal Lirik Terjemahan.mp3 | 2022-07-04 03:16 | 2.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Love Is Gone SLANDER ft Dylan Matthew Lirik Terjemahan Indonesia.mp3 | 2022-06-28 04:52 | 2.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - LosPakualamos Get my way.mp3 | 2022-07-01 12:39 | 3.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lk Nhạc Đám cưới Nha Hot nhất 2022 muốn em là Yêu Là Cưới Cưa Là Đổ Đám Cưới Miền Tây Remix 2022.mp3 | 2022-07-17 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lirik One Ok Rock Wherever You Are indonesia Translation.mp3 | 2022-07-07 22:27 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lirik One Ok Rock Wherever You Are indonesia Translation (mp3cut.net).mp3 | 2022-07-11 10:21 | 485K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Linkin Park In The End Mellen Gi Tommee Profitt Remix.mp3 | 2022-07-12 17:34 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lindsey Stirling Carol of the Bells Official Video.mp3 | 2022-06-29 08:07 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lil Uzi Vert 20 Min.mp3 | 2022-08-12 20:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lil Tatang Patriot.mp3 | 2022-06-29 05:19 | 2.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lil Salmonela x Crygen Ratna Anjink Diss Irfan Gapreh x Ratna Kosonkduasatu.mp3 | 2022-07-21 04:16 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lil Nas X HOLIDAY Official Video.mp3 | 2022-08-11 04:08 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Last Child Duka slowed reverb echo .mp3 | 2022-07-08 06:23 | 5.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lary Over Anuel AA Bryant Myers Brytiago Almighty Tu Me Enamoraste Official Video.mp3 | 2022-07-01 16:34 | 5.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lagu sad 30 detik cocok untuk status WhatsApp.mp3 | 2022-07-24 05:45 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lagu jepang ORANGE lirik lagu terjemah bahasa indonesia.mp3 | 2022-07-07 17:23 | 4.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lagu Selamat ulang tahununoficiall music videoGellen Martadinatacinematic ultahGilang pambudi.mp3 | 2022-08-03 15:21 | 1.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lagu Sedih Ghost Lirik Dan Terjemahan Slowed Down .mp3 | 2022-08-03 11:24 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Lagu Jorok Baon Cikadap Cleaned_v720P.mp4 | 2022-06-28 11:26 | 5.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lagu Hengker Fri Fayer ft RehanHengker slowed reverb Lyrics.mp3 | 2022-08-04 15:45 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - LOVE CHAOS Ewe Paksa lirik.mp3 | 2022-08-05 16:11 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - LIRIK INDONESIA OJO DIBANDINGKE ANAK KECIL VIRAL FAREL PRAYOGA.mp3 | 2022-08-05 06:23 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - LINGSIR WENGI LAGU PANGGILAN UNTUK .mp3 | 2022-07-19 10:51 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - LAGU INDONESIA RAYA TEXT DAN VOCAL ORIGINAL OFFICIAL.mp3 | 2022-08-11 13:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - LAGU BACKSOUND BOBON SANTOSO INDIA.mp3 | 2022-07-27 18:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lỡ Yêu Người Đậm Sâu Lofi Ver Linh Hương Luz Cánh Hoa tàn tình tan và em bay theo gió ngàn_320kbps.mp3 | 2022-08-11 03:42 | 1.4M | |
![[VID]](/icons/movie.gif) | y2mate.com - Lạc Vào Trong Mơ Lofi Ver Simon C x Wuy x Freak D_480p.mp4 | 2022-06-29 02:59 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Lãng Tử Nhàn Thoại Thiên Tú HM Remix Thái Quỳnh Cover Hot Tiktok 2020.mp3 | 2022-08-11 03:24 | 3.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Làm Người Yêu Em Nhé Baby Wendy Thảo Audio Official.mp3 | 2022-07-08 06:29 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Krewella Say GoodBye Sideburns Metal ReVision.mp3 | 2022-07-17 01:09 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Korn vs Blue Stahli Ultranumb Coming Undone Aggro1 Remix.mp3 | 2022-07-09 09:12 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Kokoronashi Gumi lirik terjemahan Indonesia.mp3 | 2022-07-12 04:53 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Kobo Kanaeru mantra hujan Gustixa Remix.mp3 | 2022-07-15 08:37 | 1.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Kimetsu no Yaiba OST Go Shinna ft Nami Nakagawa Kamado Tanjirou no Uta Lirik Terjemahan.mp3 | 2022-07-12 05:01 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Kevin MacLeod BEST OF Best known music by Kevin MacLeod.mp3.mp3 | 2022-08-08 09:10 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Kenangan Sebuah Mimpi_360p (1).mp4 | 2022-07-01 03:01 | 5.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Keisya Levronka Tak Ingin Usai Official Music Video.mp3 | 2022-08-07 16:08 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Keisya Levronka Tak Ingin Usai Official Lyric Video.mp3 | 2022-08-01 08:06 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com-Kehlani-x-RB-Acoustic-Guitar-Type-Beat-Give-Me-Your-Love.mp3-2.mp3 | 2022-07-21 09:09 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - KUMPULAN DJ FYP TIKTOK 2022 SOUND KANE JEDAG JEDUG FUL BAS TERBARU.mp3 | 2022-07-30 01:01 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - KDA THE BADDEST ft GIDLE Bea Miller Wolftyla Official Lyric Video League of Legends.mp3 | 2022-08-04 13:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - KDA POPSTARS ft Madison Beer GIDLE Jaira Burns Music Video League of Legends.mp3 | 2022-08-04 13:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - KDA MORE ft Madison Beer GIDLE Lexie Liu Jaira Burns Seraphine Official Music Video.mp3 | 2022-08-04 13:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - KATA KATA BIJAK JHON IQ7 PART 2.mp3 | 2022-07-02 02:53 | 1.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Kẻ Theo Đuổi Ánh Sáng Lofi Ver Huy Vạc x Tiến Nguyễn x Freak D_320kbps.mp3 | 2022-08-11 06:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Kẻ Theo Đuổi Ánh Sáng Lofi Ver Huy Vạc x Tiến Nguyễn x Freak D.mp3 | 2022-08-11 06:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Justin Bieber Favorite Girl Lyrics.mp3 | 2022-07-04 04:20 | 4.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Jungkook My You MY You lyrics BTS Fullscreen Whatsapp Status.mp3 | 2022-07-17 09:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - July 16 2022.mp3 | 2022-07-16 14:20 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Juice WRLD Wishing Well Official Music Video.mp3 | 2022-07-14 18:01 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Juice WRLD The Weeknd Smile Official Video.mp3 | 2022-08-09 10:29 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Juice WRLD Empty Official Audio.mp3 | 2022-08-09 10:27 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Juice WRLD All Girls Are The Same Directed by Cole Bennett.mp3 | 2022-07-14 17:52 | 2.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Joji Glimpse Of Us_320kbps.mp3 | 2022-07-09 14:37 | 8.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Jnr Choi TO THE MOON Drill Remix TikTok.mp3 | 2022-06-28 05:27 | 2.3M | |
![[VID]](/icons/movie.gif) | y2mate.com - Jeff Kaale strawberry_v144P.mp4 | 2022-07-07 06:33 | 4.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - James Arthur Can I be him sped up.mp3 | 2022-07-19 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - James Arthur Can I Be Him speed up version.mp3 | 2022-08-06 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - JEDAG JEDUG FF 30 DETIKPRESET VIRALDJ HANYA DIApecahseribushorts.mp3 | 2022-07-14 07:59 | 264K | |
![[SND]](/icons/sound2.gif) | y2mate.com - JANGAN KHAWATIR DENGAN REZEKIMU MOTIVASI HIDUP Ustadz Abdul Somad Lc MA.mp3 | 2022-07-07 17:18 | 31M | |
![[SND]](/icons/sound2.gif) | y2mate.com - JACK J97 NGÔI SAO CÔ ĐƠN OFFICIAL MUSIC VIDEO.mp3 | 2022-08-04 07:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - IzzNsri Haa Tepok Acoustic full version.mp3 | 2022-06-27 16:42 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Iwan Fals TikusTikus Kantor 1986.mp3 | 2022-07-07 00:16 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Iwan Fals Sugali Official Music Video.mp3 | 2022-07-24 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Iwan Fals Pesawat Tempurku Official Music Video (1).mp3 | 2022-08-02 09:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Isyana Sarasvati Tetap Dalam Jiwa Video Clip.mp3 | 2022-08-02 11:30 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Interupt Power In Your Soul feat Luna LePage Official Lyric Video.mp3 | 2022-07-23 00:42 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Initial D Night Of Fire.mp3 | 2022-07-14 00:35 | 4.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Initial D I Need Your Love LYRICS.mp3 | 2022-07-14 00:22 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Initial D Dancing C O O L V I B R A T I O N S.mp3 | 2022-07-16 14:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Im in love with the coco audiolyrics.mp3 | 2022-07-16 02:22 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Imagine Dragons Bones Official Lyric Video_320kbps.mp3 | 2022-07-31 02:47 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - IWAN FALS FOR INDONESIA Album Terbaik dan Terpopuler Sepanjang Masa TANPA IKLAN.mp3 | 2022-06-27 12:05 | 40M | |
![[SND]](/icons/sound2.gif) | y2mate.com - INDONESIA RAYA Merinding Tiba tiba Semua bangkit berdiri Begitu Mendengar Lagu INDONESIA RAYA.mp3 | 2022-07-31 02:37 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - I Mean Love.mp3 | 2022-07-01 16:42 | 3.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - I Love You So.mp3 | 2022-07-09 22:06 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - I Like You So Much Youll Know It Ysabelle Cuevas Lyrics .mp3 | 2022-08-09 15:15 | 1.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Hindia Secukupnya Lyric Video OST Nanti Kita Cerita Tentang Hari Ini.mp3 | 2022-07-17 00:57 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Hijau Daun Sesuatu Yang Sempurna Official Video Clip Musik.mp3 | 2022-08-08 13:19 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Headache Relief Music with Binaural Beats.mp3 | 2022-07-30 18:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Happy Birthday lagu ulang tahun versi koplo assiikk ntaps TIKTOK v.mp3 | 2022-07-08 03:44 | 6.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Happy Birthday Bulan Sutena.mp3 | 2022-08-06 07:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Hal L Official Audio.mp3 (mp3cut.net).mp3 | 2022-08-03 01:17 | 634K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Hal L Lirik.mp3 | 2022-08-05 09:11 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Hal Hebat Cover Raffa affar Takkan siakan dia Full Album TERPOPULER Viral di TIKTOK .mp3 | 2022-07-18 21:23 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - HUYỀN TÂM MÔN LẦN HẸN HÒ ĐẦU TIÊN Prod BEGINNING OFFICIAL AUDIO.mp3 | 2022-08-11 09:04 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - HIVI Remaja Official Lyric Video.mp3 | 2022-08-02 16:03 | 1.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - HIVI Mata Ke Hati Acoustic Version Official Lyric Video.mp3 | 2022-07-14 09:20 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - HAPPY Birthday Song Happy Birthday to You.mp3 | 2022-07-22 15:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - HAPPY Birthday Song Happy Birthday to You (1).mp3 | 2022-07-22 15:16 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - HANYA SATU PERSINGGAHAN IKLIM LIVE COVER INDAH YASTAMI.mp3 | 2022-08-05 20:07 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Høøver GANG_360p.mp4 | 2022-07-17 02:11 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Gustixa spirit oceans ft Shalom Margaret_256kbps.mp3 | 2022-08-06 13:56 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Gustixa spirit oceans ft Shalom Margaret.mp3 | 2022-08-03 11:43 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Gustixa cant help falling in love ft Yara Fabricante.mp3 | 2022-07-13 10:13 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Greg Street ft Nappy Roots Good Day Official Video.mp3 | 2022-07-03 18:04 | 3.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Grand Theft Auto San Andreas Bike School Theme Long Edit.mp3.mp3 | 2022-07-14 08:55 | 2.6M | |
![[VID]](/icons/movie.gif) | y2mate.com - Goth Bitch_360p.mp4 | 2022-08-06 04:02 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Globglogabgalab Remix Red The Living Tombstone.mp3 | 2022-07-29 18:23 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Glimpse of usJoji versi Dangdut cover by Sibay Classic.mp3 | 2022-07-07 17:26 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Glimpse of Us x Pluto Projector Lyrics.mp3 | 2022-07-15 06:41 | 5.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Glimpse of Us Joji Lirik Lagu Terjemahan.mp3 | 2022-06-28 12:09 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Glimpse of Us Joji Lirik Lagu Terjemahan.mp3 | 2022-07-06 02:03 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Glass Animals Heat Waves Slowed TikTokLyrics sometimes all i think about is you late nights.mp3 | 2022-08-03 13:29 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Giờ này anh biết phải làm gì_320kbps.mp3 | 2022-07-31 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Giờ này anh biết phải làm gì Bomman_320kbps.mp3 | 2022-07-31 11:13 | 665K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Gellen Martadinata Selamat Ulang Tahun cover by Moyy.mp3 | 2022-08-12 18:37 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Gellen Martadinata Selamat Ulang Tahun Unofficial Music Video Lyric .mp3 | 2022-07-17 16:16 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Gellen Martadinata Selamat Ulang Tahun Lirik Video.mp3 | 2022-07-31 14:31 | 1.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - GUYONWATON OFFICIAL SEBATAS TEMAN OFFICIAL LYRIC VIDEO.mp3 | 2022-08-12 06:23 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - GTA SAN ANDREAS PedroDJDaddy Trap Remix 2019.mp3 | 2022-07-21 16:39 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - First date but its so relaxing.mp3 | 2022-07-12 06:51 | 12M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Fell Under a Spell Remix.mp3 | 2022-08-10 20:17 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Feby Putri Usik Official Lyric Video.mp3 | 2022-07-12 13:50 | 4.8M | |
![[VID]](/icons/movie.gif) | y2mate.com - Fariz RM Sakura Cover Jeje_v720P.mp4 | 2022-07-18 13:53 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - FamyAva speed up .mp3 | 2022-07-06 17:45 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - FamyAva Speed upLirik dan Terjemahan Tiktok Viral Song.mp3 | 2022-08-06 16:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - FYP KAMU CANTIK SANA SINI MAU X DANCA KUDURO DJ IMUT REMIX.mp3 | 2022-08-04 21:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Eyes blue or brown cant remember terpikat senyummu Heather X Eyes Blue Lirik Dan Terjemahan.mp3 | 2022-08-09 12:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Erikasub Indonesia.mp3 | 2022-07-09 10:15 | 2.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Engelbert Humperdinck A Man Without LoveLyricsI Had No Loving Arms To Hold Me Everyday I Wake Up.mp3 | 2022-07-07 17:16 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Eminem Without Me Official Music Video.mp3 | 2022-08-04 21:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Eminem Rap God Explicit.mp3 | 2022-08-04 21:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Eminem Godzilla ft Juice WRLD Directed by Cole Bennett.mp3 | 2022-08-04 21:07 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Ellie Goulding Juice WRLD Hate Me Official Video_v144P.mp4 | 2022-08-04 02:29 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Elley Duhé Middle of the Night 16D AUDIO NOT 8D Tiktok Song (1).mp3 | 2022-07-20 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Eiyuu No UtaUltraman Ginga S OpeningLirikTerjemahan Bahasa Indonesia.mp3 | 2022-08-05 17:56 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Egzod Maestro Chives Royalty ft Neoni Wiguez Alltair Remix NCS Release.mp3 | 2022-07-31 08:47 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Ed Sheeran Perfect Lyrics.mp3 | 2022-07-29 17:55 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - EazyE Real Muthaphuckkin Gs Music Video.mp3 | 2022-08-04 21:08 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - EVAN LOSS FULL SENYUM SAYANG.mp3 | 2022-08-11 17:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - EMAS HANTARAN ARIEF YOLLANDA LIVE COVER INDAH YASTAMI.mp3 | 2022-08-05 10:16 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dynasty.mp3 | 2022-07-26 18:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Durung Ikhlas LAVORA Official Music Video.mp3 | 2022-07-17 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Drip of The Japanese Emperor Hirohito Drip.mp3 | 2022-08-06 01:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dragonball Z Theme of Tapion HQ Epic Cover.mp3 | 2022-07-06 22:00 | 2.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dr Dre Snoop Dogg Nuthin But A G Thang HQ 192000 hz_320kbps.mp3 | 2022-08-04 01:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dolor Oscuro.mp3 | 2022-07-09 08:49 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj sad song Fallen Kingdom Ini kah yang kalian cari cari.mp3 | 2022-07-14 01:13 | 2.8M | |
![[VID]](/icons/movie.gif) | y2mate.com - Dj peluk cium peluk cium bolak balik dj tiktok terbaru 2022 peluk cium peluk cium_v240P.mp4 | 2022-07-09 05:20 | 10M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj come on come on turn the radio on dj tiktok terbaru 2022 dj cheap thrills.mp3 | 2022-06-29 11:55 | 5.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj We Dont Care Hard Type Beat Jedag Jedug Viral Tiktok 2021.mp3 | 2022-07-05 10:34 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Viral Tiktok Temanku Semua Pada Jahat X Enak Dong X Milkshake Trend Tiktok Nabih Fvnky .mp3 | 2022-06-30 16:32 | 3.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Viral Baby Dont Go Jedag Jedug Full Bass DJ SANTUY.mp3 | 2022-07-15 05:50 | 2.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Slow Itll Be Okay.mp3 | 2022-08-07 00:49 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Remix FULL BASS Harusnya Aku Armada Dj Terbaru tiktok indonesia.mp3 | 2022-06-27 20:58 | 5.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Come On Come On Slowed Reverb .mp3 | 2022-08-07 05:19 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Cloud Bread Kau mau apa lihatlah Lirik lagu 30 detik cocok buat story whatsapp .mp3 | 2022-07-28 04:28 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Chori Sonia X Mashup Viral By Adit Fvnky Rmx Dj Viral Tik Tok Terbaru 2022.mp3 | 2022-08-06 06:40 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Angklung NYAYIAN RINDU By IMp remix super slow terbaru 2021.mp3 | 2022-06-27 20:53 | 4.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dj Angel Baby mentahan ccp lirik lagu 30 detik .mp3 | 2022-07-26 09:52 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Disturbed Decadence Need for Speed Most Wanted Soundtrack 1080p.mp3 | 2022-07-13 19:35 | 3.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dimas anjay mabar profesional slebew sound effect.mp3 | 2022-07-18 21:13 | 96K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Different Heaven Safe And Sound NCS Release.mp3 | 2022-07-04 16:09 | 2.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Different Heaven Safe And Sound NCS Release.mp3 | 2022-07-09 03:56 | 2.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Deus Ex Mankind Divided Hacking Ambient Mix 1 Hour of Music.mp3 | 2022-07-01 09:35 | 56M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Demons Imagine Dragons Cover by Jada Facer Lirik dan Terjemahan.mp3 | 2022-08-02 14:26 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - De Killtros ley 20mil liricistas Outroks Beat Chyste MC.mp3 | 2022-07-15 05:20 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dandelions Ruth B Lirik Terjemahan Indonesia.mp3 | 2022-08-04 16:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dan Shay Justin Bieber 10000 Hours Official Music Video_96kbps.mp3 | 2022-07-31 04:04 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Daft Punk Robot Rock Official Video.mp3 | 2022-07-17 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Daaz Homie Valdes Fano HAKUNA MATATA Cover Audio.mp3 | 2022-06-29 22:52 | 3.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DVRST Autumn Wind.mp3 | 2022-06-29 12:14 | 2.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DUNIA BONEKA GTA ROLEPLAY SONG ProdBy RifkyArizaldy.mp3 | 2022-07-10 10:01 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DR LOVE DONT STAND SO CLOSE頭文字DINITIAL D.mp3 | 2022-08-04 18:55 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ ake ake yg paling dicari full bass DJ remix.mp3 | 2022-07-09 03:26 | 4.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ YAMETE KUDASAI TIKTOK VIRAL TERBARU 2021 DJ TIK TOK TERBARU 2021.mp3 | 2022-07-13 19:35 | 6.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ WORTH IT x BRENK Style Pong Pong Terbaru Ricko Pillow Remix.mp3 | 2022-07-29 06:31 | 528K | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TikTok Terbaru 2020 Lelah Berjuang Full Bass No Copyright Sound NCS_320kbps.mp3 | 2022-08-04 15:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TIKTOK Ku Bersyukur Memiliki Kamu Takkan Terganti Terbaru 2020.mp3 | 2022-06-27 20:59 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TIBAN BAHANA PUI REMIX TERBARU FULL BASS.mp3 | 2022-07-04 15:09 | 9.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ THAILAND VIRAL DJ SUCAT PELAT BOHONG REMIX VIRAL TIKTOK TERBARU 2022 DJ SUCAT PELAT BOHONG.mp3 | 2022-08-01 20:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TERBARU VIRAL HANYA SATU PERSINGGAHAN FULL BASS.mp3 | 2022-06-27 21:00 | 17M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TERBARU FULL BASS ALWAYS LOVING YOU NEW REMIX.mp3 | 2022-06-27 20:58 | 5.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TELOLET X RINDU SEMALAM SLOW Viral Di Fyp TikTok.mp3 | 2022-08-12 03:20 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TANGKIS DANG SLOW TIKTOK VIRAL 2022 TERBARU FULL BASS .mp3 | 2022-07-06 06:56 | 2.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ TANGKIS DANG BY DJ SOPAN SOUND OTAN VIRAL TIK TOK TERBARU 2022 YANG KALIAN CARI .mp3 | 2022-07-12 06:51 | 5.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SPONGEBOB TERBARU 2022.mp3 | 2022-07-17 02:25 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SLOW MALAM INI X TANGKIS DANG VIRAL TIKTOK 2022 YANG KALIAN CARI.mp3 | 2022-07-15 08:01 | 4.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUO REMIX VIRAL TIKTOK TERBARU 2022 JEDAG JEDUG FULL BASS DJ CAMPURAN.mp3 | 2022-08-11 13:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUO REMIX PALEMBANG JEDAG JEDUG MENGKANE VIRAL TIKTOK_2.mp3 | 2022-08-10 13:03 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUO REMIX PALEMBANG JEDAG JEDUG MENGKANE VIRAL TIKTOK.mp3 | 2022-08-08 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUO REMIX PALEMBANG JEDAG JEDUG MENGKANE VIRAL TIKTOK (2).mp3 | 2022-08-09 06:43 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUO BASS BETON X SADARKAH KASIH SCS ENTERTAINMENT VIRAL FYP TIKTOK 2022.mp3 | 2022-08-07 18:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUO BASS BETON X SADARKAH KASIH SCS ENTERTAINMENT VIRAL FYP TIKTOK 2022 (1).mp3 | 2022-07-23 13:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUA VIRAL TIKTOK TERBARU 2022.mp3 | 2022-07-29 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SIKOK BAGI DUA REMIX VIRAL TIKTOK TERBARU 2022 JEDAG JEDUG FULL BASS DJ CAMPURAN (1).mp3 | 2022-07-28 08:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SARI ROTI SARI ROTI X GOYANG SAMPE BAWAH SOUND MUNGIL VIRAL TIKTOK YANG KALIAN CARI .mp3 | 2022-06-28 08:05 | 9.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SA JANJI TRA MABUK LAGI BREAKBEAT REMIX VIRAL TIKTOK TERBARU .mp3 | 2022-07-11 14:18 | 2.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SAFE AND SOUND X PUSING PALA BARBIE Viral Ukur Ukur Remix DJ KUNANG.mp3 | 2022-08-01 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SAFE AND SOUND X GAM GAM TEKI X DISITU ENAK SUSU JANDA DJ TIKTOK VIRAL FULL BASS 2022 .mp3 | 2022-07-19 05:18 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ SAD BIKIN BAPER NAN KO PAHAM Dj HarrisNugraha Ft BLG RAP New Remix 2022.mp3 | 2022-07-31 08:45 | 7.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ RINDU SEMALAM REMIX JEDAG JEDUG MENGKANE VIRAL TIKTOK DJ SEMALAM KUTAHAN KUTAHAN SEMALAM.mp3 | 2022-07-22 01:44 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Party ABCDEFU x Menimisu Bass Pong Pong ftDJ TANTI .mp3 | 2022-07-29 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ PENANTIAN DJ VIRAL DJ TIKTOK TERBARU 2021.mp3 | 2022-06-27 20:58 | 7.2M | |
![[VID]](/icons/movie.gif) | y2mate.com - DJ PELUK CIUM PELUK CIUM BOLAK BALIK VIRAL TIKTOK JEDAG JEDUG TERBARU_v720P.mp4 | 2022-07-06 01:30 | 11M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ PELUK CIUM PELUK CIUM BOLAK BALIK VIRAL TIKTOK JEDAG JEDUG TERBARU.mp3 | 2022-07-07 05:48 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ PALING DI CARI HABIBIE VIRAL TIKTOK JEDAG JEDUG BAS GLER.mp3 | 2022-07-29 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ PAK PONG VONG SAMPAI BAWAH 2022 DJ IMUT REMIX_320kbps.mp3 | 2022-08-06 00:59 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ PAK PONG VONG SAMPAI BAWAH 2022 DJ IMUT REMIX.mp3 | 2022-08-04 21:05 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ OJO DI BANDINGKE REMIX VIRAL TIKTOK TERBARU 2022 WONG KO NGENE KOK DI BANDING BANDINGKE.mp3 | 2022-07-19 14:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ NO COMMENT VIRAL TIK TOK TERBARU 2022 YANG KALIAN CARI TUTY WIBOWO.mp3 | 2022-08-06 19:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ NO COMENT DI PUTUSIN PACARMU DI TINGGALIN PACARMU TIKTOK VIRAL 2022.mp3 | 2022-08-02 14:32 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ NDOO LIFE WOLFGANG DANCE V2 SOUND BABY SHARK VIRAL TIKTOK 2022.mp3 | 2022-07-10 17:49 | 14M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ NAMAKU BENTO SOUND RIMPURAENG VIRAL TIKTOK 2022.mp3 | 2022-07-29 07:33 | 5.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Malam Minggu Aku Ga Punya Pacar.mp3 | 2022-08-04 00:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ MENIMISU FULL BASS REMIX VIRAL TIKTOK TERBARU 2022 DJ MENIMISU FULL BASS VIRAL TIKTOK.mp3 | 2022-07-11 09:47 | 4.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ MENEKETEHE X STENDING MOTOR X BANGUN TIDUR SELFIE MENGKANE.mp3 | 2022-08-11 07:19 | 3.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ MENEKETEHE SLOW VINKY YETE FYP VIRAL TIKTOK.mp3 | 2022-07-17 18:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ MARI SEMUA DANSA DENGANKU JEDAG JEDUG MENGKANE VIRAL TIKTOK DJ MARI BERCINTA MBON MBON REMIX.mp3 | 2022-07-19 07:02 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ MARI BERCINTA VIRALDJ MARI SEMUA DANSA DENGANKU VIRAL TIKTOK 2022.mp3 | 2022-07-30 01:08 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ MAMBUTU SOUND 𝕽𝖎𝖟𝖐𝖎SZ BY KIKY REMIX KANE VIRAL FYP TIKTOK (1).mp3 | 2022-07-16 22:02 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Like Move It x Coco Song Viral Fyp TikTok Terbaru 2022 Ricko Pillow Remix.mp3 | 2022-07-29 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ LUGOWO X SULING SAKTI SLOW BASS BY ALVIN REVOLUTION.mp3 | 2022-07-18 09:03 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ LUGOWO ALIF CHRIZTO VIRAL TIK TOK.mp3 | 2022-07-27 09:56 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ LOVE NWANTITI SANGAT SANTUY ANGKLUNGREMIX FULL BASS TERBARU2021 BY FERNANDO BASS.mp3 | 2022-07-15 21:48 | 4.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ LISA MONEY VIRAL TIKTOK DJ MONEY LISA VIRAL TIKTOK TERBARU 2021.mp3 | 2022-06-27 20:59 | 17M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ LEGOWO 30 DETIK STORY BEAT VN FULL BASS VIRAL DI TIKTOK LINK MEDIAFIRE.mp3 | 2022-07-22 23:05 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Kopi Lambada x My Stand By Tik Tok Viral Terbaru 2022 Ricko Pillow Remix.mp3 | 2022-07-29 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Kanan Kiri Slow Reverb .mp3 | 2022-07-27 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KU HAMIL DULUAN SUDAH 3 BULAN SLOW Viral Di Fyp TikTok.mp3 | 2022-07-17 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KM CANTIK TAPI SANA SINI MAU X SELEBEW X AMELIA JEDAG JEDUG 2022 DJ IMUT REMIX.mp3 | 2022-08-04 21:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KEKASIH HALAL DIA GADIS BERKERUDUNG MERAH JEDAG JEDUG MENGKANE VIRAL TIKTOK BY RAKA REMIXER.mp3 | 2022-07-25 19:11 | 29M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KEKASIH HALAL DIA GADIS BERKERUDUNG MERAH JEDAG JEDUG MENGKANE VIRAL TIKTOK BY RAKA REMIXER(3).mp3 | 2022-06-30 15:41 | 404K | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KEJU JOGET ANGKLUNG YANG LAGI VIRAL TIKTOK TERBARU 2021 FULL BASS MENGKANE .mp3 | 2022-07-13 14:32 | 4.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANE MALAM INI TANGKIS DANG X TOCANA PISTA X JUJUR SA SUBILANG MENGKANE VIRAL TIKTOK.mp3 | 2022-07-15 05:49 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANE COME COME ON TURN THE RADIO ON X SAMPE BAWAH ENAKEUN DJ TERBARU 2022.mp3 | 2022-07-02 06:35 | 5.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANE COME COME ON TURN THE RADIO ON X SAMPE BAWAH ENAKEUN DJ TERBARU 2022 (1).mp3 | 2022-07-04 08:23 | 5.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANE AKIMILAKU MASIH GANTENG X DALINDA X MASHUP OLD MENGKANE VIRAL TIKTOK.mp3 | 2022-07-30 19:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANDAS DANGDUT DJ KANDAS JEDAG JEDUG SLOW FULL BASS VIRAL FYP TIK TOK 2022.mp3 | 2022-08-12 09:51 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANAN KIRI KANAN KIRI VERSI SLOW FULL BASS VIRAL TIKTOK 2021.mp3 | 2022-07-19 09:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANAN KIRI KANAN KIRI PUTAR PUTAR JARI TIKTOK VIRAL REMIX TERBARU FULL BASS 2021PUTER PUTER JARI.mp3 | 2022-07-20 12:30 | 348K | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ KANAN KIRI FULL BASS DJ KANAN KIRI GTA 5 ROLEPLAY VIRAL TIKTOK 2021.mp3 | 2022-07-21 03:47 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Jawa Ngamen 5 Slow Beat Viral Tiktok 2022 .mp3 | 2022-07-04 12:27 | 3.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ JOKO TINGKIR NGOMBE DOWET REMIX VIRAL TIKTOK TERBARU 2022.mp3 | 2022-08-01 06:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ JEDAG JEDUG FULL BASS Lagu tik tok viral 2021 WilfexBor Terbaru.mp3 | 2022-07-03 20:30 | 24M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ JEDAG JEDUG FULL BASS Lagu tik tok viral 2021 WilfexBor Terbaru (1).mp3 | 2022-08-09 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ I WANNA FEEL LIKE Slowed Version.mp3 | 2022-07-08 03:33 | 5.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ INI ADALAH AKU RAJA MEXICO FULL BASS TIKTOK VIRAL REMIX TER.mp3 | 2022-07-24 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ I NEED YOU BABY x SAMPE BAWAH TIKTOK VIRAL REMIX FULL BASS 2022.mp3 | 2022-08-05 17:49 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ HANING SING PUSING MUKA KAYA KINGKONG.mp3 | 2022-08-10 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ GORENG GORENG X CUKY CUKY X MASHUP OLD VIRAL MENGKANE.mp3 | 2022-07-19 16:39 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ GORENG GORENG BY DJ SOPAN JEDAG JEDUG VIRAL TIK TOK TERBARU 2022 YANG KALIAN CARI .mp3 | 2022-08-07 12:41 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ GLIMPSE OF US JOJI MENGKANE FYP TIKTOK.mp3 | 2022-07-11 10:05 | 7.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ GEDHANG KLUTUK JEDAG JEDUG STYLE.mp3 | 2022-07-29 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ GAUN MERAH FULL BASS REMIX TERBARU 2021 TIK TOK VIRAL.mp3 | 2022-06-27 20:58 | 5.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ EVERYTHING AT ONCE SOUND YT DANANKK MENGKANE.mp3 | 2022-07-18 20:36 | 6.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ DOMINO MAROKO TANGKIS DANG TIIKTOK VIRAL 2022.mp3 | 2022-08-10 12:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ DINDA JANGAN MARAH MARAH SLOW REMIX DJ ACAN.mp3 | 2022-06-27 20:58 | 6.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ DERMAGA BIRU Thomas Arya TIKTOK VIRAL TERBARU 2022 SLOW BASS.mp3 | 2022-08-01 10:26 | 6.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ DEAR DIARY SLOW REMIX JATIM SLOW BASS_320kbps.mp3 | 2022-07-28 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ DANZA KUDURO X STEREO LOVE TREND GONCENG AYANG VIRAL TIK TOK TERBARU 2022 YANG KALIAN CARI .mp3 | 2022-07-07 08:03 | 5.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Cinta Terlarang Sesungguhnya Kasih Sayangku Tiada Batas Remix.mp3 | 2022-06-27 20:57 | 6.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CUMA MANTAN RAHMAT TAHALU SOUND 𝘼𝟳 𝙃𝙄𝙍𝙊𝙒𝘼𝙉𝙂𝙂𝙔 VIRAL FYP TIKTOK TERBARU 2022.mp3 | 2022-07-07 07:17 | 12M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CLOSE YOUR EYE x BANGUN TIDUR SELFIE x GO SAMPE BAWAH VIRAL TIK TOK TERBARU 2022.mp3 | 2022-07-20 07:49 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CLOSE YOUR EYE x BANGUN TIDUR SELFIE x GO SAMPE BAWAH VIRAL TIK TOK TERBARU 2022 (1).mp3 | 2022-07-20 07:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CLOSE YOUR EYES X YA CUMA KAMU X TEKI TEKI GAM GAM Remix DJ KUNANG.mp3 | 2022-08-01 12:52 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CLOSE YOUR EYES X TAKI TAKI GAM GAMA VIRAL DJ IMUT REMIX.mp3 | 2022-08-04 21:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CHEAP THRILLS come on come on X AKU MAU APA Remix DJ KUNANG.mp3 | 2022-08-01 12:53 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CAMPURAN VIRAL TIKTOK 2022 JEDAG JEDUG FULL BASS TERBARU.mp3 | 2022-08-03 21:35 | 2.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CAMPURAN VIRAL TIKTOK 2022 JEDAG JEDUG FULL BASS TERBARU (1).mp3 | 2022-08-07 17:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CAMPURAN TIK TOK 2022 JEDAG JEDUG FULL BASS YANG LAGI VIRAL_2.mp3 | 2022-06-27 20:57 | 22M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CAMPURAN TIK TOK 2022 JEDAG JEDUG FULL BASS YANG LAGI VIRAL.mp3 | 2022-06-27 20:57 | 22M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ CAMPURAN FYP TIKTOK VIRAL TERBARU JEDAG JEDUG FULL BASS MENGKANE 2022 (1).mp3 | 2022-07-27 06:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ Buleud IMP ID REMIX viral tik tok.mp3 | 2022-06-27 20:55 | 4.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ BREAKBEAT REMIX 2021 LAGU BARAT PALING TERBARU FULLBASS BIKIN SUGES.mp3 | 2022-06-27 20:58 | 36M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ BILA NANTI ENGKAU TAK BAHAGIA KEMBALILAH PINTU SELALU TERBUKA DJ BILA NANTI VIRAL TIKTOK 2021.mp3 | 2022-06-27 20:54 | 7.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ BERDANSA DAN MENARI IKUTI ALUNAN LAGU MARI BERCINTA REMIX TIKTOK VIRAL 2022 FULL BASS.mp3 | 2022-07-15 07:56 | 4.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ BANGUN TIDUR SELFIE X JAMILAH ENGKOL X DAPA MALARIA MENGKANE.mp3 | 2022-07-01 14:34 | 4.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ BANGUN TIDUR SELFIE MAU MAKAN SELFIE X EMANG EMANG ENAK VIRAL TIK TOK ll TERBARU 2022.mp3 | 2022-07-29 07:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ ANGEL BABY JEDAG JEDUG FULL BEAT VIRAL TIKTOK TERBARU 2022 DJ KOMANG RIMEX DJ ANGEL BABY REMIX.mp3 | 2022-07-06 17:13 | 4.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ AMORPROHIBIDO X BAGI BAGI DOSA BY RIZWAN SOPAN DJ FYP TIK TOK VIRAL 2022 AMORPROHIBIDO.mp3 | 2022-07-29 03:48 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ AKU TITIPKAN DIA X SIA SIAKU BERJUANG DIRANTAU ORANG REMIX VIRAL TIKTOK ALBUM 2021 (1).mp3 | 2022-08-08 10:12 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ AKIMILAKU MASIH GANTENG DJ FYP TIK TOK VIRAL TERBARU 2022.mp3 | 2022-07-29 03:46 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ AKANKAH KAU MERASAKAN DJ TERSIMPAN Dj Viral.mp3 | 2022-06-27 20:53 | 7.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ AGUS ON THE MIX CUKUP KAU DISAMPINGKU REMIX VIRAL TIKTOK DJ RAGU X SEMBUH FULLBASS 2022.mp3 | 2022-07-19 16:45 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DJ.mp3 | 2022-08-06 14:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DEWA 19 KANGEN LIRIK REFF.mp3 | 2022-07-20 07:09 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DASH UCIHA MERINDUKANMU Bikin Baper official music video.mp3 | 2022-07-20 04:57 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DARCION MY OWN LYRICS.mp3 | 2022-08-09 12:35 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - DANCE WITH THE DEAD Kickstart My Heart Remix.mp3 | 2022-07-10 21:02 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Dákiti The Marías LyricsLetra full ver.mp3 | 2022-07-10 11:00 | 2.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Cristal MOYOT.mp3 | 2022-07-01 04:01 | 2.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Crimmees by 279empirebeats full edit song bass boost.mp3 | 2022-06-29 03:26 | 1.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Cowboy Jack Clement I Guess Things Happen That Way.mp3 | 2022-07-05 00:11 | 2.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Cosas De La Clica.mp3 | 2022-07-09 08:44 | 2.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Confirm Button Sound Effect HD.mp3 | 2022-07-10 17:23 | 43K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Chrisye Kala Cinta Menggoda Official Music Video.mp3 | 2022-07-05 13:41 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Christina Perri A Thousand Years Official Music Video.mp3 | 2022-08-05 16:17 | 4.4M | |
![[VID]](/icons/movie.gif) | y2mate.com - Central Cee Loading Music Video GRM Daily_v144P.mp4 | 2022-08-04 04:32 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Casablanca Nuha Bahrin dan Naufal Azrin.mp3 | 2022-07-30 06:01 | 435K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Calum Scott feat Lyodra Heaven Official Music Video.mp3 | 2022-07-13 00:34 | 3.0M | |
![[SND]](/icons/sound2.gif) | y2mate.com - CINTA TERBAIK X AKU KAU DAN KENANGAN DJ BABY CHIA.mp3 | 2022-06-30 10:54 | 19M | |
![[SND]](/icons/sound2.gif) | y2mate.com - CCP mentahan overlay lagu DJ Angel babylirik lagu 30 detik .mp3 | 2022-07-26 02:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - CASABLANCA.mp3 | 2022-08-03 16:51 | 956K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bully Walk Theme Music HD_320kbps.mp3 | 2022-07-28 12:16 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Budi Doremi Melukis Senja Official Video.mp3 | 2022-08-01 23:51 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Buồn Orinn Remix Reddy x Vũ Duy Khánh Remix Tik Tok 2021.mp3 | 2022-08-05 05:53 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bryan Cranston dancing on MIDNIGHT extended.mp3 | 2022-07-21 03:01 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bruno Mars Talking To The Moon Karaoke Piano.mp3 | 2022-07-25 19:16 | 3.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bruno Mars Locked Out Of Heaven Official Music Video.mp3 | 2022-08-07 00:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Blingos ft EL KATIBA.mp3 | 2022-08-11 20:35 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Blingos ft EL KATIBA عكس السرب Clip Officiel.mp3 | 2022-08-11 20:32 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bima Tarore Selamat Ulang Tahun Official Music Video.mp3 | 2022-06-27 21:27 | 3.7M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Billie Eilish Greatest Hits 2022 Billie Eilish Full Playlist Best Songs 2022 Billie Eilish 2022.mp3 | 2022-07-23 08:37 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Best Old School Rap Compilation US 1.mp3 | 2022-07-31 11:02 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Best Old Country Music Of All Time Old Country Songs Country SongsClassic Counry Collection.mp3 | 2022-07-17 17:59 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Best Imagine Dragons Never Broke Again Songs Of All Time Imagine Dragons Greatest Hits Album 2022_v720P.mp4 | 2022-07-15 11:29 | 120M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Best Hacker music Deface Music EVER.mp3 | 2022-07-07 15:27 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Beautiful Piano Music Vol 3 Relaxing Music for Studying Sleep or Relaxation.mp3 | 2022-08-06 21:39 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bayaan Din Dhalay Official Video.mp3 | 2022-07-29 20:36 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Batu Nisan Cahaya Bidadari.mp3 | 2022-07-12 04:12 | 7.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bass Drop Sound Effect HD.mp3 | 2022-07-13 14:27 | 65K | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bad Bunny Moscow Mule Official Video Un Verano Sin Ti.mp3 | 2022-08-03 02:10 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Bacaan Imam Sholat Suara Indahnya bikin Nangis Syaikh Salah Al Mussaly.mp3 | 2022-08-04 13:09 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - Baby You Kiss Me Ở Sâu Trong Tâm TríLac Vao Trong Mo Simon C ft Wuy Jena Remix_v720P (2).mp4 | 2022-06-29 03:04 | 23M | |
![[SND]](/icons/sound2.gif) | y2mate.com - BOOM BOOM BANG MIE PUQ X BOOMAYEAYE DJ IMUT REMIX.mp3 | 2022-06-30 10:52 | 2.6M | |
![[SND]](/icons/sound2.gif) | y2mate.com - BILA NANTI NABILA MAHARANI REMIX FULL BASS TERBARU 2021 VIRAL TIKTOK .mp3 | 2022-06-30 10:53 | 5.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - BIE KIBOE SELAMAT WISUDA KAWAN.mp3 | 2022-07-03 20:20 | 4.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - BAON CIKIDAP LAGU jorok official lirik video_320kbps.mp3 | 2022-07-27 23:01 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Ayon Starlight Lyrics.mp3 | 2022-07-27 17:03 | 3.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Awalnya Cinta Pandangan Pertama TIKTOKINDONESIATIKTOKKOREATIKTOKFYPSHORTTIKTOKFYP (1).mp3 | 2022-07-24 08:36 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Avenged Sevenfold Dear God Official Music Video.mp3 | 2022-08-04 14:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com-Autumn-Wind_320kbps.mp3.mp3 | 2022-07-04 19:03 | 9.9M | |
![[VID]](/icons/movie.gif) | y2mate.com - Asede konol versi upin ipin lucu_360p.mp4 | 2022-07-02 15:37 | 2.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Are You Ok x 太棒了 Whip Nae Nae ARS 2021 芒種 x Tik Tok ARS 2021 爱的暴风雨 x GTA Remix ARS.mp3 | 2022-07-21 03:42 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Arctic Monkeys Snap Out Of It Official Audio.mp3 | 2022-08-10 17:08 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Arctic Monkeys I Wanna Be Yours Lyrics.mp3 | 2022-08-09 14:56 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Arctic Monkeys 505 sped upLyrics 505 sped up danny fenton.mp3 | 2022-07-03 03:11 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Arcade Button Sound Effect HD_320kbps.mp3 | 2022-08-01 14:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Angry Birds Theme Song Earrape.mp3 | 2022-07-24 12:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Andrei Petrov Modniy Tanec soviet psych funk library music 1977 Russia USSR.mp3 | 2022-07-20 23:39 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Andra And The Backbone Sempurna Official Music Video.mp3 | 2022-07-22 08:06 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Always In Motion.mp3 | 2022-07-12 06:38 | 3.5M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Aloha 아로하 COOL 쿨 VIETSUB HANGUL.mp3 | 2022-07-05 02:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - All My Exs Live In Texas.mp3 | 2022-07-12 10:07 | 3.1M | |
![[SND]](/icons/sound2.gif) | y2mate.com - After Dark x Sweater Weather slowed and reverb.mp3 | 2022-07-29 07:03 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - After Dark x Sweater Weather.mp3 | 2022-07-06 03:16 | 4.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - AcesToAces memory lane.mp3 | 2022-08-01 09:50 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - A Way of Life.mp3 | 2022-07-13 02:50 | 7.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - AURORA Runaway Lyrics.mp3 | 2022-08-04 19:57 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ANGEL BABY Troye Sivan Reff.mp3 | 2022-08-03 05:58 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ALL LAGU BADSIDE INDOPRIDE ROLEPLAY FULL FRAKSI V2.mp3 | 2022-07-12 02:39 | 29M | |
![[SND]](/icons/sound2.gif) | y2mate.com - AJIMAT MY GANG Official Music Video.mp3 | 2022-08-02 06:46 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - AJIMAT MY GANG Official Music Video (1).mp3 | 2022-08-02 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Aşık Mahsuni Şerif Ağla Gözüm Ağla Remix TikTok Albay Gözlüm Albay Alman Gözlüm Alman Ağlay Gözlüm.mp3 | 2022-07-13 18:56 | 2.2M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 3107 4 Wn x Erik ft Nâu Official Music Video.mp3 | 2022-08-06 14:13 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - 505.mp3 | 2022-07-28 17:25 | 3.9M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 30 Minutes of Smooth Jazz.mp3 | 2022-08-04 01:00 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - 3 PEMUDA BERBAHAYA FEAT SALLSA BINTAN FULL ALBUM COVER TERBARU.mp3 | 2022-06-30 10:55 | 44M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 3 HOURS Most EPIC POWERFUL BATTLE MUSIC Powerful Instrumental Music Vol 1 PURE EPIC.mp3 | 2022-08-04 00:25 | 0 | |
![[VID]](/icons/movie.gif) | y2mate.com - 2pac Gansta Rap Old School Mix 2020New RapHip Hop Music Mix ft 2pac Eazy E Biggie Eminem_360p.mp4 | 2022-07-14 21:30 | 103M | |
![[VID]](/icons/movie.gif) | y2mate.com - 2Pac Thug 4 Life x Gramatik Dungeon Sound_360p.mp4 | 2022-07-06 22:08 | 6.4M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 2Pac Mask Off Oldschool My Chain remix.mp3 | 2022-07-31 16:00 | 4.5M | |
![[VID]](/icons/movie.gif) | y2mate.com - 2Pac Gangsta Rap Old School Mix July 2021 Best 2Pac Rap Hip Hop Music Mix ft Eminem Biggie_360p.mp4 | 2022-07-14 21:36 | 57M | |
![[VID]](/icons/movie.gif) | y2mate.com - 2Pac Fat Joe Plata o Plomo Hustle Corp Remix_360p.mp4 | 2022-07-15 00:01 | 17M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 𝘉𝘢𝘩𝘢𝘨𝘪𝘢𝘮𝘶 𝘉𝘢𝘩𝘢𝘨𝘪𝘢𝘬𝘶 𝘚𝘭𝘰𝘸𝘦𝘥.mp3 | 2022-07-22 23:05 | 920K | |
![[VID]](/icons/movie.gif) | y2mate.com - 𝕲𝖆𝖓𝖌𝖘𝖙𝖆 PHONK MIX_480p.mp4 | 2022-07-04 21:39 | 43M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 𝐘𝐞𝐚𝐭 𝐘𝐚𝐦 𝐧𝐢𝐠𝐡𝐭𝐜𝐨𝐫𝐞𝐬𝐩𝐞𝐝 𝐮𝐩 𝐢 𝐥𝐢𝐤𝐞 𝐬𝐱 𝐢 𝐥𝐢𝐤𝐞 𝐝𝐫𝐮𝐠𝐬.mp3 | 2022-07-24 08:36 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - 짜릿한 찰리 비트 Light Switch Charlie Puth xooos cover.mp3 | 2022-07-14 09:40 | 2.3M | |
![[SND]](/icons/sound2.gif) | y2mate.com - 뽀로로 5기 뽀롱뽀롱 뽀로로 오프닝 타이틀 곡.mp3 | 2022-07-31 20:03 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ささえる人の歌 back number.mp3 | 2022-08-10 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - បកពងវង Pak Pong Vong Remix Tiktok Viral 2021 Slow Beat.mp3 | 2022-07-10 17:49 | 2.8M | |
![[SND]](/icons/sound2.gif) | y2mate.com - ဒဌအမန ရပနငနမ.mp3 | 2022-08-06 18:54 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - ခငလတပပ မငခန Kwint Loot Pay Par Minn Khant Chinese.mp3 | 2022-08-06 18:56 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - عمر الزاهي 1982 الخلوي ساقي باقي يوم الجمعة خرجو الريام رأت عيني انا و المرسم ساعة الاخرة.mp3 | 2022-07-12 11:50 | 75M | |
![[SND]](/icons/sound2.gif) | y2mate.com - Счастливы вместе Заставка сериала_320kbps.mp3 | 2022-07-27 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Николай Минх Медленный фокстрот 1950.mp3 | 2022-07-20 23:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate.com - Иду курю.mp3 | 2022-07-05 00:06 | 3.3M | |
![[SND]](/icons/sound2.gif) | y2mate (mp3cut.net).mp3 | 2022-08-02 10:34 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate (mp3cut.net)(1).mp3 | 2022-08-02 16:07 | 0 | |
![[SND]](/icons/sound2.gif) | y2mate (mp3cut.net) (1).mp3 | 2022-07-17 22:45 | 1.8M | |
![[SND]](/icons/sound2.gif) | y2kah.mp3 | 2022-07-14 05:49 | 3.9M | |
![[SND]](/icons/sound2.gif) | y2f.mp3 | 2022-08-04 16:24 | 0 | |
![[SND]](/icons/sound2.gif) | y2black.mp3 | 2022-08-07 03:38 | 0 | |
![[SND]](/icons/sound2.gif) | y2.mp3 | 2022-08-09 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | y1.mp3 | 2022-08-09 12:49 | 0 | |
![[SND]](/icons/sound2.gif) | y.mp3 | 2022-08-12 14:58 | 104K | |
![[SND]](/icons/sound2.gif) | xzzz.mp3 | 2022-08-04 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | xzz.mp3 | 2022-07-30 13:42 | 0 | |
![[SND]](/icons/sound2.gif) | xzero.mp3 | 2022-07-26 06:18 | 0 | |
![[SND]](/icons/sound2.gif) | xz1.mp3 | 2022-07-15 16:56 | 3.7M | |
![[SND]](/icons/sound2.gif) | xz.mp3 | 2022-08-09 07:31 | 3.2M | |
![[SND]](/icons/sound2.gif) | xyz.mp3 | 2022-07-22 15:52 | 292K | |
![[SND]](/icons/sound2.gif) | xyrus4.mp3 | 2022-08-05 10:01 | 0 | |
![[SND]](/icons/sound2.gif) | xyrus3.mp3 | 2022-08-05 09:46 | 1.5M | |
![[SND]](/icons/sound2.gif) | xyrus2.mp3 | 2022-08-05 09:52 | 0 | |
![[SND]](/icons/sound2.gif) | xyrus1.mp3 | 2022-08-05 09:44 | 1.0M | |
![[SND]](/icons/sound2.gif) | xyr.mp3 | 2022-07-29 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | xyl-yes-no(mp3gid.me).mp3 | 2022-06-30 04:20 | 3.2M | |
![[SND]](/icons/sound2.gif) | xyecoc.mp3 | 2022-07-17 12:54 | 0 | |
![[SND]](/icons/sound2.gif) | xy.mp3 | 2022-08-11 04:37 | 0 | |
![[SND]](/icons/sound2.gif) | xxz.mp3 | 2022-07-08 11:21 | 1.8M | |
![[SND]](/icons/sound2.gif) | xxxxx.mp3 | 2022-07-30 13:37 | 0 | |
![[SND]](/icons/sound2.gif) | xxxx.mp3 | 2022-07-30 11:35 | 3.4M | |
![[SND]](/icons/sound2.gif) | xxxtontationchaabi.mp3 | 2022-07-22 20:11 | 0 | |
![[SND]](/icons/sound2.gif) | xxxtentacion_the_remedy_for_a_broken_heart_slowed_reverb.mp3 | 2022-07-14 18:00 | 7.5M | |
![[SND]](/icons/sound2.gif) | xxxmanera_-_Never_Broke_Again_(musmore.com).mp3 | 2022-08-08 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | xxxmanera-never-broke-again-mp3.mp3 | 2022-08-09 11:09 | 0 | |
![[SND]](/icons/sound2.gif) | xxxmanera-NeverBrokeAgain(musmore.com).mp3 | 2022-08-09 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | xxxmanera-MaisonMargiela.mp3 | 2022-07-05 13:10 | 6.9M | |
![[SND]](/icons/sound2.gif) | xxxmanera - Loyalty Before Royalty.mp3 | 2022-08-03 23:46 | 0 | |
![[SND]](/icons/sound2.gif) | xxxiaoli006.mp3 | 2022-07-24 09:18 | 0 | |
![[SND]](/icons/sound2.gif) | xxx.mp3 | 2022-07-27 18:38 | 2.1M | |
![[SND]](/icons/sound2.gif) | xxv.mp3 | 2022-07-23 01:31 | 176K | |
![[SND]](/icons/sound2.gif) | xxtxx.mp3 | 2022-08-04 14:29 | 0 | |
![[SND]](/icons/sound2.gif) | xxthap.mp3 | 2022-07-24 08:44 | 2.4M | |
![[SND]](/icons/sound2.gif) | xxtha.mp3 | 2022-06-28 07:00 | 2.6M | |
![[SND]](/icons/sound2.gif) | xxth.mp3 | 2022-06-28 06:59 | 4.4M | |
![[SND]](/icons/sound2.gif) | xxtetacion.mp3 | 2022-08-03 01:19 | 0 | |
![[SND]](/icons/sound2.gif) | xxk.mp3 | 2022-07-08 23:28 | 23M | |
![[SND]](/icons/sound2.gif) | xxiaaoli06.mp3 | 2022-07-24 09:16 | 0 | |
![[SND]](/icons/sound2.gif) | xx.mp3 | 2022-08-11 04:33 | 3.3M | |
![[SND]](/icons/sound2.gif) | xwan100.mp3 | 2022-07-13 07:27 | 13M | |
![[SND]](/icons/sound2.gif) | xwan41.mp3 | 2022-08-12 01:58 | 0 | |
![[SND]](/icons/sound2.gif) | xwan40.mp3 | 2022-08-12 01:58 | 0 | |
![[SND]](/icons/sound2.gif) | xwan39.mp3 | 2022-08-12 01:59 | 0 | |
![[SND]](/icons/sound2.gif) | xwan38.mp3 | 2022-07-25 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | xwan37.mp3 | 2022-07-16 01:00 | 2.7M | |
![[SND]](/icons/sound2.gif) | xwan36.mp3 | 2022-07-09 03:45 | 4.4M | |
![[SND]](/icons/sound2.gif) | xwan35.mp3 | 2022-07-09 03:43 | 2.5M | |
![[SND]](/icons/sound2.gif) | xwan34.mp3 | 2022-07-09 03:45 | 3.9M | |
![[SND]](/icons/sound2.gif) | xwan33.mp3 | 2022-07-09 03:46 | 3.1M | |
![[SND]](/icons/sound2.gif) | xwan32.mp3 | 2022-07-09 03:45 | 4.0M | |
![[SND]](/icons/sound2.gif) | xwan31.mp3 | 2022-07-09 03:45 | 4.1M | |
![[SND]](/icons/sound2.gif) | xwan30.mp3 | 2022-07-08 13:06 | 3.8M | |
![[SND]](/icons/sound2.gif) | xwan29.mp3 | 2022-07-09 03:44 | 3.5M | |
![[SND]](/icons/sound2.gif) | xwan28.mp3 | 2022-07-04 01:00 | 4.4M | |
![[SND]](/icons/sound2.gif) | xwan27.mp3 | 2022-07-02 21:08 | 3.8M | |
![[SND]](/icons/sound2.gif) | xwan26.mp3 | 2022-07-02 21:02 | 3.7M | |
![[SND]](/icons/sound2.gif) | xwan25.mp3 | 2022-07-02 20:56 | 5.3M | |
![[SND]](/icons/sound2.gif) | xwan24.mp3 | 2022-07-02 20:51 | 4.2M | |
![[SND]](/icons/sound2.gif) | xwan23.mp3 | 2022-06-30 13:58 | 1.2M | |
![[SND]](/icons/sound2.gif) | xwan22.mp3 | 2022-06-30 13:57 | 2.8M | |
![[SND]](/icons/sound2.gif) | xwan21.mp3 | 2022-06-30 13:57 | 3.6M | |
![[SND]](/icons/sound2.gif) | xwan20.mp3 | 2022-06-29 06:39 | 3.7M | |
![[SND]](/icons/sound2.gif) | xwan19.mp3 | 2022-06-29 06:39 | 5.0M | |
![[SND]](/icons/sound2.gif) | xwan18.mp3 | 2022-06-29 06:29 | 9.4M | |
![[SND]](/icons/sound2.gif) | xwan17.mp3 | 2022-06-27 15:46 | 4.9M | |
![[SND]](/icons/sound2.gif) | xwan16.mp3 | 2022-06-27 15:46 | 5.3M | |
![[SND]](/icons/sound2.gif) | xwan15.mp3 | 2022-06-27 15:46 | 4.5M | |
![[SND]](/icons/sound2.gif) | xwan14.mp3 | 2022-06-27 15:45 | 2.7M | |
![[SND]](/icons/sound2.gif) | xwan13.mp3 | 2022-06-27 15:44 | 3.0M | |
![[SND]](/icons/sound2.gif) | xwan12.mp3 | 2022-06-27 15:45 | 2.6M | |
![[SND]](/icons/sound2.gif) | xwan11.mp3 | 2022-06-27 15:44 | 3.1M | |
![[SND]](/icons/sound2.gif) | xwan10.mp3 | 2022-06-27 15:44 | 3.7M | |
![[SND]](/icons/sound2.gif) | xwan9.mp3 | 2022-06-27 15:44 | 2.9M | |
![[SND]](/icons/sound2.gif) | xwan8.mp3 | 2022-06-27 15:45 | 11M | |
![[SND]](/icons/sound2.gif) | xwan7.mp3 | 2022-06-27 15:45 | 11M | |
![[SND]](/icons/sound2.gif) | xwan6.mp3 | 2022-06-27 15:45 | 3.8M | |
![[SND]](/icons/sound2.gif) | xwan5.mp3 | 2022-06-27 15:46 | 7.0M | |
![[SND]](/icons/sound2.gif) | xwan4.mp3 | 2022-06-27 15:46 | 12M | |
![[SND]](/icons/sound2.gif) | xwan3.mp3 | 2022-06-27 15:45 | 3.6M | |
![[SND]](/icons/sound2.gif) | xwan2.mp3 | 2022-06-27 15:32 | 3.7M | |
![[SND]](/icons/sound2.gif) | xwan1.mp3 | 2022-06-27 15:31 | 3.7M | |
![[SND]](/icons/sound2.gif) | xwan.mp3 | 2022-06-27 15:31 | 3.2M | |
![[SND]](/icons/sound2.gif) | xvx.mp3 | 2022-08-12 08:54 | 0 | |
![[SND]](/icons/sound2.gif) | xv.mp3 | 2022-08-04 01:38 | 0 | |
![[SND]](/icons/sound2.gif) | xuanthu.mp3 | 2022-07-12 23:39 | 2.9M | |
![[SND]](/icons/sound2.gif) | xuannghi.mp3 | 2022-08-04 13:09 | 0 | |
![[SND]](/icons/sound2.gif) | xtx2.mp3 | 2022-07-23 05:11 | 0 | |
![[SND]](/icons/sound2.gif) | xtenta.mp3 | 2022-07-30 13:11 | 2.1M | |
![[SND]](/icons/sound2.gif) | xs.mp3 | 2022-08-07 06:43 | 956K | |
![[SND]](/icons/sound2.gif) | xrenz9.mp3 | 2022-08-06 05:37 | 0 | |
![[SND]](/icons/sound2.gif) | xrenz7.mp3 | 2022-08-06 05:37 | 0 | |
![[SND]](/icons/sound2.gif) | xrenz6.mp3 | 2022-08-06 05:36 | 0 | |
![[SND]](/icons/sound2.gif) | xrenz5.mp3 | 2022-08-06 05:36 | 0 | |
![[SND]](/icons/sound2.gif) | xrenz4.mp3 | 2022-08-06 05:36 | 0 | |
![[SND]](/icons/sound2.gif) | xrenz3.mp3 | 2022-08-06 05:36 | 0 | |
![[SND]](/icons/sound2.gif) | xrenz1.mp3 | 2022-08-06 05:35 | 0 | |
![[SND]](/icons/sound2.gif) | xr.mp3 | 2022-08-03 15:35 | 0 | |
![[SND]](/icons/sound2.gif) | xoxo.mp3 | 2022-08-05 14:04 | 0 | |
![[SND]](/icons/sound2.gif) | xoremix.mp3 | 2022-06-29 11:12 | 5.1M | |
![[SND]](/icons/sound2.gif) | xooos.mp3 | 2022-07-17 02:30 | 0 | |
![[SND]](/icons/sound2.gif) | xomchua2.mp3 | 2022-07-13 07:16 | 4.2M | |
![[SND]](/icons/sound2.gif) | xomchua1.mp3 | 2022-07-12 13:55 | 12M | |
![[SND]](/icons/sound2.gif) | xoahet.mp3 | 2022-07-11 02:34 | 5.3M | |
![[SND]](/icons/sound2.gif) | xo1.mp3 | 2022-08-02 19:58 | 0 | |
![[SND]](/icons/sound2.gif) | xo.mp3 | 2022-08-07 22:05 | 0 | |
![[SND]](/icons/sound2.gif) | xnxx.mp3 | 2022-07-22 13:28 | 3.7M | |
![[SND]](/icons/sound2.gif) | xmrd.mp3 | 2022-07-13 14:14 | 3.3M | |
![[SND]](/icons/sound2.gif) | xmn.mp3 | 2022-06-28 04:18 | 2.5M | |
![[SND]](/icons/sound2.gif) | xml.mp3 | 2022-07-29 04:42 | 0 | |
![[SND]](/icons/sound2.gif) | xj.mp3 | 2022-08-07 21:46 | 0 | |
![[SND]](/icons/sound2.gif) | xipo.mp3 | 2022-08-10 15:18 | 0 | |
![[SND]](/icons/sound2.gif) | xinmaruocdauremix.mp3 | 2022-07-26 17:53 | 0 | |
![[SND]](/icons/sound2.gif) | xinmaruocdau.mp3 | 2022-08-10 05:52 | 0 | |
![[SND]](/icons/sound2.gif) | xin 1 lần say.mp3 | 2022-07-21 12:38 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoolii006.mp3 | 2022-07-24 09:09 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoolii005.mp3 | 2022-07-24 09:05 | 4.3M | |
![[SND]](/icons/sound2.gif) | xiaoli5.mp3 | 2022-07-24 08:54 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoli006.mp3 | 2022-07-24 09:15 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoli005.mp3 | 2022-07-24 08:29 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoli004.mp3 | 2022-07-17 20:29 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoli004 (1).mp3 | 2022-07-17 20:48 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoli003.mp3 | 2022-07-17 13:30 | 2.8M | |
![[SND]](/icons/sound2.gif) | xiaoli002.mp3 | 2022-07-14 15:47 | 3.2M | |
![[SND]](/icons/sound2.gif) | xiaoli001.mp3 | 2022-07-14 15:32 | 4.5M | |
![[SND]](/icons/sound2.gif) | xiaoli0005.mp3 | 2022-07-24 08:50 | 0 | |
![[SND]](/icons/sound2.gif) | xiaoli0004.mp3 | 2022-07-17 20:50 | 2.9M | |
![[SND]](/icons/sound2.gif) | xepchulofi.mp3 | 2022-07-05 04:54 | 2.6M | |
![[SND]](/icons/sound2.gif) | xepchuilofi.mp3 | 2022-07-17 06:33 | 2.6M | |
![[SND]](/icons/sound2.gif) | xepchui.mp3.mp3 | 2022-07-03 15:19 | 2.6M | |
![[SND]](/icons/sound2.gif) | xeon1.mp3 | 2022-07-01 07:53 | 4.4M | |
![[SND]](/icons/sound2.gif) | xen4.mp3 | 2022-07-04 09:50 | 61M | |
![[SND]](/icons/sound2.gif) | xen3.mp3 | 2022-06-30 10:49 | 5.1M | |
![[SND]](/icons/sound2.gif) | xen2.mp3 | 2022-06-29 11:48 | 11M | |
![[SND]](/icons/sound2.gif) | xen1.mp3 | 2022-06-29 11:32 | 11M | |
![[SND]](/icons/sound2.gif) | xeli5.mp3 | 2022-07-17 15:45 | 0 | |
![[SND]](/icons/sound2.gif) | xeli4.mp3 | 2022-07-17 14:55 | 2.0M | |
![[SND]](/icons/sound2.gif) | xeli3.mp3 | 2022-07-17 14:55 | 4.9M | |
![[SND]](/icons/sound2.gif) | xeli2.mp3 | 2022-07-17 14:55 | 3.7M | |
![[SND]](/icons/sound2.gif) | xeli1.mp3 | 2022-07-19 08:01 | 0 | |
![[SND]](/icons/sound2.gif) | xeli0.mp3 | 2022-07-19 08:01 | 0 | |
![[SND]](/icons/sound2.gif) | xdhii1.mp3 | 2022-08-09 07:36 | 0 | |
![[SND]](/icons/sound2.gif) | xdandelions.mp3 | 2022-07-01 18:29 | 3.7M | |
![[SND]](/icons/sound2.gif) | xd.mp3 | 2022-08-07 22:13 | 0 | |
![[SND]](/icons/sound2.gif) | xcho_ty-i-ya.mp3 | 2022-08-10 19:50 | 0 | |
![[SND]](/icons/sound2.gif) | xcho-listok.mp3 | 2022-08-08 19:37 | 0 | |
![[SND]](/icons/sound2.gif) | xcho-i-can-fly.mp3 | 2022-08-08 19:38 | 0 | |
![[SND]](/icons/sound2.gif) | xcho-gangster.mp3 | 2022-08-08 19:37 | 0 | |
![[SND]](/icons/sound2.gif) | xcho-feat-macan-memories.mp3 | 2022-08-08 19:37 | 0 | |
![[SND]](/icons/sound2.gif) | xc.mp3 | 2022-07-03 12:06 | 4.5M | |
![[SND]](/icons/sound2.gif) | xbat.mp3 | 2022-07-26 19:45 | 0 | |
![[SND]](/icons/sound2.gif) | xayoo-kurwa-moments (mp3cut.net).mp3 | 2022-07-23 17:52 | 0 | |
![[SND]](/icons/sound2.gif) | xau.mp3 | 2022-07-11 02:31 | 3.6M | |
![[SND]](/icons/sound2.gif) | xassa-all-night-mp3.mp3 | 2022-07-11 21:14 | 7.1M | |
![[SND]](/icons/sound2.gif) | xanders1.mp3 | 2022-07-20 11:35 | 0 | |
![[SND]](/icons/sound2.gif) | xanders.mp3 | 2022-07-09 05:48 | 5.1M | |
![[SND]](/icons/sound2.gif) | xander.mp3 | 2022-07-24 10:34 | 0 | |
![[SND]](/icons/sound2.gif) | xam.mp3 | 2022-07-01 09:40 | 4.7M | |
![[SND]](/icons/sound2.gif) | xa.mp3 | 2022-08-12 08:44 | 3.8M | |
![[SND]](/icons/sound2.gif) | x__⠀_05xx05 - uu mama kiku viru(1).mp3 | 2022-07-25 20:14 | 108K | |
![[SND]](/icons/sound2.gif) | xRiltz9215.mp3 | 2022-07-14 06:12 | 2.0M | |
![[SND]](/icons/sound2.gif) | xRiltz8310.mp3 | 2022-07-27 08:13 | 3.0M | |
![[SND]](/icons/sound2.gif) | xRiltz7777.mp3 | 2022-07-27 08:13 | 2.5M | |
![[SND]](/icons/sound2.gif) | xRiltz7772.mp3 | 2022-07-14 06:12 | 1.2M | |
![[SND]](/icons/sound2.gif) | xRiltz7363.mp3 | 2022-07-27 08:13 | 2.7M | |
![[SND]](/icons/sound2.gif) | xRiltz7237.mp3 | 2022-07-14 06:12 | 1.9M | |
![[SND]](/icons/sound2.gif) | xRiltz6672.mp3 | 2022-07-14 06:12 | 2.5M | |
![[SND]](/icons/sound2.gif) | xRiltz5563.mp3 | 2022-07-14 06:12 | 1.7M | |
![[SND]](/icons/sound2.gif) | xRiltz5227.mp3 | 2022-07-14 06:12 | 1.7M | |
![[SND]](/icons/sound2.gif) | xRiltz2318.mp3 | 2022-07-14 06:12 | 2.1M | |
![[SND]](/icons/sound2.gif) | xRiltz1939.mp3 | 2022-07-14 08:17 | 2.4M | |
![[SND]](/icons/sound2.gif) | xRiltz1605.mp3 | 2022-07-27 08:13 | 2.6M | |
![[SND]](/icons/sound2.gif) | xRiltz1373.mp3 | 2022-07-14 06:12 | 5.1M | |
![[SND]](/icons/sound2.gif) | xRiltz1010.mp3 | 2022-08-11 11:26 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1009.mp3 | 2022-08-11 11:26 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1007.mp3 | 2022-08-11 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1006.mp3 | 2022-08-11 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1005.mp3 | 2022-08-11 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1004.mp3 | 2022-08-11 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1003.mp3 | 2022-08-11 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1002.mp3 | 2022-08-11 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz1001.mp3 | 2022-08-11 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz209.mp3 | 2022-08-11 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz110.mp3 | 2022-08-04 08:27 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz108.mp3 | 2022-08-04 08:27 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz107.mp3 | 2022-08-04 08:27 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz106.mp3 | 2022-08-04 08:26 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz105.mp3 | 2022-08-04 08:27 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz104.mp3 | 2022-08-04 08:26 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz103.mp3 | 2022-08-04 08:26 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz102.mp3 | 2022-08-04 08:26 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz101.mp3 | 2022-08-11 11:22 | 0 | |
![[SND]](/icons/sound2.gif) | xRiltz27.mp3 | 2022-07-07 10:24 | 2.1M | |
![[SND]](/icons/sound2.gif) | xRiltz0992.mp3 | 2022-07-27 08:13 | 2.7M | |
![[SND]](/icons/sound2.gif) | xLiderWOTx - Tenca - Самурай (Rmx)[bassboosted][Screwed].mp3 | 2022-07-09 08:40 | 7.5M | |
![[SND]](/icons/sound2.gif) | xD.mp3 | 2022-07-17 12:08 | 48K | |
![[SND]](/icons/sound2.gif) | x3m.mp3 | 2022-07-02 05:25 | 2.8M | |
![[SND]](/icons/sound2.gif) | x2downloadcom-vvia-ate-192-kbps_zA30YidM.mp3 | 2022-07-10 08:12 | 2.5M | |
![[SND]](/icons/sound2.gif) | x2.mp3 | 2022-07-12 11:50 | 12M | |
![[SND]](/icons/sound2.gif) | x1kvp.mp3 | 2022-07-15 16:23 | 732K | |
![[SND]](/icons/sound2.gif) | x1.mp3 | 2022-07-12 11:49 | 6.2M | |
![[SND]](/icons/sound2.gif) | x0.mp3 | 2022-08-05 01:33 | 0 | |
![[VID]](/icons/movie.gif) | x.mp4 | 2022-07-20 04:31 | 0 | |
![[SND]](/icons/sound2.gif) | x.mp3 | 2022-08-11 20:30 | 93K | |
![[SND]](/icons/sound2.gif) | xǫᴢᴍʏ. - ᴄᴇᴧяʙи^.mp3 | 2022-07-09 09:51 | 3.2M | |
![[SND]](/icons/sound2.gif) | wywh.mp3 | 2022-07-08 06:04 | 3.8M | |
![[SND]](/icons/sound2.gif) | wykbl.mp3 | 2022-07-25 01:21 | 0 | |
![[SND]](/icons/sound2.gif) | wxd2r.mp3 | 2022-07-22 22:22 | 0 | |
![[SND]](/icons/sound2.gif) | wwwww.mp3 | 2022-07-16 12:33 | 4.8M | |
![[SND]](/icons/sound2.gif) | wwww.mp3 | 2022-08-01 19:01 | 2.2M | |
![[SND]](/icons/sound2.gif) | www.mp3 | 2022-07-21 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | www.m4a | 2022-07-13 19:07 | 1.4M | |
![[SND]](/icons/sound2.gif) | wwo.mp3 | 2022-07-02 03:24 | 3.4M | |
![[SND]](/icons/sound2.gif) | wwhh.mp3 | 2022-07-25 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | ww.mp3 | 2022-08-12 08:11 | 2.8M | |
![[SND]](/icons/sound2.gif) | wukog.mp3 | 2022-07-22 01:31 | 0 | |
![[SND]](/icons/sound2.gif) | wuhxntl3.mp3 | 2022-07-09 12:26 | 1.8M | |
![[SND]](/icons/sound2.gif) | wufuiqnvqwvpwcp.mp3 | 2022-07-28 04:07 | 0 | |
![[SND]](/icons/sound2.gif) | wuahahhahahahahaahhahahahahaosas.mp3 | 2022-07-11 06:30 | 46K | |
![[SND]](/icons/sound2.gif) | wthrngwthy.mp3 | 2022-08-06 12:01 | 756K | |
![[SND]](/icons/sound2.gif) | wth69.mp3 | 2022-06-28 10:10 | 6.5M | |
![[SND]](/icons/sound2.gif) | wtf2.mp3 | 2022-07-10 08:19 | 2.1M | |
![[SND]](/icons/sound2.gif) | wtf.mp3 | 2022-08-12 11:03 | 1.6M | |
![[SND]](/icons/sound2.gif) | wtf-boom.mp3 | 2022-07-25 22:54 | 73K | |
![[SND]](/icons/sound2.gif) | wt69.mp3 | 2022-06-29 13:34 | 7.6M | |
![[SND]](/icons/sound2.gif) | wszechstronny2.mp3 | 2022-07-09 20:55 | 1.7M | |
![[SND]](/icons/sound2.gif) | wszechstronny.mp3 | 2022-07-09 15:49 | 1.4M | |
![[SND]](/icons/sound2.gif) | wsm6.mp3 | 2022-07-18 05:20 | 0 | |
![[SND]](/icons/sound2.gif) | wsm5.mp3 | 2022-07-18 05:20 | 0 | |
![[SND]](/icons/sound2.gif) | wsm4.mp3 | 2022-07-18 05:19 | 0 | |
![[SND]](/icons/sound2.gif) | wsm3.mp3 | 2022-07-18 05:19 | 0 | |
![[SND]](/icons/sound2.gif) | wsm2.mp3 | 2022-07-18 05:18 | 0 | |
![[SND]](/icons/sound2.gif) | wsm1.mp3 | 2022-07-18 05:40 | 0 | |
![[SND]](/icons/sound2.gif) | wshr1.mp3 | 2022-08-09 21:05 | 0 | |
![[SND]](/icons/sound2.gif) | wsb.mp3 | 2022-07-20 11:52 | 0 | |
![[SND]](/icons/sound2.gif) | wrs - Llámame _ official music video (320 kbps).mp3 | 2022-07-06 14:49 | 7.2M | |
![[SND]](/icons/sound2.gif) | wrong.mp3 | 2022-07-16 08:14 | 649K | |
![[SND]](/icons/sound2.gif) | writethisdown.mp3 | 2022-07-16 00:06 | 12M | |
![[SND]](/icons/sound2.gif) | wretch.00 - complete and total brain rot - 01 εε-.mp3 | 2022-07-28 22:49 | 0 | |
![[SND]](/icons/sound2.gif) | wrda.mp3 | 2022-07-13 20:44 | 463K | |
![[SND]](/icons/sound2.gif) | wr.mp3 | 2022-07-30 00:36 | 3.0M | |
![[SND]](/icons/sound2.gif) | wq.mp3 | 2022-07-14 02:19 | 3.3M | |
![[SND]](/icons/sound2.gif) | wpznxnns.mp3 | 2022-07-27 14:01 | 0 | |
![[SND]](/icons/sound2.gif) | wpue72.mp3 | 2022-06-28 22:13 | 31M | |
![[SND]](/icons/sound2.gif) | woyo1.mp3 | 2022-06-29 18:45 | 5.2M | |
![[SND]](/icons/sound2.gif) | wowy.mp3 | 2022-07-31 07:40 | 0 | |
![[SND]](/icons/sound2.gif) | wow thats a lotta words too bad im not readin em (1).mp3 | 2022-07-09 05:47 | 162K | |
![[SND]](/icons/sound2.gif) | wow thats a lotta words too bad im not readin em (1) (mp3cut.net).m4a | 2022-07-09 05:47 | 160K | |
![[SND]](/icons/sound2.gif) | wow.mp3 | 2022-08-10 13:55 | 2.1M | |
![[SND]](/icons/sound2.gif) | wotp2.mp3 | 2022-07-31 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | worsed0, SQL2VD — Panic Attack (www.lightaudio.ru).mp3 | 2022-07-17 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | workout1.mp3 | 2022-07-27 02:13 | 0 | |
![[SND]](/icons/sound2.gif) | worard5.mp3 | 2022-06-29 01:04 | 2.7M | |
![[SND]](/icons/sound2.gif) | wongwong.mp3 | 2022-07-03 07:18 | 3.7M | |
![[SND]](/icons/sound2.gif) | wongame.mp3 | 2022-07-26 21:03 | 51K | |
![[SND]](/icons/sound2.gif) | wong2.mp3 | 2022-08-04 12:46 | 0 | |
![[SND]](/icons/sound2.gif) | wong.mp3 | 2022-08-04 12:13 | 1.5M | |
![[SND]](/icons/sound2.gif) | wonderframe.mp3 | 2022-08-02 12:07 | 4.2M | |
![[SND]](/icons/sound2.gif) | wonder.mp3 | 2022-08-09 07:08 | 2.7M | |
![[SND]](/icons/sound2.gif) | won.mp3 | 2022-07-26 21:01 | 0 | |
![[SND]](/icons/sound2.gif) | wolfs song.mp3 | 2022-07-24 12:09 | 0 | |
![[SND]](/icons/sound2.gif) | wolfgang.mp3 | 2022-06-29 06:13 | 9.6M | |
![[SND]](/icons/sound2.gif) | wohaxntl7.mp3 | 2022-07-09 12:57 | 1.8M | |
![[SND]](/icons/sound2.gif) | wofeng.mp3 | 2022-07-25 10:11 | 0 | |
![[SND]](/icons/sound2.gif) | woefwoef.mp3 | 2022-07-03 21:06 | 46K | |
![[SND]](/icons/sound2.gif) | wodnikidamir.mp3 | 2022-07-01 03:48 | 3.7M | |
![[SND]](/icons/sound2.gif) | wodniki.mp3 | 2022-07-01 03:48 | 3.8M | |
![[SND]](/icons/sound2.gif) | woaeae.mp3 | 2022-08-05 13:45 | 0 | |
![[SND]](/icons/sound2.gif) | wo.mp3 | 2022-07-30 17:14 | 0 | |
![[SND]](/icons/sound2.gif) | wnmklfcdhvff.mp3 | 2022-07-22 22:48 | 0 | |
![[SND]](/icons/sound2.gif) | wkwkz.mp3 | 2022-07-07 17:08 | 3.3M | |
![[SND]](/icons/sound2.gif) | wkwkwk1.mp3 | 2022-08-06 00:57 | 0 | |
![[SND]](/icons/sound2.gif) | wkwkland.mp3 | 2022-07-24 15:12 | 0 | |
![[SND]](/icons/sound2.gif) | wkwk9.mp3 | 2022-06-30 14:02 | 4.9M | |
![[SND]](/icons/sound2.gif) | wkwk8.mp3 | 2022-06-30 07:32 | 3.6M | |
![[SND]](/icons/sound2.gif) | wkwk7.mp3 | 2022-06-30 07:33 | 3.9M | |
![[SND]](/icons/sound2.gif) | wkwk6.mp3 | 2022-06-30 07:32 | 3.3M | |
![[SND]](/icons/sound2.gif) | wkwk5.mp3 | 2022-06-30 04:39 | 5.5M | |
![[SND]](/icons/sound2.gif) | wkwk4.mp3 | 2022-06-30 04:03 | 3.6M | |
![[SND]](/icons/sound2.gif) | wkwk3.mp3 | 2022-06-30 03:46 | 3.3M | |
![[SND]](/icons/sound2.gif) | wkwk2.mp3 | 2022-06-30 03:36 | 4.1M | |
![[SND]](/icons/sound2.gif) | wkwk1.mp3 | 2022-06-30 03:29 | 3.4M | |
![[SND]](/icons/sound2.gif) | wkwk.mp3 | 2022-07-10 16:55 | 3.0M | |
![[SND]](/icons/sound2.gif) | wk3.mp3 | 2022-06-29 23:13 | 11M | |
![[SND]](/icons/sound2.gif) | wk.mp3 | 2022-07-09 05:24 | 5.4M | |
![[SND]](/icons/sound2.gif) | wizz24.mp3 | 2022-07-18 15:57 | 0 | |
![[SND]](/icons/sound2.gif) | wizz23.mp3 | 2022-07-18 15:54 | 148K | |
![[SND]](/icons/sound2.gif) | wizz22.mp3 | 2022-07-04 17:16 | 15M | |
![[SND]](/icons/sound2.gif) | wizz21.mp3 | 2022-07-04 17:15 | 7.3M | |
![[SND]](/icons/sound2.gif) | wizz20.mp3 | 2022-07-04 17:15 | 3.9M | |
![[SND]](/icons/sound2.gif) | wizz7.mp3 | 2022-07-04 17:14 | 3.6M | |
![[SND]](/icons/sound2.gif) | wizz6.mp3 | 2022-07-04 17:14 | 23M | |
![[SND]](/icons/sound2.gif) | wizz5.mp3 | 2022-07-04 17:10 | 4.1M | |
![[SND]](/icons/sound2.gif) | wizz4.mp3 | 2022-07-04 17:10 | 4.3M | |
![[SND]](/icons/sound2.gif) | wizz3.mp3 | 2022-07-04 17:10 | 26M | |
![[SND]](/icons/sound2.gif) | wizz2.mp3 | 2022-07-04 17:09 | 6.0M | |
![[SND]](/icons/sound2.gif) | wizz1.mp3 | 2022-07-04 17:09 | 3.7M | |
![[SND]](/icons/sound2.gif) | wizykontol.mp3 | 2022-08-08 14:14 | 0 | |
![[SND]](/icons/sound2.gif) | wiz.mp3 | 2022-08-06 01:00 | 0 | |
![[SND]](/icons/sound2.gif) | wiz-khalifa-still-wiz-official-music-video (2).mp3 | 2022-07-27 03:27 | 0 | |
![[SND]](/icons/sound2.gif) | withyou1.mp3 | 2022-07-04 09:57 | 6.2M | |
![[SND]](/icons/sound2.gif) | withyou.mp3 | 2022-07-27 16:59 | 670K | |
![[SND]](/icons/sound2.gif) | withyou (1).mp3 | 2022-07-27 16:47 | 0 | |
![[SND]](/icons/sound2.gif) | without you slowed sad song viral tik tok (2).mp3 | 2022-08-04 10:43 | 0 | |
![[SND]](/icons/sound2.gif) | withoutme.mp3 | 2022-07-12 09:56 | 4.5M | |
![[SND]](/icons/sound2.gif) | without.mp3 | 2022-07-01 16:31 | 3.9M | |
![[SND]](/icons/sound2.gif) | withmyhoe.mp3 | 2022-07-21 17:11 | 0 | |
![[SND]](/icons/sound2.gif) | withasmile.mp3 | 2022-08-06 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | with.mp3 | 2022-08-04 14:27 | 0 | |
![[SND]](/icons/sound2.gif) | wisky.mp3 | 2022-07-18 01:03 | 0 | |
![[SND]](/icons/sound2.gif) | wishyouwerehere.mp3 | 2022-06-29 16:25 | 3.8M | |
![[SND]](/icons/sound2.gif) | wishyou.mp3 | 2022-07-02 17:09 | 3.8M | |
![[SND]](/icons/sound2.gif) | wish_you_were_here_neck_deep_lirik_lagu_terjemahan_-6248466877100523877.mp3 | 2022-07-05 10:04 | 3.7M | |
![[SND]](/icons/sound2.gif) | wish1.mp3 | 2022-07-05 15:51 | 3.8M | |
![[SND]](/icons/sound2.gif) | wish.mp3 | 2022-07-29 14:21 | 3.8M | |
![[SND]](/icons/sound2.gif) | wir-sind-des-geyers-schwarzer-haufen.mp3 | 2022-07-08 22:38 | 7.1M | |
![[SND]](/icons/sound2.gif) | wipwup.mp3 | 2022-07-23 07:13 | 1.2M | |
![[SND]](/icons/sound2.gif) | winx-winx-phonk.mp3 | 2022-07-17 11:57 | 0 | |
![[SND]](/icons/sound2.gif) | winterr.mp3 | 2022-07-26 11:12 | 0 | |
![[SND]](/icons/sound2.gif) | winter.mp3 | 2022-07-26 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | wint.mp3 | 2022-08-08 11:57 | 0 | |
![[SND]](/icons/sound2.gif) | winis.mp3 | 2022-07-09 03:00 | 2.3M | |
![[SND]](/icons/sound2.gif) | wingstofly.mp3 | 2022-06-29 05:01 | 6.0M | |
![[SND]](/icons/sound2.gif) | wing.mp3 | 2022-07-18 02:44 | 942K | |
![[SND]](/icons/sound2.gif) | windd.mp3 | 2022-07-24 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | windahhwika.mp3 | 2022-07-29 07:40 | 0 | |
![[SND]](/icons/sound2.gif) | windah.mp3 | 2022-08-05 12:34 | 2.9M | |
![[SND]](/icons/sound2.gif) | windah.m4a | 2022-06-29 04:33 | 34M | |
![[SND]](/icons/sound2.gif) | wind.mp3 | 2022-08-08 20:03 | 0 | |
![[SND]](/icons/sound2.gif) | willson.mp3 | 2022-07-01 13:55 | 22M | |
![[SND]](/icons/sound2.gif) | willrain.mp3 | 2022-08-11 07:19 | 0 | |
![[SND]](/icons/sound2.gif) | wiliam2.mp3 | 2022-07-31 10:19 | 0 | |
![[SND]](/icons/sound2.gif) | wiliam1.mp3 | 2022-07-26 09:58 | 0 | |
![[SND]](/icons/sound2.gif) | wilfex.mp3 | 2022-06-27 20:02 | 24M | |
![[SND]](/icons/sound2.gif) | wilbur soot — maybe I was boring (www.lightaudio.ru).mp3 | 2022-08-04 20:51 | 0 | |
![[SND]](/icons/sound2.gif) | wilbur soot — maybe I was boring (www.lightaudio.ru) (2).mp3 | 2022-08-04 20:52 | 0 | |
![[SND]](/icons/sound2.gif) | wikawikaa.mp3 | 2022-06-28 03:31 | 2.9M | |
![[SND]](/icons/sound2.gif) | wikawika.mp3 | 2022-07-28 13:42 | 0 | |
![[SND]](/icons/sound2.gif) | wibuu.mp3 | 2022-08-12 17:22 | 0 | |
![[SND]](/icons/sound2.gif) | wibu10.mp3 | 2022-07-01 22:52 | 1.5M | |
![[SND]](/icons/sound2.gif) | wibu1.mp3 | 2022-07-28 09:08 | 3.9M | |
![[SND]](/icons/sound2.gif) | wibu.mp3 | 2022-07-31 10:28 | 1.0M | |
![[SND]](/icons/sound2.gif) | whybaby-skittles-mp3 (1).mp3 | 2022-08-04 04:23 | 0 | |
![[SND]](/icons/sound2.gif) | whyamisoinlove.mp3 | 2022-07-14 15:57 | 2.5M | |
![[SND]](/icons/sound2.gif) | whyalive-horoshiyagni-kod-file.mp3 | 2022-07-07 19:12 | 5.1M | |
![[SND]](/icons/sound2.gif) | whyalive, HOROSHIYAGNI - Код.mp3 | 2022-07-23 08:28 | 0 | |
![[SND]](/icons/sound2.gif) | why.mp3 | 2022-06-28 06:18 | 5.8M | |
![[SND]](/icons/sound2.gif) | wht.mp3 | 2022-06-30 13:58 | 2.4M | |
![[SND]](/icons/sound2.gif) | whoa.mp3 | 2022-07-28 14:45 | 2.4M | |
![[SND]](/icons/sound2.gif) | who.mp3 | 2022-08-12 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | whitneyshafer.mp3 | 2022-07-17 16:32 | 0 | |
![[SND]](/icons/sound2.gif) | white studs.mp3 | 2022-07-07 10:32 | 248K | |
![[SND]](/icons/sound2.gif) | white_NH4XfTU.mp3 | 2022-08-12 10:37 | 0 | |
![[SND]](/icons/sound2.gif) | white.mp3 | 2022-07-23 16:21 | 2.0M | |
![[SND]](/icons/sound2.gif) | whereyafrom.mp3 | 2022-07-27 14:14 | 0 | |
![[SND]](/icons/sound2.gif) | where.mp3 | 2022-07-26 11:47 | 0 | |
![[SND]](/icons/sound2.gif) | where-are-you-now-deluxe-mix-lost-frequencies-feat-calum-scott.mp3 | 2022-07-02 14:45 | 9.8M | |
![[SND]](/icons/sound2.gif) | whenimetyou.mp3 | 2022-08-02 12:15 | 0 | |
![[SND]](/icons/sound2.gif) | whenimetu.mp3 | 2022-07-19 03:26 | 0 | |
![[SND]](/icons/sound2.gif) | when.mp3 | 2022-06-28 04:18 | 7.0M | |
![[SND]](/icons/sound2.gif) | wheels off.mp3 | 2022-07-25 11:07 | 0 | |
![[SND]](/icons/sound2.gif) | wheat-in-the-wind-7159.mp3 | 2022-07-24 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | whatuget.mp3 | 2022-06-28 05:58 | 7.1M | |
![[SND]](/icons/sound2.gif) | what are you doing smith.mp3 | 2022-08-03 21:53 | 345K | |
![[SND]](/icons/sound2.gif) | what1.mp3 | 2022-07-11 18:33 | 932K | |
![[SND]](/icons/sound2.gif) | what.mp3 | 2022-08-08 01:13 | 2.1M | |
![[SND]](/icons/sound2.gif) | wgwghaha.mp3 | 2022-07-06 15:03 | 3.3M | |
![[SND]](/icons/sound2.gif) | wew.mp3 | 2022-07-30 19:01 | 155K | |
![[SND]](/icons/sound2.gif) | wev.mp3 | 2022-08-07 00:55 | 0 | |
![[SND]](/icons/sound2.gif) | westside.mp3 | 2022-07-07 12:01 | 2.5M | |
![[SND]](/icons/sound2.gif) | westlife.mp3 | 2022-07-25 16:12 | 1.5M | |
![[SND]](/icons/sound2.gif) | west.mp3 | 2022-07-18 17:50 | 12M | |
![[SND]](/icons/sound2.gif) | wes.mp3 | 2022-08-12 16:03 | 4.2M | |
![[SND]](/icons/sound2.gif) | werw (online-audio-converter.com).mp3 | 2022-08-05 16:49 | 0 | |
![[SND]](/icons/sound2.gif) | were1.mp3 | 2022-07-26 11:43 | 0 | |
![[SND]](/icons/sound2.gif) | wengi.mp3 | 2022-07-14 20:05 | 1.8M | |
![[SND]](/icons/sound2.gif) | wendy.mp3 | 2022-07-08 07:05 | 3.7M | |
![[SND]](/icons/sound2.gif) | wendow1.mp3 | 2022-07-06 14:36 | 3.2M | |
![[SND]](/icons/sound2.gif) | wendo1.mp3 | 2022-07-06 14:28 | 3.2M | |
![[SND]](/icons/sound2.gif) | wenaro-lxner-lyod-mp3.mp3 | 2022-07-16 03:58 | 5.9M | |
![[SND]](/icons/sound2.gif) | wen.mp3 | 2022-07-16 08:14 | 309K | |
![[SND]](/icons/sound2.gif) | wells-hold-song.mp3 | 2022-08-09 14:37 | 1.3M | |
![[SND]](/icons/sound2.gif) | wellness.mp3 | 2022-08-05 03:54 | 196K | |
![[SND]](/icons/sound2.gif) | wellerman.mp3 | 2022-07-03 09:02 | 2.4M | |
![[SND]](/icons/sound2.gif) | welldone.mp3 | 2022-07-17 15:06 | 0 | |
![[SND]](/icons/sound2.gif) | well.mp3 | 2022-07-28 05:34 | 0 | |
![[SND]](/icons/sound2.gif) | welcome to my paradise-(ultimix).mp3 | 2022-06-30 13:12 | 5.2M | |
![[SND]](/icons/sound2.gif) | welcome to chase credit union.mp3 | 2022-07-03 11:37 | 17K | |
![[SND]](/icons/sound2.gif) | welcome.mp3 | 2022-07-04 13:46 | 472K | |
![[SND]](/icons/sound2.gif) | wekwek.mp3 | 2022-07-28 13:16 | 0 | |
![[SND]](/icons/sound2.gif) | weirdo.mp3 | 2022-08-06 12:35 | 0 | |
![[SND]](/icons/sound2.gif) | wehavenobeggining.mp3 | 2022-07-19 01:05 | 103K | |
![[SND]](/icons/sound2.gif) | weeknd.mp3 | 2022-08-03 15:36 | 2.3M | |
![[SND]](/icons/sound2.gif) | weekend.mp3 | 2022-07-26 12:06 | 1.7M | |
![[SND]](/icons/sound2.gif) | weeds.mp3 | 2022-07-16 02:00 | 4.8M | |
![[SND]](/icons/sound2.gif) | wedding1.mp3 | 2022-07-10 17:53 | 3.2M | |
![[SND]](/icons/sound2.gif) | wedding.mp3 | 2022-07-10 16:25 | 3.4M | |
![[SND]](/icons/sound2.gif) | wearelegion.mp3 | 2022-07-19 01:05 | 90K | |
![[SND]](/icons/sound2.gif) | weareeternal.mp3 | 2022-07-19 01:05 | 104K | |
![[SND]](/icons/sound2.gif) | we.mp3 | 2022-07-29 13:23 | 1.3M | |
![[SND]](/icons/sound2.gif) | wddrrp.mp3 | 2022-07-07 11:22 | 2.9M | |
![[SND]](/icons/sound2.gif) | wcmp.mp3 | 2022-08-02 21:51 | 0 | |
![[SND]](/icons/sound2.gif) | wch.mp3 | 2022-06-30 22:15 | 4.3M | |
![[SND]](/icons/sound2.gif) | wb.mp3 | 2022-07-19 07:35 | 2.1M | |
![[SND]](/icons/sound2.gif) | way way.mp3 | 2022-07-19 15:15 | 0 | |
![[SND]](/icons/sound2.gif) | wayne.mp3 | 2022-07-16 01:57 | 4.8M | |
![[SND]](/icons/sound2.gif) | wayk.mp3 | 2022-08-05 04:42 | 0 | |
![[SND]](/icons/sound2.gif) | wax1.mp3 | 2022-08-09 16:05 | 0 | |
![[SND]](/icons/sound2.gif) | wawess.mp3 | 2022-07-15 00:21 | 3.2M | |
![[SND]](/icons/sound2.gif) | wawesad.mp3 | 2022-07-13 22:45 | 1.5M | |
![[SND]](/icons/sound2.gif) | waweped.mp3 | 2022-07-05 23:12 | 17M | |
![[SND]](/icons/sound2.gif) | wawefc.mp3 | 2022-08-02 01:45 | 0 | |
![[SND]](/icons/sound2.gif) | wawee.mp3 | 2022-07-05 23:12 | 4.8M | |
![[SND]](/icons/sound2.gif) | wawedj1.mp3 | 2022-07-13 22:44 | 2.1M | |
![[SND]](/icons/sound2.gif) | wawe70s.mp3 | 2022-07-15 00:29 | 3.9M | |
![[SND]](/icons/sound2.gif) | wawe70.mp3 | 2022-07-10 07:39 | 86M | |
![[SND]](/icons/sound2.gif) | wawe55.mp3 | 2022-07-24 05:49 | 0 | |
![[SND]](/icons/sound2.gif) | wawe12.mp3 | 2022-07-05 23:12 | 3.3M | |
![[SND]](/icons/sound2.gif) | wawe11.mp3 | 2022-07-05 23:12 | 18M | |
![[SND]](/icons/sound2.gif) | wawe6.mp3 | 2022-07-05 10:22 | 3.2M | |
![[SND]](/icons/sound2.gif) | wawe4.mp3 | 2022-07-05 10:19 | 5.9M | |
![[SND]](/icons/sound2.gif) | wawe2.mp3 | 2022-07-05 08:19 | 414K | |
![[SND]](/icons/sound2.gif) | wawe1.mp3 | 2022-07-05 08:36 | 4.1M | |
![[SND]](/icons/sound2.gif) | wawan.mp3 | 2022-06-27 16:40 | 5.9M | |
![[SND]](/icons/sound2.gif) | wawak.mp3 | 2022-07-03 12:26 | 226K | |
![[SND]](/icons/sound2.gif) | waw.mp3 | 2022-08-05 05:10 | 0 | |
![[SND]](/icons/sound2.gif) | wavin.mp3 | 2022-07-05 06:55 | 3.4M | |
![[SND]](/icons/sound2.gif) | waves.mp3 | 2022-07-22 04:46 | 0 | |
![[SND]](/icons/sound2.gif) | wave5.mp3 | 2022-07-02 16:46 | 4.9M | |
![[SND]](/icons/sound2.gif) | watr-fluid-10149 (1).mp3 | 2022-07-08 07:07 | 4.9M | |
![[SND]](/icons/sound2.gif) | waterstream.mp3 | 2022-07-23 16:21 | 0 | |
![[SND]](/icons/sound2.gif) | waterfall.mp3 | 2022-07-23 16:21 | 2.3M | |
![[SND]](/icons/sound2.gif) | water-splash-sound-effect.mp3 | 2022-08-01 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | watawat.mp3 | 2022-07-30 19:01 | 705K | |
![[SND]](/icons/sound2.gif) | wasted.mp3 | 2022-07-28 03:00 | 3.7M | |
![[SND]](/icons/sound2.gif) | wasted .mp3 | 2022-07-23 18:28 | 0 | |
![[SND]](/icons/sound2.gif) | washing.mp3 | 2022-08-09 12:05 | 1.8M | |
![[SND]](/icons/sound2.gif) | wasad11.mp3 | 2022-07-13 14:28 | 3.1M | |
![[SND]](/icons/sound2.gif) | wasad10.mp3 | 2022-06-30 00:37 | 2.7M | |
![[SND]](/icons/sound2.gif) | wasad9.mp3 | 2022-06-30 00:37 | 3.4M | |
![[SND]](/icons/sound2.gif) | wasad8.mp3 | 2022-06-30 00:36 | 3.2M | |
![[SND]](/icons/sound2.gif) | wasad7.mp3 | 2022-06-30 00:01 | 3.5M | |
![[SND]](/icons/sound2.gif) | wasad6.mp3 | 2022-06-30 00:01 | 2.6M | |
![[SND]](/icons/sound2.gif) | wasad5.mp3 | 2022-06-30 00:01 | 3.8M | |
![[SND]](/icons/sound2.gif) | wasad4.mp3 | 2022-06-29 23:57 | 4.6M | |
![[SND]](/icons/sound2.gif) | wasad3.mp3 | 2022-06-29 23:57 | 4.5M | |
![[SND]](/icons/sound2.gif) | wasad2.mp3 | 2022-06-29 23:56 | 3.9M | |
![[SND]](/icons/sound2.gif) | wasad1.mp3 | 2022-06-29 23:52 | 3.3M | |
![[SND]](/icons/sound2.gif) | was.mp3 | 2022-07-01 10:00 | 2.6M | |
![[SND]](/icons/sound2.gif) | warzz.mp3 | 2022-08-08 08:21 | 828K | |
![[SND]](/icons/sound2.gif) | warren.mp3 | 2022-07-16 01:57 | 4.8M | |
![[SND]](/icons/sound2.gif) | warr.mp3 | 2022-07-04 00:25 | 1.0M | |
![[SND]](/icons/sound2.gif) | warpa.mp3 | 2022-08-07 11:33 | 0 | |
![[SND]](/icons/sound2.gif) | warp.mp3 | 2022-07-30 18:33 | 12M | |
![[SND]](/icons/sound2.gif) | warn.mp3 | 2022-07-23 15:42 | 0 | |
![[SND]](/icons/sound2.gif) | warm skater in a wool hat - you.mp3 | 2022-06-28 17:44 | 2.3M | |
![[SND]](/icons/sound2.gif) | warhammer-40000-dawn-of-war-dreadnought-and-hellfire-dreadnought-quotes-256_9cC9W0Dm_[cut_2sec].mp3 | 2022-07-20 14:51 | 0 | |
![[SND]](/icons/sound2.gif) | war-soundtrack.mp3 | 2022-06-28 12:51 | 10M | |
![[SND]](/icons/sound2.gif) | wapon.mp3 | 2022-07-03 03:43 | 3.2M | |
![[SND]](/icons/sound2.gif) | wap.mp3 | 2022-07-22 11:32 | 3.7M | |
![[SND]](/icons/sound2.gif) | wanti.mp3 | 2022-08-01 09:17 | 0 | |
![[SND]](/icons/sound2.gif) | want.mp3 | 2022-07-22 09:10 | 2.7M | |
![[SND]](/icons/sound2.gif) | wannamarry.mp3 | 2022-08-09 16:46 | 0 | |
![[SND]](/icons/sound2.gif) | wanna.mp3 | 2022-07-26 06:13 | 2.0M | |
![[SND]](/icons/sound2.gif) | wanna-be-a-baller-chorus.mp3 | 2022-06-30 01:23 | 950K | |
![[VID]](/icons/movie.gif) | wann2.mp4 | 2022-07-21 14:51 | 0 | |
![[VID]](/icons/movie.gif) | wann1.mp4 | 2022-07-21 14:47 | 0 | |
![[SND]](/icons/sound2.gif) | wanjay.mp3 | 2022-07-23 06:40 | 0 | |
![[SND]](/icons/sound2.gif) | wandj5.mp3 | 2022-07-23 13:24 | 0 | |
![[SND]](/icons/sound2.gif) | wanafelll09.mp3 | 2022-07-23 04:59 | 0 | |
![[SND]](/icons/sound2.gif) | wan.mp3 | 2022-07-18 08:17 | 0 | |
![[SND]](/icons/sound2.gif) | walwalers.mp3 | 2022-07-26 03:26 | 0 | |
![[SND]](/icons/sound2.gif) | walwal.mp3 | 2022-08-09 18:24 | 6.3M | |
![[SND]](/icons/sound2.gif) | walk with me1.mp3 | 2022-08-11 03:55 | 272K | |
![[SND]](/icons/sound2.gif) | walking into Driftveil City like sounds like skill issue.mp3 | 2022-07-18 07:14 | 0 | |
![[SND]](/icons/sound2.gif) | walkie-talkie-turn-on-beep-SBA-300149699-preview.mp3 | 2022-08-08 04:26 | 0 | |
![[SND]](/icons/sound2.gif) | walk.mp3 | 2022-08-09 14:59 | 4.2M | |
![[SND]](/icons/sound2.gif) | walii.mp3 | 2022-08-04 15:44 | 0 | |
![[SND]](/icons/sound2.gif) | waliFA.mp3 | 2022-07-11 03:13 | 52M | |
![[SND]](/icons/sound2.gif) | wali2.mp3 | 2022-08-04 15:43 | 0 | |
![[SND]](/icons/sound2.gif) | wali1.mp3 | 2022-07-27 15:41 | 4.1M | |
![[SND]](/icons/sound2.gif) | wali.mp3 | 2022-08-04 15:35 | 2.9M | |
![[SND]](/icons/sound2.gif) | walangtayo.mp3 | 2022-07-29 05:59 | 0 | |
![[SND]](/icons/sound2.gif) | walangiba.mp3 | 2022-07-18 20:58 | 0 | |
![[SND]](/icons/sound2.gif) | walanggana.mp3 | 2022-07-19 08:47 | 3.2M | |
![[SND]](/icons/sound2.gif) | wala lang.mp3 | 2022-07-01 08:57 | 66K | |
![[SND]](/icons/sound2.gif) | walakana.mp3 | 2022-07-16 00:27 | 4.7M | |
![[SND]](/icons/sound2.gif) | wala.mp3 | 2022-07-16 13:33 | 6.5M | |
![[SND]](/icons/sound2.gif) | wal2.mp3 | 2022-08-02 01:54 | 0 | |
![[SND]](/icons/sound2.gif) | wal1.mp3 | 2022-08-02 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | wal.mp3 | 2022-08-02 02:19 | 0 | |
![[SND]](/icons/sound2.gif) | waktu.mp3 | 2022-07-08 20:40 | 3.2M | |
![[SND]](/icons/sound2.gif) | wakas.mp3 | 2022-07-08 19:58 | 12M | |
![[SND]](/icons/sound2.gif) | wak1.mp3 | 2022-08-06 16:29 | 1.0M | |
![[SND]](/icons/sound2.gif) | waitaminute.mp3 | 2022-07-09 11:02 | 2.9M | |
![[SND]](/icons/sound2.gif) | wail.mp3 | 2022-08-04 12:47 | 0 | |
![[SND]](/icons/sound2.gif) | wahyu.mp3 | 2022-08-05 20:18 | 4.3M | |
![[SND]](/icons/sound2.gif) | wahaipantai.mp3 | 2022-07-08 15:23 | 3.6M | |
![[SND]](/icons/sound2.gif) | wagies-bgm.mp3 | 2022-07-01 08:09 | 1.0M | |
![[SND]](/icons/sound2.gif) | wadimor122.mp3 | 2022-07-29 11:01 | 0 | |
![[SND]](/icons/sound2.gif) | wadimor.mp3 | 2022-07-17 15:20 | 1.1M | |
![[SND]](/icons/sound2.gif) | wadada.mp3 | 2022-07-30 13:56 | 0 | |
![[SND]](/icons/sound2.gif) | wac.mp3 | 2022-07-22 12:31 | 0 | |
![[SND]](/icons/sound2.gif) | waave.mp3 | 2022-08-01 01:44 | 0 | |
![[SND]](/icons/sound2.gif) | waan.mp3 | 2022-07-25 16:25 | 0 | |
![[SND]](/icons/sound2.gif) | wa9.mp3 | 2022-07-10 12:31 | 2.6M | |
![[SND]](/icons/sound2.gif) | wa8.mp3 | 2022-07-07 04:15 | 4.6M | |
![[SND]](/icons/sound2.gif) | wa7.mp3 | 2022-07-06 00:15 | 5.3M | |
![[SND]](/icons/sound2.gif) | wa6.mp3 | 2022-07-06 00:15 | 4.7M | |
![[SND]](/icons/sound2.gif) | wa5.mp3 | 2022-06-30 15:40 | 3.6M | |
![[SND]](/icons/sound2.gif) | wa4.mp3 | 2022-07-28 08:34 | 5.0M | |
![[SND]](/icons/sound2.gif) | wa3.mp3 | 2022-07-28 08:34 | 2.4M | |
![[SND]](/icons/sound2.gif) | wa2.mp3 | 2022-07-28 08:35 | 2.9M | |
![[SND]](/icons/sound2.gif) | wa1.mp3 | 2022-06-29 23:48 | 3.6M | |
![[SND]](/icons/sound2.gif) | wKgJWVke2J2Dl-aaACYxKZ44zZc717.mp3 | 2022-07-30 03:43 | 0 | |
![[SND]](/icons/sound2.gif) | w1bu.mp3 | 2022-07-31 11:27 | 0 | |
![[SND]](/icons/sound2.gif) | w00ds_-_Streetlight_(getmp3.pro).mp3 | 2022-07-05 23:05 | 7.0M | |
![[SND]](/icons/sound2.gif) | w.mp3 | 2022-08-07 14:38 | 2.8M | |
![[SND]](/icons/sound2.gif) | vzkaz pro Elle.mp3 | 2022-07-13 16:39 | 2.9M | |
![[SND]](/icons/sound2.gif) | vzen.mp3 | 2022-08-06 19:50 | 0 | |
![[SND]](/icons/sound2.gif) | vxkontrollll.mp3 | 2022-08-04 01:26 | 0 | |
![[SND]](/icons/sound2.gif) | vvG.mp3 | 2022-07-18 15:22 | 0 | |
![[SND]](/icons/sound2.gif) | vv4.mp3 | 2022-07-31 12:24 | 0 | |
![[SND]](/icons/sound2.gif) | vv.mp3 | 2022-08-12 08:16 | 200K | |
![[SND]](/icons/sound2.gif) | vv (2).mp3 | 2022-07-15 10:47 | 2.4M | |
![[SND]](/icons/sound2.gif) | vutrutronganh.mp3 | 2022-07-26 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | vuska-feat-zippo-dusha-kajfuj.mp3 | 2022-07-06 22:57 | 6.8M | |
![[VID]](/icons/movie.gif) | vuontam.mp4 | 2022-07-07 15:50 | 77M | |
![[SND]](/icons/sound2.gif) | vuAfvONq.mp3 | 2022-07-15 18:05 | 3.1M | |
![[SND]](/icons/sound2.gif) | vtornik_-_Dzhoni_Vonker_73215538.mp3 | 2022-08-09 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | vtornik-run-run-run-mp3_i9aAqw4g.mp3 | 2022-08-06 19:09 | 0 | |
![[SND]](/icons/sound2.gif) | vsyuno.mp3 | 2022-08-06 07:35 | 0 | |
![[SND]](/icons/sound2.gif) | vsxynbb.mp3 | 2022-08-05 06:29 | 0 | |
![[SND]](/icons/sound2.gif) | vskatarenai.mp3 | 2022-07-02 13:14 | 2.2M | |
![[SND]](/icons/sound2.gif) | vserana.mp3 | 2022-08-09 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | vse-treki-sanitis-fol.mp3 | 2022-08-01 16:45 | 0 | |
![[SND]](/icons/sound2.gif) | vs3.mp3 | 2022-08-09 22:55 | 0 | |
![[SND]](/icons/sound2.gif) | vs2.mp3 | 2022-08-09 22:54 | 0 | |
![[SND]](/icons/sound2.gif) | vs1.mp3 | 2022-08-09 22:54 | 0 | |
![[SND]](/icons/sound2.gif) | vs.mp3 | 2022-07-10 05:24 | 2.4M | |
![[SND]](/icons/sound2.gif) | vrchat - anime.mp3 | 2022-07-08 19:32 | 4.3M | |
![[SND]](/icons/sound2.gif) | vr.mp3 | 2022-07-08 16:33 | 4.0M | |
![[SND]](/icons/sound2.gif) | vp15.mp3 | 2022-07-04 13:12 | 830K | |
![[SND]](/icons/sound2.gif) | vp12.mp3 | 2022-07-04 11:38 | 2.4M | |
![[SND]](/icons/sound2.gif) | vp11.mp3 | 2022-08-09 23:28 | 0 | |
![[SND]](/icons/sound2.gif) | vp10.mp3 | 2022-08-12 23:02 | 0 | |
![[SND]](/icons/sound2.gif) | vp8.mp3 | 2022-08-02 08:10 | 3.1M | |
![[SND]](/icons/sound2.gif) | vp7.mp3 | 2022-08-12 01:12 | 0 | |
![[SND]](/icons/sound2.gif) | vp6.mp3 | 2022-07-23 12:00 | 49M | |
![[SND]](/icons/sound2.gif) | vp5.mp3 | 2022-07-03 12:59 | 3.0M | |
![[SND]](/icons/sound2.gif) | vp4.mp3 | 2022-08-06 06:29 | 2.8M | |
![[SND]](/icons/sound2.gif) | vp3.mp3 | 2022-08-06 06:28 | 240K | |
![[SND]](/icons/sound2.gif) | vp2.mp3 | 2022-08-12 17:30 | 3.4M | |
![[SND]](/icons/sound2.gif) | vp1.mp3 | 2022-08-12 17:30 | 4.9M | |
![[SND]](/icons/sound2.gif) | vp.mp3 | 2022-08-02 06:24 | 0 | |
![[SND]](/icons/sound2.gif) | vozmitrubku_chechnya.mp3 | 2022-07-07 11:40 | 900K | |
![[SND]](/icons/sound2.gif) | vozdisniatrevoga.mp3 | 2022-07-28 07:50 | 0 | |
![[SND]](/icons/sound2.gif) | votinh.mp3 | 2022-07-31 20:37 | 0 | |
![[SND]](/icons/sound2.gif) | vote2.mp3 | 2022-07-26 14:59 | 0 | |
![[SND]](/icons/sound2.gif) | vote1.mp3 | 2022-07-26 14:36 | 0 | |
![[SND]](/icons/sound2.gif) | vot999.mp3 | 2022-07-25 06:06 | 0 | |
![[SND]](/icons/sound2.gif) | vot.mp3 | 2022-07-25 06:01 | 0 | |
![[SND]](/icons/sound2.gif) | vot-i-pomer-ded-maksim-bez-nazvaniya.mp3 | 2022-07-15 19:41 | 5.9M | |
![[SND]](/icons/sound2.gif) | vortex1.mp3 | 2022-08-12 14:10 | 324K | |
![[SND]](/icons/sound2.gif) | vortex.mp3 | 2022-08-12 13:17 | 0 | |
![[SND]](/icons/sound2.gif) | voroninitop.mp3 | 2022-07-07 06:53 | 908K | |
![[SND]](/icons/sound2.gif) | vormrkredo.mp3 | 2022-07-09 18:12 | 3.8M | |
![[SND]](/icons/sound2.gif) | vonsscreamingnword.mp3 | 2022-07-10 21:04 | 339K | |
![[SND]](/icons/sound2.gif) | vongvong.mp3 | 2022-07-03 04:28 | 2.8M | |
![[SND]](/icons/sound2.gif) | von.mp3 | 2022-08-06 19:49 | 0 | |
![[SND]](/icons/sound2.gif) | voleran-hochu-kakat.mp3 | 2022-08-04 12:24 | 0 | |
![[SND]](/icons/sound2.gif) | voldsad2.mp3 | 2022-07-01 18:48 | 2.6M | |
![[SND]](/icons/sound2.gif) | voldsad1.mp3 | 2022-07-01 18:47 | 5.4M | |
![[SND]](/icons/sound2.gif) | volds2.mp3 | 2022-06-29 16:48 | 5.2M | |
![[SND]](/icons/sound2.gif) | volds0.mp3 | 2022-06-29 16:31 | 26M | |
![[SND]](/icons/sound2.gif) | volds.mp3 | 2022-06-29 16:02 | 9.3K | |
![[SND]](/icons/sound2.gif) | vold1.mp3 | 2022-06-29 13:07 | 5.3M | |
![[SND]](/icons/sound2.gif) | vol.mp3 | 2022-08-03 23:04 | 0 | |
![[SND]](/icons/sound2.gif) | voicemail01.mp3 | 2022-07-26 18:28 | 0 | |
![[SND]](/icons/sound2.gif) | voicemail.mp3 | 2022-07-24 17:00 | 3.4M | |
![[SND]](/icons/sound2.gif) | voice _ distance.m4a | 2022-07-18 00:48 | 0 | |
![[SND]](/icons/sound2.gif) | voice.mp3 | 2022-07-15 13:38 | 2.4M | |
![[SND]](/icons/sound2.gif) | voice-2022-07-06-14-54.mp3 | 2022-07-07 05:47 | 50K | |
![[SND]](/icons/sound2.gif) | voice-2022-07-06-14-53.mp3 | 2022-07-07 05:36 | 113K | |
![[SND]](/icons/sound2.gif) | voice-2022-07-06-14-50.mp3 | 2022-07-07 04:24 | 41K | |
![[SND]](/icons/sound2.gif) | voice-2022-07-06-14-47.mp3 | 2022-07-07 04:10 | 179K | |
![[SND]](/icons/sound2.gif) | voces-aztecascharly-loko-el-gop-td-feat-neto-pena-2016-raptrap-records.mp3 | 2022-06-29 22:53 | 6.9M | |
![[SND]](/icons/sound2.gif) | vocal.mp3 | 2022-07-27 14:48 | 0 | |
![[SND]](/icons/sound2.gif) | vnky.mp3 | 2022-07-10 18:02 | 3.1M | |
![[SND]](/icons/sound2.gif) | vn.mp3 | 2022-07-08 23:54 | 2.9M | |
![[SND]](/icons/sound2.gif) | vmrpringtone.mp3 | 2022-08-04 06:21 | 0 | |
![[SND]](/icons/sound2.gif) | vmrprin.mp3 | 2022-08-04 06:16 | 0 | |
![[SND]](/icons/sound2.gif) | vmrpintro.mp3 | 2022-08-04 06:52 | 3.4M | |
![[SND]](/icons/sound2.gif) | vmrpint.mp3 | 2022-08-04 06:28 | 0 | |
![[SND]](/icons/sound2.gif) | vmrpdj.mp3 | 2022-07-23 06:19 | 0 | |
![[SND]](/icons/sound2.gif) | vld1.mp3 | 2022-06-29 15:45 | 5.3M | |
![[SND]](/icons/sound2.gif) | vk4.mp3 | 2022-07-28 14:10 | 0 | |
![[SND]](/icons/sound2.gif) | vk3.mp3 | 2022-07-27 04:58 | 2.3M | |
![[SND]](/icons/sound2.gif) | vk2.mp3 | 2022-07-27 04:59 | 2.9M | |
![[SND]](/icons/sound2.gif) | vk1.mp3 | 2022-07-27 04:59 | 3.4M | |
![[SND]](/icons/sound2.gif) | vk.mp3 | 2022-08-01 09:40 | 0 | |
![[SND]](/icons/sound2.gif) | vjudjhfgkvgz.mp3 | 2022-08-09 12:11 | 0 | |
![[SND]](/icons/sound2.gif) | vize-tokio-hotel-white-lies-mp3.mp3 | 2022-07-28 03:40 | 2.5M | |
![[SND]](/icons/sound2.gif) | viyi.mp3 | 2022-08-08 12:07 | 0 | |
![[SND]](/icons/sound2.gif) | vivo8.mp3 | 2022-07-23 10:21 | 0 | |
![[SND]](/icons/sound2.gif) | vivienne_mort_-_persefona_muzati.net.mp3 | 2022-07-04 17:11 | 9.3M | |
![[VID]](/icons/movie.gif) | vivi_basith.mp4 | 2022-06-29 05:55 | 23M | |
![[SND]](/icons/sound2.gif) | viva.mp3 | 2022-08-04 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | viv11.mp3 | 2022-07-28 01:57 | 0 | |
![[SND]](/icons/sound2.gif) | vitoshd.mp3 | 2022-08-06 15:59 | 0 | |
![[SND]](/icons/sound2.gif) | viteza.mp3 | 2022-07-01 19:24 | 2.9M | |
![[SND]](/icons/sound2.gif) | vitalyaigraetvbrawlstars.mp3 | 2022-08-08 21:36 | 3.1M | |
![[SND]](/icons/sound2.gif) | vita.mp3 | 2022-07-20 02:13 | 0 | |
![[SND]](/icons/sound2.gif) | visokosnyj-god-tihij-ogonek.mp3 | 2022-07-27 19:33 | 0 | |
![[SND]](/icons/sound2.gif) | visokosnyj-god-tihij-ogonek (1).mp3 | 2022-07-31 18:29 | 0 | |
![[SND]](/icons/sound2.gif) | visi.mp3 | 2022-07-10 17:46 | 3.1M | |
![[SND]](/icons/sound2.gif) | vishnu.mp3 | 2022-08-04 09:24 | 0 | |
![[SND]](/icons/sound2.gif) | vishneviy_zakat(dankab) - И даже если не со мной.mp3 | 2022-07-12 04:57 | 445K | |
![[SND]](/icons/sound2.gif) | visauconmuademqua.mp3 | 2022-06-30 16:15 | 3.1M | |
![[SND]](/icons/sound2.gif) | virgoun.mp3 | 2022-07-01 17:26 | 8.1M | |
![[SND]](/icons/sound2.gif) | virgon.mp3 | 2022-07-29 14:21 | 4.7M | |
![[SND]](/icons/sound2.gif) | virgin.mp3 | 2022-07-18 03:32 | 0 | |
![[SND]](/icons/sound2.gif) | viral2.mp3 | 2022-07-07 01:24 | 22M | |
![[SND]](/icons/sound2.gif) | viral1.mp3 | 2022-07-07 00:35 | 3.8M | |
![[SND]](/icons/sound2.gif) | viral.mp3 | 2022-08-10 16:46 | 3.4M | |
![[SND]](/icons/sound2.gif) | vipusk.mp3.mp3 | 2022-08-10 11:25 | 0 | |
![[SND]](/icons/sound2.gif) | vipf.mp3 | 2022-06-27 12:24 | 9.1M | |
![[SND]](/icons/sound2.gif) | vip3.mp3 | 2022-08-09 08:06 | 0 | |
![[SND]](/icons/sound2.gif) | vip1.mp3 | 2022-07-09 15:06 | 2.2M | |
![[SND]](/icons/sound2.gif) | vip.mp3 | 2022-07-30 09:07 | 2.7M | |
![[SND]](/icons/sound2.gif) | violinalsopiano.mp3 | 2022-07-29 07:45 | 0 | |
![[SND]](/icons/sound2.gif) | violin.mp3 | 2022-07-20 12:59 | 2.9M | |
![[SND]](/icons/sound2.gif) | violetevergarden.mp3 | 2022-08-06 08:45 | 0 | |
![[SND]](/icons/sound2.gif) | violet.mp3 | 2022-07-21 18:25 | 0 | |
![[SND]](/icons/sound2.gif) | violation.mp3 | 2022-07-29 23:33 | 0 | |
![[SND]](/icons/sound2.gif) | vio.mp3 | 2022-07-07 06:12 | 31M | |
![[SND]](/icons/sound2.gif) | vinsz3.mp3 | 2022-07-03 05:18 | 1.9M | |
![[SND]](/icons/sound2.gif) | vinsz2.mp3 | 2022-06-29 21:51 | 2.8M | |
![[SND]](/icons/sound2.gif) | vinsz1.mp3 | 2022-06-29 06:21 | 12M | |
![[SND]](/icons/sound2.gif) | vinkyyt.mp3 | 2022-07-16 16:23 | 15M | |
![[SND]](/icons/sound2.gif) | vinky.mp3 | 2022-07-09 11:10 | 21M | |
![[SND]](/icons/sound2.gif) | vinhkysonggio.mp3 | 2022-08-01 03:55 | 0 | |
![[SND]](/icons/sound2.gif) | vingyt.mp3 | 2022-07-02 19:30 | 5.0M | |
![[SND]](/icons/sound2.gif) | vine-man-im-dead-kyrie-irving.mp3 | 2022-06-29 06:13 | 53K | |
![[SND]](/icons/sound2.gif) | vincent.mp3 | 2022-08-12 20:18 | 0 | |
![[SND]](/icons/sound2.gif) | vinayakan trance.mp3 | 2022-08-04 13:03 | 0 | |
![[SND]](/icons/sound2.gif) | vin.mp3 | 2022-07-20 09:40 | 0 | |
![[SND]](/icons/sound2.gif) | vim.mp3 | 2022-07-13 06:55 | 4.2M | |
![[SND]](/icons/sound2.gif) | villain_dark editing audios to evil laugh to.mp3 | 2022-06-27 14:54 | 6.6M | |
![[SND]](/icons/sound2.gif) | viktorwynd.mp3 | 2022-07-21 15:37 | 239K | |
![[SND]](/icons/sound2.gif) | viktor_korolev_-_murka_(z2.fm).mp3 | 2022-07-05 20:19 | 10M | |
![[SND]](/icons/sound2.gif) | viktor.mp3 | 2022-07-04 20:11 | 6.6M | |
![[SND]](/icons/sound2.gif) | viktor-cojj-zvezda-po-imeni-solnce.mp3 | 2022-07-21 09:44 | 3.4M | |
![[SND]](/icons/sound2.gif) | vikrem.mp3 | 2022-08-07 16:26 | 0 | |
![[SND]](/icons/sound2.gif) | vikramtime.mp3 | 2022-08-04 10:55 | 0 | |
![[SND]](/icons/sound2.gif) | vikramt.mp3 | 2022-06-29 01:22 | 3.3M | |
![[SND]](/icons/sound2.gif) | vikramslow.mp3 | 2022-08-04 16:04 | 0 | |
![[SND]](/icons/sound2.gif) | vikram mass.mp3 | 2022-07-27 07:32 | 0 | |
![[SND]](/icons/sound2.gif) | vikramgirl.mp3 | 2022-08-10 14:53 | 0 | |
![[SND]](/icons/sound2.gif) | vikram10.mp3 | 2022-07-03 09:28 | 7.2M | |
![[SND]](/icons/sound2.gif) | vikram1.mp3 | 2022-07-08 07:19 | 2.2M | |
![[SND]](/icons/sound2.gif) | vikram.mp3 | 2022-08-12 12:22 | 2.3M | |
![[SND]](/icons/sound2.gif) | vikraem.mp3 | 2022-08-07 16:33 | 0 | |
![[SND]](/icons/sound2.gif) | vikraam.mp3 | 2022-07-17 03:15 | 0 | |
![[SND]](/icons/sound2.gif) | vik1.mp3 | 2022-07-11 06:22 | 2.4M | |
![[SND]](/icons/sound2.gif) | vijay.mp3 | 2022-07-02 17:21 | 3.2M | |
![[SND]](/icons/sound2.gif) | vietcongdieua.mp3 | 2022-08-03 00:45 | 0 | |
![[SND]](/icons/sound2.gif) | vietcongcutomuonnam.mp3 | 2022-08-07 08:35 | 0 | |
![[SND]](/icons/sound2.gif) | viera.mp3 | 2022-07-05 14:48 | 4.0M | |
![[SND]](/icons/sound2.gif) | videoplayback~1.mp3 | 2022-07-07 17:36 | 3.4M | |
![[VID]](/icons/movie.gif) | videoplayback_2.mp4 | 2022-07-14 17:04 | 60M | |
![[SND]](/icons/sound2.gif) | videoplayback_2-[onlinevideoconverter.com].mp3 | 2022-08-08 06:31 | 38M | |
![[SND]](/icons/sound2.gif) | videoplayback_06052022.mp3 | 2022-07-05 10:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | videoplayback_05072022.mp3 | 2022-07-05 10:30 | 3.8M | |
![[SND]](/icons/sound2.gif) | videoplayback10.m4a | 2022-07-19 01:02 | 451K | |
![[SND]](/icons/sound2.gif) | videoplayback9.m4a | 2022-07-19 01:00 | 275K | |
![[VID]](/icons/movie.gif) | videoplayback.mp4 | 2022-08-12 19:19 | 4.0M | |
![[SND]](/icons/sound2.gif) | videoplayback.mp3 | 2022-08-10 17:54 | 2.4M | |
![[SND]](/icons/sound2.gif) | videoplayback.m4a | 2022-08-11 17:09 | 0 | |
![[SND]](/icons/sound2.gif) | videoplayback (online-audio-converter.com).mp3 | 2022-08-05 21:25 | 2.3M | |
![[SND]](/icons/sound2.gif) | videoplayback (online-audio-converter.com) (1).mp3 | 2022-08-05 20:05 | 1.1M | |
![[VID]](/icons/movie.gif) | videoplayback (16).mp4 | 2022-07-21 22:47 | 0 | |
![[SND]](/icons/sound2.gif) | videoplayback (16) (online-audio-converter.com).mp3 | 2022-07-13 20:22 | 57M | |
![[SND]](/icons/sound2.gif) | videoplayback (15) (online-audio-converter.com).mp3 | 2022-07-12 20:36 | 48M | |
![[VID]](/icons/movie.gif) | videoplayback (14).mp4 | 2022-07-11 20:06 | 89M | |
![[VID]](/icons/movie.gif) | videoplayback (13).mp4 | 2022-07-09 07:16 | 70K | |
![[SND]](/icons/sound2.gif) | videoplayback (13) (online-audio-converter.com).mp3 | 2022-07-11 20:02 | 29M | |
![[SND]](/icons/sound2.gif) | videoplayback (11) (online-audio-converter.com).mp3 | 2022-07-11 12:53 | 73M | |
![[SND]](/icons/sound2.gif) | videoplayback (10) (online-audio-converter.com).mp3 | 2022-07-10 22:47 | 97M | |
![[SND]](/icons/sound2.gif) | videoplayback (9) (online-audio-converter.com).mp3 | 2022-07-10 22:08 | 64M | |
![[SND]](/icons/sound2.gif) | videoplayback (8) (online-audio-converter.com).mp3 | 2022-07-10 21:27 | 36M | |
![[SND]](/icons/sound2.gif) | videoplayback (7) (online-audio-converter.com).mp3 | 2022-07-06 19:58 | 48M | |
![[SND]](/icons/sound2.gif) | videoplayback (5).m4a | 2022-06-28 21:09 | 7.3M | |
![[SND]](/icons/sound2.gif) | videoplayback (5) (online-audio-converter.com).mp3 | 2022-07-23 23:53 | 3.3M | |
![[SND]](/icons/sound2.gif) | videoplayback (4) (online-audio-converter.com).mp3 | 2022-07-05 19:10 | 57M | |
![[VID]](/icons/movie.gif) | videoplayback (3).mp4 | 2022-07-23 15:49 | 1.9M | |
![[SND]](/icons/sound2.gif) | videoplayback (3) (online-audio-converter.com).mp3 | 2022-07-04 19:51 | 55M | |
![[VID]](/icons/movie.gif) | videoplayback (2).mp4 | 2022-07-23 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | videoplayback (2).m4a | 2022-07-10 10:16 | 3.9M | |
![[SND]](/icons/sound2.gif) | videoplayback (2) (online-audio-converter.com).mp3 | 2022-08-05 20:15 | 6.4M | |
![[VID]](/icons/movie.gif) | videoplayback (1).mp4 | 2022-07-23 15:17 | 0 | |
![[SND]](/icons/sound2.gif) | videoplayback (1).m4a | 2022-07-13 04:26 | 2.3M | |
![[SND]](/icons/sound2.gif) | videoplayback (1) (online-video-cutter.com) (1).mp3 | 2022-08-07 19:46 | 0 | |
![[SND]](/icons/sound2.gif) | videoplayback (1) (online-audio-converter.com).mp3 | 2022-08-05 20:10 | 2.5M | |
![[VID]](/icons/movie.gif) | video_20220628_141009.mp4 | 2022-06-30 02:07 | 1.0M | |
![[VID]](/icons/movie.gif) | video_2022-07-04_01-08-25.mp4 | 2022-07-03 17:17 | 27M | |
![[SND]](/icons/sound2.gif) | video_2022-07-03_15-35-23 (online-audio-converter.com).mp3 | 2022-07-03 12:43 | 1.0M | |
![[SND]](/icons/sound2.gif) | video D2TPjenRx0s.mp3 | 2022-07-28 19:07 | 0 | |
![[VID]](/icons/movie.gif) | video1638263279_AdobeExpress - Copy (online-video-cutter.com).mp4 | 2022-08-05 18:36 | 0 | |
![[VID]](/icons/movie.gif) | video.mp4 | 2022-06-30 09:36 | 450M | |
![[SND]](/icons/sound2.gif) | video-output-D2829C5A-8152-4C31-85B5-ABA4EB5964C4.MP4.mp3 | 2022-06-27 16:18 | 28M | |
![[VID]](/icons/movie.gif) | video-1658059071.mp4 | 2022-08-04 09:44 | 1.4M | |
![[SND]](/icons/sound2.gif) | victoriouscityintro.mp3 | 2022-08-03 14:18 | 0 | |
![[VID]](/icons/movie.gif) | victor-e-leo-recuerdos-de-amor-video-clipe_bhLhDHtr.mp4 | 2022-07-06 16:12 | 13M | |
![[SND]](/icons/sound2.gif) | vic1.mp3 | 2022-07-09 17:56 | 3.5M | |
![[SND]](/icons/sound2.gif) | vibes gitar.mp3 | 2022-07-31 17:09 | 0 | |
![[SND]](/icons/sound2.gif) | viber_message 1623912255787.mp3 | 2022-07-06 19:17 | 25K | |
![[SND]](/icons/sound2.gif) | viber_message.mp3 | 2022-07-26 20:53 | 0 | |
![[SND]](/icons/sound2.gif) | vibe69.mp3 | 2022-06-28 12:31 | 5.8M | |
![[SND]](/icons/sound2.gif) | vibe1.mp3 | 2022-07-19 19:33 | 0 | |
![[SND]](/icons/sound2.gif) | vi.mp3 | 2022-08-07 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | vgd.mp3 | 2022-07-19 07:42 | 4.6M | |
![[SND]](/icons/sound2.gif) | vg.mp3 | 2022-08-04 02:51 | 0 | |
![[SND]](/icons/sound2.gif) | vfyvfy.mp3 | 2022-07-12 15:08 | 434K | |
![[SND]](/icons/sound2.gif) | vffgrgbybddt.mp3 | 2022-07-03 03:58 | 14M | |
![[SND]](/icons/sound2.gif) | vf.mp3 | 2022-08-09 16:56 | 0 | |
![[SND]](/icons/sound2.gif) | versace.mp3 | 2022-07-30 19:01 | 2.0M | |
![[SND]](/icons/sound2.gif) | versace🇨🇦 - vlaga «arut, big baby tape» (VLAGA).mp3 | 2022-07-25 19:09 | 0 | |
![[SND]](/icons/sound2.gif) | versace🇨🇦 - когда ты улыбаешься «remix».mp3 | 2022-07-26 10:45 | 0 | |
![[SND]](/icons/sound2.gif) | vercolyn.mp3 | 2022-07-26 06:23 | 0 | |
![[SND]](/icons/sound2.gif) | verbee-odin-mp3-1.mp3 | 2022-08-10 17:56 | 0 | |
![[SND]](/icons/sound2.gif) | vera-brezhneva-blizkie-ljudi.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | ver6.mp3 | 2022-07-18 11:19 | 0 | |
![[SND]](/icons/sound2.gif) | ver5.mp3 | 2022-07-18 11:15 | 0 | |
![[SND]](/icons/sound2.gif) | ver4.mp3 | 2022-07-18 11:14 | 0 | |
![[SND]](/icons/sound2.gif) | ver3.mp3 | 2022-07-18 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | ver2.mp3 | 2022-07-18 11:11 | 0 | |
![[SND]](/icons/sound2.gif) | ver1.mp3 | 2022-07-18 11:07 | 0 | |
![[SND]](/icons/sound2.gif) | venom2.mp3 | 2022-07-14 20:02 | 4.2M | |
![[SND]](/icons/sound2.gif) | venom.mp3 | 2022-07-26 10:30 | 396K | |
![[SND]](/icons/sound2.gif) | vend10.mp3 | 2022-07-10 14:33 | 2.8M | |
![[SND]](/icons/sound2.gif) | vend9.mp3 | 2022-07-10 14:33 | 2.3M | |
![[SND]](/icons/sound2.gif) | vend8.mp3 | 2022-07-10 14:33 | 3.5M | |
![[SND]](/icons/sound2.gif) | vend7.mp3 | 2022-07-10 14:26 | 20M | |
![[SND]](/icons/sound2.gif) | vend6.mp3 | 2022-07-10 14:25 | 9.0M | |
![[SND]](/icons/sound2.gif) | vend5.mp3 | 2022-07-10 14:24 | 4.2M | |
![[SND]](/icons/sound2.gif) | vend4.mp3 | 2022-07-07 14:53 | 3.7M | |
![[SND]](/icons/sound2.gif) | vend3.mp3 | 2022-07-07 14:52 | 36M | |
![[SND]](/icons/sound2.gif) | vend2.mp3 | 2022-07-06 15:53 | 3.9M | |
![[SND]](/icons/sound2.gif) | vend1.mp3 | 2022-07-06 15:36 | 3.8M | |
![[SND]](/icons/sound2.gif) | vend.mp3 | 2022-07-06 15:35 | 5.6M | |
![[SND]](/icons/sound2.gif) | vemw.mp3 | 2022-07-19 04:22 | 0 | |
![[SND]](/icons/sound2.gif) | vektor-a-lyudi-mp3.mp3 | 2022-08-10 19:22 | 0 | |
![[SND]](/icons/sound2.gif) | vegas.mp3 | 2022-07-29 14:21 | 236K | |
![[SND]](/icons/sound2.gif) | veer1.mp3 | 2022-07-04 14:18 | 3.3M | |
![[SND]](/icons/sound2.gif) | veer.mp3 | 2022-07-04 14:17 | 3.1M | |
![[SND]](/icons/sound2.gif) | vedro18.mp3 | 2022-06-30 06:09 | 3.7M | |
![[SND]](/icons/sound2.gif) | vedro17.mp3 | 2022-07-06 04:08 | 5.5M | |
![[SND]](/icons/sound2.gif) | vedro16.mp3 | 2022-06-30 06:08 | 5.2M | |
![[SND]](/icons/sound2.gif) | vedro15.mp3 | 2022-06-30 06:08 | 6.1M | |
![[SND]](/icons/sound2.gif) | vedro14.mp3 | 2022-06-30 06:08 | 6.1M | |
![[SND]](/icons/sound2.gif) | vedro13.mp3 | 2022-06-30 06:11 | 64M | |
![[SND]](/icons/sound2.gif) | vedro12.mp3 | 2022-06-30 06:09 | 16M | |
![[SND]](/icons/sound2.gif) | vedro11.mp3 | 2022-06-29 04:54 | 39M | |
![[SND]](/icons/sound2.gif) | vedro10.mp3 | 2022-06-29 04:52 | 6.1M | |
![[SND]](/icons/sound2.gif) | vedro9.mp3 | 2022-06-28 04:17 | 130M | |
![[SND]](/icons/sound2.gif) | vedro8.mp3 | 2022-06-28 04:08 | 7.1M | |
![[SND]](/icons/sound2.gif) | vedro7.mp3 | 2022-06-28 04:07 | 6.7M | |
![[SND]](/icons/sound2.gif) | vedro6.mp3 | 2022-06-28 04:07 | 7.2M | |
![[SND]](/icons/sound2.gif) | vedro5.mp3 | 2022-06-28 04:06 | 4.6M | |
![[SND]](/icons/sound2.gif) | vedro4.mp3 | 2022-06-28 04:06 | 25M | |
![[SND]](/icons/sound2.gif) | vedro3.mp3 | 2022-06-28 04:05 | 6.0M | |
![[SND]](/icons/sound2.gif) | vedro2.mp3 | 2022-06-29 04:51 | 7.8M | |
![[SND]](/icons/sound2.gif) | vedro1.mp3 | 2022-06-29 04:51 | 7.6M | |
![[SND]](/icons/sound2.gif) | vedo.mp3 | 2022-07-07 12:20 | 3.5M | |
![[SND]](/icons/sound2.gif) | vedi102.mp3 | 2022-07-23 05:17 | 0 | |
![[SND]](/icons/sound2.gif) | vedi101.mp3 | 2022-07-23 05:16 | 0 | |
![[SND]](/icons/sound2.gif) | vedi100.mp3 | 2022-06-29 12:08 | 9.9M | |
![[SND]](/icons/sound2.gif) | vedi99.mp3 | 2022-06-29 12:08 | 6.6M | |
![[SND]](/icons/sound2.gif) | vedi98.mp3 | 2022-06-29 12:24 | 7.6M | |
![[SND]](/icons/sound2.gif) | vedi97.mp3 | 2022-06-29 12:24 | 8.9M | |
![[SND]](/icons/sound2.gif) | vedi96.mp3 | 2022-06-29 12:24 | 6.7M | |
![[SND]](/icons/sound2.gif) | vedi95.mp3 | 2022-06-29 12:23 | 6.4M | |
![[SND]](/icons/sound2.gif) | vedi94.mp3 | 2022-06-29 12:23 | 5.2M | |
![[SND]](/icons/sound2.gif) | vedi93.mp3 | 2022-06-29 12:22 | 9.0M | |
![[SND]](/icons/sound2.gif) | vedi92.mp3 | 2022-06-29 12:22 | 8.0M | |
![[SND]](/icons/sound2.gif) | vedi91.mp3 | 2022-06-29 12:22 | 7.7M | |
![[SND]](/icons/sound2.gif) | vedi90.mp3 | 2022-06-29 12:21 | 5.6M | |
![[SND]](/icons/sound2.gif) | vedi89.mp3 | 2022-06-29 12:21 | 8.5M | |
![[SND]](/icons/sound2.gif) | vedi88.mp3 | 2022-06-29 12:21 | 9.0M | |
![[SND]](/icons/sound2.gif) | vedi87.mp3 | 2022-06-29 12:20 | 8.5M | |
![[SND]](/icons/sound2.gif) | vedi86.mp3 | 2022-06-29 12:20 | 9.1M | |
![[SND]](/icons/sound2.gif) | vedi85.mp3 | 2022-06-29 12:20 | 7.3M | |
![[SND]](/icons/sound2.gif) | vedi84.mp3 | 2022-06-29 12:20 | 5.6M | |
![[SND]](/icons/sound2.gif) | vedi83.mp3 | 2022-06-29 12:19 | 6.8M | |
![[SND]](/icons/sound2.gif) | vedi82.mp3 | 2022-06-29 12:19 | 15M | |
![[SND]](/icons/sound2.gif) | vedi81.mp3 | 2022-06-29 12:19 | 14M | |
![[SND]](/icons/sound2.gif) | vedi80.mp3 | 2022-06-29 12:19 | 10M | |
![[SND]](/icons/sound2.gif) | vedi79.mp3 | 2022-06-29 12:18 | 12M | |
![[SND]](/icons/sound2.gif) | vedi78.mp3 | 2022-06-29 12:19 | 7.5M | |
![[SND]](/icons/sound2.gif) | vedi77.mp3 | 2022-06-29 12:18 | 7.2M | |
![[SND]](/icons/sound2.gif) | vedi76.mp3 | 2022-06-29 12:18 | 5.7M | |
![[SND]](/icons/sound2.gif) | vedi75.mp3 | 2022-06-29 12:17 | 8.2M | |
![[SND]](/icons/sound2.gif) | vedi74.mp3 | 2022-06-29 12:17 | 9.3M | |
![[SND]](/icons/sound2.gif) | vedi73.mp3 | 2022-06-29 12:17 | 6.3M | |
![[SND]](/icons/sound2.gif) | vedi72.mp3 | 2022-06-29 12:17 | 7.9M | |
![[SND]](/icons/sound2.gif) | vedi71.mp3 | 2022-06-29 12:17 | 14M | |
![[SND]](/icons/sound2.gif) | vedi70.mp3 | 2022-06-29 12:16 | 11M | |
![[SND]](/icons/sound2.gif) | vedi69.mp3 | 2022-06-29 12:16 | 5.8M | |
![[SND]](/icons/sound2.gif) | vedi68.mp3 | 2022-06-29 12:16 | 6.7M | |
![[SND]](/icons/sound2.gif) | vedi67.mp3 | 2022-06-29 12:16 | 11M | |
![[SND]](/icons/sound2.gif) | vedi66.mp3 | 2022-06-29 12:16 | 17M | |
![[SND]](/icons/sound2.gif) | vedi65.mp3 | 2022-06-29 12:16 | 15M | |
![[SND]](/icons/sound2.gif) | vedi64.mp3 | 2022-06-29 12:15 | 9.9M | |
![[SND]](/icons/sound2.gif) | vedi63.mp3 | 2022-06-29 12:15 | 9.8M | |
![[SND]](/icons/sound2.gif) | vedi62.mp3 | 2022-06-29 12:15 | 11M | |
![[SND]](/icons/sound2.gif) | vedi61.mp3 | 2022-06-29 12:14 | 9.6M | |
![[SND]](/icons/sound2.gif) | vedi60.mp3 | 2022-06-29 12:14 | 11M | |
![[SND]](/icons/sound2.gif) | vedi59.mp3 | 2022-06-29 12:14 | 10M | |
![[SND]](/icons/sound2.gif) | vedi58.mp3 | 2022-06-29 12:14 | 8.1M | |
![[SND]](/icons/sound2.gif) | vedi57.mp3 | 2022-06-29 12:13 | 9.4M | |
![[SND]](/icons/sound2.gif) | vedi56.mp3 | 2022-06-29 12:13 | 9.5M | |
![[SND]](/icons/sound2.gif) | vedi55.mp3 | 2022-06-29 12:13 | 6.8M | |
![[SND]](/icons/sound2.gif) | vedi54.mp3 | 2022-06-29 12:13 | 6.9M | |
![[SND]](/icons/sound2.gif) | vedi53.mp3 | 2022-06-29 12:13 | 11M | |
![[SND]](/icons/sound2.gif) | vedi52.mp3 | 2022-06-29 12:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | vedi51.mp3 | 2022-06-29 12:12 | 2.7M | |
![[SND]](/icons/sound2.gif) | vedi50.mp3 | 2022-06-29 12:12 | 6.5M | |
![[SND]](/icons/sound2.gif) | vedi49.mp3 | 2022-06-29 12:12 | 7.4M | |
![[SND]](/icons/sound2.gif) | vedi48.mp3 | 2022-06-29 12:12 | 8.3M | |
![[SND]](/icons/sound2.gif) | vedi47.mp3 | 2022-06-29 12:11 | 7.9M | |
![[SND]](/icons/sound2.gif) | vedi46.mp3 | 2022-06-29 12:11 | 9.8M | |
![[SND]](/icons/sound2.gif) | vedi45.mp3 | 2022-06-29 12:11 | 9.0M | |
![[SND]](/icons/sound2.gif) | vedi44.mp3 | 2022-06-29 12:11 | 8.6M | |
![[SND]](/icons/sound2.gif) | vedi43.mp3 | 2022-06-29 12:10 | 8.6M | |
![[SND]](/icons/sound2.gif) | vedi42.mp3 | 2022-06-29 12:31 | 8.0M | |
![[SND]](/icons/sound2.gif) | vedi41.mp3 | 2022-06-29 12:30 | 7.4M | |
![[SND]](/icons/sound2.gif) | vedi40.mp3 | 2022-06-29 12:30 | 6.6M | |
![[SND]](/icons/sound2.gif) | vedi39.mp3 | 2022-06-29 12:30 | 6.4M | |
![[SND]](/icons/sound2.gif) | vedi38.mp3 | 2022-06-29 12:30 | 1.2M | |
![[SND]](/icons/sound2.gif) | vedi37.mp3 | 2022-06-29 12:30 | 7.7M | |
![[SND]](/icons/sound2.gif) | vedi36.mp3 | 2022-06-29 12:30 | 8.2M | |
![[SND]](/icons/sound2.gif) | vedi35.mp3 | 2022-06-29 12:29 | 5.4M | |
![[SND]](/icons/sound2.gif) | vedi34.mp3 | 2022-06-29 12:29 | 4.8M | |
![[SND]](/icons/sound2.gif) | vedi33.mp3 | 2022-06-29 12:29 | 11M | |
![[SND]](/icons/sound2.gif) | vedi32.mp3 | 2022-06-29 12:29 | 7.4M | |
![[SND]](/icons/sound2.gif) | vedi31.mp3 | 2022-06-29 12:29 | 11M | |
![[SND]](/icons/sound2.gif) | vedi30.mp3 | 2022-06-29 12:29 | 8.4M | |
![[SND]](/icons/sound2.gif) | vedi29.mp3 | 2022-06-29 12:28 | 6.0M | |
![[SND]](/icons/sound2.gif) | vedi28.mp3 | 2022-06-29 12:28 | 7.7M | |
![[SND]](/icons/sound2.gif) | vedi27.mp3 | 2022-06-29 12:28 | 6.4M | |
![[SND]](/icons/sound2.gif) | vedi26.mp3 | 2022-06-29 12:28 | 8.3M | |
![[SND]](/icons/sound2.gif) | vedi25.mp3 | 2022-06-29 12:28 | 6.6M | |
![[SND]](/icons/sound2.gif) | vedi24.mp3 | 2022-06-29 12:28 | 6.9M | |
![[SND]](/icons/sound2.gif) | vedi23.mp3 | 2022-06-29 12:27 | 6.9M | |
![[SND]](/icons/sound2.gif) | vedi22.mp3 | 2022-06-29 12:27 | 8.8M | |
![[SND]](/icons/sound2.gif) | vedi21.mp3 | 2022-06-29 12:27 | 7.9M | |
![[SND]](/icons/sound2.gif) | vedi20.mp3 | 2022-06-29 12:27 | 9.3M | |
![[SND]](/icons/sound2.gif) | vedi19.mp3 | 2022-06-29 12:27 | 7.6M | |
![[SND]](/icons/sound2.gif) | vedi18.mp3 | 2022-06-29 12:27 | 7.0M | |
![[SND]](/icons/sound2.gif) | vedi17.mp3 | 2022-06-29 12:27 | 7.1M | |
![[SND]](/icons/sound2.gif) | vedi16.mp3 | 2022-06-29 12:27 | 8.7M | |
![[SND]](/icons/sound2.gif) | vedi15.mp3 | 2022-06-29 12:26 | 6.6M | |
![[SND]](/icons/sound2.gif) | vedi14.mp3 | 2022-06-29 12:26 | 8.7M | |
![[SND]](/icons/sound2.gif) | vedi13.mp3 | 2022-06-29 12:26 | 7.7M | |
![[SND]](/icons/sound2.gif) | vedi12.mp3 | 2022-06-29 12:26 | 7.7M | |
![[SND]](/icons/sound2.gif) | vedi11.mp3 | 2022-06-29 12:26 | 8.0M | |
![[SND]](/icons/sound2.gif) | vedi10.mp3 | 2022-06-29 12:25 | 6.8M | |
![[SND]](/icons/sound2.gif) | vedi9.mp3 | 2022-06-29 12:25 | 7.5M | |
![[SND]](/icons/sound2.gif) | vedi8.mp3 | 2022-06-29 12:25 | 7.7M | |
![[SND]](/icons/sound2.gif) | vedi7.mp3 | 2022-06-29 12:25 | 9.2M | |
![[SND]](/icons/sound2.gif) | vedi6.mp3 | 2022-06-29 12:25 | 9.6M | |
![[SND]](/icons/sound2.gif) | vedi5.mp3 | 2022-06-29 12:25 | 7.1M | |
![[SND]](/icons/sound2.gif) | vedi4.mp3 | 2022-06-29 12:24 | 6.3M | |
![[SND]](/icons/sound2.gif) | vedi3.mp3 | 2022-06-29 12:24 | 7.3M | |
![[SND]](/icons/sound2.gif) | vedi2.mp3 | 2022-06-29 12:24 | 7.9M | |
![[SND]](/icons/sound2.gif) | vebenanh.mp3 | 2022-07-03 04:27 | 4.0M | |
![[SND]](/icons/sound2.gif) | ve.mp3 | 2022-07-09 03:45 | 3.5M | |
![[SND]](/icons/sound2.gif) | vdo.mp3 | 2022-07-26 15:09 | 0 | |
![[SND]](/icons/sound2.gif) | vd7.mp3 | 2022-08-01 18:05 | 0 | |
![[SND]](/icons/sound2.gif) | vcy.mp3 | 2022-08-09 01:57 | 1.0M | |
![[SND]](/icons/sound2.gif) | vco.mp3 | 2022-07-28 01:52 | 0 | |
![[SND]](/icons/sound2.gif) | vaycuoi2.mp3 | 2022-07-17 02:45 | 0 | |
![[SND]](/icons/sound2.gif) | vaycuoi1.mp3 | 2022-07-17 02:39 | 0 | |
![[SND]](/icons/sound2.gif) | vay.mp3 | 2022-07-17 02:41 | 0 | |
![[SND]](/icons/sound2.gif) | vasu.mp3 | 2022-07-21 06:41 | 2.1M | |
![[SND]](/icons/sound2.gif) | vasco20.mp3 | 2022-08-10 19:25 | 0 | |
![[SND]](/icons/sound2.gif) | vasco19.mp3 | 2022-07-28 20:48 | 0 | |
![[SND]](/icons/sound2.gif) | vasco18.mp3 | 2022-07-28 11:28 | 0 | |
![[SND]](/icons/sound2.gif) | vasco17.mp3 | 2022-07-13 20:43 | 3.3M | |
![[SND]](/icons/sound2.gif) | vasco16.mp3 | 2022-07-13 20:39 | 1.9M | |
![[SND]](/icons/sound2.gif) | vasco14.mp3 | 2022-07-01 13:17 | 4.5M | |
![[SND]](/icons/sound2.gif) | vasco13.mp3 | 2022-06-27 22:25 | 4.2M | |
![[SND]](/icons/sound2.gif) | vasco12.mp3 | 2022-06-27 22:18 | 3.5M | |
![[SND]](/icons/sound2.gif) | vasco11.mp3 | 2022-06-27 22:13 | 3.9M | |
![[SND]](/icons/sound2.gif) | vasco10.mp3 | 2022-06-27 22:09 | 4.6M | |
![[SND]](/icons/sound2.gif) | vasco9.mp3 | 2022-06-27 21:55 | 3.1M | |
![[SND]](/icons/sound2.gif) | vasco8.mp3 | 2022-06-27 21:49 | 4.8M | |
![[SND]](/icons/sound2.gif) | vasco2.mp3 | 2022-07-01 15:42 | 3.4M | |
![[SND]](/icons/sound2.gif) | vasco1.mp3 | 2022-07-07 06:07 | 7.9M | |
![[SND]](/icons/sound2.gif) | vasco.mp3 | 2022-07-06 20:31 | 7.0M | |
![[SND]](/icons/sound2.gif) | vas.mp3 | 2022-07-07 13:21 | 7.1M | |
![[SND]](/icons/sound2.gif) | vanzkuy.mp3 | 2022-07-20 09:20 | 0 | |
![[SND]](/icons/sound2.gif) | vanguardofdestruction.mp3 | 2022-07-19 01:05 | 71K | |
![[SND]](/icons/sound2.gif) | vang.mp3 | 2022-08-03 03:30 | 272K | |
![[SND]](/icons/sound2.gif) | vane4.mp3 | 2022-08-04 21:09 | 0 | |
![[SND]](/icons/sound2.gif) | vane3.mp3 | 2022-08-04 21:09 | 0 | |
![[SND]](/icons/sound2.gif) | vane1.mp3 | 2022-08-04 21:07 | 0 | |
![[SND]](/icons/sound2.gif) | van2.mp3 | 2022-07-25 01:49 | 744K | |
![[SND]](/icons/sound2.gif) | van1.mp3 | 2022-08-08 15:22 | 1.7M | |
![[SND]](/icons/sound2.gif) | van.mp3 | 2022-08-08 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | valle1.mp3 | 2022-07-02 20:45 | 11M | |
![[SND]](/icons/sound2.gif) | vallaja8.mp3 | 2022-07-04 04:37 | 4.0M | |
![[SND]](/icons/sound2.gif) | vallaja7.mp3 | 2022-07-03 07:58 | 494K | |
![[SND]](/icons/sound2.gif) | vall13.mp3 | 2022-08-03 01:49 | 0 | |
![[SND]](/icons/sound2.gif) | vall12.mp3 | 2022-07-10 23:55 | 3.5M | |
![[SND]](/icons/sound2.gif) | vall11.mp3 | 2022-07-09 00:09 | 4.0M | |
![[SND]](/icons/sound2.gif) | vall10.mp3 | 2022-07-05 09:13 | 1.8M | |
![[SND]](/icons/sound2.gif) | vall9.mp3 | 2022-07-05 09:13 | 2.8M | |
![[SND]](/icons/sound2.gif) | vall8.mp3 | 2022-07-05 08:29 | 29M | |
![[SND]](/icons/sound2.gif) | vall7.mp3 | 2022-07-02 23:08 | 17M | |
![[SND]](/icons/sound2.gif) | vall6.mp3 | 2022-07-02 23:08 | 7.6M | |
![[SND]](/icons/sound2.gif) | vall5.mp3 | 2022-07-02 23:08 | 5.6M | |
![[SND]](/icons/sound2.gif) | vall4.mp3 | 2022-07-02 23:08 | 3.4M | |
![[SND]](/icons/sound2.gif) | vall3.mp3 | 2022-07-02 23:08 | 5.8M | |
![[SND]](/icons/sound2.gif) | vall2.mp3 | 2022-07-02 11:50 | 3.5M | |
![[SND]](/icons/sound2.gif) | vall.mp3 | 2022-07-11 07:23 | 2.0M | |
![[SND]](/icons/sound2.gif) | validgame.mp3 | 2022-07-26 21:06 | 0 | |
![[SND]](/icons/sound2.gif) | valid_batch_element_3_200_20712_d0107eb00aeee1a19048 (online-audio-converter.com).mp3 | 2022-07-20 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | valid.mp3 | 2022-07-26 23:02 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow14.mp3 | 2022-07-26 00:59 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow13.mp3 | 2022-07-26 00:59 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow12.mp3 | 2022-07-26 00:59 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow11.mp3 | 2022-07-26 00:58 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow10.mp3 | 2022-07-20 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow9.mp3 | 2022-07-20 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow8.mp3 | 2022-07-20 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow7.mp3 | 2022-07-26 00:56 | 0 | |
![[SND]](/icons/sound2.gif) | valeslow6.mp3 | 2022-07-07 11:42 | 4.1M | |
![[SND]](/icons/sound2.gif) | valeslow5.mp3 | 2022-07-07 11:43 | 4.6M | |
![[SND]](/icons/sound2.gif) | valeslow4.mp3 | 2022-07-07 11:38 | 3.5M | |
![[SND]](/icons/sound2.gif) | valeslow3.mp3 | 2022-07-05 03:21 | 4.9M | |
![[SND]](/icons/sound2.gif) | valeslow2.mp3 | 2022-07-05 03:21 | 4.4M | |
![[SND]](/icons/sound2.gif) | valeslow1.mp3 | 2022-07-05 03:22 | 4.3M | |
![[SND]](/icons/sound2.gif) | valesenam.mp3 | 2022-07-05 03:21 | 15M | |
![[SND]](/icons/sound2.gif) | valesad0.mp3 | 2022-07-14 01:15 | 5.3M | |
![[SND]](/icons/sound2.gif) | valerijj-meladze-svoboda-ili-sladkijj-plen.mp3 | 2022-08-08 11:02 | 0 | |
![[SND]](/icons/sound2.gif) | valelawas0.mp3 | 2022-07-20 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | valedj4.mp3 | 2022-07-11 11:40 | 5.6M | |
![[SND]](/icons/sound2.gif) | valedj3.mp3 | 2022-07-09 02:52 | 3.0M | |
![[SND]](/icons/sound2.gif) | valedj2.mp3 | 2022-07-08 00:02 | 38M | |
![[SND]](/icons/sound2.gif) | valedj1.mp3 | 2022-07-07 23:59 | 19M | |
![[SND]](/icons/sound2.gif) | vale8.mp3 | 2022-07-30 14:08 | 0 | |
![[SND]](/icons/sound2.gif) | vale7.mp3 | 2022-07-14 01:10 | 52M | |
![[SND]](/icons/sound2.gif) | vale6.mp3 | 2022-07-13 13:53 | 2.8M | |
![[SND]](/icons/sound2.gif) | vale5.mp3 | 2022-07-07 11:53 | 42M | |
![[SND]](/icons/sound2.gif) | vale4.mp3 | 2022-07-07 11:53 | 50M | |
![[SND]](/icons/sound2.gif) | vale3.mp3 | 2022-07-05 04:51 | 49M | |
![[SND]](/icons/sound2.gif) | vale2.mp3 | 2022-07-05 04:49 | 34M | |
![[SND]](/icons/sound2.gif) | vale1.mp3 | 2022-07-05 04:40 | 37M | |
![[SND]](/icons/sound2.gif) | vale0.mp3 | 2022-07-01 12:34 | 4.8M | |
![[SND]](/icons/sound2.gif) | valdez.mp3 | 2022-07-11 04:47 | 7.5M | |
![[SND]](/icons/sound2.gif) | vakvak.mp3 | 2022-07-22 22:04 | 203K | |
![[SND]](/icons/sound2.gif) | vaicaunoi.mp3 | 2022-07-20 05:23 | 0 | |
![[SND]](/icons/sound2.gif) | vagosnihdek.mp3 | 2022-08-03 11:00 | 360K | |
![[SND]](/icons/sound2.gif) | vagos1.mp3 | 2022-08-01 23:01 | 0 | |
![[SND]](/icons/sound2.gif) | vagos0.mp3 | 2022-08-01 23:01 | 0 | |
![[SND]](/icons/sound2.gif) | vagos.mp3 | 2022-08-01 22:23 | 0 | |
![[SND]](/icons/sound2.gif) | vagina.mp3 | 2022-07-15 14:32 | 4.2M | |
![[SND]](/icons/sound2.gif) | vagabovvv1 production - ай бала..mp3 | 2022-07-06 19:41 | 2.2M | |
![[SND]](/icons/sound2.gif) | vadcb.mp3 | 2022-08-09 15:29 | 0 | |
![[SND]](/icons/sound2.gif) | vacation.mp3 | 2022-08-09 14:50 | 0 | |
![[SND]](/icons/sound2.gif) | vaca1.mp3 | 2022-07-06 06:47 | 4.0M | |
![[SND]](/icons/sound2.gif) | vaat1.mp3 | 2022-07-14 20:57 | 2.6M | |
![[SND]](/icons/sound2.gif) | vaar.mp3 | 2022-08-10 16:16 | 0 | |
![[SND]](/icons/sound2.gif) | va_-_Russian_Doomer_music_vol3_67066824.mp3 | 2022-08-02 07:12 | 0 | |
![[SND]](/icons/sound2.gif) | va7.mp3 | 2022-08-10 13:11 | 0 | |
![[SND]](/icons/sound2.gif) | v102.mp3 | 2022-07-11 10:49 | 3.4M | |
![[SND]](/icons/sound2.gif) | v101.mp3 | 2022-07-11 10:41 | 4.2M | |
![[SND]](/icons/sound2.gif) | v100.mp3 | 2022-07-11 10:06 | 5.7M | |
![[SND]](/icons/sound2.gif) | v20.mp3 | 2022-08-11 22:57 | 0 | |
![[SND]](/icons/sound2.gif) | v19.mp3 | 2022-08-11 22:58 | 0 | |
![[SND]](/icons/sound2.gif) | v18.mp3 | 2022-08-11 22:57 | 0 | |
![[SND]](/icons/sound2.gif) | v17.mp3 | 2022-08-11 22:56 | 0 | |
![[SND]](/icons/sound2.gif) | v15.mp3 | 2022-08-11 22:42 | 0 | |
![[SND]](/icons/sound2.gif) | v14.mp3 | 2022-08-11 22:30 | 0 | |
![[SND]](/icons/sound2.gif) | v13.mp3 | 2022-08-11 22:30 | 0 | |
![[SND]](/icons/sound2.gif) | v12.mp3 | 2022-08-11 22:29 | 0 | |
![[SND]](/icons/sound2.gif) | v11.mp3 | 2022-08-11 22:29 | 0 | |
![[SND]](/icons/sound2.gif) | v10.mp3 | 2022-08-11 22:15 | 0 | |
![[SND]](/icons/sound2.gif) | v9.mp3 | 2022-08-11 22:13 | 0 | |
![[SND]](/icons/sound2.gif) | v8.mp3 | 2022-08-11 22:13 | 0 | |
![[SND]](/icons/sound2.gif) | v7.mp3 | 2022-08-11 22:14 | 0 | |
![[SND]](/icons/sound2.gif) | v5.mp3 | 2022-08-12 01:15 | 388K | |
![[SND]](/icons/sound2.gif) | v4.mp3 | 2022-08-12 01:19 | 3.4M | |
![[SND]](/icons/sound2.gif) | v2.mp3 | 2022-08-11 21:46 | 2.2M | |
![[SND]](/icons/sound2.gif) | v1.mp3 | 2022-08-11 21:45 | 2.3M | |
![[SND]](/icons/sound2.gif) | v1.mp3 | 2022-07-30 14:03 | 0 | |
![[SND]](/icons/sound2.gif) | v0f025gc0000cak3klbc77u4dngqvhsg.mp3 | 2022-07-07 09:00 | 1.2M | |
![[SND]](/icons/sound2.gif) | v0_10103943620_1_1.mp3 | 2022-07-20 08:49 | 0 | |
![[SND]](/icons/sound2.gif) | v.mp3 | 2022-07-16 02:41 | 102K | |
![[SND]](/icons/sound2.gif) | v-saltykov-belaya-noch-2003.mp3 | 2022-08-03 15:37 | 1.3M | |
![[SND]](/icons/sound2.gif) | uzyy.mp3 | 2022-07-30 11:49 | 0 | |
![[SND]](/icons/sound2.gif) | uzi.mp3 | 2022-07-06 20:23 | 1.9M | |
![[SND]](/icons/sound2.gif) | uye.mp3 | 2022-08-03 19:42 | 0 | |
![[SND]](/icons/sound2.gif) | uy.mp3 | 2022-07-14 02:08 | 4.5M | |
![[SND]](/icons/sound2.gif) | uwu_medyk.mp3 | 2022-07-13 22:13 | 17K | |
![[SND]](/icons/sound2.gif) | uwu3.mp3 | 2022-08-04 15:53 | 0 | |
![[SND]](/icons/sound2.gif) | uwu2.mp3 | 2022-08-04 15:48 | 576K | |
![[SND]](/icons/sound2.gif) | uwu1.mp3 | 2022-08-03 07:47 | 3.8M | |
![[SND]](/icons/sound2.gif) | uwu.mp3 | 2022-07-22 23:57 | 364K | |
![[SND]](/icons/sound2.gif) | uv21.mp3 | 2022-07-28 06:28 | 0 | |
![[SND]](/icons/sound2.gif) | uuy.mp3 | 2022-07-04 19:57 | 4.1M | |
![[SND]](/icons/sound2.gif) | uuwian.mp3 | 2022-08-09 14:49 | 0 | |
![[SND]](/icons/sound2.gif) | uuuu.mp3 | 2022-07-02 17:53 | 5.3M | |
![[SND]](/icons/sound2.gif) | uuu.mp3 | 2022-07-17 22:23 | 6.0M | |
![[SND]](/icons/sound2.gif) | uu.mp3 | 2022-07-29 13:22 | 3.9M | |
![[SND]](/icons/sound2.gif) | utung.mp3 | 2022-07-08 18:16 | 2.5M | |
![[SND]](/icons/sound2.gif) | utopia.mp3 | 2022-08-08 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | utog1.mp3 | 2022-07-20 18:26 | 0 | |
![[SND]](/icons/sound2.gif) | utang.mp3 | 2022-07-01 21:27 | 3.8M | |
![[SND]](/icons/sound2.gif) | utak.mp3 | 2022-07-20 15:40 | 0 | |
![[SND]](/icons/sound2.gif) | ussrkelvin.mp3 | 2022-07-25 09:28 | 2.4M | |
![[SND]](/icons/sound2.gif) | ussr1.mp3 | 2022-07-04 06:54 | 2.7M | |
![[SND]](/icons/sound2.gif) | ussr.mp3 | 2022-07-04 06:54 | 2.6M | |
![[SND]](/icons/sound2.gif) | usok.mp3 | 2022-07-26 22:12 | 2.8M | |
![[SND]](/icons/sound2.gif) | usituru.mp3 | 2022-08-11 11:07 | 1.4M | |
![[SND]](/icons/sound2.gif) | usaii.mp3 | 2022-07-29 16:59 | 0 | |
![[SND]](/icons/sound2.gif) | usai2.mp3 | 2022-07-14 13:39 | 3.1M | |
![[SND]](/icons/sound2.gif) | usai.mp3 | 2022-08-08 07:26 | 3.4M | |
![[SND]](/icons/sound2.gif) | usa2.mp3 | 2022-08-07 03:24 | 388K | |
![[SND]](/icons/sound2.gif) | usa.mp3 | 2022-07-05 13:34 | 3.2M | |
![[SND]](/icons/sound2.gif) | urogeh5.mp3 | 2022-08-05 01:38 | 6.2M | |
![[SND]](/icons/sound2.gif) | url.mp3 | 2022-07-18 02:02 | 0 | |
![[SND]](/icons/sound2.gif) | urii-shatunov-belie-rozi-remix.mp3 | 2022-07-24 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | urban-pasifika-mix-4_dj-canon-wat-u-talkin-abou-remix.mp3 | 2022-07-15 21:39 | 3.2M | |
![[SND]](/icons/sound2.gif) | ura1.mp3 | 2022-07-01 16:14 | 3.4M | |
![[SND]](/icons/sound2.gif) | ur-soundtrack-03-the-todd-terry-project-weekend.mp3 | 2022-07-26 12:12 | 0 | |
![[SND]](/icons/sound2.gif) | upuan1.mp3 | 2022-07-04 04:17 | 3.8M | |
![[SND]](/icons/sound2.gif) | upuan.mp3 | 2022-08-04 14:42 | 3.2M | |
![[SND]](/icons/sound2.gif) | upmusicme_Gareth_Coker_-_Kwoloks_Hollow_70300334.mp3 | 2022-07-24 09:11 | 0 | |
![[SND]](/icons/sound2.gif) | uploadhtml_açığı_ile_shell_sokma_REDHAT_x_b8A2ntxWuCU_140.mp3 | 2022-07-23 19:15 | 0 | |
![[SND]](/icons/sound2.gif) | upinipin.mp3 | 2022-07-02 04:40 | 6.4M | |
![[SND]](/icons/sound2.gif) | up.mp3 | 2022-07-19 13:51 | 3.8M | |
![[SND]](/icons/sound2.gif) | unyuunyu.mp3 | 2022-07-12 11:19 | 3.7M | |
![[SND]](/icons/sound2.gif) | unwell.mp3 | 2022-08-10 01:13 | 0 | |
![[SND]](/icons/sound2.gif) | unutulanlar.mp3 | 2022-07-24 08:04 | 0 | |
![[SND]](/icons/sound2.gif) | untukmuyangdisana.mp3 | 2022-07-13 03:35 | 3.8M | |
![[SND]](/icons/sound2.gif) | untitledvbbn.mp3 | 2022-07-10 21:29 | 3.1M | |
![[SND]](/icons/sound2.gif) | untitled4.mp3 | 2022-07-17 02:27 | 0 | |
![[SND]](/icons/sound2.gif) | untitled.mp3 | 2022-08-07 14:34 | 492K | |
![[SND]](/icons/sound2.gif) | untilifoundyouxiwouldratherdie(slowedandreverb)withlyrics._405.m4a | 2022-06-28 01:24 | 2.9M | |
![[SND]](/icons/sound2.gif) | until i found you x i would rather die (slowed and reverb) with lyrics..mp3 | 2022-06-28 02:42 | 2.8M | |
![[SND]](/icons/sound2.gif) | until i found you by stephen sanchez cover.mp3 | 2022-07-07 19:21 | 2.6M | |
![[SND]](/icons/sound2.gif) | untilifoundyou.mp3 | 2022-07-17 23:58 | 2.7M | |
![[SND]](/icons/sound2.gif) | until i found you.mp3 | 2022-06-28 03:57 | 2.8M | |
![[SND]](/icons/sound2.gif) | until faond.mp3 | 2022-08-12 12:45 | 0 | |
![[SND]](/icons/sound2.gif) | until.mp3 | 2022-08-05 08:57 | 2.6M | |
![[SND]](/icons/sound2.gif) | unti4141tled.mp3 | 2022-07-16 09:44 | 0 | |
![[SND]](/icons/sound2.gif) | unravel.mp3 | 2022-07-15 16:56 | 9.7M | |
![[SND]](/icons/sound2.gif) | unnv_-_bez_daty_(proddoublew_remix)_muzati.net.mp3 | 2022-06-27 13:18 | 7.5M | |
![[SND]](/icons/sound2.gif) | unnv-muza-mp3.mp3 | 2022-08-12 14:56 | 0 | |
![[SND]](/icons/sound2.gif) | unmanned crossing.mp3 | 2022-07-07 10:32 | 351K | |
![[SND]](/icons/sound2.gif) | unknown - Елена Темникова - импульсы города (speed up).mp3 | 2022-06-28 09:12 | 2.5M | |
![[SND]](/icons/sound2.gif) | unki_Smokii_-_Vaz_2106_73734616 (4).mp3 | 2022-07-31 19:26 | 0 | |
![[SND]](/icons/sound2.gif) | universal_commentarii.mp3 | 2022-06-28 21:40 | 2.4M | |
![[SND]](/icons/sound2.gif) | unity.mp3 | 2022-08-01 09:31 | 0 | |
![[SND]](/icons/sound2.gif) | united in flames cut.mp3 | 2022-08-09 13:16 | 0 | |
![[SND]](/icons/sound2.gif) | united.mp3 | 2022-08-09 04:04 | 0 | |
![[SND]](/icons/sound2.gif) | unit.mp3 | 2022-06-28 05:18 | 11M | |
![[SND]](/icons/sound2.gif) | unik1.mp3 | 2022-07-30 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | ungol72822.mp3 | 2022-07-28 23:20 | 0 | |
![[SND]](/icons/sound2.gif) | ungol.mp3 | 2022-07-28 05:39 | 88K | |
![[SND]](/icons/sound2.gif) | underworld.mp3 | 2022-08-05 23:38 | 4.5M | |
![[SND]](/icons/sound2.gif) | undertele.mp3 | 2022-07-25 11:00 | 38M | |
![[SND]](/icons/sound2.gif) | undertel.mp3 | 2022-08-09 06:39 | 0 | |
![[SND]](/icons/sound2.gif) | undertale remix reff.mp3 | 2022-07-08 10:39 | 718K | |
![[SND]](/icons/sound2.gif) | undertaker.mp3 | 2022-07-08 10:45 | 3.0M | |
![[SND]](/icons/sound2.gif) | under.mp3 | 2022-07-19 09:37 | 0 | |
![[SND]](/icons/sound2.gif) | unden.mp3 | 2022-07-13 05:29 | 3.2M | |
![[SND]](/icons/sound2.gif) | undecided.mp3 | 2022-07-13 10:07 | 4.5M | |
![[SND]](/icons/sound2.gif) | unconditionally.mp3 | 2022-07-24 11:27 | 1.3M | |
![[SND]](/icons/sound2.gif) | unconditionality.mp3 | 2022-07-26 11:18 | 0 | |
![[SND]](/icons/sound2.gif) | unconXdande.mp3 | 2022-07-17 05:49 | 0 | |
![[SND]](/icons/sound2.gif) | uncleflexxx-camry-3.5.mp3 | 2022-08-01 20:00 | 0 | |
![[SND]](/icons/sound2.gif) | uncle.mp3 | 2022-06-29 07:09 | 670K | |
![[SND]](/icons/sound2.gif) | unangsayaw1.mp3 | 2022-07-02 18:19 | 4.2M | |
![[SND]](/icons/sound2.gif) | un-banco_1.mp3 | 2022-07-21 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | umurku16.mp3 | 2022-06-29 06:57 | 2.9M | |
![[SND]](/icons/sound2.gif) | umiyak.mp3 | 2022-07-03 23:41 | 2.7M | |
![[SND]](/icons/sound2.gif) | umbi2.mp3 | 2022-07-22 08:55 | 0 | |
![[SND]](/icons/sound2.gif) | umbi1.mp3 | 2022-07-22 09:04 | 0 | |
![[SND]](/icons/sound2.gif) | umbi.mp3 | 2022-07-22 06:57 | 1.2M | |
![[SND]](/icons/sound2.gif) | umay7.mp3 | 2022-07-24 18:26 | 0 | |
![[SND]](/icons/sound2.gif) | umay6.mp3 | 2022-07-24 18:45 | 0 | |
![[SND]](/icons/sound2.gif) | umay5.mp3 | 2022-07-24 18:47 | 0 | |
![[SND]](/icons/sound2.gif) | umay4.mp3 | 2022-07-24 17:50 | 3.3M | |
![[SND]](/icons/sound2.gif) | umay3.mp3 | 2022-07-24 17:46 | 17M | |
![[SND]](/icons/sound2.gif) | umay2.mp3 | 2022-07-24 17:37 | 5.5M | |
![[SND]](/icons/sound2.gif) | umay1.mp3.mp3 | 2022-07-24 17:27 | 4.9M | |
![[SND]](/icons/sound2.gif) | umay1.mp3 | 2022-07-27 09:15 | 4.9M | |
![[SND]](/icons/sound2.gif) | umar.mp3 | 2022-06-29 23:49 | 6.0M | |
![[SND]](/icons/sound2.gif) | umaga.mp3 | 2022-07-30 00:40 | 300K | |
![[SND]](/icons/sound2.gif) | umaasa.mp3 | 2022-06-27 15:44 | 10M | |
![[SND]](/icons/sound2.gif) | um.mp3 | 2022-07-17 00:23 | 0 | |
![[VID]](/icons/movie.gif) | ultramen.mp4 | 2022-07-05 13:25 | 694K | |
![[SND]](/icons/sound2.gif) | ultahnyadeyy31.mp3 | 2022-07-30 11:24 | 0 | |
![[SND]](/icons/sound2.gif) | ultah feby.m4a | 2022-07-12 16:08 | 2.0M | |
![[SND]](/icons/sound2.gif) | ultah.mp3 | 2022-08-03 13:26 | 1.1M | |
![[SND]](/icons/sound2.gif) | ulonely.mp3 | 2022-07-08 16:36 | 3.4M | |
![[SND]](/icons/sound2.gif) | ulol.mp3 | 2022-07-27 14:11 | 0 | |
![[SND]](/icons/sound2.gif) | ulipyo.mp3 | 2022-07-28 09:21 | 0 | |
![[SND]](/icons/sound2.gif) | ular.mp3 | 2022-07-29 09:29 | 0 | |
![[SND]](/icons/sound2.gif) | ulap.mp3 | 2022-08-10 04:52 | 0 | |
![[SND]](/icons/sound2.gif) | ulang.mp3 | 2022-07-04 11:19 | 2.3M | |
![[SND]](/icons/sound2.gif) | ulan.mp3 | 2022-07-13 10:07 | 7.1M | |
![[SND]](/icons/sound2.gif) | ulala.mp3 | 2022-07-22 10:23 | 0 | |
![[SND]](/icons/sound2.gif) | ukrainskij_salo_-_calo_salo_salo_(z2.fm).mp3 | 2022-08-04 15:20 | 964K | |
![[SND]](/icons/sound2.gif) | ukrainskie-narodnye-pesni-samogonochka(mp3gid.me).mp3 | 2022-07-10 03:05 | 4.6M | |
![[SND]](/icons/sound2.gif) | ukonn.mp3.m4a | 2022-07-10 16:54 | 950K | |
![[SND]](/icons/sound2.gif) | uje_takbiran_bop.mp3 | 2022-07-09 18:54 | 35M | |
![[SND]](/icons/sound2.gif) | ujangajun.mp3 | 2022-08-01 11:43 | 0 | |
![[SND]](/icons/sound2.gif) | ujang.mp3 | 2022-07-01 07:03 | 562K | |
![[SND]](/icons/sound2.gif) | uify.mp3 | 2022-08-08 05:26 | 0 | |
![[SND]](/icons/sound2.gif) | uicideboy_paris_mp3_27572.mp3 | 2022-06-29 03:45 | 1.6M | |
![[SND]](/icons/sound2.gif) | uicideboy_-_Magazine_50968775.mp3 | 2022-07-16 02:13 | 5.1M | |
![[SND]](/icons/sound2.gif) | uicideboy_-_Champion_of_Death_50968773.mp3 | 2022-07-16 02:13 | 4.5M | |
![[SND]](/icons/sound2.gif) | uicideBoy_-_Kill_Yourself_Part_III_64303924.mp3 | 2022-07-16 02:12 | 5.6M | |
![[SND]](/icons/sound2.gif) | uicideBoy_-_I_Am_The_Apocalypse_64653522.mp3 | 2022-07-16 19:40 | 0 | |
![[SND]](/icons/sound2.gif) | uicideBoy_-_FUCKTHEPOPULATION_64303923.mp3 | 2022-07-16 19:39 | 0 | |
![[SND]](/icons/sound2.gif) | ui1.mp3 | 2022-07-30 13:14 | 3.3M | |
![[SND]](/icons/sound2.gif) | ui.mp3 | 2022-07-08 22:07 | 4.8M | |
![[SND]](/icons/sound2.gif) | uhvfhb.mp3 | 2022-07-25 04:26 | 0 | |
![[SND]](/icons/sound2.gif) | uh.mp3 | 2022-07-30 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | ugun13.mp3 | 2022-07-11 17:42 | 7.9M | |
![[SND]](/icons/sound2.gif) | ugun12.mp3 | 2022-07-07 18:08 | 15M | |
![[SND]](/icons/sound2.gif) | ugun11.mp3 | 2022-07-02 04:00 | 12M | |
![[SND]](/icons/sound2.gif) | ugun10.mp3 | 2022-07-02 04:00 | 8.9M | |
![[SND]](/icons/sound2.gif) | ugun9.mp3 | 2022-07-02 03:59 | 10M | |
![[SND]](/icons/sound2.gif) | ugun8.mp3 | 2022-07-02 03:59 | 11M | |
![[SND]](/icons/sound2.gif) | ugun7.mp3 | 2022-07-02 03:58 | 9.5M | |
![[SND]](/icons/sound2.gif) | ugun6.mp3 | 2022-07-02 03:58 | 13M | |
![[SND]](/icons/sound2.gif) | ugun5.mp3 | 2022-07-02 03:57 | 9.0M | |
![[SND]](/icons/sound2.gif) | ugun4.mp3 | 2022-07-02 03:57 | 8.5M | |
![[SND]](/icons/sound2.gif) | ugun3.mp3 | 2022-07-02 10:43 | 11M | |
![[SND]](/icons/sound2.gif) | ugun2.mp3 | 2022-07-02 03:55 | 9.4M | |
![[SND]](/icons/sound2.gif) | ugun.mp3 | 2022-07-02 03:55 | 7.6M | |
![[SND]](/icons/sound2.gif) | uglystephan_-_YArost_73313910.mp3 | 2022-07-01 18:25 | 4.1M | |
![[SND]](/icons/sound2.gif) | uglystephan_-_Snova_obognal_ikh_prod_by_treepside_(musmore.com).mp3 | 2022-08-06 08:24 | 0 | |
![[SND]](/icons/sound2.gif) | uglystephan_-_Snova_obognal_ikh_73313912.mp3 | 2022-07-07 21:12 | 4.9M | |
![[SND]](/icons/sound2.gif) | uglystephan_-_Ne_volnuyut_(musmore.com).mp3 | 2022-08-06 09:08 | 0 | |
![[SND]](/icons/sound2.gif) | uglystephan_-_Besporyadok_73313911.mp3 | 2022-07-01 18:15 | 4.7M | |
![[SND]](/icons/sound2.gif) | uglystephan - Карты.mp3 | 2022-08-06 20:42 | 0 | |
![[SND]](/icons/sound2.gif) | uglystephan-Беспорядок.mp3 | 2022-08-06 09:11 | 3.9M | |
![[SND]](/icons/sound2.gif) | uglystephan (feat. Шайн) - Raf Simons Steppin' Vol. 2.mp3 | 2022-08-06 20:45 | 0 | |
![[SND]](/icons/sound2.gif) | ugh.mp3 | 2022-07-02 09:10 | 12M | |
![[SND]](/icons/sound2.gif) | ugfgjiu(allmp3.su).mp3 | 2022-07-29 05:41 | 0 | |
![[SND]](/icons/sound2.gif) | ufuhfjbh.mp3 | 2022-07-17 04:51 | 0 | |
![[SND]](/icons/sound2.gif) | udof1.mp3 | 2022-07-05 04:26 | 3.5M | |
![[SND]](/icons/sound2.gif) | udo.mp3 | 2022-07-31 23:46 | 5.8M | |
![[SND]](/icons/sound2.gif) | udinsutejo.mp3 | 2022-07-06 08:50 | 16M | |
![[SND]](/icons/sound2.gif) | udinss1.mp3 | 2022-07-22 22:10 | 0 | |
![[SND]](/icons/sound2.gif) | udinanjay.mp3 | 2022-07-31 11:45 | 1.5M | |
![[SND]](/icons/sound2.gif) | udin8.mp3 | 2022-08-07 00:58 | 0 | |
![[SND]](/icons/sound2.gif) | udin7.mp3 | 2022-07-19 05:39 | 3.7M | |
![[SND]](/icons/sound2.gif) | udin6.mp3 | 2022-07-19 05:35 | 3.8M | |
![[SND]](/icons/sound2.gif) | udin5.mp3 | 2022-07-12 01:14 | 3.6M | |
![[SND]](/icons/sound2.gif) | udin4.mp3 | 2022-07-12 01:10 | 4.5M | |
![[SND]](/icons/sound2.gif) | udin3.mp3 | 2022-07-12 01:05 | 4.0M | |
![[SND]](/icons/sound2.gif) | udin2.mp3 | 2022-07-12 01:00 | 4.1M | |
![[SND]](/icons/sound2.gif) | udin1.mp3 | 2022-07-12 00:47 | 4.6M | |
![[SND]](/icons/sound2.gif) | udin.mp3 | 2022-07-27 08:39 | 176K | |
![[SND]](/icons/sound2.gif) | udan.mp3 | 2022-08-01 03:14 | 2.3M | |
![[SND]](/icons/sound2.gif) | ucup3.mp3 | 2022-07-09 16:42 | 4.1M | |
![[SND]](/icons/sound2.gif) | ucup2.mp3 | 2022-07-09 16:41 | 3.9M | |
![[SND]](/icons/sound2.gif) | ucup.mp3 | 2022-07-24 08:39 | 3.2M | |
![[SND]](/icons/sound2.gif) | ucopbeban.mp3 | 2022-07-11 10:46 | 69M | |
![[SND]](/icons/sound2.gif) | ucok.mp3 | 2022-07-05 14:10 | 2.7M | |
![[SND]](/icons/sound2.gif) | ucl.mp3 | 2022-07-01 05:40 | 7.1M | |
![[SND]](/icons/sound2.gif) | uciha.mp3 | 2022-07-13 11:43 | 2.7M | |
![[SND]](/icons/sound2.gif) | ubivayavlyubil_-_Razbivajj_na_oskolki_73548360.mp3 | 2022-07-31 09:23 | 0 | |
![[SND]](/icons/sound2.gif) | ubit_boba__2009__-_fifty_caliber_-_jeff_lew__(z2.fm).mp3 | 2022-07-16 11:36 | 0 | |
![[SND]](/icons/sound2.gif) | uber.mp3 | 2022-08-06 18:14 | 0 | |
![[SND]](/icons/sound2.gif) | ubay 1.mp3 | 2022-07-02 07:17 | 26M | |
![[SND]](/icons/sound2.gif) | uay.mp3 | 2022-06-30 13:06 | 3.1M | |
![[SND]](/icons/sound2.gif) | uar.mp3 | 2022-07-04 07:06 | 4.8M | |
![[SND]](/icons/sound2.gif) | uGiL.mp3 | 2022-07-08 15:50 | 441K | |
![[SND]](/icons/sound2.gif) | u1.mp3 | 2022-08-07 03:57 | 3.7M | |
![[SND]](/icons/sound2.gif) | u.mp3 | 2022-07-16 02:21 | 3.1M | |
![[SND]](/icons/sound2.gif) | u-i-u-aa-u-i-u-aa_(mp3IQ.net).mp3 | 2022-07-18 14:15 | 4.0M | |
![[SND]](/icons/sound2.gif) | tytyd.mp3 | 2022-08-05 16:05 | 4.2M | |
![[SND]](/icons/sound2.gif) | tyson-yen-vs-samuel-rodriguez-the-only-thing-i-know-for-real-maniac-ag.mp3 | 2022-07-28 20:29 | 9.5M | |
![[SND]](/icons/sound2.gif) | tysj.mp3 | 2022-07-23 18:44 | 0 | |
![[SND]](/icons/sound2.gif) | typeluv-poslan.mp3 | 2022-08-10 07:24 | 0 | |
![[SND]](/icons/sound2.gif) | typeluv-poslan-mp3.mp3 | 2022-07-16 13:26 | 4.6M | |
![[SND]](/icons/sound2.gif) | typecast.mp3 | 2022-07-16 02:00 | 5.4M | |
![[SND]](/icons/sound2.gif) | typebeat1.mp3 | 2022-07-15 04:31 | 2.3M | |
![[SND]](/icons/sound2.gif) | tyler the creator - new magic wand (slowed reverb)_(audiohunter.ru).mp3 | 2022-08-05 18:34 | 0 | |
![[SND]](/icons/sound2.gif) | tyga armani nagrywkaref.mp3 | 2022-07-30 15:55 | 323K | |
![[SND]](/icons/sound2.gif) | tyga armani nagrywka.mp3 | 2022-07-30 17:21 | 3.0M | |
![[SND]](/icons/sound2.gif) | tyga_-_ayy_macarena_muzter.net.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | tyes.mp3 | 2022-08-12 14:05 | 248K | |
![[SND]](/icons/sound2.gif) | tydrift.mp3 | 2022-07-16 01:57 | 9.8M | |
![[SND]](/icons/sound2.gif) | twt.mp3 | 2022-06-30 07:44 | 3.4M | |
![[SND]](/icons/sound2.gif) | twocolors - Lovefool (Official Music Video) (mp3cut.net).mp3 | 2022-07-24 08:47 | 0 | |
![[SND]](/icons/sound2.gif) | two2.mp3 | 2022-07-28 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | two.mp3 | 2022-07-15 08:45 | 3.3M | |
![[SND]](/icons/sound2.gif) | twitter.mp3 | 2022-07-08 08:00 | 25K | |
![[SND]](/icons/sound2.gif) | twins-cabins-swing-lynn-s-l-o-w-e-d-r-e-v-e-r-b-no-vocals-instrumental_(MUZDOMA.MOBi).mp3 | 2022-07-09 16:34 | 4.9M | |
![[SND]](/icons/sound2.gif) | twice.mp3.mp3 | 2022-07-13 14:34 | 7.3M | |
![[SND]](/icons/sound2.gif) | twice.mp3 | 2022-07-13 14:36 | 7.3M | |
![[SND]](/icons/sound2.gif) | twerk1.mp3 | 2022-07-02 08:24 | 3.1M | |
![[SND]](/icons/sound2.gif) | twerk.mp3 | 2022-08-12 14:17 | 0 | |
![[SND]](/icons/sound2.gif) | twenty one pilots Heathens.mp3 | 2022-07-09 02:04 | 5.0M | |
![[SND]](/icons/sound2.gif) | twenty one pilots - Heathens.mp3 | 2022-07-18 09:41 | 0 | |
![[SND]](/icons/sound2.gif) | twenty_one_pilots_-_Ride_(Official_Video)(256k).mp3 | 2022-07-15 20:51 | 6.9M | |
![[SND]](/icons/sound2.gif) | twenty.mp3 | 2022-07-25 18:02 | 1.7M | |
![[SND]](/icons/sound2.gif) | twenty-one-pilots-stressed-out.mp3 | 2022-06-30 17:19 | 7.8M | |
![[SND]](/icons/sound2.gif) | twenty-one-pilots-stressed-out-mp3.mp3 | 2022-07-08 09:10 | 7.7M | |
![[SND]](/icons/sound2.gif) | twenty-one-pilots-fake-you-out.mp3 | 2022-06-27 19:52 | 8.9M | |
![[SND]](/icons/sound2.gif) | twbl.mp3 | 2022-07-12 01:17 | 3.1M | |
![[SND]](/icons/sound2.gif) | tw.mp3 | 2022-08-11 04:31 | 0 | |
![[SND]](/icons/sound2.gif) | tvxm.mp3 | 2022-08-04 11:51 | 0 | |
![[SND]](/icons/sound2.gif) | tvoya_mama_slyshaet.mp3 | 2022-07-18 08:39 | 0 | |
![[SND]](/icons/sound2.gif) | tvoe-nezhnoe-bezumie-retard.mp3 | 2022-07-14 14:03 | 6.5M | |
![[SND]](/icons/sound2.gif) | tvoe-nezhnoe-bezumie-nyashi-ne-boyatsya.mp3 | 2022-07-14 11:20 | 4.4M | |
![[SND]](/icons/sound2.gif) | tvddl.mp3 | 2022-07-26 09:30 | 1.0M | |
![[SND]](/icons/sound2.gif) | tva27.mp3 | 2022-07-21 20:57 | 3.1M | |
![[SND]](/icons/sound2.gif) | tva26.mp3 | 2022-07-21 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | tva25.mp3 | 2022-07-21 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | tva24.mp3 | 2022-07-21 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | tva23.mp3 | 2022-07-21 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | tva22.mp3 | 2022-07-21 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | tva21.mp3 | 2022-07-21 20:57 | 0 | |
![[SND]](/icons/sound2.gif) | tva20.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva19.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva18.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva17.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva16.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva15.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva14.mp3 | 2022-07-21 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | tva13.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva12.mp3 | 2022-07-21 20:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva11.mp3 | 2022-07-21 07:04 | 0 | |
![[SND]](/icons/sound2.gif) | tva10.mp3 | 2022-07-21 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | tva9.mp3 | 2022-07-21 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | tva8.mp3 | 2022-07-21 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | tva7.mp3 | 2022-07-21 20:55 | 0 | |
![[SND]](/icons/sound2.gif) | tva6.mp3 | 2022-07-22 02:56 | 0 | |
![[SND]](/icons/sound2.gif) | tva 6.mp3 | 2022-07-22 03:00 | 0 | |
![[SND]](/icons/sound2.gif) | tva5.mp3 | 2022-07-15 22:37 | 3.2M | |
![[SND]](/icons/sound2.gif) | tva4.mp3 | 2022-07-15 22:37 | 2.7M | |
![[SND]](/icons/sound2.gif) | tva2.mp3 | 2022-07-15 09:20 | 3.3M | |
![[SND]](/icons/sound2.gif) | tva1.mp3 | 2022-07-15 11:40 | 450K | |
![[SND]](/icons/sound2.gif) | tva.mp3 | 2022-07-15 09:20 | 1.9M | |
![[SND]](/icons/sound2.gif) | tv19.mp3 | 2022-07-28 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | tuyentren.mp3 | 2022-06-28 00:08 | 3.0K | |
![[SND]](/icons/sound2.gif) | tuyenduoi.mp3 | 2022-06-28 00:08 | 3.3K | |
![[SND]](/icons/sound2.gif) | tuty.mp3 | 2022-07-26 19:28 | 0 | |
![[SND]](/icons/sound2.gif) | tutur.mp3 | 2022-07-13 20:43 | 3.3M | |
![[SND]](/icons/sound2.gif) | tutu1.mp3 | 2022-07-02 15:32 | 2.3M | |
![[SND]](/icons/sound2.gif) | tutu.mp3 | 2022-07-23 10:43 | 108K | |
![[SND]](/icons/sound2.gif) | tutor.mp3 | 2022-07-11 11:07 | 2.8M | |
![[SND]](/icons/sound2.gif) | turuuu.mp3 | 2022-07-10 13:58 | 792K | |
![[SND]](/icons/sound2.gif) | turuu.mp3 | 2022-07-16 17:24 | 0 | |
![[SND]](/icons/sound2.gif) | turutidur123.mp3 | 2022-06-29 07:39 | 1.8M | |
![[SND]](/icons/sound2.gif) | turu tapi chill version.mp3 | 2022-06-29 09:54 | 6.9M | |
![[SND]](/icons/sound2.gif) | turudek.mp3 | 2022-08-06 11:52 | 724K | |
![[SND]](/icons/sound2.gif) | turu47.mp3 | 2022-07-10 18:04 | 55M | |
![[SND]](/icons/sound2.gif) | turu4.mp3 | 2022-07-21 07:19 | 9.3M | |
![[SND]](/icons/sound2.gif) | turu3.mp3 | 2022-07-21 08:01 | 2.3M | |
![[SND]](/icons/sound2.gif) | turu2.mp3 | 2022-07-21 07:18 | 3.8M | |
![[SND]](/icons/sound2.gif) | turu1.mp3 | 2022-06-28 14:24 | 718K | |
![[SND]](/icons/sound2.gif) | turu.mp3 | 2022-08-05 11:13 | 732K | |
![[SND]](/icons/sound2.gif) | turret sound 1.mp3 | 2022-07-27 18:29 | 0 | |
![[SND]](/icons/sound2.gif) | turn.mp3 | 2022-06-30 19:35 | 27M | |
![[SND]](/icons/sound2.gif) | turki2.mp3 | 2022-08-03 00:15 | 0 | |
![[SND]](/icons/sound2.gif) | turip.mp3 | 2022-06-29 08:06 | 967K | |
![[SND]](/icons/sound2.gif) | turi ip ip slowed reverb------ (remake)(MP3_128K).mp3 | 2022-08-11 21:06 | 0 | |
![[SND]](/icons/sound2.gif) | turf.mp3 | 2022-08-04 15:50 | 0 | |
![[SND]](/icons/sound2.gif) | turex18.mp3 | 2022-08-06 04:16 | 0 | |
![[SND]](/icons/sound2.gif) | turex17.mp3 | 2022-07-16 15:06 | 1.7M | |
![[SND]](/icons/sound2.gif) | turbohui.mp3 | 2022-07-08 14:25 | 2.8M | |
![[SND]](/icons/sound2.gif) | turbobass.mp3 | 2022-07-08 14:12 | 3.9M | |
![[SND]](/icons/sound2.gif) | tuq.mp3 | 2022-07-09 07:47 | 4.7M | |
![[SND]](/icons/sound2.gif) | tungo.mp3 | 2022-07-15 10:33 | 10M | |
![[SND]](/icons/sound2.gif) | tung.mp3 | 2022-07-10 11:54 | 37M | |
![[SND]](/icons/sound2.gif) | tune.mp3 | 2022-08-08 01:17 | 2.6M | |
![[SND]](/icons/sound2.gif) | tun1.mp3 | 2022-07-12 06:23 | 3.2M | |
![[SND]](/icons/sound2.gif) | tumsath.mp3 | 2022-08-11 16:51 | 0 | |
![[SND]](/icons/sound2.gif) | tumrubanh.mp3 | 2022-08-07 07:21 | 0 | |
![[SND]](/icons/sound2.gif) | tumblr_mf1qoigLoF1qbo7rbo1.mp3 | 2022-07-10 19:47 | 2.4M | |
![[SND]](/icons/sound2.gif) | tumblr_lpeancuXtd1r0j1hso1.mp3 | 2022-07-04 05:10 | 7.3M | |
![[SND]](/icons/sound2.gif) | tumaniyo_feat._miyagi__endshpil__-_dance_up_(scott_rill_remix)_muzrecord.net.mp3 | 2022-07-17 12:58 | 0 | |
![[SND]](/icons/sound2.gif) | tumanda.mp3 | 2022-08-06 07:01 | 0 | |
![[SND]](/icons/sound2.gif) | tum.mp3 | 2022-07-16 17:00 | 3.5M | |
![[SND]](/icons/sound2.gif) | tulusmonokrom.mp3 | 2022-07-01 19:52 | 3.3M | |
![[SND]](/icons/sound2.gif) | tulusinteraksi.mp3 | 2022-08-07 03:24 | 0 | |
![[SND]](/icons/sound2.gif) | tulushdj.mp3 | 2022-08-04 01:42 | 0 | |
![[SND]](/icons/sound2.gif) | tulusdiri.mp3 | 2022-07-16 05:00 | 3.7M | |
![[SND]](/icons/sound2.gif) | tulus13.mp3 | 2022-06-28 17:36 | 10M | |
![[SND]](/icons/sound2.gif) | tulus12.mp3 | 2022-06-28 17:36 | 6.8M | |
![[SND]](/icons/sound2.gif) | tulus11.mp3 | 2022-06-28 17:35 | 6.7M | |
![[SND]](/icons/sound2.gif) | tulus10.mp3 | 2022-06-28 17:35 | 7.8M | |
![[SND]](/icons/sound2.gif) | tulus8.mp3 | 2022-06-28 17:36 | 5.3M | |
![[SND]](/icons/sound2.gif) | tulus7.mp3 | 2022-06-28 17:36 | 7.1M | |
![[SND]](/icons/sound2.gif) | tulus6.mp3 | 2022-06-28 17:36 | 7.4M | |
![[SND]](/icons/sound2.gif) | tulus5.mp3 | 2022-06-28 17:36 | 8.2M | |
![[SND]](/icons/sound2.gif) | tulus4.mp3 | 2022-06-28 17:36 | 7.1M | |
![[SND]](/icons/sound2.gif) | tulus3.mp3 | 2022-06-28 17:36 | 6.2M | |
![[SND]](/icons/sound2.gif) | tulus2.mp3 | 2022-06-28 17:36 | 5.9M | |
![[SND]](/icons/sound2.gif) | tulus1.mp3 | 2022-06-28 17:35 | 5.9M | |
![[SND]](/icons/sound2.gif) | tulus.mp3 | 2022-08-06 02:52 | 3.0M | |
![[SND]](/icons/sound2.gif) | tulok.mp3 | 2022-08-09 19:08 | 0 | |
![[SND]](/icons/sound2.gif) | tukso1.mp3 | 2022-06-30 18:45 | 3.3M | |
![[SND]](/icons/sound2.gif) | tuj.mp3 | 2022-07-26 06:46 | 4.7M | |
![[SND]](/icons/sound2.gif) | tui.mp3 | 2022-07-14 06:05 | 4.2M | |
![[SND]](/icons/sound2.gif) | tuhanjagakan.mp3 | 2022-07-05 18:59 | 5.8M | |
![[SND]](/icons/sound2.gif) | tuhan.mp3 | 2022-07-04 20:38 | 12M | |
![[SND]](/icons/sound2.gif) | tubidy_mp3_8688.mp3 | 2022-07-03 02:25 | 2.5M | |
![[SND]](/icons/sound2.gif) | tuandz.mp3 | 2022-07-18 05:14 | 5.5M | |
![[SND]](/icons/sound2.gif) | tua.mp3 | 2022-07-10 10:37 | 3.3M | |
![[SND]](/icons/sound2.gif) | tty.mp3 | 2022-07-05 16:50 | 3.4M | |
![[SND]](/icons/sound2.gif) | ttu.mp3 | 2022-07-05 16:50 | 2.0M | |
![[SND]](/icons/sound2.gif) | ttt.mp3 | 2022-07-05 16:50 | 29M | |
![[SND]](/icons/sound2.gif) | tts_freetts.ru_62e431b42e18d461065252c.mp3 | 2022-07-29 19:17 | 0 | |
![[SND]](/icons/sound2.gif) | tts_demofiles_62ed67eb3476e458632464c.mp3 | 2022-08-05 19:05 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-8-4_2 2 10.mp3 | 2022-08-04 00:03 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-8-2_21_17_24.mp3 | 2022-08-02 19:19 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-29_21_25_6.mp3 | 2022-07-30 04:28 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-29_21_24_18.mp3 | 2022-07-30 04:29 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-29_5_36_0.mp3 | 2022-07-29 03:53 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-21_21_2_58.mp3 | 2022-07-21 16:14 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-21_21_2_54.mp3 | 2022-07-21 16:03 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-20_21_27_8.mp3 | 2022-07-20 13:28 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-17_18_41_46.mp3 | 2022-07-17 23:45 | 0 | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-6_16_25_9.mp3 | 2022-07-06 23:26 | 8.6K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-3_17_39_30.mp3 | 2022-07-03 07:39 | 24K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-7-3_17_37_31.mp3 | 2022-07-03 07:38 | 13K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-6-29_19_38_4.mp3 | 2022-06-29 11:38 | 8.8K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-6-29_19_37_21.mp3 | 2022-06-29 11:37 | 15K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-6-29_19_36_31.mp3 | 2022-06-29 11:36 | 10K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-6-29_19_34_56.mp3 | 2022-06-29 11:35 | 15K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-6-29_19_33_22.mp3 | 2022-06-29 11:34 | 10K | |
![[SND]](/icons/sound2.gif) | ttsMP3.com_VoiceText_2022-6-29_19_30_39.mp3 | 2022-06-29 11:30 | 11K | |
![[SND]](/icons/sound2.gif) | ttp.mp3 | 2022-07-05 16:50 | 37M | |
![[SND]](/icons/sound2.gif) | ttn.mp3 | 2022-07-05 16:49 | 19M | |
![[SND]](/icons/sound2.gif) | ttm.mp3 | 2022-07-16 12:04 | 3.8M | |
![[SND]](/icons/sound2.gif) | ttboy69.mp3 | 2022-07-26 16:23 | 2.5M | |
![[SND]](/icons/sound2.gif) | ttai0912.mp3 | 2022-07-27 17:24 | 0 | |
![[VID]](/icons/movie.gif) | tt_200001tzKx.mp4 | 2022-07-30 05:16 | 7.9M | |
![[SND]](/icons/sound2.gif) | tt56.mp3 | 2022-08-01 23:18 | 0 | |
![[SND]](/icons/sound2.gif) | tt32.mp3 | 2022-07-12 15:00 | 4.4M | |
![[SND]](/icons/sound2.gif) | tt.mp3 | 2022-08-06 00:59 | 0 | |
![[SND]](/icons/sound2.gif) | tsunami3.mp3 | 2022-06-29 15:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | tsss.mp3 | 2022-08-04 19:29 | 0 | |
![[SND]](/icons/sound2.gif) | tso-fm-haykakan-draxt_456255841.mp3 | 2022-07-11 17:27 | 4.1M | |
![[SND]](/icons/sound2.gif) | tserke gia emena demo.mp3 | 2022-07-28 22:28 | 0 | |
![[SND]](/icons/sound2.gif) | tsc.mp3 | 2022-07-06 00:26 | 4.2M | |
![[SND]](/icons/sound2.gif) | tsb, opt - Drill Ru 2.mp3 | 2022-07-24 22:14 | 736K | |
![[SND]](/icons/sound2.gif) | tsarmp3.mp3 | 2022-06-30 12:36 | 86M | |
![[SND]](/icons/sound2.gif) | tsangelo1.mp3 | 2022-07-18 14:46 | 644K | |
![[SND]](/icons/sound2.gif) | ts2.mp3 | 2022-08-07 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | ts1.mp3 | 2022-08-07 03:42 | 0 | |
![[SND]](/icons/sound2.gif) | ts.mp3 | 2022-07-18 06:55 | 0 | |
![[SND]](/icons/sound2.gif) | trytofollowme.mp3 | 2022-07-05 22:58 | 2.9M | |
![[SND]](/icons/sound2.gif) | tr v2.mp3 | 2022-07-28 07:37 | 0 | |
![[SND]](/icons/sound2.gif) | trust issues by justin bieber sped up.mp3 | 2022-07-01 17:49 | 3.5M | |
![[SND]](/icons/sound2.gif) | truphone.mp3 | 2022-07-16 01:56 | 7.7M | |
![[SND]](/icons/sound2.gif) | trunk.mp3 | 2022-08-07 06:00 | 1.4M | |
![[SND]](/icons/sound2.gif) | trungquoc.mp3 | 2022-07-10 04:26 | 74M | |
![[SND]](/icons/sound2.gif) | trumpet.mp3 | 2022-07-26 15:53 | 0 | |
![[SND]](/icons/sound2.gif) | trufuego.mp3 | 2022-07-07 12:01 | 1.8M | |
![[SND]](/icons/sound2.gif) | true6.mp3 | 2022-06-28 15:45 | 3.7M | |
![[SND]](/icons/sound2.gif) | trs3.mp3 | 2022-07-15 05:28 | 1.5M | |
![[SND]](/icons/sound2.gif) | trs2.mp3 | 2022-07-15 05:28 | 2.9M | |
![[SND]](/icons/sound2.gif) | trs1.mp3 | 2022-07-15 05:28 | 2.3M | |
![[SND]](/icons/sound2.gif) | troye_sivan_angel_baby_lyrics_4221274773853913525.mp3 | 2022-07-06 06:52 | 3.7M | |
![[SND]](/icons/sound2.gif) | troye.mp3 | 2022-08-02 23:04 | 0 | |
![[SND]](/icons/sound2.gif) | tropicana-soundroll-main-version-1725-02-15.mp3 | 2022-07-29 09:35 | 0 | |
![[SND]](/icons/sound2.gif) | tropa.mp3 | 2022-07-04 08:29 | 8.8M | |
![[SND]](/icons/sound2.gif) | troll_song_4341602713972043947 (mp3cut.net).mp3 | 2022-06-29 03:55 | 1.2M | |
![[SND]](/icons/sound2.gif) | trnidek1.mp3 | 2022-08-01 10:37 | 0 | |
![[SND]](/icons/sound2.gif) | trls1.mp3 | 2022-07-28 08:12 | 0 | |
![[SND]](/icons/sound2.gif) | trk2.mp3 | 2022-07-24 15:29 | 0 | |
![[SND]](/icons/sound2.gif) | trk1.mp3 | 2022-07-24 15:49 | 0 | |
![[SND]](/icons/sound2.gif) | trippie-redd-the-grinch_64089223.mp3 | 2022-07-01 14:12 | 3.5M | |
![[SND]](/icons/sound2.gif) | trinix_remix__nooran_sisters_-_patakha_guddi_(drill_remix)_muzati.net.mp3 | 2022-07-19 13:59 | 0 | |
![[SND]](/icons/sound2.gif) | trim527B06AE-8AA4-417F-A8DE-C11A.mp3 | 2022-08-01 23:06 | 0 | |
![[SND]](/icons/sound2.gif) | trim.09E25743-B1D4-4D53-ABE4-5B8CA3057D2E.mp3 | 2022-08-10 16:43 | 0 | |
![[SND]](/icons/sound2.gif) | trilokh.mp3 | 2022-07-13 02:04 | 867K | |
![[SND]](/icons/sound2.gif) | trillpil.mp3 | 2022-07-06 18:54 | 7.6M | |
![[SND]](/icons/sound2.gif) | trikster.mp3 | 2022-07-04 19:02 | 3.2M | |
![[SND]](/icons/sound2.gif) | triksetcle.mp3 | 2022-07-08 13:50 | 3.0M | |
![[SND]](/icons/sound2.gif) | trik.mp3 | 2022-06-29 13:52 | 2.9M | |
![[SND]](/icons/sound2.gif) | tricksternew.mp3 | 2022-07-30 08:32 | 0 | |
![[SND]](/icons/sound2.gif) | trickster.mp3 | 2022-08-08 14:35 | 2.2M | |
![[VID]](/icons/movie.gif) | trial of former Prime Minister Putin 2010.mp4 | 2022-07-10 07:42 | 6.7M | |
![[SND]](/icons/sound2.gif) | tri.mp3 | 2022-07-04 06:36 | 2.7M | |
![[SND]](/icons/sound2.gif) | trevor-daniel-falling-blackbear-remix.mp3 | 2022-08-08 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | tret.mp3 | 2022-08-06 06:19 | 0 | |
![[SND]](/icons/sound2.gif) | tresno.mp3 | 2022-07-21 23:49 | 0 | |
![[SND]](/icons/sound2.gif) | trentanglau.mp3 | 2022-07-22 11:46 | 0 | |
![[SND]](/icons/sound2.gif) | trend.mp3 | 2022-06-27 15:57 | 12M | |
![[SND]](/icons/sound2.gif) | trekkkk.mp3 | 2022-08-09 10:13 | 0 | |
![[SND]](/icons/sound2.gif) | trees.mp3 | 2022-08-12 15:03 | 0 | |
![[SND]](/icons/sound2.gif) | treepside-dora_-_mladshaya-sestra-treepside.mp3 | 2022-07-17 05:39 | 4.2M | |
![[SND]](/icons/sound2.gif) | treasure hunt mission 2.mp3 | 2022-07-27 10:04 | 0 | |
![[SND]](/icons/sound2.gif) | travis-scott-sicko-mode-ft-drake.mp3 | 2022-07-11 20:02 | 10M | |
![[SND]](/icons/sound2.gif) | trauma.mp3 | 2022-07-25 22:45 | 1.3M | |
![[SND]](/icons/sound2.gif) | trapchaabi.mp3 | 2022-07-22 20:14 | 0 | |
![[SND]](/icons/sound2.gif) | trap.mp3 | 2022-07-21 12:09 | 0 | |
![[SND]](/icons/sound2.gif) | tranzipone - привет со льда.mp3 | 2022-07-04 20:11 | 3.0M | |
![[SND]](/icons/sound2.gif) | tranzipone - догоню, бегу, бегу сука, бегу сука за тобой.mp3 | 2022-07-08 07:44 | 4.3M | |
![[SND]](/icons/sound2.gif) | translate_tts.mp3 | 2022-07-02 09:51 | 4.7K | |
![[SND]](/icons/sound2.gif) | traktor.mp3 | 2022-07-28 07:51 | 21M | |
![[SND]](/icons/sound2.gif) | traitor.mp3 | 2022-08-05 16:13 | 3.5M | |
![[SND]](/icons/sound2.gif) | traitim.mp3 | 2022-07-10 01:46 | 3.4M | |
![[SND]](/icons/sound2.gif) | trails.mp3 | 2022-07-07 03:28 | 12M | |
![[SND]](/icons/sound2.gif) | traeger1.mp3 | 2022-07-21 20:07 | 201M | |
![[SND]](/icons/sound2.gif) | trackk3.mp3 | 2022-07-22 11:38 | 0 | |
![[SND]](/icons/sound2.gif) | track_000.mp3 | 2022-06-29 15:53 | 4.9M | |
![[SND]](/icons/sound2.gif) | track No2.mp3 | 2022-07-20 12:18 | 0 | |
![[SND]](/icons/sound2.gif) | track2.mp3 | 2022-07-11 05:16 | 2.7M | |
![[SND]](/icons/sound2.gif) | track 08.mp3 | 2022-07-12 23:39 | 2.3M | |
![[SND]](/icons/sound2.gif) | track.mp3 | 2022-07-07 06:34 | 175M | |
![[SND]](/icons/sound2.gif) | trac.mp3 | 2022-08-09 16:05 | 0 | |
![[SND]](/icons/sound2.gif) | tr2.mp3 | 2022-08-04 13:03 | 0 | |
![[SND]](/icons/sound2.gif) | tr1.mp3 | 2022-08-11 07:54 | 15M | |
![[SND]](/icons/sound2.gif) | tr.mp3 | 2022-08-04 13:03 | 2.2M | |
![[SND]](/icons/sound2.gif) | tqx14.mp3 | 2022-06-28 14:42 | 2.3M | |
![[SND]](/icons/sound2.gif) | tqx13.mp3 | 2022-06-28 14:42 | 3.1M | |
![[SND]](/icons/sound2.gif) | tqx12.mp3 | 2022-06-28 14:42 | 4.2M | |
![[SND]](/icons/sound2.gif) | tqx11.mp3 | 2022-06-28 14:41 | 2.9M | |
![[SND]](/icons/sound2.gif) | tqx10.mp3 | 2022-06-28 14:41 | 2.5M | |
![[SND]](/icons/sound2.gif) | tqx9.mp3 | 2022-06-28 14:44 | 7.3M | |
![[SND]](/icons/sound2.gif) | tqx8.mp3 | 2022-06-28 14:43 | 2.9M | |
![[SND]](/icons/sound2.gif) | tqx7.mp3 | 2022-06-28 14:43 | 7.4M | |
![[SND]](/icons/sound2.gif) | tqx6.mp3 | 2022-06-28 14:43 | 2.8M | |
![[SND]](/icons/sound2.gif) | tqx5.mp3 | 2022-06-28 14:43 | 5.3M | |
![[SND]](/icons/sound2.gif) | tqx4.mp3 | 2022-06-28 14:42 | 3.0M | |
![[SND]](/icons/sound2.gif) | tqx3.mp3 | 2022-06-28 14:42 | 118K | |
![[SND]](/icons/sound2.gif) | tqx2.mp3 | 2022-06-28 14:42 | 8.7M | |
![[SND]](/icons/sound2.gif) | tqx1.mp3 | 2022-06-28 14:41 | 3.3M | |
![[SND]](/icons/sound2.gif) | tpxvshx - HalfTime.mp3 | 2022-07-02 19:23 | 10M | |
![[SND]](/icons/sound2.gif) | tpotmeneno.mp3 | 2022-07-15 17:37 | 6.1M | |
![[SND]](/icons/sound2.gif) | tpmbhsy.mp3 | 2022-07-23 09:45 | 0 | |
![[SND]](/icons/sound2.gif) | tpl-bm-otp-london-view-music-video-pressplay.mp3 | 2022-07-05 17:20 | 5.8M | |
![[SND]](/icons/sound2.gif) | tpast.mp3.mp3 | 2022-08-12 17:29 | 0 | |
![[SND]](/icons/sound2.gif) | tp8.mp3 | 2022-06-28 02:08 | 18M | |
![[SND]](/icons/sound2.gif) | tp1.mp3 | 2022-07-24 12:29 | 0 | |
![[SND]](/icons/sound2.gif) | toystory.mp3 | 2022-07-02 05:56 | 2.0M | |
![[SND]](/icons/sound2.gif) | toyota.mp3 | 2022-07-30 00:53 | 0 | |
![[SND]](/icons/sound2.gif) | toy.mp3 | 2022-06-30 19:03 | 2.0M | |
![[SND]](/icons/sound2.gif) | toxicity.m4a | 2022-07-10 10:24 | 3.4M | |
![[SND]](/icons/sound2.gif) | toxic55.mp3 | 2022-07-09 05:17 | 8.6M | |
![[SND]](/icons/sound2.gif) | toxic54.mp3 | 2022-07-09 05:14 | 8.3M | |
![[SND]](/icons/sound2.gif) | toxic53.mp3 | 2022-07-07 17:55 | 3.8M | |
![[SND]](/icons/sound2.gif) | toxic52.mp3 | 2022-07-07 17:46 | 6.9M | |
![[SND]](/icons/sound2.gif) | toxic51.mp3 | 2022-07-07 08:55 | 7.3M | |
![[SND]](/icons/sound2.gif) | toxic50.mp3 | 2022-07-04 12:30 | 7.6M | |
![[SND]](/icons/sound2.gif) | toxic49.mp3 | 2022-07-04 12:29 | 6.9M | |
![[SND]](/icons/sound2.gif) | toxic49 (1).mp3 | 2022-07-04 15:31 | 6.9M | |
![[SND]](/icons/sound2.gif) | toxic48.mp3 | 2022-07-04 12:30 | 4.8M | |
![[SND]](/icons/sound2.gif) | toxic47.mp3 | 2022-07-04 12:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | toxic46.mp3 | 2022-07-04 12:30 | 8.1M | |
![[SND]](/icons/sound2.gif) | toxic45.mp3 | 2022-07-04 12:30 | 6.3M | |
![[SND]](/icons/sound2.gif) | toxic44.mp3 | 2022-07-04 12:29 | 5.3M | |
![[SND]](/icons/sound2.gif) | toxic43.mp3 | 2022-07-04 12:29 | 7.4M | |
![[SND]](/icons/sound2.gif) | toxic42.mp3 | 2022-07-04 12:17 | 6.9M | |
![[SND]](/icons/sound2.gif) | toxic41.mp3 | 2022-07-04 12:16 | 7.2M | |
![[SND]](/icons/sound2.gif) | toxic41-1.mp3 | 2022-07-04 15:35 | 7.2M | |
![[SND]](/icons/sound2.gif) | toxic39.mp3 | 2022-07-04 12:17 | 9.6M | |
![[SND]](/icons/sound2.gif) | toxic38.mp3 | 2022-07-04 12:17 | 4.7M | |
![[SND]](/icons/sound2.gif) | toxic37.mp3 | 2022-07-04 12:17 | 9.5M | |
![[SND]](/icons/sound2.gif) | toxic36.mp3 | 2022-07-04 12:17 | 8.1M | |
![[SND]](/icons/sound2.gif) | toxic35.mp3 | 2022-07-04 12:16 | 5.3M | |
![[SND]](/icons/sound2.gif) | toxic34.mp3 | 2022-07-04 12:16 | 7.2M | |
![[SND]](/icons/sound2.gif) | toxic33.mp3 | 2022-07-04 11:21 | 9.3M | |
![[SND]](/icons/sound2.gif) | toxic32.mp3 | 2022-07-06 08:48 | 6.7M | |
![[SND]](/icons/sound2.gif) | toxic31.mp3 | 2022-07-04 11:04 | 7.9M | |
![[SND]](/icons/sound2.gif) | toxic30.mp3 | 2022-07-04 11:00 | 5.9M | |
![[SND]](/icons/sound2.gif) | toxic29.mp3 | 2022-07-04 10:59 | 7.8M | |
![[SND]](/icons/sound2.gif) | toxic28.mp3 | 2022-07-04 09:47 | 8.8M | |
![[SND]](/icons/sound2.gif) | toxic27.mp3 | 2022-07-04 09:47 | 9.4M | |
![[SND]](/icons/sound2.gif) | toxic26.mp3 | 2022-07-04 09:36 | 7.8M | |
![[SND]](/icons/sound2.gif) | toxic25.mp3 | 2022-07-04 09:34 | 4.1M | |
![[SND]](/icons/sound2.gif) | toxic24.mp3 | 2022-07-04 09:34 | 7.1M | |
![[SND]](/icons/sound2.gif) | toxic23.mp3 | 2022-07-04 09:31 | 7.4M | |
![[SND]](/icons/sound2.gif) | toxic22.mp3 | 2022-07-04 09:29 | 4.5M | |
![[SND]](/icons/sound2.gif) | toxic21.mp3 | 2022-07-04 09:29 | 3.8M | |
![[SND]](/icons/sound2.gif) | toxic20.mp3 | 2022-07-04 09:24 | 8.4M | |
![[SND]](/icons/sound2.gif) | toxic19.mp3 | 2022-07-04 09:21 | 5.2M | |
![[SND]](/icons/sound2.gif) | toxic18.mp3 | 2022-07-04 09:17 | 5.1M | |
![[SND]](/icons/sound2.gif) | toxic17.mp3 | 2022-07-04 09:17 | 5.1M | |
![[SND]](/icons/sound2.gif) | toxic16.mp3 | 2022-07-04 09:15 | 5.7M | |
![[SND]](/icons/sound2.gif) | toxic15.mp3 | 2022-07-04 09:12 | 7.4M | |
![[SND]](/icons/sound2.gif) | toxic14.mp3 | 2022-07-04 09:03 | 9.4M | |
![[SND]](/icons/sound2.gif) | toxic13.mp3 | 2022-07-04 09:01 | 7.1M | |
![[SND]](/icons/sound2.gif) | toxic12.mp3 | 2022-07-04 08:58 | 8.6M | |
![[SND]](/icons/sound2.gif) | toxic11.mp3 | 2022-07-04 06:46 | 9.5M | |
![[SND]](/icons/sound2.gif) | toxic10.mp3 | 2022-07-04 06:42 | 8.8M | |
![[SND]](/icons/sound2.gif) | toxic9.mp3 | 2022-07-04 06:40 | 9.1M | |
![[SND]](/icons/sound2.gif) | toxic8.mp3 | 2022-07-04 06:34 | 6.2M | |
![[SND]](/icons/sound2.gif) | toxic7.mp3 | 2022-07-04 06:31 | 7.8M | |
![[SND]](/icons/sound2.gif) | toxic6.mp3 | 2022-07-04 06:31 | 6.5M | |
![[SND]](/icons/sound2.gif) | toxic5.mp3 | 2022-07-04 06:29 | 7.5M | |
![[SND]](/icons/sound2.gif) | toxic4.mp3 | 2022-07-04 06:25 | 4.6M | |
![[SND]](/icons/sound2.gif) | toxic3.mp3 | 2022-07-04 06:21 | 6.6M | |
![[SND]](/icons/sound2.gif) | toxic2.m4a | 2022-07-04 06:23 | 2.4M | |
![[SND]](/icons/sound2.gif) | toxic1.mp3 | 2022-08-05 22:56 | 2.4M | |
![[SND]](/icons/sound2.gif) | toxic.mp3 | 2022-08-04 15:02 | 2.4M | |
![[SND]](/icons/sound2.gif) | town02.mp3 | 2022-07-23 16:10 | 1.7M | |
![[SND]](/icons/sound2.gif) | touch ft LilgWrld.mp3 | 2022-07-25 03:28 | 0 | |
![[SND]](/icons/sound2.gif) | touchbytouch.mp3 | 2022-07-20 03:26 | 0 | |
![[SND]](/icons/sound2.gif) | touch.mp3 | 2022-08-09 18:28 | 3.5M | |
![[SND]](/icons/sound2.gif) | toto1.mp3 | 2022-07-06 23:28 | 6.1M | |
![[SND]](/icons/sound2.gif) | toto.mp3 | 2022-08-12 13:26 | 3.0M | |
![[SND]](/icons/sound2.gif) | tothemoon.mp3.mp3 | 2022-07-13 06:18 | 3.6M | |
![[SND]](/icons/sound2.gif) | tothemoon.mp3 | 2022-08-08 07:36 | 0 | |
![[SND]](/icons/sound2.gif) | tothebone.mp3 | 2022-08-12 08:42 | 2.0M | |
![[SND]](/icons/sound2.gif) | total.mp3 | 2022-08-12 15:51 | 37M | |
![[SND]](/icons/sound2.gif) | tose1.mp3 | 2022-08-09 08:36 | 0 | |
![[SND]](/icons/sound2.gif) | toro1.mp3 | 2022-08-09 21:55 | 4.1M | |
![[SND]](/icons/sound2.gif) | torik3.mp3 | 2022-06-29 10:50 | 2.0M | |
![[SND]](/icons/sound2.gif) | torik2.mp3 | 2022-06-29 10:49 | 3.0M | |
![[SND]](/icons/sound2.gif) | torik1.mp3 | 2022-06-29 10:49 | 3.4M | |
![[SND]](/icons/sound2.gif) | tor akla bikal.mp3 | 2022-08-05 11:25 | 322K | |
![[SND]](/icons/sound2.gif) | tora.mp3 | 2022-07-23 10:33 | 0 | |
![[SND]](/icons/sound2.gif) | toptop.mp3 | 2022-07-17 08:14 | 136K | |
![[SND]](/icons/sound2.gif) | topsong01.mp3 | 2022-08-06 05:47 | 0 | |
![[SND]](/icons/sound2.gif) | topromanticsong.mp3 | 2022-08-09 14:31 | 0 | |
![[SND]](/icons/sound2.gif) | topremix-net_gazirovka_-_black_jvstin_remix__456239213169246089.mp3 | 2022-07-07 11:09 | 8.1M | |
![[SND]](/icons/sound2.gif) | topn.mp3 | 2022-07-18 03:26 | 0 | |
![[SND]](/icons/sound2.gif) | toples3.mp3 | 2022-07-14 15:04 | 2.5M | |
![[SND]](/icons/sound2.gif) | toples2.mp3 | 2022-07-14 15:03 | 2.6M | |
![[SND]](/icons/sound2.gif) | toples1.mp3 | 2022-07-14 15:03 | 2.2M | |
![[SND]](/icons/sound2.gif) | topic-feat.-a7s-breaking-me.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | topi1.mp3 | 2022-07-27 16:06 | 0 | |
![[SND]](/icons/sound2.gif) | topeng.mp3 | 2022-07-24 14:20 | 5.3M | |
![[SND]](/icons/sound2.gif) | topackzb.mp3 | 2022-07-19 12:04 | 1.1M | |
![[SND]](/icons/sound2.gif) | topa.mp3 | 2022-07-23 14:41 | 0 | |
![[SND]](/icons/sound2.gif) | top_20_bai_hat_hot_nhat_tren_tiktok_2022_nhac_remix_hot_trend_duoc_su_dung_nhieu_nhat_tiktok_2022_7570171970171449728.mp3 | 2022-08-01 14:19 | 0 | |
![[SND]](/icons/sound2.gif) | topMusik.mp3 | 2022-07-08 14:04 | 6.0M | |
![[SND]](/icons/sound2.gif) | top20.mp3 | 2022-07-09 15:10 | 78M | |
![[SND]](/icons/sound2.gif) | top.mp3 | 2022-08-10 14:48 | 3.1M | |
![[SND]](/icons/sound2.gif) | toon2.mp3.mp3 | 2022-07-15 17:11 | 2.5M | |
![[SND]](/icons/sound2.gif) | toofan.mp3 | 2022-08-06 06:33 | 0 | |
![[SND]](/icons/sound2.gif) | tonyq.mp3 | 2022-07-22 04:06 | 0 | |
![[SND]](/icons/sound2.gif) | tonight.mp3 | 2022-08-02 16:35 | 0 | |
![[SND]](/icons/sound2.gif) | toni.mp3 | 2022-06-30 16:41 | 2.4M | |
![[SND]](/icons/sound2.gif) | tongkrongan.mp3 | 2022-07-18 15:54 | 3.8M | |
![[SND]](/icons/sound2.gif) | tonggiavy.mp3 | 2022-08-10 06:27 | 0 | |
![[SND]](/icons/sound2.gif) | tones-and-i-dance-monkey.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | tomp3.cc - Marianas Trench Wildfire Lyric Video.mp3 | 2022-07-18 21:34 | 0 | |
![[SND]](/icons/sound2.gif) | tomnome.mp3 | 2022-07-12 18:20 | 47K | |
![[SND]](/icons/sound2.gif) | tommy1.mp3 | 2022-07-12 03:23 | 62M | |
![[SND]](/icons/sound2.gif) | tomdesc.mp3 | 2022-07-12 18:21 | 106K | |
![[SND]](/icons/sound2.gif) | tomboy69.mp3 | 2022-07-26 16:20 | 0 | |
![[SND]](/icons/sound2.gif) | toma tussi gasta la plata (speed up)(_wtEzNBKSVxc_).m4a | 2022-07-06 12:02 | 2.4M | |
![[SND]](/icons/sound2.gif) | tomassleby1.mp3 | 2022-07-31 00:44 | 0 | |
![[SND]](/icons/sound2.gif) | tomasslebew.mp3 | 2022-07-11 18:54 | 6.4M | |
![[SND]](/icons/sound2.gif) | tomas slebew.mp3 | 2022-07-26 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | tomas.mp3 | 2022-07-24 14:31 | 0 | |
![[SND]](/icons/sound2.gif) | tom123.mp3 | 2022-07-23 11:39 | 0 | |
![[SND]](/icons/sound2.gif) | tom1.mp3 | 2022-08-09 17:17 | 0 | |
![[SND]](/icons/sound2.gif) | tom.mp3 | 2022-08-12 14:51 | 1.6M | |
![[SND]](/icons/sound2.gif) | tolol.mp3 | 2022-07-30 10:08 | 0 | |
![[SND]](/icons/sound2.gif) | toliver123.mp3 | 2022-07-12 16:07 | 2.3M | |
![[SND]](/icons/sound2.gif) | tola.mp3 | 2022-07-09 10:58 | 7.6M | |
![[SND]](/icons/sound2.gif) | tol.mp3 | 2022-06-30 02:57 | 3.8M | |
![[SND]](/icons/sound2.gif) | tokyodrift001.mp3 | 2022-07-11 13:47 | 3.9M | |
![[SND]](/icons/sound2.gif) | tokyodrift.mp3 | 2022-07-07 21:05 | 3.5M | |
![[SND]](/icons/sound2.gif) | tokyo1.mp3 | 2022-06-30 10:09 | 3.9M | |
![[SND]](/icons/sound2.gif) | tokyo.mp3 | 2022-08-02 03:05 | 4.1M | |
![[SND]](/icons/sound2.gif) | toktok.mp3 | 2022-07-10 05:41 | 4.2M | |
![[SND]](/icons/sound2.gif) | toji E.mp3 | 2022-07-05 09:14 | 11M | |
![[SND]](/icons/sound2.gif) | toi.mp3 | 2022-07-02 03:19 | 1.1M | |
![[SND]](/icons/sound2.gif) | tohalek_-_Bokal_vina_ya_pyu_ego_do_dna_60434839.mp3 | 2022-07-26 17:42 | 0 | |
![[SND]](/icons/sound2.gif) | togok.mp3 | 2022-07-01 19:39 | 13M | |
![[SND]](/icons/sound2.gif) | toge7.mp3 | 2022-07-21 05:23 | 0 | |
![[SND]](/icons/sound2.gif) | toge6.mp3 | 2022-07-21 05:23 | 0 | |
![[SND]](/icons/sound2.gif) | toge3.mp3 | 2022-07-21 05:23 | 0 | |
![[SND]](/icons/sound2.gif) | toge2.mp3 | 2022-07-21 05:23 | 0 | |
![[SND]](/icons/sound2.gif) | toge1.mp3 | 2022-07-21 05:23 | 0 | |
![[SND]](/icons/sound2.gif) | toge0.mp3 | 2022-08-10 11:54 | 0 | |
![[SND]](/icons/sound2.gif) | todd.mp3 | 2022-08-08 08:42 | 0 | |
![[SND]](/icons/sound2.gif) | todamoon.mp3 | 2022-07-28 03:01 | 0 | |
![[SND]](/icons/sound2.gif) | tod1.mp3 | 2022-07-31 07:07 | 0 | |
![[SND]](/icons/sound2.gif) | tod.mp3 | 2022-08-03 02:37 | 0 | |
![[SND]](/icons/sound2.gif) | tobatmaksiat.mp3 | 2022-06-29 04:37 | 6.1M | |
![[SND]](/icons/sound2.gif) | tobatbrow.mp3 | 2022-07-22 23:19 | 0 | |
![[SND]](/icons/sound2.gif) | tobatbro.mp3 | 2022-07-16 17:55 | 2.5M | |
![[SND]](/icons/sound2.gif) | tobat69.mp3 | 2022-07-07 13:13 | 4.1M | |
![[SND]](/icons/sound2.gif) | tobat.mp3 | 2022-07-20 11:48 | 2.1M | |
![[SND]](/icons/sound2.gif) | toaimeson.mp3 | 2022-07-31 10:38 | 0 | |
![[SND]](/icons/sound2.gif) | to.mp3 | 2022-07-19 07:35 | 2.4M | |
![[SND]](/icons/sound2.gif) | tnz12.mp3 | 2022-06-30 08:08 | 4.0M | |
![[SND]](/icons/sound2.gif) | tnz11.mp3 | 2022-06-30 08:06 | 5.8M | |
![[SND]](/icons/sound2.gif) | tnz10.mp3 | 2022-06-30 08:06 | 3.9M | |
![[SND]](/icons/sound2.gif) | tnz9.mp3 | 2022-06-30 08:06 | 4.1M | |
![[SND]](/icons/sound2.gif) | tnz8.mp3 | 2022-06-30 07:09 | 3.0M | |
![[SND]](/icons/sound2.gif) | tnz7.mp3 | 2022-06-30 06:57 | 2.4M | |
![[SND]](/icons/sound2.gif) | tnz6.mp3 | 2022-06-30 06:57 | 2.4M | |
![[SND]](/icons/sound2.gif) | tnz5.mp3 | 2022-06-30 06:56 | 1.9M | |
![[SND]](/icons/sound2.gif) | tnz4.mp3 | 2022-06-30 06:56 | 2.3M | |
![[SND]](/icons/sound2.gif) | tnz3.mp3 | 2022-06-30 06:56 | 2.5M | |
![[SND]](/icons/sound2.gif) | tnz2.mp3 | 2022-06-30 06:56 | 2.9M | |
![[SND]](/icons/sound2.gif) | tnz1.mp3 | 2022-06-30 06:37 | 3.7M | |
![[SND]](/icons/sound2.gif) | tny.mp3 | 2022-07-08 02:59 | 5.8M | |
![[SND]](/icons/sound2.gif) | tnm.mp3 | 2022-07-22 15:39 | 0 | |
![[SND]](/icons/sound2.gif) | tnh.mp3 | 2022-08-10 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | tng_transporter9.mp3 | 2022-07-14 09:15 | 65K | |
![[SND]](/icons/sound2.gif) | tn.mp3 | 2022-07-04 06:59 | 15M | |
![[SND]](/icons/sound2.gif) | tmpq7mpzzl9.mp3 | 2022-07-10 12:00 | 232K | |
![[SND]](/icons/sound2.gif) | tmpcqy7h8pq.mp3 | 2022-07-16 00:12 | 207K | |
![[SND]](/icons/sound2.gif) | tm23.mp3 | 2022-08-07 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | tm20.mp3 | 2022-08-07 15:32 | 4.4M | |
![[SND]](/icons/sound2.gif) | tm19.mp3 | 2022-08-07 15:32 | 3.3M | |
![[SND]](/icons/sound2.gif) | tm18.mp3 | 2022-08-07 15:32 | 2.4M | |
![[SND]](/icons/sound2.gif) | tm17.mp3 | 2022-08-07 15:32 | 6.5M | |
![[SND]](/icons/sound2.gif) | tm16.mp3 | 2022-07-13 15:20 | 3.9M | |
![[SND]](/icons/sound2.gif) | tm15.mp3 | 2022-08-07 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | tm14.mp3 | 2022-08-07 15:32 | 4.1M | |
![[SND]](/icons/sound2.gif) | tm13.mp3 | 2022-08-07 15:32 | 3.0M | |
![[SND]](/icons/sound2.gif) | tm12.mp3 | 2022-08-07 15:32 | 4.7M | |
![[SND]](/icons/sound2.gif) | tm11.mp3 | 2022-08-07 15:32 | 4.1M | |
![[SND]](/icons/sound2.gif) | tm10.mp3 | 2022-08-07 15:32 | 3.7M | |
![[SND]](/icons/sound2.gif) | tm9.mp3 | 2022-08-07 15:32 | 2.8M | |
![[SND]](/icons/sound2.gif) | tm8.mp3 | 2022-08-07 15:32 | 2.9M | |
![[SND]](/icons/sound2.gif) | tm7.mp3 | 2022-08-07 15:32 | 3.4M | |
![[SND]](/icons/sound2.gif) | tm6.mp3 | 2022-08-07 15:32 | 6.7M | |
![[SND]](/icons/sound2.gif) | tm5.mp3 | 2022-08-07 15:32 | 7.3M | |
![[SND]](/icons/sound2.gif) | tm4.mp3 | 2022-08-07 15:32 | 8.8M | |
![[SND]](/icons/sound2.gif) | tm3.mp3 | 2022-08-07 15:32 | 6.6M | |
![[SND]](/icons/sound2.gif) | tm2.mp3 | 2022-08-07 15:32 | 7.7M | |
![[SND]](/icons/sound2.gif) | tm1.mp3 | 2022-08-07 15:32 | 10M | |
![[SND]](/icons/sound2.gif) | tlg.mp3 | 2022-07-02 07:28 | 4.0M | |
![[SND]](/icons/sound2.gif) | tkus.mp3 | 2022-07-14 20:05 | 1.8M | |
![[SND]](/icons/sound2.gif) | tklove.mp3 | 2022-08-12 03:33 | 0 | |
![[SND]](/icons/sound2.gif) | tkc2.mp3 | 2022-07-10 17:56 | 4.8M | |
![[SND]](/icons/sound2.gif) | tkbrn.mp3 | 2022-07-09 15:49 | 33M | |
![[SND]](/icons/sound2.gif) | tkbircuy.mp3 | 2022-07-09 12:01 | 5.4M | |
![[SND]](/icons/sound2.gif) | tkbir.mp3 | 2022-07-09 10:25 | 7.2M | |
![[SND]](/icons/sound2.gif) | tk3 .mp3 | 2022-07-25 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | tk2.mp3 | 2022-07-25 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | tk1.mp3 | 2022-07-25 11:37 | 0 | |
![[SND]](/icons/sound2.gif) | tj.mp3 | 2022-07-20 23:39 | 0 | |
![[SND]](/icons/sound2.gif) | tiwi.mp3 | 2022-08-07 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | tiusai.mp3 | 2022-06-27 18:58 | 8.7M | |
![[SND]](/icons/sound2.gif) | tiu19.mp3 | 2022-07-19 16:24 | 2.8M | |
![[SND]](/icons/sound2.gif) | tiu18.mp3 | 2022-07-16 05:46 | 2.7M | |
![[SND]](/icons/sound2.gif) | tiu17.mp3 | 2022-07-08 15:58 | 6.5M | |
![[SND]](/icons/sound2.gif) | tiu16.mp3 | 2022-07-08 15:58 | 4.0M | |
![[SND]](/icons/sound2.gif) | tiu15.mp3 | 2022-06-30 03:19 | 3.6M | |
![[SND]](/icons/sound2.gif) | tiu14.mp3 | 2022-06-30 03:19 | 3.0M | |
![[SND]](/icons/sound2.gif) | tiu13.mp3 | 2022-06-30 03:19 | 3.0M | |
![[SND]](/icons/sound2.gif) | tiu12.mp3 | 2022-06-29 15:16 | 3.6M | |
![[SND]](/icons/sound2.gif) | tiu11.mp3 | 2022-06-29 15:16 | 2.8M | |
![[SND]](/icons/sound2.gif) | tiu10.mp3 | 2022-06-29 15:16 | 2.2M | |
![[SND]](/icons/sound2.gif) | tiu9.mp3 | 2022-06-29 15:16 | 5.2M | |
![[SND]](/icons/sound2.gif) | tiu8.mp3 | 2022-06-29 15:16 | 4.5M | |
![[SND]](/icons/sound2.gif) | tiu7.mp3 | 2022-06-29 15:15 | 3.4M | |
![[SND]](/icons/sound2.gif) | tiu6.mp3 | 2022-06-29 15:15 | 2.6M | |
![[SND]](/icons/sound2.gif) | tiu5.mp3 | 2022-06-29 15:15 | 3.4M | |
![[SND]](/icons/sound2.gif) | tiu4.mp3 | 2022-06-29 15:15 | 1.8M | |
![[SND]](/icons/sound2.gif) | tiu3.mp3 | 2022-06-29 15:15 | 2.7M | |
![[SND]](/icons/sound2.gif) | tiu2.mp3 | 2022-08-03 00:00 | 3.1M | |
![[SND]](/icons/sound2.gif) | tiu1.mp3 | 2022-06-29 15:14 | 4.1M | |
![[SND]](/icons/sound2.gif) | tiu.mp3 | 2022-07-22 20:14 | 3.6M | |
![[SND]](/icons/sound2.gif) | tittle.mp3 | 2022-07-22 06:47 | 2.7M | |
![[SND]](/icons/sound2.gif) | title.mp3 | 2022-07-29 14:21 | 2.8M | |
![[SND]](/icons/sound2.gif) | titig.mp3 | 2022-07-14 03:03 | 4.0M | |
![[SND]](/icons/sound2.gif) | titibo.mp3 | 2022-08-04 15:47 | 0 | |
![[SND]](/icons/sound2.gif) | tite2.mp3 | 2022-08-04 19:04 | 0 | |
![[SND]](/icons/sound2.gif) | tite1.mp3 | 2022-08-04 19:00 | 0 | |
![[SND]](/icons/sound2.gif) | tite.mp3 | 2022-08-09 10:49 | 0 | |
![[SND]](/icons/sound2.gif) | titanic_best_version.mp3 | 2022-07-24 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | titan1.mp3 | 2022-07-17 17:54 | 0 | |
![[SND]](/icons/sound2.gif) | tishina.mp3 | 2022-07-06 07:05 | 2.9M | |
![[SND]](/icons/sound2.gif) | tirrpintrorainpogi.mp3 | 2022-07-06 17:55 | 5.6M | |
![[SND]](/icons/sound2.gif) | tirrp.mp3 | 2022-07-20 03:46 | 1.3M | |
![[SND]](/icons/sound2.gif) | tirachrach.mp3 | 2022-07-22 12:17 | 0 | |
![[SND]](/icons/sound2.gif) | tiputipu.mp3 | 2022-07-28 12:40 | 0 | |
![[SND]](/icons/sound2.gif) | tipu.mp3 | 2022-08-06 17:07 | 0 | |
![[SND]](/icons/sound2.gif) | tipopohronil-на горе стоит верблюд -kissvk.com.mp3 | 2022-07-14 16:52 | 3.4M | |
![[SND]](/icons/sound2.gif) | tipex.mp3 | 2022-08-09 05:46 | 2.7M | |
![[SND]](/icons/sound2.gif) | tintinn.mp3 | 2022-07-21 12:01 | 0 | |
![[SND]](/icons/sound2.gif) | tinotoyo.mp3 | 2022-07-26 22:31 | 0 | |
![[SND]](/icons/sound2.gif) | tinhdepdmay.mp3 | 2022-07-17 06:32 | 3.7M | |
![[SND]](/icons/sound2.gif) | tingkir.mp3 | 2022-07-09 00:23 | 4.4M | |
![[SND]](/icons/sound2.gif) | tingindolane.mp3 | 2022-07-11 16:13 | 34K | |
![[SND]](/icons/sound2.gif) | tinggi.mp3 | 2022-08-05 11:02 | 0 | |
![[SND]](/icons/sound2.gif) | ting.mp3 | 2022-07-21 12:07 | 0 | |
![[SND]](/icons/sound2.gif) | tinder.mp3 | 2022-06-29 21:35 | 4.4M | |
![[SND]](/icons/sound2.gif) | tinatawag.mp3 | 2022-07-04 09:04 | 6.1M | |
![[SND]](/icons/sound2.gif) | tin.mp3 | 2022-06-29 09:37 | 236K | |
![[SND]](/icons/sound2.gif) | timur.mp3 | 2022-06-30 18:32 | 168M | |
![[SND]](/icons/sound2.gif) | timmies.mp3 | 2022-07-12 09:34 | 1.9M | |
![[SND]](/icons/sound2.gif) | timeback.mp3 | 2022-07-18 15:47 | 0 | |
![[SND]](/icons/sound2.gif) | time.mp3 | 2022-07-27 08:01 | 2.8M | |
![[SND]](/icons/sound2.gif) | tim.mp3 | 2022-07-18 13:09 | 3.4M | |
![[SND]](/icons/sound2.gif) | tilly.mp3 | 2022-07-09 02:35 | 4.5M | |
![[SND]](/icons/sound2.gif) | tilldeathdouspart.mp3 | 2022-07-02 06:34 | 3.4M | |
![[SND]](/icons/sound2.gif) | tilawra.mp3 | 2022-07-24 10:39 | 0 | |
![[SND]](/icons/sound2.gif) | tikusruk-cewe-chindo-ft-lil-silit_T2-i7ASxH0w.mp3 | 2022-07-20 11:30 | 0 | |
![[SND]](/icons/sound2.gif) | tikuskantor.mp3 | 2022-07-14 17:56 | 2.4M | |
![[SND]](/icons/sound2.gif) | tikus34.mp3 | 2022-06-29 16:02 | 2.4M | |
![[SND]](/icons/sound2.gif) | tikus2u.mp3 | 2022-07-21 12:57 | 0 | |
![[SND]](/icons/sound2.gif) | tikus.mp3 | 2022-08-01 17:09 | 2.4M | |
![[SND]](/icons/sound2.gif) | tiktokremix123.mp3 | 2022-06-29 17:48 | 56M | |
![[SND]](/icons/sound2.gif) | tiktokbhdbff20212.mp3 | 2022-06-29 05:46 | 34M | |
![[SND]](/icons/sound2.gif) | tiktokbhdbff2021.mp3 | 2022-06-29 05:41 | 35M | |
![[SND]](/icons/sound2.gif) | tiktok1659935553675.mp3 | 2022-08-08 05:14 | 0 | |
![[SND]](/icons/sound2.gif) | tiktok1659928111013.mp3 | 2022-08-08 05:10 | 0 | |
![[SND]](/icons/sound2.gif) | tiktok3.mp3 | 2022-08-03 05:03 | 3.8M | |
![[SND]](/icons/sound2.gif) | tiktok2.mp3 | 2022-08-03 05:03 | 1.4M | |
![[SND]](/icons/sound2.gif) | tiktok1.mp3 | 2022-08-03 05:03 | 2.9M | |
![[SND]](/icons/sound2.gif) | tiktok.mp3 | 2022-08-05 16:04 | 736K | |
![[SND]](/icons/sound2.gif) | tiktok-i-just-can-t‼️-kevin-rater-remix-2021-ytmp3juice.mp3 | 2022-08-09 15:45 | 0 | |
![[SND]](/icons/sound2.gif) | tiktod.mp3 | 2022-08-12 08:28 | 0 | |
![[VID]](/icons/movie.gif) | tikmate.app_7124635268526689562.mp4 | 2022-07-27 14:48 | 0 | |
![[SND]](/icons/sound2.gif) | tikamaro.mp3 | 2022-07-07 18:05 | 4.2M | |
![[SND]](/icons/sound2.gif) | tije ah ah ah 3 jam.mp3 | 2022-07-12 19:42 | 2.4M | |
![[SND]](/icons/sound2.gif) | tije.mp3 | 2022-07-12 19:35 | 1.9M | |
![[SND]](/icons/sound2.gif) | tigorishkakogon.mp3 | 2022-08-06 16:12 | 0 | |
![[SND]](/icons/sound2.gif) | tigini.mp3 | 2022-07-04 03:26 | 3.1M | |
![[SND]](/icons/sound2.gif) | tigidong1.mp3 | 2022-08-02 16:37 | 0 | |
![[SND]](/icons/sound2.gif) | tigbason.mp3 | 2022-08-01 12:06 | 836K | |
![[SND]](/icons/sound2.gif) | tigawo.mp3 | 2022-07-13 13:46 | 3.5M | |
![[SND]](/icons/sound2.gif) | tiga.mp3 | 2022-07-17 19:51 | 0 | |
![[SND]](/icons/sound2.gif) | tiesto_seavolution.mp3 | 2022-07-02 10:06 | 11M | |
![[SND]](/icons/sound2.gif) | tiesto-sevenn-boom.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | tienquanca.mp3 | 2022-07-01 01:47 | 3.4M | |
![[SND]](/icons/sound2.gif) | tiengxehoi.mp3 | 2022-08-09 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | tiendz.mp3 | 2022-07-09 16:45 | 56M | |
![[SND]](/icons/sound2.gif) | tiendeptrai20ai2.mp3 | 2022-07-12 08:47 | 4.4M | |
![[SND]](/icons/sound2.gif) | tien.mp3 | 2022-08-08 01:13 | 3.1M | |
![[SND]](/icons/sound2.gif) | tiectrasao.mp3 | 2022-08-07 03:37 | 0 | |
![[SND]](/icons/sound2.gif) | tidur.mp3 | 2022-07-20 09:25 | 3.4M | |
![[SND]](/icons/sound2.gif) | tidur.m4a | 2022-07-06 12:10 | 15K | |
![[SND]](/icons/sound2.gif) | tidakbersyukur.mp3 | 2022-07-21 12:05 | 8.7M | |
![[SND]](/icons/sound2.gif) | tidak.mp3 | 2022-07-06 12:13 | 4.6M | |
![[SND]](/icons/sound2.gif) | tibja.mp3 | 2022-07-17 01:09 | 0 | |
![[SND]](/icons/sound2.gif) | tiba.mp3 | 2022-07-10 11:39 | 3.7M | |
![[SND]](/icons/sound2.gif) | tiara2.mp3 | 2022-07-31 10:56 | 0 | |
![[SND]](/icons/sound2.gif) | tiara1.mp3 | 2022-07-31 10:48 | 2.8M | |
![[SND]](/icons/sound2.gif) | tiara09.mp3 | 2022-07-28 07:39 | 0 | |
![[SND]](/icons/sound2.gif) | tiara.mp3 | 2022-08-07 08:21 | 3.6M | |
![[SND]](/icons/sound2.gif) | tiapmalem.mp3 | 2022-07-01 17:20 | 10M | |
![[SND]](/icons/sound2.gif) | tian4.mp3 | 2022-08-08 20:43 | 0 | |
![[SND]](/icons/sound2.gif) | tian3.mp3 | 2022-08-08 20:44 | 0 | |
![[SND]](/icons/sound2.gif) | tian1.mp3 | 2022-08-09 22:12 | 0 | |
![[SND]](/icons/sound2.gif) | tian.mp3.mp3 | 2022-07-03 08:57 | 2.7M | |
![[SND]](/icons/sound2.gif) | tian.mp3 | 2022-08-13 00:24 | 0 | |
![[SND]](/icons/sound2.gif) | tiadaguna.mp3 | 2022-06-28 02:17 | 6.5M | |
![[SND]](/icons/sound2.gif) | tiMO21.mp3 | 2022-08-08 00:28 | 2.5M | |
![[SND]](/icons/sound2.gif) | thuyenvang.mp3 | 2022-08-08 01:13 | 4.2M | |
![[SND]](/icons/sound2.gif) | thuyenquyen.mp3 | 2022-08-08 03:11 | 0 | |
![[SND]](/icons/sound2.gif) | thuyenhoa.mp3 | 2022-07-12 07:03 | 5.7M | |
![[SND]](/icons/sound2.gif) | thuongemdengia.mp3 | 2022-07-22 03:09 | 3.6M | |
![[SND]](/icons/sound2.gif) | thunder_some_rain-57605.mp3 | 2022-07-24 04:51 | 0 | |
![[SND]](/icons/sound2.gif) | thunder.mp3 | 2022-07-23 16:21 | 1.5M | |
![[SND]](/icons/sound2.gif) | thunder-25689.mp3 | 2022-07-24 04:51 | 0 | |
![[SND]](/icons/sound2.gif) | thumbi.mp3 | 2022-08-07 16:49 | 0 | |
![[SND]](/icons/sound2.gif) | thumas.mp3 | 2022-07-01 10:18 | 4.3M | |
![[SND]](/icons/sound2.gif) | thrill_pill_polnoch.mp3 | 2022-08-11 17:56 | 0 | |
![[SND]](/icons/sound2.gif) | thrill-pill-polnoch.mp3 | 2022-08-11 15:55 | 0 | |
![[SND]](/icons/sound2.gif) | thrill-pill-egor-krid-morgenshtern-grustnaya-pesnya-mp3.mp3 | 2022-07-03 21:14 | 8.7M | |
![[SND]](/icons/sound2.gif) | three3.mp3 | 2022-07-28 07:32 | 0 | |
![[SND]](/icons/sound2.gif) | three.mp3 | 2022-07-14 15:46 | 4.1M | |
![[SND]](/icons/sound2.gif) | thoyba.mp3 | 2022-08-02 04:25 | 0 | |
![[SND]](/icons/sound2.gif) | thot.mp3 | 2022-07-13 15:17 | 4.5M | |
![[SND]](/icons/sound2.gif) | thoothu12.mp3 | 2022-08-01 07:02 | 0 | |
![[SND]](/icons/sound2.gif) | thoothu8.mp3 | 2022-07-03 07:31 | 2.7M | |
![[SND]](/icons/sound2.gif) | thoothu7.mp3 | 2022-07-03 07:25 | 3.0M | |
![[SND]](/icons/sound2.gif) | thoothu6.mp3 | 2022-07-03 07:10 | 2.1M | |
![[SND]](/icons/sound2.gif) | thoothu2.mp3 | 2022-07-08 12:17 | 4.5M | |
![[SND]](/icons/sound2.gif) | thoothu1.mp3 | 2022-07-03 06:39 | 4.3M | |
![[SND]](/icons/sound2.gif) | thomsad1.mp3 | 2022-07-08 17:15 | 3.2M | |
![[SND]](/icons/sound2.gif) | thomprot.mp3 | 2022-07-24 07:18 | 0 | |
![[SND]](/icons/sound2.gif) | thomasff.mp3 | 2022-06-28 15:06 | 4.3M | |
![[SND]](/icons/sound2.gif) | thomas.mp3 | 2022-08-11 13:24 | 3.6M | |
![[SND]](/icons/sound2.gif) | thom9.mp3 | 2022-06-30 10:25 | 4.3M | |
![[SND]](/icons/sound2.gif) | thithoi.mp3 | 2022-07-30 22:52 | 0 | |
![[SND]](/icons/sound2.gif) | thisview(MP3_70K).mp3 | 2022-07-22 14:33 | 0 | |
![[SND]](/icons/sound2.gif) | thisv.mp3 | 2022-07-22 14:51 | 0 | |
![[SND]](/icons/sound2.gif) | this is vagos.mp3 | 2022-08-04 17:10 | 0 | |
![[SND]](/icons/sound2.gif) | this is my kingdom come 2.mp3 | 2022-07-07 18:10 | 542K | |
![[SND]](/icons/sound2.gif) | this_band_kahit_ayaw_mo_na_lyrics_aac_19018.m4a | 2022-07-06 08:48 | 3.9M | |
![[SND]](/icons/sound2.gif) | this.mp3 | 2022-07-19 13:50 | 0 | |
![[SND]](/icons/sound2.gif) | this-is-war-loopable-95413.mp3 | 2022-08-07 17:09 | 0 | |
![[SND]](/icons/sound2.gif) | thirteen.mp3 | 2022-07-29 06:35 | 0 | |
![[SND]](/icons/sound2.gif) | thientu.mp3 | 2022-07-13 16:38 | 3.0M | |
![[SND]](/icons/sound2.gif) | thi.mp3 | 2022-07-28 01:32 | 3.2M | |
![[SND]](/icons/sound2.gif) | thgdin2.mp3 | 2022-07-20 00:10 | 5.3M | |
![[SND]](/icons/sound2.gif) | theyn.mp3 | 2022-08-11 17:16 | 0 | |
![[SND]](/icons/sound2.gif) | theylongtobe.mp3 | 2022-08-06 06:06 | 2.5M | |
![[SND]](/icons/sound2.gif) | the will.mp3 | 2022-08-12 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | theweekndn.mp3 | 2022-07-30 17:53 | 0 | |
![[SND]](/icons/sound2.gif) | theweeknd.mp3 | 2022-08-11 05:40 | 0 | |
![[SND]](/icons/sound2.gif) | thevirgin.mp3 | 2022-07-18 02:59 | 0 | |
![[SND]](/icons/sound2.gif) | the virgin.mp3 | 2022-07-10 16:28 | 4.4M | |
![[SND]](/icons/sound2.gif) | thetle.mp3 | 2022-07-20 22:57 | 0 | |
![[SND]](/icons/sound2.gif) | theshade.mp3 | 2022-08-09 06:59 | 1.9M | |
![[SND]](/icons/sound2.gif) | the shade .mp3 | 2022-08-04 01:53 | 0 | |
![[SND]](/icons/sound2.gif) | the secret room.mp3 | 2022-07-13 20:02 | 714K | |
![[SND]](/icons/sound2.gif) | therefore you and me (Eve) - ninzin.com_303.mp3 | 2022-07-17 14:54 | 888K | |
![[SND]](/icons/sound2.gif) | thereason.mp3 | 2022-07-22 12:00 | 3.1M | |
![[SND]](/icons/sound2.gif) | there.mp3 | 2022-07-06 15:31 | 8.1M | |
![[SND]](/icons/sound2.gif) | therapy.mp3 | 2022-07-11 11:21 | 1.7M | |
![[SND]](/icons/sound2.gif) | the purge.mp3 | 2022-07-15 12:26 | 1.1M | |
![[SND]](/icons/sound2.gif) | thepattern.mp3 | 2022-07-19 01:05 | 105K | |
![[SND]](/icons/sound2.gif) | the only one.mp3 | 2022-07-24 01:49 | 0 | |
![[SND]](/icons/sound2.gif) | theo12.mp3 | 2022-07-12 13:00 | 3.1M | |
![[SND]](/icons/sound2.gif) | theo11.mp3 | 2022-07-11 10:53 | 2.3M | |
![[SND]](/icons/sound2.gif) | theo10.mp3 | 2022-07-11 10:52 | 4.1M | |
![[SND]](/icons/sound2.gif) | theo9.mp3 | 2022-07-11 10:49 | 4.5M | |
![[SND]](/icons/sound2.gif) | theo8.mp3 | 2022-07-11 10:44 | 3.6M | |
![[SND]](/icons/sound2.gif) | theo7.mp3 | 2022-07-11 10:41 | 3.1M | |
![[SND]](/icons/sound2.gif) | theo6.mp3 | 2022-07-11 10:39 | 3.7M | |
![[SND]](/icons/sound2.gif) | theo5.mp3 | 2022-07-11 10:02 | 3.2M | |
![[SND]](/icons/sound2.gif) | theo4.mp3 | 2022-07-11 10:03 | 3.3M | |
![[SND]](/icons/sound2.gif) | theo3.mp3 | 2022-07-11 10:00 | 2.2M | |
![[SND]](/icons/sound2.gif) | theo 2.mp3 | 2022-07-11 09:57 | 1.8M | |
![[SND]](/icons/sound2.gif) | theo1.mp3 | 2022-07-11 09:55 | 3.1M | |
![[SND]](/icons/sound2.gif) | theo.mp3 | 2022-08-05 12:08 | 0 | |
![[SND]](/icons/sound2.gif) | the new sweet groove.mp3 | 2022-08-10 19:01 | 0 | |
![[SND]](/icons/sound2.gif) | themurder.mp3 | 2022-07-09 10:18 | 10M | |
![[SND]](/icons/sound2.gif) | theme.mp3 | 2022-07-02 17:42 | 2.5M | |
![[SND]](/icons/sound2.gif) | theman.mp3 | 2022-07-22 11:59 | 0 | |
![[SND]](/icons/sound2.gif) | thefatrat.mp3 | 2022-07-13 10:33 | 6.1M | |
![[SND]](/icons/sound2.gif) | the crossing.mp3 | 2022-07-05 16:26 | 4.7M | |
![[SND]](/icons/sound2.gif) | thechille.mp3 | 2022-08-10 20:22 | 372K | |
![[SND]](/icons/sound2.gif) | theboxma_22-07-22_00-16-51-391.mp3 | 2022-07-21 19:38 | 0 | |
![[SND]](/icons/sound2.gif) | thebox.mp3 | 2022-07-11 03:15 | 3.0M | |
![[SND]](/icons/sound2.gif) | the best Ukrainian songs - BUSHIDO ZHO - Водила чувствует мой вайб.mp3 | 2022-08-12 15:37 | 0 | |
![[SND]](/icons/sound2.gif) | thealamenthe.mp3 | 2022-07-05 13:16 | 6.2M | |
![[SND]](/icons/sound2.gif) | the_remedy_for_a_broken_heart_(why_am_I_so_in_love)(128k).mp3 | 2022-07-05 19:00 | 2.4M | |
![[SND]](/icons/sound2.gif) | the_elder_scrolls_v_skyrim_38. Jeremy Soule - Around the Fire.mp3 | 2022-07-05 18:49 | 4.4M | |
![[SND]](/icons/sound2.gif) | the_elder_scrolls_v_skyrim_38. Jeremy Soule - Around the Fire (2).mp3 | 2022-07-05 19:07 | 4.4M | |
![[SND]](/icons/sound2.gif) | the_elder_scrolls_v_skyrim_01. Jeremy Soule - Dragonborn.mp3 | 2022-07-05 19:41 | 5.4M | |
![[SND]](/icons/sound2.gif) | the.mp3 | 2022-08-06 01:01 | 3.8M | |
![[SND]](/icons/sound2.gif) | the-walters-i-love-you-so-speed-up_456239163.mp3 | 2022-06-28 19:31 | 2.0M | |
![[SND]](/icons/sound2.gif) | the-sonics-have-love-will-travel.mp3 | 2022-07-24 16:49 | 0 | |
![[SND]](/icons/sound2.gif) | the-smiths-the-boy-with-the-thorn-in-his-side.mp3 | 2022-08-09 05:32 | 0 | |
![[SND]](/icons/sound2.gif) | the-score-full-album-2022-the-score-greatest-hits-best-the-score-songs-playlist-2022.mp3 | 2022-07-14 08:49 | 113M | |
![[SND]](/icons/sound2.gif) | the-rise-of-the-xylophone-army-part-1_EWnzk1g5.mp3 | 2022-07-28 18:35 | 0 | |
![[SND]](/icons/sound2.gif) | the-ride-of-the-rohirrim.mp3 | 2022-07-24 19:15 | 0 | |
![[SND]](/icons/sound2.gif) | the-prince-karma-later-bitches.mp3 | 2022-08-08 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | the-neighbourhood-sweater-weatherrr.ar.mp3 | 2022-08-06 15:52 | 0 | |
![[SND]](/icons/sound2.gif) | the-limba-rakhim-hentaj-mp3.mp3 | 2022-07-08 08:21 | 7.7M | |
![[SND]](/icons/sound2.gif) | the-kid-laroi-feat.-justin-bieber-stay.mp3 | 2022-08-08 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | the-fifth-element-music-video-1997-youtubemp3free.org.mp3 | 2022-07-26 20:27 | 0 | |
![[SND]](/icons/sound2.gif) | the-chainsmokers-feat.-emily-warren-side-effects.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | the-chainsmokers-feat.-daya-dont-let-me-down.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | the-chainsmokers-coldplay-something-just-like-this.mp3 | 2022-08-08 11:10 | 0 | |
![[SND]](/icons/sound2.gif) | thd.mp3 | 2022-08-05 14:25 | 0 | |
![[SND]](/icons/sound2.gif) | thaygiaoba.mp3 | 2022-07-10 11:58 | 2.8M | |
![[SND]](/icons/sound2.gif) | thaychua110.mp3 | 2022-07-28 06:06 | 0 | |
![[SND]](/icons/sound2.gif) | thatway.mp3 | 2022-07-14 02:56 | 3.4M | |
![[SND]](/icons/sound2.gif) | thatsabwomp.mp3 | 2022-08-03 19:59 | 0 | |
![[SND]](/icons/sound2.gif) | thatha.mp3 | 2022-07-19 05:41 | 0 | |
![[SND]](/icons/sound2.gif) | thari.mp3 | 2022-07-12 17:58 | 2.3M | |
![[SND]](/icons/sound2.gif) | thanna.mp3 | 2022-06-30 18:16 | 5.3M | |
![[SND]](/icons/sound2.gif) | thankyou.mp3 | 2022-07-07 12:01 | 2.5M | |
![[SND]](/icons/sound2.gif) | thanhxuan.mp3 | 2022-08-08 01:13 | 3.4M | |
![[SND]](/icons/sound2.gif) | thanhti9.mp3 | 2022-07-16 12:13 | 0 | |
![[SND]](/icons/sound2.gif) | thanhti.mp3 | 2022-07-16 12:12 | 0 | |
![[SND]](/icons/sound2.gif) | thanhthuson.mp3 | 2022-07-16 12:17 | 0 | |
![[SND]](/icons/sound2.gif) | thanhak.mp3 | 2022-08-12 13:58 | 0 | |
![[SND]](/icons/sound2.gif) | thang dien slowed.mp3 | 2022-07-02 05:48 | 5.0M | |
![[SND]](/icons/sound2.gif) | thangcam.mp3 | 2022-08-10 01:33 | 0 | |
![[SND]](/icons/sound2.gif) | thangbecamquyen2.mp3 | 2022-08-04 11:03 | 0 | |
![[SND]](/icons/sound2.gif) | thallumala.mp3 | 2022-08-08 06:03 | 0 | |
![[SND]](/icons/sound2.gif) | thalika.mp3 | 2022-07-01 19:22 | 3.5M | |
![[SND]](/icons/sound2.gif) | thailandstyle.mp3 | 2022-07-06 18:42 | 58M | |
![[SND]](/icons/sound2.gif) | thailand.mp3 | 2022-07-15 10:28 | 4.2M | |
![[SND]](/icons/sound2.gif) | thai8.mp3 | 2022-07-23 04:19 | 0 | |
![[SND]](/icons/sound2.gif) | thai.mp3 | 2022-07-14 20:05 | 3.9M | |
![[SND]](/icons/sound2.gif) | tha2.mp3 | 2022-07-08 07:19 | 17M | |
![[SND]](/icons/sound2.gif) | tha1.mp3 | 2022-07-08 07:14 | 3.0M | |
![[SND]](/icons/sound2.gif) | th2.mp3 | 2022-07-25 11:30 | 0 | |
![[SND]](/icons/sound2.gif) | th1.mp3 | 2022-07-25 11:44 | 3.0M | |
![[SND]](/icons/sound2.gif) | th.mp3 | 2022-07-25 10:58 | 3.7M | |
![[SND]](/icons/sound2.gif) | tgag.mp3 | 2022-07-02 09:33 | 4.0M | |
![[SND]](/icons/sound2.gif) | tga.mp3 | 2022-07-27 17:47 | 0 | |
![[SND]](/icons/sound2.gif) | tg3.mp3 | 2022-08-05 07:13 | 1.0M | |
![[SND]](/icons/sound2.gif) | tg1.mp3 | 2022-08-02 06:14 | 0 | |
![[SND]](/icons/sound2.gif) | tg.mp3 | 2022-07-17 15:13 | 2.4M | |
![[SND]](/icons/sound2.gif) | tf.mp3 | 2022-06-27 16:01 | 5.7M | |
![[SND]](/icons/sound2.gif) | text to speech 2 hrs christian.mp3 | 2022-07-08 22:32 | 137M | |
![[SND]](/icons/sound2.gif) | text 2 speech.mp3 | 2022-07-12 19:39 | 137M | |
![[SND]](/icons/sound2.gif) | texas.mp3 | 2022-07-02 03:54 | 7.7M | |
![[SND]](/icons/sound2.gif) | tetris - Touch Her Ass.mp3 | 2022-07-13 18:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | tetete.mp3 | 2022-07-23 23:48 | 0 | |
![[SND]](/icons/sound2.gif) | tetegati.mp3 | 2022-07-26 15:59 | 0 | |
![[SND]](/icons/sound2.gif) | teteg ati (slowed).mp3 | 2022-08-05 06:07 | 0 | |
![[SND]](/icons/sound2.gif) | teteg.mp3 | 2022-08-04 17:23 | 0 | |
![[SND]](/icons/sound2.gif) | tet.mp3 | 2022-06-30 11:55 | 4.0M | |
![[SND]](/icons/sound2.gif) | testyfg.mp3 | 2022-07-09 10:44 | 884K | |
![[SND]](/icons/sound2.gif) | testxy4.mp3 | 2022-07-02 10:15 | 5.9M | |
![[SND]](/icons/sound2.gif) | testla.mp3 | 2022-07-21 19:39 | 0 | |
![[SND]](/icons/sound2.gif) | testj.mp3 | 2022-07-16 08:16 | 5.3M | |
![[SND]](/icons/sound2.gif) | teste.mp3 | 2022-08-09 22:12 | 44K | |
![[SND]](/icons/sound2.gif) | test_audio.m4a | 2022-07-03 21:14 | 104K | |
![[SND]](/icons/sound2.gif) | test999.mp3 | 2022-07-22 10:55 | 0 | |
![[SND]](/icons/sound2.gif) | test23.mp3 | 2022-08-02 20:24 | 0 | |
![[SND]](/icons/sound2.gif) | test1.mp3 | 2022-08-09 13:54 | 4.2M | |
![[SND]](/icons/sound2.gif) | tes1.mp3 | 2022-07-03 10:42 | 4.2M | |
![[SND]](/icons/sound2.gif) | tes.mp3 | 2022-07-10 17:38 | 3.6M | |
![[SND]](/icons/sound2.gif) | terro.mp3 | 2022-06-28 18:49 | 3.6M | |
![[SND]](/icons/sound2.gif) | terraria.mp3 | 2022-07-20 14:56 | 2.3M | |
![[SND]](/icons/sound2.gif) | terra.mp3 | 2022-07-07 16:19 | 1.5M | |
![[SND]](/icons/sound2.gif) | terpikat.mp3 | 2022-07-01 05:18 | 2.7M | |
![[SND]](/icons/sound2.gif) | terpesona2.mp3 | 2022-07-19 18:47 | 0 | |
![[SND]](/icons/sound2.gif) | terpesona1.mp3 | 2022-07-19 18:37 | 2.1M | |
![[SND]](/icons/sound2.gif) | terompet.mp3 | 2022-07-30 03:21 | 0 | |
![[SND]](/icons/sound2.gif) | terluka.mp3 | 2022-07-30 09:04 | 4.3M | |
![[SND]](/icons/sound2.gif) | terlanjur cinta.mp3 | 2022-07-02 09:08 | 343K | |
![[SND]](/icons/sound2.gif) | terindah.mp3 | 2022-07-15 10:59 | 3.9M | |
![[SND]](/icons/sound2.gif) | teriak.mp3 | 2022-08-09 05:49 | 3.3M | |
![[SND]](/icons/sound2.gif) | teri.mp3 | 2022-07-17 18:01 | 0 | |
![[SND]](/icons/sound2.gif) | teri-baat-yash-singh.mp3 | 2022-07-18 19:03 | 0 | |
![[SND]](/icons/sound2.gif) | tere siva jag mein music.mp3 | 2022-07-07 11:36 | 165K | |
![[SND]](/icons/sound2.gif) | terek.mp3 | 2022-07-19 06:16 | 2.3M | |
![[SND]](/icons/sound2.gif) | terbilabila.mp3 | 2022-08-07 03:39 | 0 | |
![[SND]](/icons/sound2.gif) | terbangbersamaku.mp3 | 2022-07-10 14:22 | 4.7M | |
![[SND]](/icons/sound2.gif) | terbangber.mp3 | 2022-07-10 15:02 | 3.7M | |
![[SND]](/icons/sound2.gif) | terangkanlah.mp3 | 2022-07-02 16:57 | 3.0M | |
![[SND]](/icons/sound2.gif) | teqila.mp3.mp3 | 2022-07-26 15:34 | 0 | |
![[SND]](/icons/sound2.gif) | tepuk.mp3 | 2022-07-04 08:32 | 124K | |
![[SND]](/icons/sound2.gif) | tepok3.mp3 | 2022-07-07 02:49 | 3.2M | |
![[SND]](/icons/sound2.gif) | tepok2.mp3 | 2022-07-07 02:44 | 3.3M | |
![[SND]](/icons/sound2.gif) | tepok1.mp3 | 2022-07-05 09:29 | 3.4M | |
![[SND]](/icons/sound2.gif) | tepok.mp3 | 2022-07-31 14:08 | 6.8M | |
![[SND]](/icons/sound2.gif) | teoem.mp3 | 2022-07-22 03:09 | 1.5M | |
![[SND]](/icons/sound2.gif) | teo.mp3 | 2022-07-02 04:02 | 3.4M | |
![[SND]](/icons/sound2.gif) | tentram.mp3 | 2022-08-04 00:27 | 0 | |
![[SND]](/icons/sound2.gif) | tentacion5.mp3 | 2022-07-14 11:06 | 1.2M | |
![[SND]](/icons/sound2.gif) | tenong.mp3 | 2022-07-06 07:56 | 13K | |
![[SND]](/icons/sound2.gif) | tenong-[AudioTrimmer.com].mp3 | 2022-07-11 08:30 | 12K | |
![[SND]](/icons/sound2.gif) | tenebris - минус уши.mp3 | 2022-07-10 12:51 | 1.9M | |
![[SND]](/icons/sound2.gif) | tendabiru.mp3 | 2022-06-27 12:38 | 5.2M | |
![[SND]](/icons/sound2.gif) | ten10.mp3 | 2022-07-28 07:31 | 1.0M | |
![[SND]](/icons/sound2.gif) | ten.mp3 | 2022-07-15 08:47 | 4.2M | |
![[SND]](/icons/sound2.gif) | tempik11.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik10.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik9.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik8.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik7.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik5.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik4.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik3.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik2.mp3 | 2022-07-21 18:24 | 0 | |
![[SND]](/icons/sound2.gif) | tempik1.mp3 | 2022-07-21 18:42 | 0 | |
![[SND]](/icons/sound2.gif) | tempgoood232.mp3 | 2022-08-03 11:48 | 0 | |
![[SND]](/icons/sound2.gif) | temperatura robot.mp3 | 2022-08-03 11:40 | 0 | |
![[SND]](/icons/sound2.gif) | temperatura-robot.mp3 | 2022-08-03 11:40 | 0 | |
![[SND]](/icons/sound2.gif) | temp-goood.mp3 | 2022-08-03 11:46 | 0 | |
![[SND]](/icons/sound2.gif) | temonslebew.mp3 | 2022-07-20 07:26 | 0 | |
![[SND]](/icons/sound2.gif) | te molla - arnon feat killua (lirik dan terjemahan).mp3 | 2022-07-02 13:49 | 3.1M | |
![[SND]](/icons/sound2.gif) | teman.mp3 | 2022-08-07 21:22 | 2.9M | |
![[SND]](/icons/sound2.gif) | temKTOsNAMI.mp3 | 2022-07-12 15:49 | 8.7M | |
![[SND]](/icons/sound2.gif) | tellme0.mp3 | 2022-07-05 15:30 | 1.9M | |
![[SND]](/icons/sound2.gif) | tellem.mp3 | 2022-08-01 07:00 | 2.9M | |
![[SND]](/icons/sound2.gif) | tellaso.mp3 | 2022-07-01 14:21 | 963K | |
![[SND]](/icons/sound2.gif) | tell1.mp3 | 2022-07-05 13:51 | 2.7M | |
![[SND]](/icons/sound2.gif) | telehape.mp3 | 2022-07-25 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | telaso9.mp3 | 2022-07-26 08:33 | 3.5M | |
![[SND]](/icons/sound2.gif) | telape.mp3 | 2022-06-27 19:00 | 8.8M | |
![[SND]](/icons/sound2.gif) | telahepa.mp3 | 2022-07-08 15:59 | 8.4M | |
![[SND]](/icons/sound2.gif) | telahape8.mp3 | 2022-07-12 02:51 | 4.1M | |
![[SND]](/icons/sound2.gif) | telahape.mp3 | 2022-07-14 09:08 | 2.2M | |
![[SND]](/icons/sound2.gif) | tekit.mp3 | 2022-08-11 13:42 | 2.5M | |
![[SND]](/icons/sound2.gif) | teki.mp3 | 2022-08-01 08:58 | 0 | |
![[SND]](/icons/sound2.gif) | teka.mp3 | 2022-07-05 06:58 | 3.0M | |
![[SND]](/icons/sound2.gif) | tehkantong.mp3 | 2022-07-31 01:01 | 0 | |
![[SND]](/icons/sound2.gif) | tehchifyhkahwa.mp3 | 2022-07-23 16:44 | 0 | |
![[SND]](/icons/sound2.gif) | teh.mp3 | 2022-07-29 13:04 | 0 | |
![[SND]](/icons/sound2.gif) | tegarganz.mp3 | 2022-08-08 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | tegarez.mp3 | 2022-07-29 10:48 | 0 | |
![[SND]](/icons/sound2.gif) | tegar2.mp3 | 2022-07-29 10:43 | 0 | |
![[SND]](/icons/sound2.gif) | tegar1.mp3 | 2022-07-05 20:13 | 23M | |
![[SND]](/icons/sound2.gif) | tegar.mp3 | 2022-08-09 12:52 | 3.6M | |
![[SND]](/icons/sound2.gif) | teepanma.mp3 | 2022-07-01 18:42 | 4.1M | |
![[SND]](/icons/sound2.gif) | ted коченый - стань гитлером.mp3 | 2022-07-07 20:44 | 465K | |
![[SND]](/icons/sound2.gif) | tecno.mp3 | 2022-07-15 11:14 | 11M | |
![[SND]](/icons/sound2.gif) | technicalpiano.mp3 | 2022-07-05 10:30 | 19M | |
![[SND]](/icons/sound2.gif) | tecca.mp3 | 2022-07-10 05:23 | 5.6M | |
![[SND]](/icons/sound2.gif) | teatrigoparis.mp3 | 2022-07-18 13:25 | 0 | |
![[SND]](/icons/sound2.gif) | teasad.mp3 | 2022-08-04 02:53 | 0 | |
![[SND]](/icons/sound2.gif) | teamnexallog.mp3 | 2022-07-23 08:12 | 0 | |
![[SND]](/icons/sound2.gif) | tea.mp3 | 2022-07-19 22:06 | 2.7M | |
![[SND]](/icons/sound2.gif) | tduh.mp3 | 2022-06-28 11:06 | 4.6M | |
![[SND]](/icons/sound2.gif) | tdosikooi1 - shootout (slowed).mp3 | 2022-07-29 08:40 | 3.4M | |
![[SND]](/icons/sound2.gif) | tdguna.mp3 | 2022-07-23 16:58 | 0 | |
![[SND]](/icons/sound2.gif) | tdg.mp3 | 2022-07-20 19:31 | 0 | |
![[SND]](/icons/sound2.gif) | tcuy11.mp3 | 2022-06-30 02:36 | 5.0M | |
![[SND]](/icons/sound2.gif) | tcuy10.mp3 | 2022-06-28 12:19 | 4.2M | |
![[SND]](/icons/sound2.gif) | tcuy9.mp3 | 2022-06-28 12:19 | 3.9M | |
![[SND]](/icons/sound2.gif) | tcuy8.mp3 | 2022-06-28 12:18 | 1.1M | |
![[SND]](/icons/sound2.gif) | tcuy7.mp3 | 2022-06-28 12:06 | 7.0M | |
![[SND]](/icons/sound2.gif) | tcuy6.mp3 | 2022-06-28 12:05 | 2.6M | |
![[SND]](/icons/sound2.gif) | tcuy5.mp3 | 2022-06-28 12:04 | 2.1M | |
![[SND]](/icons/sound2.gif) | tcuy4.mp3 | 2022-06-28 12:09 | 137M | |
![[SND]](/icons/sound2.gif) | tcuy3.mp3 | 2022-06-28 12:04 | 1.8M | |
![[SND]](/icons/sound2.gif) | tcuy2.mp3 | 2022-06-28 12:04 | 4.7M | |
![[SND]](/icons/sound2.gif) | tcuy1.mp3 | 2022-06-28 12:04 | 8.9M | |
![[SND]](/icons/sound2.gif) | tchaikovsk.mp3 | 2022-08-06 16:23 | 0 | |
![[VID]](/icons/movie.gif) | tcha.mp4 | 2022-07-03 10:56 | 8.5M | |
![[SND]](/icons/sound2.gif) | tcd.mp3 | 2022-07-09 16:07 | 2.7M | |
![[SND]](/icons/sound2.gif) | tbt.mp3 | 2022-07-22 15:49 | 0 | |
![[SND]](/icons/sound2.gif) | tblexer.mp3 | 2022-07-19 08:38 | 0 | |
![[SND]](/icons/sound2.gif) | tban.mp3 | 2022-07-29 18:01 | 0 | |
![[SND]](/icons/sound2.gif) | tazex1.mp3 | 2022-07-18 21:01 | 0 | |
![[SND]](/icons/sound2.gif) | tayto.mp3 | 2022-07-30 14:34 | 324K | |
![[SND]](/icons/sound2.gif) | tayo.mp3 | 2022-08-06 20:11 | 0 | |
![[SND]](/icons/sound2.gif) | taykylove.mp3 | 2022-07-06 23:16 | 2.8M | |
![[SND]](/icons/sound2.gif) | tayk.mp3 | 2022-07-24 23:08 | 0 | |
![[SND]](/icons/sound2.gif) | tayc.mp3 | 2022-07-06 19:38 | 9.2M | |
![[SND]](/icons/sound2.gif) | tayb.mp3 | 2022-07-31 04:16 | 0 | |
![[SND]](/icons/sound2.gif) | taya.mp3 | 2022-07-30 00:54 | 0 | |
![[SND]](/icons/sound2.gif) | tay_ky_love_sinike_x_jokes_bii_duzme_remix_audio_lyrics_-5176770384724885543.mp3 | 2022-07-02 07:31 | 2.8M | |
![[SND]](/icons/sound2.gif) | tay.mp3 | 2022-07-28 06:25 | 576K | |
![[SND]](/icons/sound2.gif) | taxi edm.mp3 | 2022-07-03 07:46 | 156M | |
![[SND]](/icons/sound2.gif) | tawag.mp3 | 2022-07-31 13:10 | 0 | |
![[SND]](/icons/sound2.gif) | tavern-music.mp3 | 2022-07-04 11:06 | 166M | |
![[SND]](/icons/sound2.gif) | tatu.mp3 | 2022-07-14 02:01 | 6.3M | |
![[SND]](/icons/sound2.gif) | tatu — Нас не догонят (AXIUS LINK REMIX) (www.lightaudio.ru).mp3 | 2022-07-18 14:43 | 11M | |
![[SND]](/icons/sound2.gif) | tatthu.mp3 | 2022-07-12 01:55 | 38M | |
![[SND]](/icons/sound2.gif) | tatsulok.mp3 | 2022-08-03 16:19 | 0 | |
![[SND]](/icons/sound2.gif) | tatsu.mp3 | 2022-08-03 15:19 | 588K | |
![[SND]](/icons/sound2.gif) | tats.mp3 | 2022-07-19 15:25 | 6.8M | |
![[SND]](/icons/sound2.gif) | tato.mp3 | 2022-07-09 17:53 | 237K | |
![[SND]](/icons/sound2.gif) | tatas.mp3 | 2022-06-27 19:06 | 7.5M | |
![[SND]](/icons/sound2.gif) | tatarka.mp3 | 2022-07-24 16:14 | 0 | |
![[SND]](/icons/sound2.gif) | tatanginamo.mp3 | 2022-07-18 02:07 | 0 | |
![[SND]](/icons/sound2.gif) | tatang3.mp3 | 2022-08-02 16:04 | 3.2M | |
![[SND]](/icons/sound2.gif) | tatang2.mp3 | 2022-07-10 12:48 | 2.4M | |
![[SND]](/icons/sound2.gif) | tatang.mp3 | 2022-07-10 12:38 | 4.7M | |
![[SND]](/icons/sound2.gif) | tata.mp3 | 2022-07-14 12:47 | 2.0M | |
![[SND]](/icons/sound2.gif) | taste1.mp3 | 2022-07-03 14:04 | 3.6M | |
![[SND]](/icons/sound2.gif) | tast.mp3 | 2022-07-16 04:46 | 3.6M | |
![[SND]](/icons/sound2.gif) | tasade (2).mp3 | 2022-07-19 20:50 | 0 | |
![[SND]](/icons/sound2.gif) | tarpaima.mp3 | 2022-08-07 08:36 | 0 | |
![[SND]](/icons/sound2.gif) | tarkuy.mp3 | 2022-06-27 14:01 | 2.9M | |
![[SND]](/icons/sound2.gif) | tariton.mp3 | 2022-07-17 10:08 | 0 | |
![[SND]](/icons/sound2.gif) | tarik1.mp3 | 2022-08-12 01:52 | 3.3M | |
![[SND]](/icons/sound2.gif) | taras-obnazhennyjj-kajjf.mp3 | 2022-07-03 01:33 | 9.7M | |
![[SND]](/icons/sound2.gif) | tara202-magistrali-(muzbom.ru).mp3 | 2022-07-12 02:00 | 8.2M | |
![[SND]](/icons/sound2.gif) | tapydi.mp3 | 2022-08-09 00:29 | 0 | |
![[SND]](/icons/sound2.gif) | tapiboong.mp3 | 2022-06-28 00:59 | 4.3M | |
![[SND]](/icons/sound2.gif) | taolaai.mp3 | 2022-07-18 10:55 | 2.4M | |
![[SND]](/icons/sound2.gif) | tantee.mp3 | 2022-07-19 06:48 | 3.6M | |
![[SND]](/icons/sound2.gif) | tanteculik.mp3 | 2022-07-22 09:19 | 3.6M | |
![[SND]](/icons/sound2.gif) | tante1.mp3 | 2022-06-27 18:41 | 6.1M | |
![[SND]](/icons/sound2.gif) | tante.mp3 | 2022-07-19 06:46 | 100K | |
![[SND]](/icons/sound2.gif) | tantae.mp3 | 2022-07-08 12:25 | 3.3M | |
![[SND]](/icons/sound2.gif) | tankis.mp3 | 2022-07-26 18:56 | 0 | |
![[SND]](/icons/sound2.gif) | tankilove.mp3 | 2022-07-26 03:58 | 1.4M | |
![[SND]](/icons/sound2.gif) | tanjki.mp3 | 2022-08-07 14:17 | 0 | |
![[SND]](/icons/sound2.gif) | tangkisdang.mp3 | 2022-08-03 12:52 | 0 | |
![[SND]](/icons/sound2.gif) | tangkis.mp3 | 2022-07-23 04:10 | 4.0M | |
![[SND]](/icons/sound2.gif) | tanga.mp3 | 2022-07-08 11:29 | 4.3M | |
![[SND]](/icons/sound2.gif) | tanan.mp3 | 2022-07-28 15:37 | 0 | |
![[VID]](/icons/movie.gif) | tan2.mp4 | 2022-08-12 15:46 | 0 | |
![[VID]](/icons/movie.gif) | tan.mp4 | 2022-08-12 06:47 | 408K | |
![[SND]](/icons/sound2.gif) | tan.mp3 | 2022-07-03 01:45 | 4.4M | |
![[SND]](/icons/sound2.gif) | tamtam.mp3 | 2022-07-14 03:00 | 2.8M | |
![[SND]](/icons/sound2.gif) | tamswat.mp3 | 2022-07-02 02:29 | 62M | |
![[SND]](/icons/sound2.gif) | tampro.mp3 | 2022-07-13 06:10 | 3.8M | |
![[SND]](/icons/sound2.gif) | tampes8.mp3 | 2022-07-28 01:15 | 0 | |
![[SND]](/icons/sound2.gif) | tampes7.mp3 | 2022-07-28 01:15 | 0 | |
![[SND]](/icons/sound2.gif) | tampes6.mp3 | 2022-07-28 01:14 | 0 | |
![[SND]](/icons/sound2.gif) | tampes5.mp3 | 2022-07-28 00:28 | 0 | |
![[SND]](/icons/sound2.gif) | tampes4.mp3 | 2022-07-28 00:27 | 0 | |
![[SND]](/icons/sound2.gif) | tampes3.mp3 | 2022-07-28 00:26 | 0 | |
![[SND]](/icons/sound2.gif) | tampes2.mp3 | 2022-07-28 00:26 | 0 | |
![[SND]](/icons/sound2.gif) | tampes1.mp3 | 2022-07-28 00:25 | 0 | |
![[SND]](/icons/sound2.gif) | tampar.mp3 | 2022-07-28 06:13 | 3.1M | |
![[SND]](/icons/sound2.gif) | tampan rumpawan.mp3 | 2022-07-20 04:51 | 0 | |
![[SND]](/icons/sound2.gif) | tampan.mp3 | 2022-07-03 10:56 | 3.1M | |
![[SND]](/icons/sound2.gif) | tamo ready.mp3 | 2022-06-27 15:17 | 2.9M | |
![[SND]](/icons/sound2.gif) | tami.mp3 | 2022-07-05 05:33 | 168M | |
![[SND]](/icons/sound2.gif) | tamhihi.mp3 | 2022-07-02 14:02 | 57M | |
![[SND]](/icons/sound2.gif) | tamdz.mp3 | 2022-07-05 12:36 | 45M | |
![[SND]](/icons/sound2.gif) | tamcaidu.mp3 | 2022-08-07 09:01 | 0 | |
![[SND]](/icons/sound2.gif) | tama.mp3 | 2022-07-06 17:31 | 4.8M | |
![[SND]](/icons/sound2.gif) | tam2000.mp3 | 2022-08-09 06:54 | 0 | |
![[SND]](/icons/sound2.gif) | tam123.mp3 | 2022-08-07 00:33 | 704K | |
![[SND]](/icons/sound2.gif) | tam11.mp3 | 2022-07-01 15:33 | 36M | |
![[SND]](/icons/sound2.gif) | tam07.mp3 | 2022-07-01 07:29 | 3.8M | |
![[SND]](/icons/sound2.gif) | tally-hall-turn-the-lights-off.mp3 | 2022-07-08 12:05 | 4.0M | |
![[SND]](/icons/sound2.gif) | talktomoon.mp3 | 2022-07-11 21:15 | 5.0M | |
![[SND]](/icons/sound2.gif) | talking.mp3 | 2022-07-07 10:28 | 4.5M | |
![[SND]](/icons/sound2.gif) | talke.mp3 | 2022-08-04 03:06 | 596K | |
![[SND]](/icons/sound2.gif) | talk.mp3 | 2022-07-14 11:18 | 2.6M | |
![[SND]](/icons/sound2.gif) | talang.mp3 | 2022-06-28 15:15 | 4.7M | |
![[SND]](/icons/sound2.gif) | tala1.mp3 | 2022-06-28 15:28 | 5.0M | |
![[SND]](/icons/sound2.gif) | tala.mp3 | 2022-07-23 23:54 | 4.7M | |
![[SND]](/icons/sound2.gif) | taky_cat_1659389519_musicaldown.com (mp3cut.net).mp3 | 2022-08-02 08:30 | 0 | |
![[SND]](/icons/sound2.gif) | takusai1.mp3 | 2022-07-03 12:49 | 4.2M | |
![[SND]](/icons/sound2.gif) | takusai.mp3 | 2022-07-25 07:29 | 3.5M | |
![[SND]](/icons/sound2.gif) | taktau.mp3 | 2022-08-09 06:26 | 1.2M | |
![[SND]](/icons/sound2.gif) | tak tahu bagaimana.mp3 | 2022-07-07 08:43 | 738K | |
![[SND]](/icons/sound2.gif) | takselalu.mp3 | 2022-07-05 22:54 | 2.3M | |
![[SND]](/icons/sound2.gif) | tak selalu.mp3 | 2022-07-05 22:01 | 2.3M | |
![[SND]](/icons/sound2.gif) | tak pernah menginkan kamu lebih...mp3 | 2022-07-18 12:39 | 0 | |
![[SND]](/icons/sound2.gif) | takkan.mp3 | 2022-07-10 11:40 | 3.5M | |
![[SND]](/icons/sound2.gif) | takiu.mp3 | 2022-07-29 14:21 | 0 | |
![[SND]](/icons/sound2.gif) | takitak.mp3 | 2022-07-28 10:31 | 0 | |
![[SND]](/icons/sound2.gif) | takitak (online-audio-converter.com).mp3 | 2022-07-28 10:46 | 0 | |
![[SND]](/icons/sound2.gif) | takinginusai.mp3 | 2022-08-05 16:45 | 4.2M | |
![[SND]](/icons/sound2.gif) | tak ingin usai.mp3 | 2022-07-11 07:02 | 4.2M | |
![[SND]](/icons/sound2.gif) | tak ingin pisah lagi speed up tiktok (marion jola rizky febian) lirik.mp3 | 2022-06-29 16:37 | 3.9M | |
![[SND]](/icons/sound2.gif) | tak ingin pisah lagi - marion jola.mp3 | 2022-07-02 11:40 | 2.7M | |
![[SND]](/icons/sound2.gif) | taki.mp3 | 2022-08-04 09:47 | 4.0M | |
![[SND]](/icons/sound2.gif) | takhilang.mp3 | 2022-07-02 11:40 | 2.7M | |
![[SND]](/icons/sound2.gif) | takemehome.mp3 | 2022-07-02 16:50 | 3.0M | |
![[SND]](/icons/sound2.gif) | takeitem.mp3 | 2022-07-23 04:49 | 0 | |
![[SND]](/icons/sound2.gif) | take away.mp3 | 2022-07-10 13:35 | 257K | |
![[SND]](/icons/sound2.gif) | take.mp3 | 2022-07-25 04:53 | 2.6M | |
![[SND]](/icons/sound2.gif) | take(MP3_70K).mp3 | 2022-07-22 14:33 | 0 | |
![[SND]](/icons/sound2.gif) | takcinta.mp3 | 2022-07-10 12:20 | 6.8M | |
![[SND]](/icons/sound2.gif) | takbiran910.mp3 | 2022-07-09 12:43 | 31M | |
![[SND]](/icons/sound2.gif) | takbiran1.mp3 | 2022-07-09 18:16 | 22M | |
![[SND]](/icons/sound2.gif) | takbiran0122.mp3 | 2022-07-10 04:01 | 86M | |
![[SND]](/icons/sound2.gif) | takbiran.mp3 | 2022-07-19 11:02 | 4.3M | |
![[SND]](/icons/sound2.gif) | takbir1.mp3 | 2022-07-09 11:18 | 35M | |
![[SND]](/icons/sound2.gif) | takanterganti.mp3 | 2022-07-04 12:32 | 1.3M | |
![[SND]](/icons/sound2.gif) | takanbisa.mp3 | 2022-08-06 10:11 | 0 | |
![[SND]](/icons/sound2.gif) | taja.mp3 | 2022-07-04 11:08 | 2.4M | |
![[SND]](/icons/sound2.gif) | taina.mp3 | 2022-07-16 11:06 | 0 | |
![[SND]](/icons/sound2.gif) | taii.mp3 | 2022-07-30 09:31 | 0 | |
![[SND]](/icons/sound2.gif) | taichi.mp3 | 2022-07-22 17:21 | 40K | |
![[SND]](/icons/sound2.gif) | taibeo.mp3 | 2022-07-27 14:09 | 0 | |
![[SND]](/icons/sound2.gif) | tai12.mp3 | 2022-06-28 01:27 | 4.1M | |
![[SND]](/icons/sound2.gif) | tai11.mp3 | 2022-06-28 01:26 | 4.3M | |
![[SND]](/icons/sound2.gif) | tai10.mp3 | 2022-06-28 01:25 | 1.5M | |
![[SND]](/icons/sound2.gif) | tai9.mp3 | 2022-06-28 01:25 | 8.5M | |
![[SND]](/icons/sound2.gif) | tai8.mp3 | 2022-06-28 01:24 | 2.8M | |
![[SND]](/icons/sound2.gif) | tai7.mp3 | 2022-06-28 01:24 | 6.4M | |
![[SND]](/icons/sound2.gif) | tai6.mp3 | 2022-06-28 01:24 | 2.8M | |
![[SND]](/icons/sound2.gif) | tai5.mp3 | 2022-06-28 01:23 | 5.6M | |
![[SND]](/icons/sound2.gif) | tai4.mp3 | 2022-06-28 01:23 | 4.6M | |
![[SND]](/icons/sound2.gif) | tai3.mp3 | 2022-06-28 01:21 | 6.7M | |
![[SND]](/icons/sound2.gif) | tai2.mp3 | 2022-06-28 01:20 | 4.6M | |
![[SND]](/icons/sound2.gif) | tai1.mp3 | 2022-06-28 01:20 | 2.2M | |
![[SND]](/icons/sound2.gif) | tai.mp3 | 2022-07-29 02:54 | 1.9M | |
![[SND]](/icons/sound2.gif) | tahu.mp3 | 2022-07-24 01:41 | 1.6M | |
![[SND]](/icons/sound2.gif) | taho.mp3 | 2022-07-23 13:25 | 0 | |
![[SND]](/icons/sound2.gif) | tahi.mp3 | 2022-07-23 22:44 | 0 | |
![[SND]](/icons/sound2.gif) | tahanan.mp3 | 2022-08-07 07:27 | 4.6M | |
![[SND]](/icons/sound2.gif) | tagne.mp3 | 2022-08-12 22:25 | 0 | |
![[SND]](/icons/sound2.gif) | tagmp3_Tell_your_friends_ft_Kanye_West_D_(getmp3.pro).mp3 | 2022-07-16 02:02 | 15M | |
![[SND]](/icons/sound2.gif) | tagayy.mp3 | 2022-06-28 11:43 | 3.2M | |
![[SND]](/icons/sound2.gif) | tagay.mp3 | 2022-07-27 13:13 | 232K | |
![[SND]](/icons/sound2.gif) | taemin advice.mp3 | 2022-07-21 06:59 | 0 | |
![[SND]](/icons/sound2.gif) | taekk.mp3 | 2022-07-23 15:54 | 0 | |
![[SND]](/icons/sound2.gif) | taek.mp3 | 2022-08-12 17:50 | 233K | |
![[SND]](/icons/sound2.gif) | tads4.mp3 | 2022-07-22 13:42 | 0 | |
![[SND]](/icons/sound2.gif) | tadjik.mp3 | 2022-07-07 16:25 | 3.2M | |
![[SND]](/icons/sound2.gif) | tadhana.mp3 | 2022-07-07 08:17 | 3.4M | |
![[SND]](/icons/sound2.gif) | taco.mp3 | 2022-07-21 10:01 | 3.3M | |
![[SND]](/icons/sound2.gif) | tachkichetyre.mp3 | 2022-07-13 10:05 | 5.5M | |
![[SND]](/icons/sound2.gif) | tachki chetyre.mp3 | 2022-07-13 10:05 | 5.5M | |
![[SND]](/icons/sound2.gif) | tabloooo.mp3 | 2022-07-06 23:37 | 5.0M | |
![[SND]](/icons/sound2.gif) | tabla3.mp3 | 2022-07-17 20:17 | 0 | |
![[SND]](/icons/sound2.gif) | tabla2.mp3 | 2022-07-17 20:16 | 0 | |
![[SND]](/icons/sound2.gif) | tabla1.mp3 | 2022-07-17 20:21 | 0 | |
![[SND]](/icons/sound2.gif) | tabla.mp3 | 2022-08-04 19:08 | 0 | |
![[SND]](/icons/sound2.gif) | taDU4YOPVl-2-leon7104_1583.mp3 | 2022-07-16 14:57 | 0 | |
![[SND]](/icons/sound2.gif) | ta.mp3 | 2022-07-08 23:48 | 9.6M | |
![[SND]](/icons/sound2.gif) | tRICKSter2.mp3 | 2022-08-02 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | tPGMl1.mp3 | 2022-07-05 13:30 | 3.2M | |
![[SND]](/icons/sound2.gif) | tAtU_-_Nas_Ne_Dogonyat_remix_kick_71902578.mp3 | 2022-07-23 15:49 | 0 | |
![[SND]](/icons/sound2.gif) | tATu_-_All_The_Things_She_Said_47837674.mp3 | 2022-06-30 09:32 | 8.2M | |
![[SND]](/icons/sound2.gif) | t.mp3 | 2022-07-26 10:14 | 2.4M | |
![[SND]](/icons/sound2.gif) | t.a.t.u. - нас не догонят (dj spizdil remix).mp3 | 2022-07-05 10:25 | 7.4M | |
![[SND]](/icons/sound2.gif) | t.A.T.u. - All The Things She Said (Lyrics) have i crossed the line tiktok remix.mp3 | 2022-06-30 18:13 | 3.1M | |
![[VID]](/icons/movie.gif) | tải xuống.mp4 | 2022-07-16 01:10 | 2.0M | |
![[SND]](/icons/sound2.gif) | szum.mp3 | 2022-08-10 21:30 | 0 | |
![[SND]](/icons/sound2.gif) | szerverbetolto.mp3 | 2022-07-13 23:12 | 3.8M | |
![[SND]](/icons/sound2.gif) | szülinapi köszöntő~zeneINSEC - Copy.mp3 | 2022-07-10 15:53 | 5.9M | |
![[SND]](/icons/sound2.gif) | syr.mp3 | 2022-07-01 11:26 | 3.5M | |
![[SND]](/icons/sound2.gif) | synthesize.mp3 | 2022-07-04 19:08 | 192K | |
![[SND]](/icons/sound2.gif) | syng.mp3 | 2022-06-30 10:48 | 3.3M | |
![[SND]](/icons/sound2.gif) | syml-wheres-my-love-turkce-ceviri.mp3 | 2022-07-01 21:43 | 7.0M | |
![[SND]](/icons/sound2.gif) | sykm.mp3 | 2022-07-14 06:05 | 5.0M | |
![[SND]](/icons/sound2.gif) | syg.mp3 | 2022-06-30 15:03 | 5.2M | |
![[SND]](/icons/sound2.gif) | sya.mp3 | 2022-07-13 10:47 | 3.6M | |
![[SND]](/icons/sound2.gif) | sxrvgh - симфония доты.mp3 | 2022-07-08 06:59 | 928K | |
![[SND]](/icons/sound2.gif) | sxndxdxx.mp3 | 2022-07-15 11:13 | 4.4M | |
![[SND]](/icons/sound2.gif) | sws3.mp3 | 2022-07-06 00:17 | 7.9M | |
![[SND]](/icons/sound2.gif) | sws2.mp3 | 2022-07-06 00:17 | 8.7M | |
![[SND]](/icons/sound2.gif) | sws1.mp3 | 2022-07-06 00:17 | 9.8M | |
![[SND]](/icons/sound2.gif) | swm.mp3 | 2022-07-10 23:29 | 3.1M | |
![[SND]](/icons/sound2.gif) | switch.mp3 | 2022-07-19 15:50 | 0 | |
![[SND]](/icons/sound2.gif) | swey000.mp3 | 2022-07-18 18:45 | 0 | |
![[SND]](/icons/sound2.gif) | swesad.mp3 | 2022-07-09 14:37 | 518K | |
![[SND]](/icons/sound2.gif) | sweets.mp3 | 2022-06-28 04:37 | 1.2M | |
![[SND]](/icons/sound2.gif) | sweetest pie - sped up V2 (with the wink) (320K).mp3 | 2022-06-29 16:03 | 5.9M | |
![[SND]](/icons/sound2.gif) | sweetest pie - sped up (1).mp3 | 2022-07-12 10:30 | 2.8M | |
![[SND]](/icons/sound2.gif) | sweetchilfomine_144p.mp3 | 2022-07-26 16:15 | 0 | |
![[SND]](/icons/sound2.gif) | sweetchild.mp3 | 2022-08-08 15:21 | 3.5M | |
![[SND]](/icons/sound2.gif) | sweetbyme.mp3 | 2022-06-28 11:50 | 13M | |
![[SND]](/icons/sound2.gif) | sweet_groove.mp3 | 2022-08-11 11:33 | 0 | |
![[SND]](/icons/sound2.gif) | sweet_bekki - двадцать один ночной звонок.mp3 | 2022-07-04 20:11 | 3.9M | |
![[SND]](/icons/sound2.gif) | sweet.mp3 | 2022-08-03 15:24 | 1.7M | |
![[SND]](/icons/sound2.gif) | sweatherweather.mp3 | 2022-07-12 17:23 | 3.6M | |
![[SND]](/icons/sound2.gif) | sweater.mp3 | 2022-07-07 11:06 | 7.7M | |
![[SND]](/icons/sound2.gif) | swaysway.mp3 | 2022-07-18 18:44 | 0 | |
![[SND]](/icons/sound2.gif) | sway1.mp3 | 2022-07-01 17:59 | 2.9M | |
![[SND]](/icons/sound2.gif) | sway.mp3 | 2022-06-29 17:07 | 3.5M | |
![[SND]](/icons/sound2.gif) | swan.mp3 | 2022-07-09 01:25 | 373K | |
![[SND]](/icons/sound2.gif) | swaggin.mp3 | 2022-08-07 05:59 | 0 | |
![[SND]](/icons/sound2.gif) | swagger-katya-katyushka-ty-moya-shl-shka.mp3 | 2022-06-28 18:13 | 2.2M | |
![[SND]](/icons/sound2.gif) | sw8.mp3 | 2022-08-10 11:46 | 0 | |
![[SND]](/icons/sound2.gif) | sw7.mp3 | 2022-08-10 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | sw6.mp3 | 2022-08-10 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | sw5.mp3 | 2022-08-10 11:45 | 0 | |
![[SND]](/icons/sound2.gif) | sw4.mp3 | 2022-08-10 11:44 | 0 | |
![[SND]](/icons/sound2.gif) | sw3.mp3 | 2022-08-10 10:43 | 0 | |
![[SND]](/icons/sound2.gif) | sw2.mp3 | 2022-08-10 10:42 | 0 | |
![[SND]](/icons/sound2.gif) | svt.mp3 | 2022-08-12 17:29 | 0 | |
![[SND]](/icons/sound2.gif) | svoboda.mp3 | 2022-07-18 16:10 | 0 | |
![[SND]](/icons/sound2.gif) | sv18.mp3 | 2022-07-28 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | sv.mp3 | 2022-07-01 17:02 | 7.8M | |
![[SND]](/icons/sound2.gif) | suziks_-_poteryal_73734339.mp3 | 2022-08-01 06:23 | 0 | |
![[SND]](/icons/sound2.gif) | sutena.mp3 | 2022-07-28 08:28 | 824K | |
![[SND]](/icons/sound2.gif) | susyg.mp3 | 2022-07-25 05:35 | 0 | |
![[SND]](/icons/sound2.gif) | susu50.mp3 | 2022-06-30 12:04 | 4.6M | |
![[SND]](/icons/sound2.gif) | susu7.mp3 | 2022-06-30 12:07 | 1.8M | |
![[SND]](/icons/sound2.gif) | susu2.mp3 | 2022-06-30 05:04 | 36M | |
![[SND]](/icons/sound2.gif) | susu1.mp3 | 2022-06-30 04:48 | 1.5M | |
![[SND]](/icons/sound2.gif) | susu.mp3 | 2022-07-28 08:24 | 3.7M | |
![[VID]](/icons/movie.gif) | susos.mp4 | 2022-07-01 02:01 | 1.2M | |
![[SND]](/icons/sound2.gif) | susayang.mp3 | 2022-07-25 11:06 | 3.3M | |
![[SND]](/icons/sound2.gif) | sus2.mp3 | 2022-07-31 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | sus1.mp3 | 2022-07-31 11:23 | 0 | |
![[SND]](/icons/sound2.gif) | sus.mp3 | 2022-07-30 17:21 | 3.3M | |
![[SND]](/icons/sound2.gif) | suryaeek.mp3 | 2022-06-29 11:05 | 2.5M | |
![[SND]](/icons/sound2.gif) | surya1.mp3 | 2022-07-22 22:32 | 0 | |
![[SND]](/icons/sound2.gif) | surya.mp3 | 2022-07-05 07:52 | 4.5M | |
![[SND]](/icons/sound2.gif) | surupung.mp3 | 2022-07-20 07:15 | 3.2M | |
![[SND]](/icons/sound2.gif) | suru.mp3 | 2022-07-20 23:04 | 0 | |
![[SND]](/icons/sound2.gif) | suriya.mp3 | 2022-07-16 16:59 | 5.4M | |
![[SND]](/icons/sound2.gif) | surga.mp3 | 2022-07-24 20:46 | 0 | |
![[SND]](/icons/sound2.gif) | surf-curse-freaks-tik-tok-version.mp3 | 2022-08-02 00:17 | 0 | |
![[SND]](/icons/sound2.gif) | surat cinta untuk starla (slowed+reverb)tiktokversion (128 kbps).mp3 | 2022-07-03 08:41 | 4.9M | |
![[SND]](/icons/sound2.gif) | surah1.mp3 | 2022-07-19 18:12 | 0 | |
![[SND]](/icons/sound2.gif) | sura.mp3 | 2022-08-05 12:12 | 0 | |
![[SND]](/icons/sound2.gif) | supra5.mp3 | 2022-07-05 07:49 | 5.7M | |
![[SND]](/icons/sound2.gif) | supra4.mp3 | 2022-07-05 07:49 | 4.3M | |
![[SND]](/icons/sound2.gif) | supra3.mp3 | 2022-07-05 07:49 | 3.8M | |
![[SND]](/icons/sound2.gif) | supra2.mp3 | 2022-07-05 07:49 | 3.9M | |
![[SND]](/icons/sound2.gif) | supra1.mp3 | 2022-07-05 07:49 | 5.2M | |
![[SND]](/icons/sound2.gif) | supra.mp3 | 2022-07-22 23:55 | 0 | |
![[SND]](/icons/sound2.gif) | super pipo - Tuesday (Bass Boosted Slowed).mp3 | 2022-07-19 15:58 | 0 | |
![[SND]](/icons/sound2.gif) | superman3.mp3 | 2022-06-30 23:51 | 3.9M | |
![[SND]](/icons/sound2.gif) | superman2.mp3 | 2022-06-30 23:51 | 3.7M | |
![[SND]](/icons/sound2.gif) | superman1.mp3 | 2022-06-30 23:50 | 3.5M | |
![[SND]](/icons/sound2.gif) | superkomfort-витебск-таллин-kissvk.com.mp3 | 2022-07-18 11:48 | 0 | |
![[SND]](/icons/sound2.gif) | superidol.mp3 | 2022-07-30 15:58 | 0 | |
![[SND]](/icons/sound2.gif) | super idol.mp3 | 2022-07-05 07:05 | 4.3M | |
![[SND]](/icons/sound2.gif) | superhero.mp3 | 2022-06-28 05:18 | 12M | |
![[SND]](/icons/sound2.gif) | superbook.mp3 | 2022-07-19 12:04 | 4.3M | |
![[SND]](/icons/sound2.gif) | superbass.mp3 | 2022-08-06 06:06 | 0 | |
![[SND]](/icons/sound2.gif) | super.mp3 | 2022-07-07 10:57 | 53M | |
![[SND]](/icons/sound2.gif) | super-sus-pubertat(mp3name.co) (1).mp3 | 2022-07-03 22:19 | 5.8M | |
![[SND]](/icons/sound2.gif) | super-lezginka--lezginka-2016.mp3 | 2022-07-30 17:53 | 0 | |
![[SND]](/icons/sound2.gif) | super-instrumental-lezginka.mp3 | 2022-07-15 18:16 | 8.9M | |
![[SND]](/icons/sound2.gif) | sunshinelove.mp3 | 2022-06-29 05:02 | 8.9M | |
![[SND]](/icons/sound2.gif) | sunshine.mp3 | 2022-06-29 12:24 | 11M | |
![[SND]](/icons/sound2.gif) | sunsetswithu.mp3 | 2022-07-04 09:37 | 3.5M | |
![[SND]](/icons/sound2.gif) | sunset.mp3 | 2022-07-08 21:32 | 6.3M | |
![[SND]](/icons/sound2.gif) | sunroof123.mp3 | 2022-06-29 15:52 | 7.9M | |
![[SND]](/icons/sound2.gif) | sunroof.mp3 | 2022-08-12 09:50 | 2.7M | |
![[SND]](/icons/sound2.gif) | sunro.mp3 | 2022-08-08 06:56 | 0 | |
![[SND]](/icons/sound2.gif) | sunrise.mp3 | 2022-07-15 23:49 | 15M | |
![[SND]](/icons/sound2.gif) | sunrf.mp3 | 2022-08-13 01:12 | 0 | |
![[SND]](/icons/sound2.gif) | sunmoon.mp3 | 2022-07-24 17:43 | 2.4M | |
![[SND]](/icons/sound2.gif) | sunflower.mp3 | 2022-08-06 17:21 | 2.5M | |
![[SND]](/icons/sound2.gif) | sundaystres.mp3 | 2022-07-04 06:36 | 2.7M | |
![[SND]](/icons/sound2.gif) | sunday.mp3 | 2022-07-11 21:15 | 4.9M | |
![[SND]](/icons/sound2.gif) | sundala.mp3 | 2022-07-06 09:02 | 7.8M | |
![[SND]](/icons/sound2.gif) | sunda50.mp3 | 2022-07-13 15:10 | 451K | |
![[SND]](/icons/sound2.gif) | sunda.mp3 | 2022-07-17 07:51 | 4.2M | |
![[SND]](/icons/sound2.gif) | sun and moon.mp3 | 2022-07-12 06:00 | 2.3M | |
![[SND]](/icons/sound2.gif) | sunami1.mp3 | 2022-08-11 03:09 | 0 | |
![[SND]](/icons/sound2.gif) | sunami.mp3 | 2022-07-11 01:54 | 7.7M | |
![[SND]](/icons/sound2.gif) | sun.mp3 | 2022-07-16 13:54 | 396K | |
![[SND]](/icons/sound2.gif) | sun-araw-deep-cover.mp3 | 2022-07-05 18:57 | 19M | |
![[SND]](/icons/sound2.gif) | sumut.mp3 | 2022-07-29 05:34 | 0 | |
![[SND]](/icons/sound2.gif) | sumsel.mp3 | 2022-07-29 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | sumpas.mp3 | 2022-06-29 09:55 | 25M | |
![[SND]](/icons/sound2.gif) | sumpa.mp3 | 2022-07-03 15:06 | 2.2M | |
![[SND]](/icons/sound2.gif) | summer to winter.mp3 | 2022-07-24 01:49 | 0 | |
![[SND]](/icons/sound2.gif) | summer teeth drum ref mix2 (1).mp3 | 2022-07-14 01:58 | 5.6M | |
![[SND]](/icons/sound2.gif) | summer.mp3 | 2022-07-29 08:59 | 12M | |
![[SND]](/icons/sound2.gif) | sulton.mp3 | 2022-07-12 11:54 | 3.4M | |
![[SND]](/icons/sound2.gif) | sulthan 1.mp3 | 2022-08-10 07:56 | 0 | |
![[SND]](/icons/sound2.gif) | sulthan.mp3 | 2022-08-10 07:59 | 0 | |
![[SND]](/icons/sound2.gif) | sule.mp3 | 2022-07-10 17:20 | 1.0M | |
![[SND]](/icons/sound2.gif) | sulamakane.mp3 | 2022-06-28 16:31 | 5.3M | |
![[SND]](/icons/sound2.gif) | sukabody.mp3 | 2022-07-25 15:20 | 0 | |
![[SND]](/icons/sound2.gif) | sukaanjing.mp3 | 2022-07-21 07:22 | 0 | |
![[SND]](/icons/sound2.gif) | suiii.mp3 | 2022-06-28 05:53 | 2.6M | |
![[SND]](/icons/sound2.gif) | suiii.m4a | 2022-06-28 05:43 | 2.6M | |
![[SND]](/icons/sound2.gif) | suicide_squad_08 Eminem - Without Me.mp3 | 2022-07-16 23:44 | 0 | |
![[SND]](/icons/sound2.gif) | suicide_squad_08 Eminem - Without Me (1).mp3 | 2022-07-29 05:32 | 0 | |
![[SND]](/icons/sound2.gif) | sugdad.mp3 | 2022-06-27 17:19 | 7.9M | |
![[SND]](/icons/sound2.gif) | sugarfree1.mp3 | 2022-07-09 17:20 | 6.1M | |
![[SND]](/icons/sound2.gif) | sugardaddy.mp3 | 2022-08-03 08:58 | 0 | |
![[SND]](/icons/sound2.gif) | sugarcrashnc.mp3 | 2022-08-06 03:18 | 0 | |
![[SND]](/icons/sound2.gif) | sugarcrash.mp3 | 2022-08-06 03:17 | 0 | |
![[SND]](/icons/sound2.gif) | sugar.mp3 | 2022-08-04 17:23 | 364K | |
![[SND]](/icons/sound2.gif) | sufri5.mp3 | 2022-06-29 01:10 | 4.9M | |
![[SND]](/icons/sound2.gif) | suey.mp3 | 2022-07-10 11:10 | 3.2M | |
![[SND]](/icons/sound2.gif) | sueta💜 - sᴏʀʀʏ ʀᴇᴍɪx-1.mp3 | 2022-07-09 21:41 | 4.5M | |
![[SND]](/icons/sound2.gif) | sueta💜 - 𝖘𝖍𝖚𝖙𝖙𝖑𝖊..mp3 | 2022-07-14 02:45 | 1.3M | |
![[SND]](/icons/sound2.gif) | sueta💜 - ʀᴇʟᴀx 💦.mp3 | 2022-07-12 04:56 | 3.9M | |
![[SND]](/icons/sound2.gif) | sudno-sudno.mp3 | 2022-06-28 22:03 | 2.2M | |
![[SND]](/icons/sound2.gif) | sudah.mp3 | 2022-07-25 15:45 | 1.1M | |
![[SND]](/icons/sound2.gif) | suckurity.mp3 | 2022-07-11 04:46 | 2.8M | |
![[SND]](/icons/sound2.gif) | success.mp3 | 2022-07-25 02:49 | 0 | |
![[SND]](/icons/sound2.gif) | sucatpelat.mp3 | 2022-07-12 15:23 | 4.2M | |
![[SND]](/icons/sound2.gif) | subuh.mp3 | 2022-07-21 12:05 | 2.3M | |
![[SND]](/icons/sound2.gif) | subo-ko-titi-mo.mp3 | 2022-07-08 19:25 | 1.9M | |
![[SND]](/icons/sound2.gif) | submarine.mp3 | 2022-07-18 20:54 | 0 | |
![[SND]](/icons/sound2.gif) | subji.mp3 | 2022-07-12 08:48 | 3.5M | |
![[SND]](/icons/sound2.gif) | sub-urban-cradles-official-music-video-audiotrimmer.mp3 | 2022-07-20 15:27 | 0 | |
![[SND]](/icons/sound2.gif) | suave.mp3 | 2022-07-28 05:09 | 0 | |
![[SND]](/icons/sound2.gif) | suara pintu.mp3 | 2022-08-10 20:35 | 0 | |
![[SND]](/icons/sound2.gif) | suarakeren.mp3 | 2022-06-28 13:30 | 209K | |
![[SND]](/icons/sound2.gif) | suarajelek121.mp3 | 2022-06-28 14:48 | 4.2M | |
![[SND]](/icons/sound2.gif) | stwm.mp3 | 2022-07-16 03:06 | 2.2M | |
![[SND]](/icons/sound2.gif) | stussy.mp3 | 2022-07-08 13:44 | 6.0M | |
![[SND]](/icons/sound2.gif) | stumbleindolane.mp3 | 2022-07-11 15:36 | 2.3M | |
![[SND]](/icons/sound2.gif) | stul.mp3 | 2022-07-08 13:45 | 1.8M | |
![[SND]](/icons/sound2.gif) | stuff we did (married life) slowed down + reverb.mp3 | 2022-08-06 21:40 | 0 | |
![[SND]](/icons/sound2.gif) | studiodummyv3.mp3 | 2022-07-30 20:38 | 0 | |
![[SND]](/icons/sound2.gif) | stuckyou.mp3 | 2022-07-30 08:05 | 0 | |
![[SND]](/icons/sound2.gif) | strumble.mp3 | 2022-08-09 17:25 | 0 | |
![[SND]](/icons/sound2.gif) | strong1.mp3 | 2022-07-11 10:34 | 68M | |
![[SND]](/icons/sound2.gif) | strong.mp3 | 2022-08-10 11:59 | 2.4M | |
![[SND]](/icons/sound2.gif) | strom32.mp3 | 2022-08-07 00:55 | 0 | |
![[SND]](/icons/sound2.gif) | streets.mp3 | 2022-07-21 03:14 | 0 | |
![[SND]](/icons/sound2.gif) | stream.220721.2.mp3 | 2022-07-22 09:32 | 0 | |
![[SND]](/icons/sound2.gif) | strangerthings.mp3 | 2022-08-05 16:14 | 0 | |
![[SND]](/icons/sound2.gif) | straight.mp3 | 2022-07-13 12:49 | 3.7M | |
![[SND]](/icons/sound2.gif) | str8.mp3 | 2022-07-05 16:19 | 3.5M | |
![[SND]](/icons/sound2.gif) | stospacedock.mp3 | 2022-07-23 23:12 | 0 | |
![[SND]](/icons/sound2.gif) | story wa 30 detik _ hari ini selamat ulang tahun untuk diri sendiri.mp3 | 2022-07-28 05:44 | 540K | |
![[SND]](/icons/sound2.gif) | story_wa_mentahan_ccp_30_detik_lirik_lagu_(peluk_cium_peluk_cium_bolak_balik_peluk_cium)_🎶.mp3 | 2022-07-30 19:38 | 333K | |
![[SND]](/icons/sound2.gif) | story_wa_30_detik_||_status_whatsapp_terbaru_||_SEPERTI_KISAH(128k).m4a | 2022-07-14 15:20 | 665K | |
![[VID]](/icons/movie.gif) | story_wa_30_detik___hari_ini___selamat_ulang_tahun_untuk_diri_sendiri(144p).mp4 | 2022-07-24 03:56 | 0 | |
![[SND]](/icons/sound2.gif) | story.mp3 | 2022-08-04 17:22 | 4.1M | |
![[SND]](/icons/sound2.gif) | story-celtic-fantasy.mp3 | 2022-07-04 11:03 | 37M | |
![[SND]](/icons/sound2.gif) | story-WA-Evan-loss-full-senyum-sayang-Virall_79EN_P0NGzI.mp3 | 2022-07-21 02:27 | 0 | |
![[SND]](/icons/sound2.gif) | stoneisland.mp3 | 2022-07-05 13:14 | 9.5M | |
![[SND]](/icons/sound2.gif) | stolasmoan (1).m4a | 2022-07-27 02:21 | 14K | |
![[SND]](/icons/sound2.gif) | stl.mp3 | 2022-07-15 19:20 | 4.1M | |
![[SND]](/icons/sound2.gif) | stjernestov.mp3 | 2022-06-29 03:43 | 7.0M | |
![[SND]](/icons/sound2.gif) | stipen.mp3 | 2022-07-12 06:53 | 5.0M | |
![[SND]](/icons/sound2.gif) | sting-shape-of-my-heart-mp3.mp3 | 2022-07-09 12:04 | 11M | |
![[SND]](/icons/sound2.gif) | stilldre.mp3 | 2022-07-18 15:01 | 0 | |
![[SND]](/icons/sound2.gif) | still1.mp3 | 2022-06-27 15:39 | 13M | |
![[SND]](/icons/sound2.gif) | still.mp3 | 2022-08-04 05:40 | 3.7M | |
![[SND]](/icons/sound2.gif) | stig.mp3 | 2022-07-22 13:47 | 4.8M | |
![[SND]](/icons/sound2.gif) | steve.mp3 | 2022-07-22 15:04 | 4.8M | |
![[SND]](/icons/sound2.gif) | stevanus1.mp3 | 2022-07-12 03:28 | 6.3M | |
![[SND]](/icons/sound2.gif) | stereolove8d.mp3 | 2022-07-30 11:12 | 0 | |
![[SND]](/icons/sound2.gif) | stereolove.mp3 | 2022-06-29 05:02 | 7.6M | |
![[SND]](/icons/sound2.gif) | stereo22.mp3 | 2022-07-04 11:02 | 2.9M | |
![[SND]](/icons/sound2.gif) | stereo.mp3 | 2022-07-29 14:20 | 3.3M | |
![[SND]](/icons/sound2.gif) | stephen_sanchez_until_i_found_you_official_audio_4065832485040233884.mp3 | 2022-06-29 02:01 | 2.4M | |
![[SND]](/icons/sound2.gif) | step.mp3 | 2022-07-02 14:01 | 5.2M | |
![[SND]](/icons/sound2.gif) | steadylang.mp3 | 2022-07-04 09:04 | 5.5M | |
![[SND]](/icons/sound2.gif) | steady.mp3 | 2022-07-21 22:06 | 0 | |
![[SND]](/icons/sound2.gif) | std1.mp3 | 2022-07-25 06:14 | 0 | |
![[SND]](/icons/sound2.gif) | std.mp3 | 2022-08-01 18:08 | 0 | |
![[SND]](/icons/sound2.gif) | staywithme12japan.mp3 | 2022-07-01 03:49 | 1.9M | |
![[SND]](/icons/sound2.gif) | staywithme.mp3 | 2022-08-07 06:25 | 4.7M | |
![[SND]](/icons/sound2.gif) | staying alive.m4a | 2022-06-28 17:22 | 227K | |
![[SND]](/icons/sound2.gif) | stayH4lal.mp3 | 2022-07-09 16:02 | 1.2M | |
![[SND]](/icons/sound2.gif) | stay123.mp3 | 2022-08-07 06:31 | 0 | |
![[SND]](/icons/sound2.gif) | stay2k5.mp3 | 2022-07-31 03:29 | 0 | |
![[SND]](/icons/sound2.gif) | stay.mp3 | 2022-08-12 14:43 | 2.4M | |
![[SND]](/icons/sound2.gif) | statue.mp3 | 2022-06-27 16:25 | 9.7M | |
![[SND]](/icons/sound2.gif) | startmusic.mp3 | 2022-07-08 23:42 | 470K | |
![[SND]](/icons/sound2.gif) | start_sound.mp3 | 2022-07-12 05:52 | 25K | |
![[SND]](/icons/sound2.gif) | start.mp3 | 2022-07-30 09:31 | 76K | |
![[SND]](/icons/sound2.gif) | start-audio.mp3 | 2022-07-30 21:03 | 0 | |
![[SND]](/icons/sound2.gif) | starset_my_demons.mp3 | 2022-08-07 19:40 | 0 | |
![[SND]](/icons/sound2.gif) | stars.mp3 | 2022-08-08 10:30 | 0 | |
![[SND]](/icons/sound2.gif) | starlit.mp3 | 2022-08-05 13:32 | 124K | |
![[SND]](/icons/sound2.gif) | starguardian.mp3 | 2022-08-07 06:40 | 288K | |
![[SND]](/icons/sound2.gif) | star guardian.mp3 | 2022-08-07 02:56 | 0 | |
![[SND]](/icons/sound2.gif) | starboy.mp3 | 2022-08-08 09:20 | 0 | |
![[SND]](/icons/sound2.gif) | star.mp3 | 2022-07-31 09:37 | 0 | |
![[SND]](/icons/sound2.gif) | staplegun-bin-bonkers_456246340.mp3 | 2022-08-08 05:33 | 0 | |
![[SND]](/icons/sound2.gif) | staplegun - BONKERS.mp3 | 2022-07-30 18:14 | 8.1M | |
![[SND]](/icons/sound2.gif) | stann.mp3 | 2022-07-17 15:32 | 0 | |
![[SND]](/icons/sound2.gif) | stanley_clarke-boyz_n_the_hood_theme_mp3_65148.mp3 | 2022-07-02 00:17 | 4.2M | |
![[SND]](/icons/sound2.gif) | stan10.mp3 | 2022-07-12 10:27 | 2.8M | |
![[SND]](/icons/sound2.gif) | stan2.mp3 | 2022-07-16 12:20 | 0 | |
![[SND]](/icons/sound2.gif) | stan.mp3 | 2022-08-04 05:40 | 6.2M | |
![[SND]](/icons/sound2.gif) | stalingrad-massengrab.mp3 | 2022-07-07 20:05 | 5.6M | |
![[SND]](/icons/sound2.gif) | staff.mp3 | 2022-07-01 05:54 | 3.1M | |
![[SND]](/icons/sound2.gif) | stab it 130bpm.mp3 | 2022-07-14 17:39 | 4.3M | |
![[SND]](/icons/sound2.gif) | st12.mp3 | 2022-07-24 01:56 | 11M | |
![[SND]](/icons/sound2.gif) | st7.mp3 | 2022-08-11 16:05 | 0 | |
![[SND]](/icons/sound2.gif) | st2.mp3 | 2022-07-31 11:47 | 0 | |
![[SND]](/icons/sound2.gif) | st1.mp3 | 2022-07-24 15:39 | 0 | |
![[SND]](/icons/sound2.gif) | st1.m4a | 2022-07-24 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | ssstiktok_1652171110551 (1).mp3 | 2022-06-29 09:12 | 387K | |
![[VID]](/icons/movie.gif) | ssstiktok_1652021170914.mp4 | 2022-07-21 02:19 | 0 | |
![[SND]](/icons/sound2.gif) | ssstiktok_1651442213556.mp3 | 2022-07-11 10:24 | 1.0M | |
![[SND]](/icons/sound2.gif) | ssstik_1652526939748.mp3 | 2022-08-09 05:46 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik_1652446263734.mp3 | 2022-07-25 14:13 | 555K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1660346521753.mp3 | 2022-08-12 23:25 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1660161295319.mp3 | 2022-08-10 21:59 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1660161295319 (2).mp3 | 2022-08-10 22:00 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659960016912.mp3 | 2022-08-08 12:03 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659766236770.mp3 | 2022-08-06 06:23 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659717252609.mp3 | 2022-08-05 16:50 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659709205936.mp3 | 2022-08-05 14:23 | 380K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659706519639.mp3 | 2022-08-09 13:05 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659618380760.mp3 | 2022-08-06 08:09 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659519776094.mp3 | 2022-08-03 09:43 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659393318561.mp3 | 2022-08-01 22:57 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659393318561 (1).mp3 | 2022-08-01 22:51 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659387259037.mp3 | 2022-08-05 04:12 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659316233389.mp3 | 2022-08-01 01:11 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659313432437.mp3 | 2022-08-01 00:26 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659312390644.mp3 | 2022-08-01 00:15 | 1.5M | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659289328796.mp3 | 2022-07-31 17:46 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659284297996.mp3 | 2022-07-31 16:22 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659280909056.mp3 | 2022-07-31 15:22 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659262962274.mp3 | 2022-07-31 10:30 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659261715606.mp3 | 2022-07-31 10:16 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659257711545.mp3 | 2022-07-31 09:45 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659239809628.mp3 | 2022-07-31 04:02 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659185164401.mp3 | 2022-08-03 06:05 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659117781114.mp3 | 2022-07-29 18:04 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659088284289.mp3 | 2022-07-29 09:52 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659020463759.mp3 | 2022-07-28 15:06 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659004257287.mp3 | 2022-07-28 10:38 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1659003084056.mp3 | 2022-07-28 10:25 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658983269909.mp3 | 2022-07-28 05:28 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658884901445.mp3 | 2022-07-27 01:24 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658865728775.mp3 | 2022-07-26 20:04 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658864544567.mp3 | 2022-07-27 03:16 | 919K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658853903573.mp3 | 2022-07-26 16:49 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658848479124.mp3 | 2022-07-27 13:47 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658832336059.mp3 | 2022-07-26 10:54 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658758231384.mp3 | 2022-07-25 14:16 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658683009945.mp3 | 2022-07-24 17:45 | 456K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658666519588.mp3 | 2022-07-24 12:48 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658588457023.mp3 | 2022-07-29 14:51 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658583360279.mp3 | 2022-07-23 13:37 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658541732741.mp3 | 2022-07-23 02:21 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658501847124.mp3 | 2022-07-22 14:59 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658498812927.mp3 | 2022-07-22 15:46 | 464K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658488467507.mp3 | 2022-07-22 11:15 | 343K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658380242446.mp3 | 2022-07-21 05:12 | 418K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658235208597.mp3 | 2022-07-22 15:39 | 240K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658233447380.mp3 | 2022-07-19 12:27 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658169084633.mp3 | 2022-07-18 18:33 | 225K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658152332465.mp3 | 2022-07-18 15:00 | 469K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658151415775.mp3 | 2022-07-18 15:00 | 0 | |
![[VID]](/icons/movie.gif) | ssstik.io_1658138852973.mp4 | 2022-07-19 07:45 | 746K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658115749885.mp3 | 2022-07-19 16:07 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658083117811.mp3 | 2022-07-18 03:31 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658077719267.mp3 | 2022-07-17 17:10 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1658050150878.mp3 | 2022-07-17 09:31 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657769550235.mp3 | 2022-07-14 03:42 | 525K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657761608364.mp3 | 2022-07-15 21:12 | 517K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657693389602.mp3 | 2022-07-13 06:24 | 939K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657689662974.mp3 | 2022-07-13 05:21 | 233K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657679311631.mp3 | 2022-07-13 02:51 | 903K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657557971175.mp3 | 2022-07-12 04:33 | 1.5M | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657503243396.mp3 | 2022-07-11 01:43 | 336K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657485146847.mp3 | 2022-07-10 20:33 | 737K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657453555611.mp3 | 2022-07-10 12:09 | 476K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657432160661.mp3 | 2022-08-09 18:51 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657384958063.mp3 | 2022-07-09 16:43 | 468K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657360249782.mp3 | 2022-07-09 09:53 | 483K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657289781628.mp3 | 2022-07-08 14:21 | 154K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657207196226.mp3 | 2022-07-07 15:21 | 212K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657206769913.mp3 | 2022-07-07 15:14 | 593K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657204726124.mp3 | 2022-07-07 14:44 | 303K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657182434421.mp3 | 2022-07-07 08:31 | 938K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657178768156.mp3 | 2022-07-07 07:29 | 476K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657163783172.mp3 | 2022-07-07 03:19 | 512K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1657046129348.mp3 | 2022-07-05 18:43 | 759K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656914412648.mp3 | 2022-07-04 06:52 | 469K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656856539269.mp3 | 2022-07-03 13:56 | 517K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656855684655.mp3 | 2022-07-03 13:43 | 434K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656840917252.mp3 | 2022-07-10 20:14 | 950K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656791438846.mp3 | 2022-07-02 19:51 | 950K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656765394595.mp3 | 2022-07-02 13:02 | 452K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656764580411.mp3 | 2022-07-03 17:05 | 1.4M | |
![[VID]](/icons/movie.gif) | ssstik.io_1656763085075.mp4 | 2022-07-03 05:54 | 133M | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656748973452.mp3 | 2022-07-02 09:35 | 888K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656748554584.mp3 | 2022-07-02 07:56 | 365K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656742431420.mp3 | 2022-07-02 06:15 | 909K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656656797218.mp3 | 2022-07-01 06:26 | 949K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656644478711.mp3 | 2022-07-01 03:27 | 418K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656596379359.mp3 | 2022-06-30 13:56 | 273K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656531730193.mp3 | 2022-06-29 19:49 | 356K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656523820775.mp3 | 2022-06-29 17:30 | 558K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656523388536.mp3 | 2022-06-29 17:24 | 244K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656491103476.mp3 | 2022-06-29 08:25 | 159K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656433219412.mp3 | 2022-06-28 16:22 | 308K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656428819910.mp3 | 2022-06-28 15:14 | 922K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656376367471.mp3 | 2022-06-28 00:36 | 950K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656334524855.mp3 | 2022-06-27 12:56 | 486K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656242079645.mp3 | 2022-07-25 09:30 | 278K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1656095246428.mp3 | 2022-07-23 02:10 | 246K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1653532789761.mp3 | 2022-07-12 12:04 | 144K | |
![[SND]](/icons/sound2.gif) | ssstik.io_1653374373576.mp3 | 2022-08-09 05:44 | 0 | |
![[SND]](/icons/sound2.gif) | ssstik.io_1653355133239.mp3 | 2022-07-22 14:09 | 296K | |
![[SND]](/icons/sound2.gif) | ssssz.mp3 | 2022-07-05 13:31 | 2.8M | |
![[SND]](/icons/sound2.gif) | ssss.mp3 | 2022-07-31 19:32 | 0 | |
![[SND]](/icons/sound2.gif) | ssspringvoid - Kaguya (1).mp3 | 2022-08-04 12:23 | 0 | |
![[SND]](/icons/sound2.gif) | ssshhhiiittt-nadezhda.mp3 | 2022-07-17 19:24 | 7.0M | |
![[SND]](/icons/sound2.gif) | sss.mp3 | 2022-08-12 05:18 | 3.0M | |
![[SND]](/icons/sound2.gif) | ssk.mp3 | 2022-07-03 16:06 | 4.6M | |
![[SND]](/icons/sound2.gif) | ssed1.mp3 | 2022-07-13 01:58 | 4.7M | |
![[SND]](/icons/sound2.gif) | ssd3.mp3 | 2022-07-07 05:45 | 5.6M | |
![[SND]](/icons/sound2.gif) | ssd2.mp3 | 2022-07-06 18:54 | 4.9M | |
![[SND]](/icons/sound2.gif) | ssd1.mp3 | 2022-07-06 18:54 | 8.8M | |
![[SND]](/icons/sound2.gif) | ssaudiott.mp3 | 2022-07-30 21:05 | 0 | |
![[SND]](/icons/sound2.gif) | ssa.mp3 | 2022-07-17 07:42 | 0 | |
![[SND]](/icons/sound2.gif) | ss129.mp3 | 2022-08-04 12:25 | 0 | |
![[SND]](/icons/sound2.gif) | ss.mp3 | 2022-08-10 20:48 | 66K | |
![[SND]](/icons/sound2.gif) | srra16.mp3 | 2022-08-10 20:22 | 0 | |
![[SND]](/icons/sound2.gif) | srra14.mp3 | 2022-07-23 19:34 | 0 | |
![[SND]](/icons/sound2.gif) | srra13.mp3 | 2022-07-23 19:07 | 2.0M | |
![[SND]](/icons/sound2.gif) | srra12.mp3 | 2022-07-17 19:23 | 1.7M | |
![[SND]](/icons/sound2.gif) | srra11.mp3 | 2022-07-17 19:20 | 1.8M | |
![[SND]](/icons/sound2.gif) | srra10.mp3 | 2022-07-16 04:27 | 3.1M | |
![[SND]](/icons/sound2.gif) | srra9.mp3 | 2022-07-16 04:27 | 3.9M | |
![[SND]](/icons/sound2.gif) | srra8.mp3 | 2022-07-16 04:23 | 3.8M | |
![[SND]](/icons/sound2.gif) | srra7.mp3 | 2022-07-16 04:23 | 3.1M | |
![[SND]](/icons/sound2.gif) | srra6.mp3 | 2022-07-16 04:23 | 3.5M | |
![[SND]](/icons/sound2.gif) | srra5.mp3 | 2022-07-16 04:22 | 3.9M | |
![[SND]](/icons/sound2.gif) | srra4.mp3 | 2022-07-16 04:03 | 4.3M | |
![[SND]](/icons/sound2.gif) | srra3.mp3 | 2022-07-16 04:03 | 3.3M | |
![[SND]](/icons/sound2.gif) | srra2.mp3 | 2022-07-16 04:03 | 3.4M | |
![[SND]](/icons/sound2.gif) | srra1.mp3 | 2022-07-16 04:03 | 3.4M | |
![[SND]](/icons/sound2.gif) | srra.mp3 | 2022-07-16 04:03 | 3.8M | |
![[SND]](/icons/sound2.gif) | srk2.mp3 | 2022-07-16 01:27 | 14M | |
![[SND]](/icons/sound2.gif) | srk.mp3 | 2022-07-16 01:19 | 3.1M | |
![[SND]](/icons/sound2.gif) | sretet.mp3 | 2022-07-07 04:45 | 7.0M | |
![[SND]](/icons/sound2.gif) | sr.mp3 | 2022-07-10 20:48 | 3.0M | |
![[SND]](/icons/sound2.gif) | sr-welcome-to-brixton-music-video-grm-daily-ytmp3juice.mp3 | 2022-07-10 20:24 | 3.0M | |
![[SND]](/icons/sound2.gif) | sqwore_rizza_holodnoe_oruzhie_muravi.mp3 | 2022-07-06 18:30 | 5.1M | |
![[SND]](/icons/sound2.gif) | sql2vd-worsed0-waltz-in-hell.mp3 | 2022-07-17 07:31 | 0 | |
![[SND]](/icons/sound2.gif) | spotifyy.mp3 | 2022-07-06 00:24 | 72M | |
![[SND]](/icons/sound2.gif) | spotifyiklan.mp3 | 2022-07-08 07:56 | 2.5M | |
![[SND]](/icons/sound2.gif) | spotify.mp3 | 2022-07-24 17:43 | 76M | |
![[SND]](/icons/sound2.gif) | spot 1.mp3 | 2022-07-28 18:52 | 0 | |
![[SND]](/icons/sound2.gif) | sporty2.mp3 | 2022-07-15 05:12 | 2.9M | |
![[SND]](/icons/sound2.gif) | sporty1.mp3 | 2022-07-15 05:12 | 2.3M | |
![[SND]](/icons/sound2.gif) | spor-yapin-kardesim-zyzz-edit.mp3 | 2022-06-28 15:51 | 1.6M | |
![[SND]](/icons/sound2.gif) | spombob.mp3 | 2022-07-12 11:38 | 532K | |
![[SND]](/icons/sound2.gif) | spo69.mp3 | 2022-07-02 14:39 | 5.1M | |
![[SND]](/icons/sound2.gif) | splurge-x-z-money-type-beat-hunter-prod-simmi-ohh-x-reboound.mp3 | 2022-07-13 17:50 | 6.8M | |
![[SND]](/icons/sound2.gif) | splash grover - цепи х кайф ты поймала.mp3 | 2022-07-15 18:35 | 1.7M | |
![[SND]](/icons/sound2.gif) | spiritocean.mp3 | 2022-07-07 21:58 | 5.2M | |
![[SND]](/icons/sound2.gif) | spirit.mp3 | 2022-08-07 07:55 | 0 | |
![[SND]](/icons/sound2.gif) | spirit-stallion-of-the-cimarron-you-cant-take-me-w-lyrics.mp3 | 2022-07-22 20:18 | 0 | |
![[SND]](/icons/sound2.gif) | spinee.mp3 | 2022-07-08 18:09 | 3.3M | |
![[SND]](/icons/sound2.gif) | spin.mp3 | 2022-07-17 10:59 | 0 | |
![[SND]](/icons/sound2.gif) | spicy.mp3 | 2022-07-03 09:42 | 2.2M | |
![[SND]](/icons/sound2.gif) | spi.mp3 | 2022-07-20 06:30 | 0 | |
![[SND]](/icons/sound2.gif) | speedy.mp3 | 2022-06-29 07:31 | 6.0M | |
![[SND]](/icons/sound2.gif) | speedup.mp3 | 2022-07-24 10:39 | 2.1M | |
![[SND]](/icons/sound2.gif) | speed shake pt 2 instrumental slowed best-part .mp3 | 2022-07-01 11:00 | 2.0M | |
![[SND]](/icons/sound2.gif) | speedleon.mp3 | 2022-07-02 06:15 | 2.4M | |
![[SND]](/icons/sound2.gif) | speed2.mp3 | 2022-07-27 15:40 | 0 | |
![[SND]](/icons/sound2.gif) | speed.mp3 | 2022-07-13 12:09 | 2.4M | |
![[SND]](/icons/sound2.gif) | speech_20220805000637096.mp3 | 2022-08-05 01:40 | 0 | |
![[SND]](/icons/sound2.gif) | speech_20220731111109394.mp3 | 2022-07-31 11:11 | 55K | |
![[SND]](/icons/sound2.gif) | speech.mp3 | 2022-07-11 00:59 | 241K | |
![[SND]](/icons/sound2.gif) | specret.mp3 | 2022-08-11 04:14 | 0 | |
![[SND]](/icons/sound2.gif) | species__us_1_rr.mp3 | 2022-07-22 18:48 | 0 | |
![[SND]](/icons/sound2.gif) | speakto.mp3 | 2022-08-03 19:45 | 0 | |
![[SND]](/icons/sound2.gif) | sparow2.mp3 | 2022-07-14 00:31 | 3.4M | |
![[SND]](/icons/sound2.gif) | sparow1.mp3 | 2022-07-14 00:30 | 7.3M | |
![[SND]](/icons/sound2.gif) | sparks.mp3 | 2022-08-11 13:44 | 0 | |
![[SND]](/icons/sound2.gif) | spalsgamelan.mp3 | 2022-07-07 17:52 | 499K | |
![[SND]](/icons/sound2.gif) | spadona_live.mp3 | 2022-07-21 17:46 | 0 | |
![[SND]](/icons/sound2.gif) | sp1.mp3 | 2022-07-17 10:33 | 1.0M | |
![[SND]](/icons/sound2.gif) | sp.mp3 | 2022-07-20 09:35 | 956K | |
![[SND]](/icons/sound2.gif) | soxo.mp3 | 2022-07-03 12:34 | 63M | |
![[SND]](/icons/sound2.gif) | sovkusom🥀 - DIARO - Look At Me.mp3 | 2022-07-13 11:36 | 7.1M | |
![[SND]](/icons/sound2.gif) | soviet.mp3 | 2022-07-13 04:21 | 1.4M | |
![[SND]](/icons/sound2.gif) | sova-pesni-staryh-kasset.mp3 | 2022-08-12 10:42 | 0 | |
![[SND]](/icons/sound2.gif) | sous.mp3 | 2022-07-17 17:03 | 0 | |
![[SND]](/icons/sound2.gif) | sourgrapes1.mp3 | 2022-08-06 17:19 | 0 | |
![[SND]](/icons/sound2.gif) | sourgrapes.mp3 | 2022-08-06 17:10 | 1.2M | |
![[SND]](/icons/sound2.gif) | sound ultah.mp3 | 2022-07-11 07:26 | 919K | |
![[SND]](/icons/sound2.gif) | soundthoma.mp3 | 2022-07-12 04:46 | 3.7M | |
![[SND]](/icons/sound2.gif) | sounds_hatersGonnaHate.mp3 | 2022-06-28 11:37 | 3.0M | |
![[SND]](/icons/sound2.gif) | soundradio.mp3 | 2022-07-10 22:03 | 23K | |
![[SND]](/icons/sound2.gif) | sound_dj.mp3 | 2022-07-09 12:03 | 3.7M | |
![[SND]](/icons/sound2.gif) | sound_call.mp3 | 2022-07-20 09:50 | 0 | |
![[SND]](/icons/sound2.gif) | sound_call (1).mp3 | 2022-07-20 09:49 | 0 | |
![[SND]](/icons/sound2.gif) | sound_81991400-1630422991.mp3 | 2022-07-09 10:00 | 21K | |
![[SND]](/icons/sound2.gif) | sound_1.mp3 | 2022-07-09 10:09 | 6.4M | |
![[SND]](/icons/sound2.gif) | sound2.mp3 | 2022-07-31 01:21 | 0 | |
![[SND]](/icons/sound2.gif) | sound1.mp3 | 2022-07-31 01:12 | 13M | |
![[SND]](/icons/sound2.gif) | sound.mp3 | 2022-08-12 06:21 | 0 | |
![[SND]](/icons/sound2.gif) | sound-jagoan-cs-seremm.mp3 | 2022-07-16 17:32 | 0 | |
![[SND]](/icons/sound2.gif) | sound-desah-128-ytshorts.savetube.me.mp3 | 2022-06-29 19:47 | 170K | |
![[SND]](/icons/sound2.gif) | soun.mp3 | 2022-07-07 12:19 | 1.9M | |
![[SND]](/icons/sound2.gif) | soulkillerchargeup.mp3 | 2022-08-06 16:30 | 0 | |
![[SND]](/icons/sound2.gif) | souljah_bilang_i_love_you_official_audio_-1065665375342714252.mp3 | 2022-07-05 09:08 | 3.6M | |
![[SND]](/icons/sound2.gif) | sotya.mp3 | 2022-07-02 16:38 | 5.0M | |
![[SND]](/icons/sound2.gif) | sotot3.mp3 | 2022-07-30 14:14 | 0 | |
![[SND]](/icons/sound2.gif) | sotot2.mp3 | 2022-07-30 14:11 | 0 | |
![[SND]](/icons/sound2.gif) | sotot1.mp3 | 2022-07-30 13:59 | 0 | |
![[SND]](/icons/sound2.gif) | sotong.mp3 | 2022-07-17 05:07 | 3.8M | |
![[SND]](/icons/sound2.gif) | sothirabali.mp3 | 2022-07-16 19:54 | 0 | |
![[SND]](/icons/sound2.gif) | sosick.mp3 | 2022-07-06 08:48 | 3.3M | |
![[SND]](/icons/sound2.gif) | sorry.mp3 | 2022-07-18 03:56 | 2.2M | |
![[SND]](/icons/sound2.gif) | sorgusuzlar2-mixdown-1.mp3 | 2022-07-10 13:35 | 2.8M | |
![[VID]](/icons/movie.gif) | sorbatdek.mp4 | 2022-07-22 19:06 | 1.3M | |
![[SND]](/icons/sound2.gif) | sorbatdek.mp3 | 2022-07-22 19:09 | 1.3M | |
![[SND]](/icons/sound2.gif) | sor3 changed.mp3 | 2022-07-19 22:33 | 0 | |
![[SND]](/icons/sound2.gif) | sopir.mp3 | 2022-08-06 05:01 | 0 | |
![[SND]](/icons/sound2.gif) | sooraj3.mp3 | 2022-07-29 17:28 | 0 | |
![[SND]](/icons/sound2.gif) | soolking-feat-tayc-bye-bye-clip-officiel-prod-by-nyadjiko.mp3 | 2022-07-20 12:29 | 0 | |
![[SND]](/icons/sound2.gif) | sonia.mp3 | 2022-08-04 17:22 | 116K | |
![[SND]](/icons/sound2.gif) | songs.mp3 | 2022-07-27 22:46 | 0 | |
![[SND]](/icons/sound2.gif) | song free fire max makin hd (BUENAMUSICA.NET).mp3 | 2022-08-08 16:55 | 0 | |
![[SND]](/icons/sound2.gif) | songddddddddd.mp3 | 2022-07-20 17:41 | 0 | |
![[SND]](/icons/sound2.gif) | song8.mp3 | 2022-06-29 20:31 | 72M | |
![[SND]](/icons/sound2.gif) | song7.mp3 | 2022-07-07 00:59 | 1.8M | |
![[SND]](/icons/sound2.gif) | song6.mp3 | 2022-07-07 01:02 | 37M | |
![[SND]](/icons/sound2.gif) | song5.mp3 | 2022-07-07 00:59 | 5.0M | |
![[SND]](/icons/sound2.gif) | song4.mp3.mp3 | 2022-08-01 22:18 | 0 | |
![[SND]](/icons/sound2.gif) | song4.mp3 | 2022-08-02 12:32 | 5.0M | |
![[SND]](/icons/sound2.gif) | song3.mp3.mp3 | 2022-08-01 22:18 | 0 | |
![[SND]](/icons/sound2.gif) | song3.mp3 | 2022-08-02 12:32 | 4.1M | |
![[SND]](/icons/sound2.gif) | song2.mp3.mp3 | 2022-08-01 22:18 | 0 | |
![[SND]](/icons/sound2.gif) | song2.mp3 | 2022-08-02 12:32 | 1.8M | |
![[SND]](/icons/sound2.gif) | song1.mp3.mp3 | 2022-08-01 22:18 | 0 | |
![[SND]](/icons/sound2.gif) | song1.mp3 | 2022-08-02 12:32 | 1.7M | |
![[SND]](/icons/sound2.gif) | song.mp3 | 2022-08-02 22:52 | 336K | |
![[SND]](/icons/sound2.gif) | sonaotrinh.mp3 | 2022-07-31 07:02 | 0 | |
![[SND]](/icons/sound2.gif) | son50.mp3 | 2022-07-16 12:14 | 1.8M | |
![[SND]](/icons/sound2.gif) | son28.mp3 | 2022-07-31 09:17 | 0 | |
![[SND]](/icons/sound2.gif) | son27.mp3 | 2022-07-31 09:16 | 0 | |
![[SND]](/icons/sound2.gif) | son26.mp3 | 2022-07-31 10:17 | 1.2M | |
![[SND]](/icons/sound2.gif) | son25.mp3 | 2022-07-31 09:16 | 0 | |
![[SND]](/icons/sound2.gif) | son24.mp3 | 2022-07-31 09:15 | 0 | |
![[SND]](/icons/sound2.gif) | son23.mp3 | 2022-07-31 09:15 | 0 | |
![[SND]](/icons/sound2.gif) | son22.mp3 | 2022-07-31 09:14 | 0 | |
![[SND]](/icons/sound2.gif) | son21.mp3 | 2022-07-31 09:14 | 0 | |
![[SND]](/icons/sound2.gif) | son20.mp3 | 2022-07-31 09:13 | 0 | |
![[SND]](/icons/sound2.gif) | son19.mp3 | 2022-07-31 09:13 | 884K | |
![[SND]](/icons/sound2.gif) | son18.mp3 | 2022-07-31 09:12 | 5.1M | |
![[SND]](/icons/sound2.gif) | son17.mp3 | 2022-07-31 09:12 | 2.6M | |
![[SND]](/icons/sound2.gif) | son16.mp3 | 2022-07-31 09:11 | 4.3M | |
![[SND]](/icons/sound2.gif) | son15.mp3 | 2022-07-31 09:11 | 4.9M | |
![[SND]](/icons/sound2.gif) | son14.mp3 | 2022-07-31 09:10 | 2.8M | |
![[SND]](/icons/sound2.gif) | son13.mp3 | 2022-07-31 09:10 | 2.9M | |
![[SND]](/icons/sound2.gif) | son12.mp3 | 2022-07-31 09:09 | 3.2M | |
![[SND]](/icons/sound2.gif) | son11.mp3 | 2022-07-31 09:09 | 2.6M | |
![[SND]](/icons/sound2.gif) | son10.mp3 | 2022-07-31 09:08 | 3.7M | |
![[SND]](/icons/sound2.gif) | son9.mp3 | 2022-07-31 09:07 | 2.9M | |
![[SND]](/icons/sound2.gif) | son8.mp3 | 2022-07-31 09:06 | 2.2M | |
![[SND]](/icons/sound2.gif) | son7.mp3 | 2022-07-31 08:18 | 2.5M | |
![[SND]](/icons/sound2.gif) | son6.mp3 | 2022-07-31 08:12 | 2.9M | |
![[SND]](/icons/sound2.gif) | son5.mp3 | 2022-07-31 08:08 | 4.7M | |
![[VID]](/icons/movie.gif) | son4.mp4 | 2022-07-30 10:11 | 4.0M | |
![[SND]](/icons/sound2.gif) | son4.mp3 | 2022-07-31 07:59 | 2.9M | |
![[SND]](/icons/sound2.gif) | son3.mp3 | 2022-08-07 02:17 | 3.5M | |
![[SND]](/icons/sound2.gif) | son1.mp3 | 2022-07-31 12:54 | 0 | |
![[SND]](/icons/sound2.gif) | son0.mp3 | 2022-07-31 09:08 | 5.0M | |
![[SND]](/icons/sound2.gif) | somewhere.mp3 | 2022-07-05 12:29 | 2.9M | |
![[SND]](/icons/sound2.gif) | somethingmay.mp3 | 2022-07-08 16:37 | 1.8M | |
![[SND]](/icons/sound2.gif) | someonetoyou.mp3.mp3 | 2022-07-23 12:55 | 3.1M | |
![[SND]](/icons/sound2.gif) | someonetoyou.mp3 | 2022-07-23 13:03 | 3.1M | |
![[SND]](/icons/sound2.gif) | someday.mp3 | 2022-08-08 05:56 | 0 | |
![[SND]](/icons/sound2.gif) | somebody.mp3 | 2022-08-10 04:50 | 2.2M | |
![[SND]](/icons/sound2.gif) | some1.mp3 | 2022-07-24 15:39 | 0 | |
![[SND]](/icons/sound2.gif) | some1.m4a | 2022-07-24 15:19 | 0 | |
![[SND]](/icons/sound2.gif) | so long.mp3 | 2022-07-28 23:20 | 0 | |
![[SND]](/icons/sound2.gif) | solo1.mp3 | 2022-07-06 16:51 | 8.0M | |
![[SND]](/icons/sound2.gif) | solo.mp3 | 2022-07-08 04:07 | 9.0M | |
![[SND]](/icons/sound2.gif) | solider.mp3 | 2022-07-26 07:39 | 0 | |
![[SND]](/icons/sound2.gif) | soldieronprevieww.mp3 | 2022-07-07 12:44 | 2.1M | |
![[SND]](/icons/sound2.gif) | soldat-ggg.mp3 | 2022-07-16 11:38 | 0 | |
![[SND]](/icons/sound2.gif) | sol1.mp3 | 2022-07-11 20:58 | 79K | |
![[SND]](/icons/sound2.gif) | sol.mp3 | 2022-07-17 14:44 | 0 | |
![[SND]](/icons/sound2.gif) | sokrat_st_yorgunum_ben.mp3 | 2022-07-16 18:40 | 0 | |
![[SND]](/icons/sound2.gif) | sojah.mp3 | 2022-07-20 02:02 | 0 | |
![[SND]](/icons/sound2.gif) | soi1.mp3 | 2022-07-31 10:42 | 0 | |
![[SND]](/icons/sound2.gif) | sohry23_-_LUCAVEROS_-no_ya_nikogo_ne_zval_v_postel_71995386.mp3 | 2022-07-25 22:09 | 0 | |
![[SND]](/icons/sound2.gif) | softboy.mp3 | 2022-06-27 19:55 | 4.8M | |
![[SND]](/icons/sound2.gif) | soft.mp3 | 2022-07-12 21:44 | 2.6M | |
![[SND]](/icons/sound2.gif) | sofri5.mp3 | 2022-07-20 15:18 | 0 | |
![[SND]](/icons/sound2.gif) | sofia123.mp3 | 2022-07-16 15:15 | 4.7M | |
![[SND]](/icons/sound2.gif) | sofia.mp3 | 2022-07-17 11:30 | 503K | |
![[SND]](/icons/sound2.gif) | sofia.m4a | 2022-07-06 19:39 | 3.6M | |
![[SND]](/icons/sound2.gif) | sofia-reyes-1-2-3-feat-jason-derulo-de-la-ghetto-official-video.mp3 | 2022-07-12 19:27 | 7.8M | |
![[SND]](/icons/sound2.gif) | sofia & richar.mp3 | 2022-07-04 20:34 | 311K | |
![[SND]](/icons/sound2.gif) | sofaraway.mp3 | 2022-07-14 05:51 | 5.2M | |
![[SND]](/icons/sound2.gif) | soeharto.mp3 | 2022-07-27 17:32 | 0 | |
![[SND]](/icons/sound2.gif) | sodjgnfosgn.mp3 | 2022-07-16 15:01 | 0 | |
![[SND]](/icons/sound2.gif) | soday.mp3 | 2022-08-04 11:42 | 0 | |
![[SND]](/icons/sound2.gif) | soda-pullin-up-mp3.mp3 | 2022-07-23 10:41 | 0 | |
![[SND]](/icons/sound2.gif) | soda-luv-seemee-golodnyj-pyos-mp3.mp3 | 2022-07-01 09:41 | 6.6M | |
![[SND]](/icons/sound2.gif) | soda-luv-na-moej-krovati-tri-suki-vse-golye.mp3 | 2022-07-15 05:09 | 273K | |
![[SND]](/icons/sound2.gif) | socold.mp3 | 2022-07-31 12:10 | 0 | |
![[SND]](/icons/sound2.gif) | soap.mp3 | 2022-07-16 01:56 | 8.0M | |
![[SND]](/icons/sound2.gif) | soa.mp3 | 2022-07-15 21:11 | 13M | |
![[SND]](/icons/sound2.gif) | so.mp3 | 2022-07-02 15:32 | 4.5M | |
![[SND]](/icons/sound2.gif) | snv208.mp3 | 2022-08-07 10:57 | 0 | |
![[SND]](/icons/sound2.gif) | snv207.mp3 | 2022-08-07 10:57 | 0 | |
![[SND]](/icons/sound2.gif) | snv173.mp3 | 2022-07-29 11:54 | 347K | |
![[SND]](/icons/sound2.gif) | snv172.mp3 | 2022-07-29 11:54 | 573K | |
![[SND]](/icons/sound2.gif) | snv99.mp3 | 2022-07-04 09:31 | 229K | |
![[SND]](/icons/sound2.gif) | snv84.mp3 | 2022-08-07 10:57 | 0 | |
![[SND]](/icons/sound2.gif) | snv83.mp3 | 2022-08-07 10:57 | 0 | |
![[SND]](/icons/sound2.gif) | snv82.mp3 | 2022-08-07 10:57 | 0 | |
![[SND]](/icons/sound2.gif) | snv81.mp3 | 2022-08-07 10:57 | 0 | |
![[SND]](/icons/sound2.gif) | snv80.mp3 | 2022-07-29 11:55 | 355K | |
![[SND]](/icons/sound2.gif) | snv79.mp3 | 2022-07-29 11:55 | 713K | |
![[SND]](/icons/sound2.gif) | snv78.mp3 | 2022-07-29 11:55 | 605K | |
![[SND]](/icons/sound2.gif) | snv77.mp3 | 2022-07-29 11:55 | 276K | |
![[SND]](/icons/sound2.gif) | snv76.mp3 | 2022-07-29 11:55 | 322K | |
![[SND]](/icons/sound2.gif) | snv75.mp3 | 2022-07-29 11:54 | 376K | |
![[SND]](/icons/sound2.gif) | snv74.mp3 | 2022-07-29 11:54 | 437K | |
![[SND]](/icons/sound2.gif) | snv73.mp3 | 2022-07-26 16:35 | 0 | |
![[SND]](/icons/sound2.gif) | snv72.mp3 | 2022-07-26 16:35 | 0 | |
![[SND]](/icons/sound2.gif) | snv71.mp3 | 2022-07-18 09:35 | 688K | |
![[SND]](/icons/sound2.gif) | snv70.mp3 | 2022-07-18 09:35 | 423K | |
![[SND]](/icons/sound2.gif) | snv69.mp3 | 2022-07-18 09:35 | 458K | |
![[SND]](/icons/sound2.gif) | snv68.mp3 | 2022-07-04 09:35 | 315K | |
![[SND]](/icons/sound2.gif) | snv67.mp3 | 2022-07-04 09:33 | 415K | |
![[SND]](/icons/sound2.gif) | snv66.mp3 | 2022-07-04 09:33 | 483K | |
![[SND]](/icons/sound2.gif) | snv65.mp3 | 2022-07-04 09:33 | 559K | |
![[SND]](/icons/sound2.gif) | snv64.mp3 | 2022-07-04 09:33 | 505K | |
![[SND]](/icons/sound2.gif) | snv63.mp3 | 2022-07-04 09:31 | 584K | |
![[SND]](/icons/sound2.gif) | snv62.mp3 | 2022-07-04 09:31 | 408K | |
![[SND]](/icons/sound2.gif) | snv61.mp3 | 2022-07-04 09:31 | 602K | |
![[SND]](/icons/sound2.gif) | snv60.mp3 | 2022-07-04 09:31 | 716K | |
![[SND]](/icons/sound2.gif) | snv59.mp3 | 2022-07-04 09:30 | 627K | |
![[SND]](/icons/sound2.gif) | snv58.mp3 | 2022-07-04 09:30 | 455K | |
![[SND]](/icons/sound2.gif) | snv56.mp3 | 2022-07-04 09:30 | 648K | |
![[SND]](/icons/sound2.gif) | snv55.mp3 | 2022-07-04 09:30 | 595K | |
![[SND]](/icons/sound2.gif) | snv54.mp3 | 2022-06-29 09:59 | 441K | |
![[SND]](/icons/sound2.gif) | snv53.mp3 | 2022-06-29 09:59 | 741K | |
![[SND]](/icons/sound2.gif) | snv52.mp3 | 2022-06-29 09:59 | 512K | |
![[SND]](/icons/sound2.gif) | snv51.mp3 | 2022-06-29 09:59 | 483K | |
![[SND]](/icons/sound2.gif) | snv50.mp3 | 2022-06-29 09:58 | 630K | |
![[SND]](/icons/sound2.gif) | snv49.mp3 | 2022-06-29 09:58 | 351K | |
![[SND]](/icons/sound2.gif) | snv48.mp3 | 2022-06-29 09:58 | 498K | |
![[SND]](/icons/sound2.gif) | snv47.mp3 | 2022-06-29 09:58 | 924K | |
![[SND]](/icons/sound2.gif) | snv46.mp3 | 2022-06-29 09:58 | 752K | |
![[SND]](/icons/sound2.gif) | snv45.mp3 | 2022-06-29 09:58 | 799K | |
![[SND]](/icons/sound2.gif) | snuffer.mp3 | 2022-06-28 21:39 | 9.9M | |
![[SND]](/icons/sound2.gif) | snuff.mp3 | 2022-07-22 12:21 | 0 | |
![[SND]](/icons/sound2.gif) | snte23.mp3 | 2022-08-08 17:43 | 0 | |
![[SND]](/icons/sound2.gif) | snte22.mp3 | 2022-08-08 17:43 | 0 | |
![[SND]](/icons/sound2.gif) | snte21.mp3 | 2022-08-08 17:43 | 0 | |
|